| |
|
|
|
|
|
 |
| |
|
µðºñ¼½Á¤
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
642000160[E00030231]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/28Á¤(2013.06.01)(ÇöÀç¾à°¡)
\6,615 ¿ø/28Á¤(2013.01.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»ö, û»ö, ºÐÈ«»öÀÇ ¿øÇü Á¤Á¦
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
28Á¤(¹é»öÁ¤ 9Á¤, û»öÁ¤ 12Á¤, ºÐÈ«»öÁ¤ 7Á¤), 3 ¡¿28Á¤ |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 10¹Ð¸®±×·¥ |
28 Á¤ |
8806420001601 |
8806420001618 |
|
|
| ÁÖ¼ººÐÄÚµå |
441800ATB
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| ´ëÇ¥ÄÚµå |
8806420001601 |
| º¸°ü¹æ¹ý |
±â¹Ð¿ë±â, ½Ç¿Â(1~30¡É)º¸°ü |
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
È¿´É È¿°ú
ÀÚ±ÃÀÌ ¼Õ»óµÇÁö ¾ÊÀº ¿©¼ºÀÇ ÀÚ¿¬Àû ¶Ç´Â ÀÎÀ§Àû(³¼ÒÀýÁ¦¼ú ÈÄ µî) Æó°æÈÄ ¿¡½ºÆ®·Î°Õ °áÇÌÁõ»óÀÇ Ä¡·á¸¦ À§ÇÑ ¼ºÈ£¸£¸ó ´ëü¿ä¹ý
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¾ÃÁö ¸»°í ¼Ò·®ÀÇ ¹°°ú ÇÔ²² °¡´ÉÇÑ Ç×»ó µ¿ÀÏÇÑ ½Ã°£¿¡ ±ÔÄ¢ÀûÀ¸·Î 1ÀÏ 1ȸ, 1ȸ 1Á¤¾¿ Ä®·»´õÆÑ¿¡ µû¶ó 28ÀÏ ÁÖ±â·Î ÁߴܾøÀÌ º¹¿ëÇÑ´Ù.
¸¸ÀÏ º¹¿ëÀ» ÀؾúÀ» °æ¿ì¿¡´Â °¡´ÉÇÑ ÇÑ »¡¸® 1Á¤À» º¹¿ëÇϰí 12½Ã°£ ÀÌ»óÀÌ Áö³µÀ» °æ¿ì¿¡´Â º¹¿ëÇÏÁö ¾Ê´Â´Ù. ÀÌ ¶§ ÃâÇ÷ÀÌ ÀϾ ¼ö ÀÖ´Ù.
Æó°æÀÌ µÈ °æ¿ì¿¡´Â ¾ðÁ¦µçÁö Åõ¿©¸¦ ½ÃÀÛÇÒ ¼ö ÀÖ´Ù. Æó°æÀüÀÎ ¿©¼ºÀº »ý¸® ½ÃÀÛ 5Àϰ µÇ´Â ³¯ºÎÅÍ Åõ¿©¸¦ ½ÃÀÛÇÑ´Ù.
ÀÌ ¾àÀº 3´Ü°è ÁÖ±âÀû ¿¡½ºÆ®·Î°Õ-ÇÁ·Î°Ô½ºÅ×·Ð Á¦Á¦·Î¼ ´ÙÀ½°ú °°Àº º¹¿ë¼ø¼´Â »ý¸®Áֱ⸦ ¸ð¹æÇÑ °ÍÀÌ´Ù.
1) ¿¡½ºÆ®·Î°ÕÁÖ±â·Î(±æÃʻ꿡½ºÆ®¶óµð¿Ã 2mg, 9ÀÏ, ¹é»öÁ¤) ½ÃÀÛÇØ¼,
2) ¿¡½ºÆ®·Î°Õ-ÇÁ·Î°Ô½ºÅ×·Ð °áÇÕÁÖ±â(±æÃʻ꿡½ºÆ®¶óµð¿Ã2mg°ú ÃÊ»ê¸Þµå·Ï½ÃÇÁ·Î°Ô½ºÅ×·Ð 10mg, 12ÀÏ, û»öÁ¤)ÀÌ´Ù.
