| |
|
|
|
|
|
 |
| |
|
¾ÆÀÌÅ¥¾îÁ¡¾È¾× [Idoxuridine]
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
[A04303081]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1ml(2006.02.01)(ÇöÀç¾à°¡)
\153 ¿ø/1ml(2004.02.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
´Ü¼ø Ç츣Æä½º ¹ÙÀÌ·¯½º¿¡ ±âÀÎÇÑ °¢¸·¿°
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
[ÁÖ¼ººÐÄÚµå:173102COS ¿¡ µû¸¥ ½É»çÁöħ¿¶÷]
1ȸ 1¹æ¿ï¾¿ 1½Ã°£¸¶´Ù Á¡¾ÈÇÑ´Ù.
±Þ¼º Ç츣Æä½ºÀ϶§´Â 2½Ã°£¸¶´Ù Åõ¿©ÇÏ´Ù°¡ 1ÀÏ 4ȸ Åõ¿©·Î ¼¼È÷ °¨·® Åõ¿©ÇÏ¸é¼ Áß´ÜÇÑ´Ù.
(Ä¡·á´Â Àû¾îµµ 7Àϰ£ °è¼ÓÇØ¾ß ÇÑ´Ù)
|
| °æ°í |
1) ÀÓ»êºÎ : ÀÓ»êºÎ ¶Ç´Â °¡ÀӺο¡°Ô´Â ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
À̵¶¼ö¸®µò »ó¿ë·®À» ÀÓ½ÅÇÑ Åä³¢ÀÇ ´«¿¡ ¿Ü¿ë Åõ¿©ÇßÀ» ¶§, ŹÝÀ» Åë°úÇÏ¿© Ä¡¸íÀûÀÎ
±âÇü¼ºÀ» ³ªÅ¸³Â´Ù.
RatÀÇ º¹°³» Åõ¿©¿Í °æ±¸Åõ¿© ÈÄ ¹× MouseÀÇ ÇÇÇϳ» Åõ¿©ÈÄ Ä¡¸íÀûÀÎ ±âÇü¼ºÀ» ³ªÅ¸³½
º¸°í°¡ ÀÖ´Ù .
º» ¾à¹°°ú ´ë»ç¹°Àº À¯ÁóÀ¸·Î ºÐºñµÉ ¼ö Àֱ⠶§¹®¿¡ º» ¾àÁ¦ º¹¿ë½Ã ¼öÀ¯¸¦ ÇØ¼´Â ¾È
µÈ´Ù.
2) µ¹¿¬º¯ÀÌ : À̵¶¼ö¸®µòÀº Mice¿¡¼ ¿°»öü º¯ÇüÀ» ÀÏÀ¸Ä×À¸¸ç, Æ÷À¯ µ¿¹°ÀÇ Á¶Á÷ ¹è¾ç (¿¹:»ç¶÷
Àӯı¸ÀÇ ¹è¼ö ¿°»öü, MouseÀÇ ÀÓÆÄÁ¶Á÷)°ú ÃÊÆÄ¸® ¹× Æ÷À¯µ¿¹°Á¶Á÷À» ÀÌ¿ëÇÑ ¼÷ÁÖ Á¤
·®¹ýÀ¸·Î ºÎÅÍ µ¹¿¬º¯À̸¦ ÀÏÀ¸Å² º¸°í°¡ ÀÖ´Ù.
3) ¹ß¾Ï¼º : ¼¼Æ÷µ¶¼º ¾à¹°Àº ÀáÀçÀûÀ¸·Î ¹ß¾Ï¼ºÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î DNA¹ÙÀÌ·¯½ºÀÇ °Ô³ð»Ó ¾Æ´Ï¶ó
Æ÷À¯µ¿¹° ¼¼Æ÷ÀÇ DNA¿Íµµ °áÇÕÇÒ ¼ö ÀÖ´Ù.
Mouse Á¶Á÷¿¡¼ À̵¶¼ö¸®µòÀº À½¼º ¹ÙÀÌ·¯½ººÎÅÍ RNAÁ¾¾ç ¹ÙÀÌ·¯½º(Type C)»ý»êÀ» À¯µµ
ÇÏ´Â °ÍÀ¸·Î º¸°íµÇ¾úÀ¸³ª, Á¾¾ç ¹ÙÀÌ·¯½º·Î À¯µµµÈ À̵¶¼ö¸®µòÀÌ ¾ÏÀ» À¯¹ßÇϴ°¡¿¡ °üÇÑ
¹®ÇåÀº ¾ÆÁ÷ ¾ø´Ù.
±×·¯³ª À̵¶¼ö¸®µòÀ¸·Î Ȱ¼ºÈµÈ Á¾¾ç ¹ÙÀÌ·¯½º´Â in vitro ¿¡¼ ¼¼Æ÷º¯ÇüÀ» ÀÏÀ¸Å°¸ç,
µ¿Á· MiceÀÇ Á¢Á¾½Ã ƯÀ̼ºÀÎ Á¾¾ç(ÀÓÆÄ ¹éÇ÷º´ ¹× ¾Ç¼ºÁ¾¾ç)À» À¯µµÇÏ´Â °ÍÀ¸·Î ³ªÅ¸³µ´Ù.
|
| ±Ý±â |
1) À̵¶¼ö¸®µò ¶Ç´Â ÀÌ ¾àÀÇ ´Ù¸¥ ¼ººÐ¿¡ °ú¹Î¼ºÀΠȯÀÚ
2) °¢¸· ½ÇÁúÀÇ ½ÉÃþ ±Ë¾çȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
ÀÛ¿°¨, °¢¸·¹ÝÁ¡, °¢¸·È¥Å¹°ú °°Àº ±Þ¼º ¾ÈÀÚ±¹ÀÌ º¸°íµÇ¾ú´Ù.
