| |
|
|
|
|
|
 |
| |
|
º£Å¸-¿ÉƼ¿Ã0.3%Á¡¾È¾×(¸ÞƼÇÁ¶ó³î·Ñ) ¥Â-OPHTHIOLE 0.3% EYE DROPS[metipranolol]
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
664400160[E23090011]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1ml(2008.05.01)(ÇöÀç¾à°¡)
\1,379 ¿ø/1ml(2005.07.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
ÀÌ ¾àÀº ¹«»öÅõ¸íÇÑ Á¡¼ºÀÇ ¿ë¾×À¸·Î ¹é»ö ÇÃ¶ó½ºÆ½ ¿ë±â¿¡ µé¾îÀÖ´Ù
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| ÁÖ¼ººÐÄÚµå |
381701COS
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| ´ëÇ¥ÄÚµå |
8806644001609 |
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
¾È¾Ð»ó½Â, ³ì³»Àå
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
[ÁÖ¼ººÐÄÚµå:381701COS ¿¡ µû¸¥ ½É»çÁöħ¿¶÷]
1ÀÏ 2ȸ 1¹æ¿ï Á¡¾ÈÇÑ´Ù.
Áõ»ó¿¡ µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù.
|
| °æ°í |
1) ´©¾×ºÐºñ °¨¼Ò ȯÀÚ
2) ÀúÇ÷¾Ð ȯÀÚ
|
| ±Ý±â |
1) ÀÌ ¾à¿¡ °ú¹ÎÁõ ȯÀÚ
2) ±â°üÁöõ½Ä ¹× ±× º´·ÂÀÌ Àִ ȯÀÚ
3) Æó¼â¼º ÆóÁúȯ(±âµµÇùÂø) ȯÀÚ
4) ½ÉºÎÀü, ¼¸Æ, ¹æ½Ç°áÀý 2 ¶Ç´Â 3Á¤µµ Â÷´Ü, ½ÉÀμº ¼ï, µ¿¹æ°áÀýÂ÷´ÜµîÀÇ ½ÉÁúȯ
ȯÀÚ
5) °¢¸·¹ßÀ° ÀÌ»ó ȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
1) ´« : ÀϽÃÀûÀÎ Àڱذ¨, ½Ã¾ßÈ帲, Ç¥À缺 Á¡»ó°¢¸·¿°, °á¸·¾È°Ë¿°, Àü¹æÆ÷µµ¸·¿°,
ÄÜÅÃÁî·»Áî Âø¿ëÀÚÀÇ ´«¹°ºÐºñ°¨¼Ò, °¡·Á¿òÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
2) ½ÉÇ÷°ü°è : ¶§¶§·Î ¼¸Æ, ½É¹ÚÀå¾Ö, Ç÷¾Ð ÀúÇÏ µî Àü½ÅÈí¼öÁõ»ó°ú ½ÉºÎÀüÁõÀÌ
¾Ç鵃 ¼ö ÀÖ´Ù.
3) È£Èí±â°è : ƯÈ÷ °¡¿ª¼º ±âµµÆó¼â Áõ»óȯÀÚ¿¡¼ ±â°üÁö °æ·ÃÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
¶ÇÇÑ È£Èí°ï¶õ, È£ÈíºÎÀüÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
4) ÁßÃ߽Űæ°è : µÎÅë, ¿îµ¿½ÇÁ¶, ½Å°æ¼è¾à, ±â¸é µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
5) ÇǺΠ: ÇǺιßÁø, ºÎÁ¾µî Á¢Ã˼º °ú¹ÎÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
6) ÇÇ·Î ¹× ¿ì¿ïÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| ÀϹÝÀû ÁÖÀÇ |
1) ¸ðµç ³ì³»Àå Áõ»ó¿¡ Åõ¿©½Ã ¾È¾Ð°ú Ç÷¾ÐÀ» ÀÏÁ¤ÇÑ ±â°£ °£°Ý(4-6ÁÖ)À¸·Î ÃøÁ¤ÇÑ
´Ù.
2) ´Ù¸¥ ±¹¼Ò ¥â-Â÷´ÜÁ¦¿Í ¸¶Âù°¡Áö·Î Àü½ÅÈí¼öµÇ¾î °æ±¸Åõ¿©¿Í ºñ½ÁÇÑ È¿°ú¸¦ ³ªÅ¸
³¾ ¼ö ÀÖ´Ù. µå¹°°Ô ±â°üÁö°æ·Ã, ½ÉºÎÀüÀ¸·Î ÀÎÇÑ »ç¸Á µîÀÇ ½ÉÀå ¹× È£Èí±â ºÎÀÛ
¿ëÀÌ º¸°íµÈ ¹Ù ÀÖ´Ù.
3) ¿ïÇ÷¼º ½ÉºÎÀüÀº ÀûÀýÈ÷ Á¶ÀýÇÑ ÈÄ Åõ¿©ÇÑ´Ù. ½ÉÁúȯÀÇ º´·ÂÀÌ Àִ ȯÀÚ´Â Åõ¿©
ÈÄ ¸Æ¹Ú¼ö¸¦ ½ÅÁßÈ÷ ÃøÁ¤ÇÑ´Ù.