3) ¿¡½ºÆ®·Î°Õ ÁÖ±â(±æÃʻ꿡½ºÆ®¶óµð¿Ã 1mg, 7ÀÏ, ºÐÈ«»öÁ¤)·Î ¸¶¹«¸®µÈ´Ù.
¶ÇÇÑ ÀÌ Á⵿ֱ¾È ¶Ç´Â ¸¶Áö¸· û»öÁ¤ º¹¿ëÁß¿¡ Á¤»óÀûÀÎ ÃâÇ÷ÀÌ ÀϾ ¼ö ÀÖ´Ù.
ÁÖÀÇ : µðºñ¼½Àº ÇÇÀÓÀ¸·Î Àû´çÇÏÁö ¾Ê´Ù.
|
| ±Ý±â |
1) ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀÎ
2) ¼öÀ¯ºÎ
3) ±Þ¼º ¶Ç´Â ¸¸¼º °£Áúȯ ȯÀÚ
4) Dubin-Johnson ÁõÈıº ȯÀÚ
5) Rotor ÁõÈıº ȯÀÚ
6) ½ÉÇÑ ½ÉÀå ¶Ç´Â ½ÅÀåÁúȯ ȯÀÚ
7) Ȱµ¿¼º Ç÷Àü »öÀüÁõ(½ÉÀçÁ¤¸ÆÇ÷ÀüÁõ, Æó»öÀüÁõ) Áø´ÜÀ» ¹ÞÀº ȯÀÚ ¶Ç´Â Ç×ÀÀ°íü Ä¡·á¸¦ ÇÏÁö ¾ÊÀº ÀçÇö¼º Á¤¸ÆÇ÷ÀüÁõ º´·ÂÀÌ Àִ ȯÀÚ
8) À¯¹æ¾Ï ¶Ç´Â Àڱ󻸷¾Ï°ú °°Àº ¿¡½ºÆ®·Î°Õ ÀÇÁ¸¼º Á¾¾çȯÀÚ ¶Ç´Â ÃßÃøµÇ´Â ȯÀÚ
9) Áø´ÜµÇÁö ¾ÊÀº ºÒ±ÔÄ¢ÇÑ ÀÚ±Ã/ÁúÃâÇ÷ ȯÀÚ
10) ÀÌ ¾àÀÇ ¼ººÐ¿¡ °ú¹ÎÁõÀÌ Àִ ȯÀÚ
11) ±Þ¼º ¶Ç´Â ÃÖ±Ù¿¡ Áø´Ü¹ÞÀº µ¿¸ÆÇ÷Àü»öÀüÁõ ȯÀÚ
|
| ½ÅÁßÅõ¿© |
1) À¯¹æ¾ÏÀÇ º´·ÂÀÌ Àְųª °¡Á··ÂÀÌ Àִ ȯÀÚ´Â À¯¹æ¾Ï ¹ßº´ À§Ç輺ÀÌ Áõ°¡ ÇÒ ¼ö ÀÖÀ¸¹Ç ·Î Åõ¿©ÇÏÁö ¾Ê´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù. HRTÀÇ Ä¡·á»óÀÇ À¯Àͼº°ú À§Ç鼺À» Æò°¡ÇÏ¿© ½ÅÁß È÷ Åõ¿©Çϰí, Ä¡·áÀü°ú Ä¡·á ½ÃÀÛ ÈÄ¿¡´Â Á¤±âÀûÀÎ À¯¹æ°Ë»ç(À¯¹æÁ¶¿µ¼ú)À» ¹Þµµ·Ï ÇÑ´Ù.