Àå±â°£ »ç¿ë ÈÄ¿¡´Â ³¶Æ÷¼º °á¸·¿°, Á¡»óÁ¾Ã¢À» ¼ö¹ÝÇÑ ¾È°Ë¿°, ±¸»óÀÇ ¸·ÃæÇ÷ µîÀÇ ¾ÈÀÚ±¹°ú
°¢¸·»óÇÇ ¿°»öµµ º¸°íµÇ¾ú´Ù. ÀÌ·¯ÇÑ °æ¿ì¿¡´Â Åõ¿©¸¦ Áß´ÜÇØ¾ß ÇÑ´Ù.
|
| ÀϹÝÀû ÁÖÀÇ |
1) Ä¡·á±â°£, ±ÇÀå·® ¹× »ç¿ëȽ¼ö¸¦ ÃʰúÇØ¼´Â ¾ÈµÈ´Ù.
2) À̵¶¼ö¸®µòÀº ´Ü¼ø Ç츣Æä½º °¢¸·¿°ÈÄ¿¡ ¹ÙÀÌ·¯½º°¡ Á¸ÀçÇÏÁö ¾Ê´Â °¢¸·¿°Áõ¿¡´Â È¿·ÂÀÌ ¾ø´Ù.
3) ¸î¸î ´Ü¼ø Ç츣Æä½º±ÕÀº À̵¶¼ö¸®µò ÀÛ¿ë¿¡ ÀúÇ×·ÂÀÌ ÀÖ´Ù.
4) 7-8Àϰ£ »ç¿ëÈÄ °¢¸· »óÇÇ º´¼Ò¿¡ º¯È°¡ º¸ÀÌÁö ¾ÊÀ» ¶§¿¡´Â »ç¿ëÀ» ÁßÁöÇÏ°í ´Ù¸¥ Ä¡·á¹ýÀ¸·Î
¹Ù²Ü °Í.
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| Á¦Çüº° º¹¾àÁöµµ |
[Á¡¾È¾×] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Idoxuridine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Idoxuridine acts as an antiviral agent against DNA viruses by inhibiting thymidilate phosphorylase and viral DNA polymerases. The effect of Idoxuridine results in the inability of the virus to reproduce or to infect/destroy tissue.
|
| Pharmacology |
Idoxuridine¿¡ ´ëÇÑ Pharmacology Á¤º¸ In chemical structure idoxuridine closely approximates the configuration of thymidine, one of the four building blocks of DNA (the genetic material of the Herpes virus). As a result, idoxuridine is able to replace thymidine in the enzymatic step of viral replication or "growth". The consequent production of faulty DNA results in a pseudostructure which cannot infect or destroy tissue. In short, by pre-empting a vital building block in the genetic material of the Herpes simplex virus, Herplex-D topical solution destroys the infective and destructive capacity of the viral material. The virus infected cell may only be attacked during the period of active synthesis of DNA. This occurs early in the development of the Herpes simplex lesion, but at different times in different cells. Therefore, ideally, the affected area should remain saturated with the antiviral agent.
|
| Metabolism |
Idoxuridine¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Adenosine deaminase
|
| Absorption |
Idoxuridine¿¡ ´ëÇÑ Absorption Á¤º¸ Systemic absorption is unlikely following ocular administration even when nasolacrimal secretions are swallowed, since vidarabine is rapidly deaminated in the gastrointestinal tract.
|
| Pharmacokinetics |
IdoxuridineÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : ¾È¾× : Á¡Àû½Ã Àß Èí¼öµÇÁö ¾Ê´Â´Ù.
- ³óµµ°¡ Áõ°¡ÇÒ¼ö·Ï Èí¼öÀ²Àº °¨¼ÒÇÑ´Ù.
- ºÐÆ÷ : ŹÝÅë°ú
- ´ë»ç : Iodouracil, uracil, iodide·Î ´ë»çµÈ´Ù.
- ¼Ò½Ç : ¹Ìº¯Èü ¹× ´ë»çü·Î ½Å¹è¼³µÈ´Ù.
|
| Toxicity |
Idoxuridine¿¡ ´ëÇÑ Toxicity Á¤º¸ Hypersensitivity or increased sensitivity of eyes to light. LD50=3080 mg/kg (orally in mice).
|
| Drug Interactions |
Idoxuridine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Idoxuridine¿¡ ´ëÇÑ Food Interaction Á¤º¸ Not Available
|
| Drug Target |
[Drug Target]
|
| Description |
Idoxuridine¿¡ ´ëÇÑ Description Á¤º¸ An analog of deoxyuridine that inhibits viral DNA synthesis. The drug is used as an antiviral agent. [PubChem]
|
| Dosage Form |
Idoxuridine¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Liquid TopicalSolution / drops Ophthalmic
|
| Drug Category |
Idoxuridine¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antiviral AgentsNucleic Acid Synthesis Inhibitors
|
| Smiles String Canonical |
Idoxuridine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ OCC1OC(CC1O)N1C=C(I)C(=O)NC1=O
|
| Smiles String Isomeric |
Idoxuridine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ OC[C@H]1O[C@H](C[C@@H]1O)N1C=C(I)C(=O)NC1=O
|
| InChI Identifier |
Idoxuridine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C9H11IN2O5/c10-4-2-12(9(16)11-8(4)15)7-1-5(14)6(3-13)17-7/h2,5-7,13-14H,1,3H2,(H,11,15,16)/t5-,6+,7+/m0/s1/f/h11H
|
| Chemical IUPAC Name |
Idoxuridine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2015-01-23
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|