4) ´ç´¢È¯ÀÚ¿¡ Åõ¿©½Ã¿¡´Â Åõ¿©±â°£µ¿¾È °è¼ÓÇÏ¿© Ç÷´çÀ» ÃøÁ¤ÇÏ¿©¾ß ÇÑ´Ù.
5) À°¾ÆÁ¾¼º Àü¹æÆ÷µµ¸·¿°ÀÌ º¸°íµÇ¾úÀ¸¹Ç·Î ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³ª´Â °æ¿ì¿¡´Â
Åõ¿©¸¦ ÁßÁöÇÏ°í ´Ù¸¥ Ä¡·á¹æ¹ýÀ» °±¸ÇÑ´Ù.
6) »ç°í·Î º¹¿ëÇÏ¿© ±â°üÁö°æ·Ã, ¼¸Æ, ÀúÇ÷¾Ð ¹× ½ÉºÎÀü µîÀÇ ºÎÀÛ¿ëÀÌ ³ªÅ¸³ª¸é
¥â-Â÷´ÜÁ¦ °ú¿ë·® Åõ¿©½Ã ÇàÇÏ´Â ÀϹÝÀû óġ¸¦ ÇÑ´Ù.
7) ÀÌ ¾àÀº ¿°Èº¥ÀßÄÚ´½À» ÇÔÀ¯Çϰí ÀÖÀ¸¹Ç·Î Ä£¼ö¼º ¼ÒÇÁÆ® ÄÜÅÃÆ®·»Á Âø¿ë
Çϰí Àִ ȯÀÚ¿¡´Â »ç¿ëÇÏÁö ¾Ê´Â´Ù.
|
| »óÈ£ÀÛ¿ë |
1) °æ±¸¿ë ¥â-Â÷´ÜÁ¦¿Í º´¿ë½Ã »ó½Â ÀÛ¿ëÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù.
2) ¸¶ÃëÁ¦, ºÎÁ¤¸Æ Ä¡·áÁ¦¿Í º´¿ë½Ã ½ÉÀå¾ïÁ¦ È¿°ú°¡ °ÈµÈ´Ù.
3) ¸ÞÆ¿µµÆÄ, ·¹¼¼¸£ÇÉ, Ŭ·Î´Ïµò µî Ç×°íÇ÷¾ÐÁ¦¿Í º´¿ë½Ã ¸Æ¹Ú°¨¼ÒÈ¿°ú°¡ ³ªÅ¸³¯
¼ö ÀÖ´Ù.
|
| ÀӺο¡ ´ëÇÑ Åõ¿© |
[ÀӺαݱ⠼ººÐ Á¶È¸]
±âÇü¹ß»ýÀÇ Áõ°Å´Â ¾øÁö¸¸ Ä¡·á»óÀÇ À¯ÀͼºÀÌ À§Ç輺À» »óȸÇÑ´Ù°í ÆÇ´ÜµÇ´Â
°æ¿ì¸¦ Á¦¿ÜÇϰí´Â ÀӺο¡´Â Åõ¿©ÇÏÁö ¾Ê´Â´Ù.
|
| ¼öÀ¯ºÎ¿¡ ´ëÇÑ Åõ¿© |
¥â-Â÷´ÜÁ¦´Â À¯ÁóÀ¸·Î ºÐºñµÉ ¼ö ÀÖÀ¸¹Ç·Î ¼öÀ¯Áß´ÜÀ» °í·ÁÇÑ´Ù.
|
| Àû¿ë»óÀÇ ÁÖÀÇ |
1) Àü½ÅÀûÀÎ Èí¼ö¸¦ ¹æÁöÇϱâ À§ÇØ Á¡¾ÈÈÄ ´©³¶À» ¼Õ°¡¶ôÀ¸·Î 1ºÐ°£ ¾Ð¹ÚÇÑ´Ù.
2) Á¡¾È¿ëÀ¸·Î¸¸ »ç¿ëÇÑ´Ù.
3) Á¡¾È½Ã ¿ë±âÀÇ ÀÔ±¸°¡ Á÷Á¢ ´«¿¡ ´êÁö ¾Êµµ·Ï ÁÖÀÇÇÑ´Ù.
4) ¿À¿°À» ¹æÁöÇϱâ À§ÇØ µÉ ¼ö ÀÖ´Â ÇÑ °øµ¿À¸·Î »ç¿ëÇÏÁö ¾Ê´Â´Ù.
|
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
1) ¼Ò¾ÆÀÇ ¼ÕÀÌ ´êÁö ¾Ê´Â °÷¿¡ º¸°üÇÑ´Ù.
2) Á÷»çÀϱ¤À» ÇÇÇÏ°í µÇµµ·Ï (½À±â°¡ ÀûÀº) ¼´ÃÇÑ °÷¿¡ (¹ÐÀüÇÏ¿©) º¸°üÇÑ´Ù.