2) À¯¹æ°áÀý ¶Ç´Â ¼¶À¯¼º ³¶Æ÷¼º À¯¹æÁúȯ ȯÀÚ´Â À¯¹æÀÇ »óŸ¦ ÁÖÀDZí°Ô °üÂûÇÏ¸é¼ Åõ¿© ÇÑ´Ù.
3) ¿ªÇÐÁ¶»ç¿¡ ÀÇÇϸé È£¸£¸ó ´ëü¿ä¹ý(HRT)À¸·Î Á¤¸Æ Ç÷ÀüÁõ(VTE)(½ÉÀç Á¤¸ÆÇ÷ÀüÁõ ¶Ç´Â Æó»öÀüÁõ)ÀÇ À§Ç輺ÀÌ 2-3¹è Áõ°¡µÉ ¼ö ÀÖ´Ù´Â °ÍÀ¸·Î º¸°íµÇ¾ú´Ù.
ÀϹÝÀûÀ¸·Î VTEÀÇ À§ÇèÀÎÀڷδ °³ÀηÂ, °¡Á··Â ¶Ç´Â ºñ¸¸(üÁú·®Áö¼ö>:30kg/§³)µîÀÌ ÀÖÀ¸¸ç, Àå±â°£ ºÎµ¿»óŰ¡ ÇÊ¿äÇÑ °æ¿ì ¶ÇÇÑ ½ÉÇÑ ¿Ü»óÀ̳ª ¼ö¼ú(ƯÈ÷ º¹ºÎ ¶Ç´Â ÇÏÁö ÀÇ ¿Ü°úÀû ¼ö¼ú)µîÀ¸·Î ºÎµ¿»óŰ¡ Áö¼ÓµÇ¸é, VTEÀÇ À§Ç輺ÀÌ ÀϽÃÀûÀ¸·Î Áõ°¡µÉ ¼ö
ÀÖ´Ù. Áõ»óÀÇ Á¤µµ³ª ºÎµ¿»óÅ¿¡ ÀÖ´Â ±â°£¿¡ µû¶ó¼ HRTÀÇ ÀϽÃÀû(¼ö¼ú 4~6ÁÖÀüºÎÅÍ ¼ö¼úÈÄ µî)Áß´ÜÀ» °í·ÁÇØ¾ß ÇÑ´Ù.
VTE¿¡ ´ëÇÑ Á¤¸Æ·ù¼º Á¤¸ÆÀÇ ¿ªÇÒÀº ¾ÆÁ÷ ¹àÇôÁöÁö ¾Ê¾Ò´Ù.
4) ³úÇ÷°ü Àå¾Ö, ½ÉÇÑ °íÇ÷¾ÐÀ» Æ÷ÇÔÇÑ ½ÉÇ÷°ü°è Áúȯ, ½ÉÇÑ °£´ë»ç Àå¾Ö, Àü½Å¼º È«¹Ý¼º ³¶ â, Æ÷¸£ÇǸ°Áõ ȯÀÚ´Â Ä¡·á»óÀÇ À¯Àͼº°ú À§Ç輺À» °í·ÁÇÏ¿© ÁÖÀDZí°Ô °üÂûÇÏ¸é¼ ½ÅÁß È÷ Åõ¿©ÇØ¾ß ÇÑ´Ù.
5) Ä¡·á ½ÃÀ۽ÿ¡ Ç÷°ú Æó»öÀÇ ÀüÁ¶ Áõ»óÀÏ °¡´É¼ºÀÌ ÀÖ´Â ÆíµÎÅë ¶Ç´Â ½ÉÇÑ µÎÅëÀÌ ³ªÅ¸³ª °Å³ª ¾î¶² ´Ù¸¥ Áõ»ó(Ȳ´Þ, Àü½Å¼º ¼Ò¾çÁõ, °£Áú ¹ßÀÛÀÇ ºóµµ Áõ°¡, ÇöÀúÇÑ Ç÷¾Ð »ó½Â µî)ÀÌ ³ªÅ¸³ª¸é, Áï½Ã Åõ¿©¸¦ ÁßÁöÇÏ°í ±× ¿øÀÎÀÌ Á¶»çÇØ¾ß ÇÑ´Ù.
