| |
|
|
|
|
|
 |
| |
|
¸ðÅ©¸°¾× MOCLEAN SOLN.[Chlorhexidine Gluconate , Oxybuprocaine]
|
|
ÀϹÝÀǾàǰ | ºñ±Þ¿©
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
ºñ±Þ¿©
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»ö ºÒÅõ¸íÇÑ ¾Ë·ç¹Ì´½ºÐ¹«¿ë±â¿¡ µç ¹æÇ⼺ÀÇ ³¿»õ¸¦ Áö´Ñ ¹«»ö ¶Ç´Â ¹ÌȲ»öÀÇ Åõ¸íÇÑ ¾×Á¦
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
200ML/BTL
|
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
ÀÎÈÄ¿°,Ä¡Àº¿°, ±¸³»¿°, ±¸°Á¡¸· ¹× ÀÎÈİÀÇ °¨¿°
[Drugbank ÀÇ ¼ººÐÁ¤º¸¿¶÷] [Chlorhexidine][Oxybuprocaine]
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
1ÀÏ 3-10ȸ ¹Ýº¹ºÐ¹«ÇÑ´Ù.
|
| ±Ý±â |
- 30°³¿ù ¹Ì¸¸ÀÇ À¯¾Æ
- Ŭ·Î¸£Çí½Ãµò Á¦Á¦¿¡ °üÇÏ¿© °ú¹ÎÁõÀÇ Àü·ÂÀÌ Àִ ȯÀÚ
- ³ú, ô¼ö, ±Í(³»ÀÌ, ÁßÀÌ, ¿ÜÀÌ) :
û°¢½Å°æ ¶Ç´Â ÁßÃ߽Ű濡 Á÷Á¢ ÀÛ¿ëÇÒ °æ¿ì, ³Ã», ½Å°æÀåÇØ¸¦ ÀÏÀ¸Å³ ¼ö ÀÖÀ½.
- Áú, ¹æ±¤, ±¸° µîÀÇ Á¡¸·¸é
- ´«
|
| ½ÅÁßÅõ¿© |
- ´Ù¸¥ ¾à¹°¿¡ ´ëÇÏ¿© °ú¹ÎÁõÀÌ Àִ ȯÀÚ
- õ½Ä µî ¾Ë·¯Áö ÁúȯÀÌ Àְųª ±× Àü·Â ¶Ç´Â °¡Á··ÂÀÌ Àִ ȯÀÚ
- ºÐ¸¸ Á÷ÀüÀÇ ¿ÜÀ½ºÎ ÁÖÀ§(½Å»ý¾ÆÀÇ ´« µî¿¡ µé¾î°¥ ¿ì·Á°¡ ÀÖÀ½)
|
| ÀÌ»ó¹ÝÀÀ |
- ¼ï :
µå¹°°Ô ¼ïÁõ»óÀÌ ÀϾ ¼ö ÀÖÀ¸¹Ç·Î ÃæºÐÈ÷ °üÂûÇÏ°í ±¸¿ª, ºÒÄè°¨, ½ÄÀº¶¡, ¾îÁö·¯¿ò, ´ä´äÇÔ, È£Èí°ï¶õ, ¹ßÀÛ µîÀÇ Áõ»óÀÌ ³ªÅ¸³ª´Â °æ¿ì¿¡´Â Áï½Ã »ç¿ëÀ» ÁßÁöÇϰí ÀûÀýÈ÷ óġÇÒ °Í
°ú¹ÎÁõ : ¶§¶§·Î ¹ßÁø, µÎµå·¯±â µîÀÇ °ú¹ÎÁõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ±×·¯ÇÑ °æ¿ì¿¡´Â »ç¿ëÀ» ÁßÁöÇÒ °Í.
|
| ÀϹÝÀû ÁÖÀÇ |
- 10ÀÏ ÀÌ»ó »ç¿ëÇÏÁö ¸»°Í
- À½À̿¿¡ ÀÇÇØ ³¿ë¼º¿°À» »ý¼ºÇϹǷΠÁÖÀÇÇÒ °Í
- ¼ï¹ßÇö¿¡ ´ëºñÇÏ¿©,»ç¿ë½Ã Ŭ·Î¸£Çí½Ãµò Á¦Á¦¿¡ ´ëÇÑ °ú¹ÎÁõ Àü·Â,¾à¹°°ú¹Î üÁú µîÀ» ÃæºÐÈ÷ ¹®ÁøÇÒ °Í.
|
| Àû¿ë»óÀÇ ÁÖÀÇ |
- ¿Ü¿ëÀ¸·Î¸¸ »ç¿ëÇÒ °Í.
- ´«¿¡ µé¾î°¡Áö ¾Êµµ·Ï ÁÖÀÇÇÏ°í ´«¿¡ µé¾î°¬À» °æ¿ì¿¡´Â Áï½Ã ±ú²ýÇÑ ¹°·Î Àß ¾Ä¾î³¾ °Í.
- ±¤¹üÀ§ÇÑ Ã¢»ó, ¿»ó¿¡´Â »ç¿ëÇÏÁö ¸» °Í
- Ç÷û,°í¸§ µîÀÇ À¯±â¹°ÁúÀ̳ª ºñ´©·ù¿¡ ÀÇÇÏ¿© »ì±ÕÀÛ¿ëÀÌ ¾àȵǹǷΠ»ç¿ë ³óµµ, ½Ã°£ µî¿¡ À¯ÀÇÇÏ°í ºñ´©¸¦ »ç¿ëÇÑ °æ¿ì¿¡´Â »çÀü¿¡ ÃæºÐÈ÷ ¾Ä¾î³½ ÈÄ¿¡ »ç¿ëÇÒ °Í.