3) ¿À¿ëÀ» ¸·°í ǰÁúÀÇ º¸Á¸À» À§ÇÏ¿© ´Ù¸¥ ¿ë±â¿¡ ¹Ù²Ù¾î ³ÖÁö ¾Ê´Â´Ù.
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
(metipranolol; )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| Á¦Çüº° º¹¾àÁöµµ |
[Á¡¾È¾×] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
metipranolol¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Although it is known that metipranolol binds the beta1 and beta2 adrenergic receptors, the mechanism of metipranolol's action is not known. It has no significant intrinsic sympathomimetic activity, and has only weak local anesthetic (membrane-stabilizing) and myocardial depressant activity. It appears that the ophthalmic beta-adrenergic blocking agents reduce aqueous humor production, as demonstrated by tonography and fluorophotometry. A slight increase in aqueous humor outflow may be an additional mechanism.
|
| Pharmacology |
metipranolol¿¡ ´ëÇÑ Pharmacology Á¤º¸ Metipranolol is a beta1 and beta2 (non-selective) adrenergic receptor-blocking agent that does not have significant intrinsic sympathomimetic, direct myocardial depressant, or local anesthetic (membrane-stabilizing) activity. Metipranolol is indicated in the treatment of elevated intraocular pressure in patients with ocular hypertension or open-angle glaucoma. Metipranolol, when applied topically to the eye, has the action of reducing elevated, as well as normal, intraocular pressure, whether or not accompanied by glaucoma. Elevated intraocular pressure is a major risk factor in the pathogenesis of glaucomatous visual field loss and optic nerve damage. Metipranolol reduces intraocular pressure with little or no effect on pupil size or accommodation in contrast to the miosis which cholinergic agents are known to produce.
|
| Absorption |
metipranolol¿¡ ´ëÇÑ Absorption Á¤º¸ Not Available
|
| Toxicity |
metipranolol¿¡ ´ëÇÑ Toxicity Á¤º¸ Not Available
|
| Drug Interactions |
metipranolol¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
metipranolol¿¡ ´ëÇÑ Description Á¤º¸ A beta-adrenergic antagonist effective for both beta-1 and beta-2 receptors. It is used as an antiarrhythmic, antihypertensive, and antiglaucoma agent. [PubChem]
|
| Dosage Form |
metipranolol¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Solution / drops Ophthalmic
|
| Drug Category |
metipranolol¿¡ ´ëÇÑ Drug_Category Á¤º¸ Adrenergic beta-AntagonistsAnti-Arrhythmia AgentsAntihypertensive AgentsSympatholytics
|
| Smiles String Canonical |
metipranolol¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC(C)NCC(O)COC1=C(C)C(C)=C(OC(C)=O)C(C)=C1
|
| Smiles String Isomeric |
metipranolol¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CC(C)NC[C@@H](O)COC1=C(C)C(C)=C(OC(C)=O)C(C)=C1
|
| InChI Identifier |
metipranolol¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C17H27NO4/c1-10(2)18-8-15(20)9-21-16-7-11(3)17(22-14(6)19)13(5)12(16)4/h7,10,15,18,20H,8-9H2,1-6H3
|
| Chemical IUPAC Name |
metipranolol¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ [4-[2-hydroxy-3-(propan-2-ylamino)propoxy]-2,3,6-trimethylphenyl] acetate
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2021-12-09
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
The database contains the following fields: The generic name of each chemical For module A10 (liver enzyme composite module): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the number of active and marginally active scores for each compound at the five individual endpoints (see research article for full description of method) Number of endpoints at which each compound is marginally active (M) Number of endpoints at which each compound is active (A) For modules A11 to A15 (alkaline phosphatase increased, SGOT increased, SGPT increased, LDH increased, and GGT increased, respectively): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the RI and ADR values (see the research article for full description of method) Number of ADR reports for each compound, given as <4 or ¡Ã4 Reporting Index value for each compound, except where no shipping units were available (NSU) Group 1 comprises of compounds for which ADR data were available for the first five years of marketing, so when no ADR reports were listed during this period the compounds were evaluated as inactive. Group 2 comprises of compounds for which a 'steady state' period of ADR data were available (1992-1996). In cases where no ADR reports were filed during this period, the compounds were scored as 'NA' (data not available) since they may have had one or more ADR reports during their first five years of marketing which should not be negated by a lack of ADR reports during the steady-state period. METIPRANOLOL[GGT Increase][Composite Activity](Score) I(Marginal) 0(Active) 0[Alkaline Phosphatase Increase](Activity Score) I(Number of Rpts) <4(Index value) 0[SGOT Increase](Activity Score) I(Number of Rpts) <4(Index value) 0[SGPT Increase](Activity Score) I(Number of Rpts) <4(Index value) 0[LDH Increase](Activity Score) I(Number of Rpts) <4(Index value) 0[GGT Increase](Activity Score) I(Number of Rpts) <4(Index value) 0
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|