6) ÆíµÎÅë, ½ÉÇÑ µÎÅë, °£Áú, ´Ù¹ß¼º °æÈÁõ, À̰æÈÁõ, ȲüÀÚ±ØÈ£¸£¸ó ³óµµ »ó½Â, ´ç´¢º´, °£±â´É Àå¾Ö, ´ãÁóºÐºñ Á¤Áö ¶Ç´Â ´ã¼®, ½Å±â´É Àå¾Ö, Àڱ󻸷Áõ, ÀÚ±ÃÆòȲ±ÙÁ¾ ¶Ç´Â ÀÓ ½Å¼º Æ÷Áø(ÀÚ°¡¸é¿ªÀÇ º´ÀÎÇÐÀ̶ó°í ÃßÁ¤µÇ´Â µå¹® ´ë¼öÆ÷¼ºÁúȯ) ȯÀÚ ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ´Â HRT·Î ±× Áõ»óÀÌ ¾Çȵǰųª Àç¹ßµÉ ¼ö ÀÖÀ¸¹Ç·Î, Ä¡·á»óÀÇ À¯Àͼº°ú À§Çè ¼ºÀ» Æò°¡ÇÏ¿© ½ÅÁßÈ÷ Åõ¿©Çϰí ÁÖÀÇ ±í°Ô °üÂûÇÑ´Ù.
|
| ÀÌ»ó¹ÝÀÀ |
1) ÁßÃ߽Űæ°è : ¶§¶§·Î ÆíµÎÅë, µÎÅë, Çö±âÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
2) Á¤½Å½Å°æ°è : ¶§¶§·Î ºÒ¾È, ¿ì¿ï°¨, ¼ö¸éÀå¾Ö, ¼º¿åÀÇ º¯È µî °¨Á¤ÀÌ º¯È°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
3) ½ÉÇ÷°ü°è : ¶§¶§·Î °íÇ÷¾Ð, µå¹°°Ô Á¤¸Æ Ç÷ÀüÁõ, ½É°èÇ×ÁøÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
4) À§Àå°ü°è : ¶§¶§·Î ±¸¿ª, º¹Åë, °íÀåÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
5) »ý½Ä±â°è : µå¹°°Ô À¯¹æ ÅëÁõ, ºÎÁ¤±âÀûÀÎ ÀÚ±Ã/Áú ÃâÇ÷, ¿ù°æÀü ±äÀå
6) °£ ,´ã°ü°è : µå¹°°Ô °£ È¿¼ÒÄ¡ÀÇ º¯È, ´ã³¶ Àå¾Ö°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
7) ±âŸ : ¶§¶§·Î üÁߺ¯È, ºÎÁ¾, ÇǷΰ¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| ÀϹÝÀû ÁÖÀÇ |
1) ÀÌ ¾àÀ» Åõ¿©Çϱâ Àü¿¡ ¹Ýµå½Ã ÀϹÝÀûÀÎ ÀÇÇÐÀû °Ë»ç ¹× ºÎÀΰú °Ë»ç, À¯¹æ °Ë»ç¸¦ ¹Þ¾Æ ¾ß ÇÑ´Ù. ÇÊ¿äÇÒ °æ¿ì Àڱ󻸷ÀÇ »óŵµ È®ÀÎÇÏ¿©¾ß ÇÑ´Ù.
2) ÀÌ ¾àÀ» Åõ¿©¹Þ´Â ȯÀÚ´Â ÀϹÝÀûÀÎ ÀÇÇÐÀû °Ë»ç ¹× ºÎÀΰú °Ë»ç µîÀ» Á¤±âÀûÀ¸·Î ¹Þ¾Æ¾ß ÇÑ´Ù.