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
(procaine; )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Chlorhexidine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Chlorhexidine's antimicrobial effects are associated with the attractions between chlorhexidine (cation) and negatively charged bacterial cells. After chlorhexidine is absorpted onto the organism's cell wall, it disrupts the integrity of the cell membrane and causes the leakage of intracellular components of the organisms.
Oxybuprocaine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Oxybuprocaine binds to sodium channel and reversibly stabilizes the neuronal membrane which decreases its permeability to sodium ions. Depolarization of the neuronal membrane is inhibited thereby blocking the initiation and conduction of nerve impulses.
|
| Pharmacology |
Chlorhexidine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Chlorhexidine, a topical antimicrobial agent, is bactericidal. Because of its positive charge, the chlorhexidine molecule reacts with the microbial cell surface to destroy the integrity of the cell membrane. This novel mechanism of action makes it highly unlikely for the development of bacterial resistance.
Oxybuprocaine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Oxybuprocaine is a local anaesthetic. It may be less irritating than tetracaine, and the onset and duration of action are similar to tetracaine.
|
| Metabolism |
Chlorhexidine¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Not Available
|
| Protein Binding |
Chlorhexidine¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 87%
Oxybuprocaine¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Not Available
|
| Half-life |
Chlorhexidine¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ Not Available
Oxybuprocaine¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ Not Available
|
| Absorption |
Chlorhexidine¿¡ ´ëÇÑ Absorption Á¤º¸ Absorption of chlorhexidine from the gastrointestinal tract is very poor. Additionally, an in vivo study in 18 adult patients found no detectable plasma or urine chlorhexidine concentrations following insertion of four periodontal implants under clinical conditions.
Oxybuprocaine¿¡ ´ëÇÑ Absorption Á¤º¸ Not Available
|
| Biotransformation |
Oxybuprocaine¿¡ ´ëÇÑ Biotransformation Á¤º¸ Not Available
|
| Toxicity |
Chlorhexidine¿¡ ´ëÇÑ Toxicity Á¤º¸ LD50= 2g/kg (human, oral); LD50= 3 g/kg (rat, oral); LD50= 2.5 g/kg (mice, oral); LD50= 21 mg/kg (male rat, IV); LD50= 23 mg/kg (female rat, IV); LD50= 25 mg/kg (male mice, IV); LD50= 24 mg/kg (female mice, IV); LD50= 1g/kg (rat, subcutaneous); LD50= 637 mg/kg (male mice, subcutaneous); LD50= 632 mg/kg (female mice, subcutaneous)
Oxybuprocaine¿¡ ´ëÇÑ Toxicity Á¤º¸ Not Available
|
| Drug Interactions |
Chlorhexidine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
Oxybuprocaine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Chlorhexidine¿¡ ´ëÇÑ Description Á¤º¸ A disinfectant and topical anti-infective agent used also as mouthwash to prevent oral plaque. [PubChem]
Oxybuprocaine¿¡ ´ëÇÑ Description Á¤º¸ Oxybuprocaine is the name of a local anesthetic, which is used especially in ophthalmology and otolaryngology. Oxybuprocaine binds to sodium channels and reversibly stabilizes the neuronal membrane which decreases its permeability to sodium ions.
|
| Dosage Form |
Chlorhexidine¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Aerosol TopicalDressing TopicalGel TopicalKit DentalLiquid BuccalLiquid OralLiquid TopicalLotion TopicalOintment TopicalSolution TopicalSponge Topical
Oxybuprocaine¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Solution Ophthalmic
|
| Drug Category |
Chlorhexidine¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Bacterial AgentsAnti-Infective Agents, LocalAnti-InfectivesDisinfectantsMouthwashes
Oxybuprocaine¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anesthetics, Local
|
| Smiles String Canonical |
Chlorhexidine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ NC(NC1=CC=C(Cl)C=C1)=NC(N)=NCCCCCCN=C(N)N=C(N)NC1=CC=C(Cl)C=C1
Oxybuprocaine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CCCCOC1=C(N)C=CC(=C1)C(=O)OCCN(CC)CC
|
| Smiles String Isomeric |
Chlorhexidine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ N\C(NC1=CC=C(Cl)C=C1)=N/C(N)=N/CCCCCC\N=C(N)\N=C(/N)NC1=CC=C(Cl)C=C1
Oxybuprocaine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CCCCOC1=C(N)C=CC(=C1)C(=O)OCCN(CC)CC
|
| InChI Identifier |
Chlorhexidine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C22H30Cl2N10/c23-15-5-9-17(10-6-15)31-21(27)33-19(25)29-13-3-1-2-4-14-30-20(26)34-22(28)32-18-11-7-16(24)8-12-18/h5-12H,1-4,13-14H2,(H5,25,27,29,31,33)(H5,26,28,30,32,34)/f/h31-32H,25-28H2/b29-19+,30-20+,33-21+,34-22+
Oxybuprocaine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C17H28N2O3/c1-4-7-11-21-16-13-14(8-9-15(16)18)17(20)22-12-10-19(5-2)6-3/h8-9,13H,4-7,10-12,18H2,1-3H3
|
| Chemical IUPAC Name |
Chlorhexidine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (1E)-2-[6-[[amino-[[amino-[(4-chlorophenyl)amino]methylidene]amino]methylidene]amino]hexyl]-1-[amino-[(4-chlorophenyl)amino]methylidene]guanidine
Oxybuprocaine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 2-diethylaminoethyl 4-amino-3-butoxybenzoate
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2024-09-07
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|