3) Æó°æÀü¿¡ Åõ¿©ÇÒ °æ¿ì Ä¡·á ÃÊ±â ¸î ´Þ µ¿¾È¿¡´Â ÆÄ¿ÃâÇ÷ÀÌ ÀÖÀ» ¼ö ÀÖÀ¸³ª, ÀϽÃÀûÀÎ °ÍÀÌ´Ù.
±×·¯³ª ¿øÀκҸíÀÇ Áö¼ÓÀûÀÎ ÀÚ±Ã/ÁúÃâÇ÷ÀÌ ÀÖ´Â °æ¿ì¿¡´Â Áï½Ã Åõ¿©¸¦ ÁßÁöÇÏ°í ºÎÀΰú °Ë»ç µîÀ¸·Î ±× ¿øÀÎÀ» Á¶»çÇØ¾ß ÇÑ´Ù.
4) 5³â ÀÌ»ó HRT¸¦ ¹ÞÀº ¿©¼º¿¡¼ À¯¹æ¾Ï ¹ßº´ À§Ç輺ÀÌ ¾à°£ Áõ°¡ÇÏ¿´´Ù´Â º¸°í°¡ ÀÖ´Ù.
5) ¿îÀüÀ̳ª ±â°è Á¶Á÷½Ã¿¡ ¹ÌÄ¡´Â ¿µÇâ¿¡ ´ëÇØ¼´Â ¹àÇôÁø ¹Ù°¡ ¾ø´Ù.
6) ÀÌ ¾àÀº ÇÇÀÓÁ¦°¡ ¾Æ´Ï´Ù.
|
| »óÈ£ÀÛ¿ë |
1) °£ ¸¶ÀÌÅ©·ÎÁ» È¿¼Ò¸¦ À¯µµÇÏ´Â Á¦Á¦(¹Ù¸£ºñÅ»·ù, È÷´ÜÅäÀÎ, Æä´ÏÅäÀÎ, Ä«¸£¹Ù¸¶Á¦ÇÉ, ¸® ÆÊÇǽеî)¿Í º´¿ë Åõ¿©½Ã, ÀÌ ¾àÀÇ ¿¡½ºÆ®·Î°Õ È¿°ú¸¦ ÇöÀúÈ÷ °¨¼Ò½Ãų ¼ö ÀÖ´Ù.
2) °£ ¸¶ÀÌÅ©·ÎÁ» È¿¼Ò ÀúÇØÁ¦(ÄÉÅäÄÚ³ªÁ¹ µî)¿Í º´¿ë Åõ¿©½Ã, ÀÌ ¾àÀÇ ¿¡½ºÆ®·Î°Õ È¿°ú¸¦ Áõ°½Ãų ¼ö ÀÖ´Ù.
|
| °ú·®Åõ¿© ¹× óġ |
1) ¿¡½ºÆ®·Î°Õ °ú·®Åõ¿©·Î ±¸¿ª, µÎÅë, ÀÚ±Ã/Áú ÃâÇ÷ÀÌ ÀϾ ¼ö ÀÖÀ¸¸ç, ±× Áõ»ó¿¡ µû¶ó¼ ´ëÁõ¿ä¹ýÀ» ½Ç½ÃÇÑ´Ù. °í¿ë·®ÀÇ ¿¡½ºÆ®·Î°Õ-ÇÔÀ¯ °æ±¸ÇÇÀÓÁ¦°¡ À¯¾Æ¿¡°Ô ½É°¢ÇÑ À¯ÇØÀÛ ¿ëÀ» ÁÖÁö´Â ¾Ê¾Ò´Ù.
2) ¾Ï Ä¡·á¸¦ À§ÇÑ °í¿ë·®ÀÇ MPAÅõ¿©·Î ½É°¢ÇÑ ºÎÀÛ¿ëÀÌ ÀϾÁö´Â ¾Ê¾Ò´Ù.
|
ÀÓ»ó°Ë»çÄ¡¿¡ÀÇÇÑ ¿µÇâ |
1) ¿¡½ºÆ®·Î°Õ°ú ÇÁ·Î°Ô½ºÆ¾ º¹ÇÕÁ¦ Åõ¿©·Î °©»ó¼±±â´É °Ë»ç ¹× °£±â´É °Ë»çÄ¡¿¡ ¿µÇâÀ» ¹Ì Ä¥ ¼ö ÀÖ´Ù.
2) ¸ÞƼ¶óÆù ½ÃÇèÀÇ ¹ÝÀÀ¼ºÀ» °¨¼Ò½Ãų ¼ö ÀÖ´Ù.
|
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
±â¹Ð¿ë±â, ½Ç¿Â(1~30¡É)º¸°ü |
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Xµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Estradiol¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Progesterone¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Estradiol¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Estradiol enters target cells freely (e.g., female organs, breasts, hypothalamus, pituitary) and interacts with a target cell receptor. When the estrogen receptor has bound its ligand it can enter the nucleus of the target cell, and regulate gene transcription which leads to formation of messenger RNA. The mRNA interacts with ribosomes to produce specific proteins that express the effect of estradiol upon the target cell. Estrogens increase the hepatic synthesis of sex hormone binding globulin (SHBG), thyroid-binding globulin (TBG), and other serum proteins and suppress follicle-stimulating hormone (FSH) from the anterior pituitary.
Medroxyprogesterone¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Progestins diffuse freely into target cells in the female reproductive tract, mammary gland, hypothalamus, and the pituitary and bind to the progesterone receptor. Once bound to the receptor, progestins slow the frequency of release of gonadotropin releasing hormone (GnRH) from the hypothalamus and blunt the pre-ovulatory LH surge.
|
| Pharmacology |
Estradiol¿¡ ´ëÇÑ Pharmacology Á¤º¸ Estradiol, the principal intracellular human estrogen, is substantially more active than its metabolites, estrone and estriol, at the cellular level.
Medroxyprogesterone¿¡ ´ëÇÑ Pharmacology Á¤º¸ Medroxyprogesterone is a synthetic progestin more potent than progesterone.
|
| Protein Binding |
Estradiol¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ >95%
Medroxyprogesterone¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 90%
|
| Half-life |
Estradiol¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 36 hours
Medroxyprogesterone¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 50 days
|
| Absorption |
Estradiol¿¡ ´ëÇÑ Absorption Á¤º¸ 43%
Estradiol¿¡ ´ëÇÑ Absorption Á¤º¸ 43%
Estradiol¿¡ ´ëÇÑ Absorption Á¤º¸ 43%
Medroxyprogesterone¿¡ ´ëÇÑ Absorption Á¤º¸ Rapidly absorbed from GI tract
|
| Pharmacokinetics |
Estradiol valerateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : À§Àå°ü¿¡¼ ½Å¼ÓÈ÷ Èí¼ö
Àå°£¼øÈ¯(enterohepatic recirculation)
- ºÐÆ÷ : ÅÂ¹Ý Åë°ú, À¯ÁóºÐºñ
- ´Ü¹é°áÇÕ : 80 %
- ¹Ý°¨±â : 50-60 ºÐ
- ´ë»ç : °£¿¡¼ ºñȰ¼º ¹°Áú·Î ´ë»ç
- ¼Ò½Ç : ¼Òº¯°ú ´ãÁóÀ¸·Î ¹è¼³
Medroxyprogesterone AcetateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ÀÛ¿ëÁö¼Ó½Ã°£ : µ¥Æ÷Á¦Á¦ : 3 °³¿ù
- Èí¼ö : ±ÙÀ°ÁÖ»ç : ¼¼È÷ Èí¼ö
- »ýü³»ÀÌ¿ë·ü : °æ±¸ : 0.6-10 %
- ´Ü¹é°áÇÕ : 90 %
- ´ë»ç : °£´ë»ç
- ¹Ý°¨±â : 38-46 ½Ã°£
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : 2.4 ½Ã°£
- ¼Ò½Ç : ´¢ ¹× º¯¹è¼³
|
| Biotransformation |
Estradiol¿¡ ´ëÇÑ Biotransformation Á¤º¸ Exogenous estrogens are metabolized using the same mechanism as endogenous estrogens. Estrogens are partially metabolized by cytochrome P450.
Medroxyprogesterone¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic
|
| Toxicity |
Estradiol¿¡ ´ëÇÑ Toxicity Á¤º¸ Can cause nausea and vomiting, and withdrawal bleeding may occur in females.
Medroxyprogesterone¿¡ ´ëÇÑ Toxicity Á¤º¸ Side effects include loss of bone mineral density, BMD changes in adult women, bleeding irregularities, cancer risks, and thromboembolic disorders.
|
| Drug Interactions |
Estradiol¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Amobarbital The enzyme inducer decreases the effect of hormonesAprobarbital The enzyme inducer decreases the effect of hormonesButabarbital The enzyme inducer decreases the effect of hormonesButalbital The enzyme inducer decreases the effect of hormonesButethal The enzyme inducer decreases the effect of hormonesEthotoin The enzyme inducer decreases the effect of hormonesFosphenytoin The enzyme inducer decreases the effect of hormonesGriseofulvin The enzyme inducer decreases the effect of hormonesHeptabarbital The enzyme inducer decreases the effect of hormonesHexobarbital The enzyme inducer decreases the effect of hormonesMephenytoin The enzyme inducer decreases the effect of hormonesMethohexital The enzyme inducer decreases the effect of hormonesMethylphenobarbital The enzyme inducer decreases the effect of hormonesPentobarbital The enzyme inducer decreases the effect of hormonesPhenobarbital The enzyme inducer decreases the effect of hormonesPhenytoin The enzyme inducer decreases the effect of hormonesPrednisolone The estrogenic agent increases the effect of corticosteroidPrednisone The estrogenic agent increases the effect of corticosteroidPrimidone The enzyme inducer decreases the effect of hormonesSecobarbital The enzyme inducer decreases the effect of hormonesTalbutal The enzyme inducer decreases the effect of hormonesRaloxifene Association not recommendedUrsodeoxycholic acid Estrogens decreases the effect of ursodiol
Medroxyprogesterone¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Amobarbital The enzyme inducer decreases the effect of hormonesAprobarbital The enzyme inducer decreases the effect of hormonesBosentan Bosentan decreases the effect of contraceptiveButabarbital The enzyme inducer decreases the effect of hormonesButalbital The enzyme inducer decreases the effect of hormonesButethal The enzyme inducer decreases the effect of hormonesEthotoin The enzyme inducer decreases the effect of hormonesFosphenytoin The enzyme inducer decreases the effect of hormonesMephenytoin The enzyme inducer decreases the effect of hormonesPhenytoin The enzyme inducer decreases the effect of hormonesGriseofulvin The enzyme inducer decreases the effect of hormonesHeptabarbital The enzyme inducer decreases the effect of hormonesHexobarbital The enzyme inducer decreases the effect of hormonesMethohexital The enzyme inducer decreases the effect of hormonesMethylphenobarbital The enzyme inducer decreases the effect of hormonesPentobarbital The enzyme inducer decreases the effect of hormonesPhenobarbital The enzyme inducer decreases the effect of hormonesPrimidone The enzyme inducer decreases the effect of hormonesSecobarbital The enzyme inducer decreases the effect of hormonesTalbutal The enzyme inducer decreases the effect of hormonesWarfarin The agent increases the effect of anticoagulantAcenocoumarol The agent increases the effect of anticoagulantDicumarol The agent increases the effect of anticoagulantAnisindione The agent increases the effect of anticoagulant
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Description |
Estradiol¿¡ ´ëÇÑ Description Á¤º¸ Generally refers to the 17-beta-isomer of estradiol, an aromatized C18 steroid with hydroxyl group at 3-beta- and 17-beta-position. Estradiol-17-beta is the most potent form of mammalian estrogenic steroids. In humans, it is produced primarily by the cyclic ovaries and the placenta. It is also produced by the adipose tissue of men and postmenopausal women. The 17-alpha-isomer of estradiol binds weakly to estrogen receptors (receptors, estrogen) and exhibits little estrogenic activity in estrogen-responsive tissues. Various isomers can be synthesized. [PubChem]
Medroxyprogesterone¿¡ ´ëÇÑ Description Á¤º¸ (6 alpha)-17-Hydroxy-6-methylpregn-4-ene-3,20-dione. A synthetic progestational hormone used in veterinary practice as an estrus regulator. [PubChem]
|
| Drug Category |
Estradiol¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-menopausal AgentsAnticholesteremic AgentsEstrogens
Medroxyprogesterone¿¡ ´ëÇÑ Drug_Category Á¤º¸ ContraceptivesContraceptives, Oral, SyntheticProgestins
|
| Smiles String Canonical |
Estradiol¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC12CCC3C(CCC4=C3C=CC(O)=C4)C1CCC2O
Estradiol¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC12CCC3C(CCC4=C3C=CC(O)=C4)C1CCC2O
Estradiol¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC12CCC3C(CCC4=C3C=CC(O)=C4)C1CCC2O
Medroxyprogesterone¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC1CC2C(CCC3(C)C2CCC3(O)C(C)=O)C2(C)CCC(=O)C=C12
|
| Smiles String Isomeric |
Estradiol¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@]12CC[C@H]3[C@@H](CCC4=C3C=CC(O)=C4)[C@@H]1CC[C@@H]2O
Medroxyprogesterone¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@H]1C[C@@H]2[C@H](CC[C@@]3(C)[C@H]2CC[C@]3(O)C(C)=O)[C@@]2(C)CCC(=O)C=C12
|
| InChI Identifier |
Estradiol¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1
Medroxyprogesterone¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C22H32O3/c1-13-11-16-17(20(3)8-5-15(24)12-19(13)20)6-9-21(4)18(16)7-10-22(21,25)14(2)23/h12-13,16-18,25H,5-11H2,1-4H3/t13-,16+,17-,18-,20+,21-,22-/m0/s1
|
| Chemical IUPAC Name |
Estradiol¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol
Medroxyprogesterone¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (6S,8R,9S,10R,13S,14S,17R)-17-acetyl-17-hydroxy-6,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one
|
| Drug-Induced Toxicity Related Proteins |
ESTRADIOL ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Myc proto-oncogene protein Drug:estradiol Toxicity:cytotoxic responses . [¹Ù·Î°¡±â] Replated Protein:3-hydroxy-3-methylglutaryl-coenzyme A reductase Drug:estradiol Toxicity:stimulate steroidogenesis. [¹Ù·Î°¡±â] Replated Protein:Stromelysin-2 Drug:estradiol Toxicity:nonbacterial prostatitis. [¹Ù·Î°¡±â] Replated Protein:Transcription factor E2F1 Drug:estradiol Toxicity:cytotoxic responses. [¹Ù·Î°¡±â] Replated Protein:Glucocorticoid receptor Drug:estradiol Toxicity:glucocorticoid resistance. [¹Ù·Î°¡±â] MEDROXYPROGESTERONE ACETATE (MPA) ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Estrogen receptor Drug:medroxyprogesterone acetate (MPA) Toxicity:mammary adenocarcinoma. [¹Ù·Î°¡±â] PROGESTERONE ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Mitogen-activated protein kinase Drug:progesterone Toxicity:progesterone-induced oocyte maturation . [¹Ù·Î°¡±â] Replated Protein:Angiotensinogen Drug:progesterone Toxicity:rogesterone-induced luteinizing hormone surge. [¹Ù·Î°¡±â] Replated Protein:Retinol-binding protein, cellular Drug:progesterone Toxicity:increase luteal cell progesterone accumulation. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-11-03
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|