| |
|
|
|
|
|
 |
| |
|
모크린액 MOCLEAN SOLN.[Chlorhexidine Gluconate , Oxybuprocaine]
|
|
일반의약품 | 비급여
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
비급여
[상병코드조회]
[질병코드조회]
|
| 빠른조회 |
|
| 제품성상 |
백색 불투명한 알루미늄분무용기에 든 방향성의 냄새를 지닌 무색 또는 미황색의 투명한 액제 [제형정보 확인] |
| 포장·유통단위 |
200ML/BTL
|
| 효능효과 |
[적응증 별 검색]
인후염,치은염, 구내염, 구강점막 및 인후강의 감염
[Drugbank 의 성분정보열람]
[Chlorhexidine][Oxybuprocaine]
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
1일 3-10회 반복분무한다.
|
| 금기 |
- 30개월 미만의 유아
- 클로르헥시딘 제제에 관하여 과민증의 전력이 있는 환자
- 뇌, 척수, 귀(내이, 중이, 외이) :
청각신경 또는 중추신경에 직접 작용할 경우, 난청, 신경장해를 일으킬 수 있음.
- 질, 방광, 구강 등의 점막면
- 눈
|
| 신중투여 |
- 다른 약물에 대하여 과민증이 있는 환자
- 천식 등 알러지 질환이 있거나 그 전력 또는 가족력이 있는 환자
- 분만 직전의 외음부 주위(신생아의 눈 등에 들어갈 우려가 있음)
|
| 이상반응 |
- 쇽 :
드물게 쇽증상이 일어날 수 있으므로 충분히 관찰하고 구역, 불쾌감, 식은땀, 어지러움, 답답함, 호흡곤란, 발작 등의 증상이 나타나는 경우에는 즉시 사용을 중지하고 적절히 처치할 것
과민증 : 때때로 발진, 두드러기 등의 과민증상이 나타날 수 있으므로 그러한 경우에는 사용을 중지할 것.
|
| Related FDA Approved Drug |
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| 항목 |
내용 |
| BIT 약효분류 |
구내염, 구강살균소독제
|
| ATC 코드 |
Antiinfectives and antiseptics for local oral treatment / A01AB
[코드분류상세설명]
[ATC코드예측]
|
| 복지부분류코드 |
132 (이비과용제 )
|
| Drugs By Indication |
[전체보기]
|
| Drugs By Classification |
[전체보기]
|
|
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : C등급
(procaine; )
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
| 병용금기 및 연령대금기 근거조회 |
[병용금기 및 연령대금기 근거조회]
|
| 복약라벨 |
| 이미지 |
복약설명 |
 |
어지러움이 있을수 있습니다. |
|
|
| * |
복약이미지는 모든 복약지도 사항을 표시한것은 아니며, 추가적으로 업데이트되거나 수정될 수 있습니다. |
| * |
복약이미지의 표시여부는 실제 약물복용시 중요도에 따른것은 아니며 단순히 허가정보상 키워드를 기준으로 등록되었습니다. |
| * |
귀하가 복약이미지 정보를 신뢰함은 전적으로 귀하의 책임입니다. 드럭인포는 이에 대한 어떠한 보증도 하지 않습니다. |
|
|
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| Mechanism of Action |
Chlorhexidine에 대한 Mechanism_Of_Action 정보
Chlorhexidine's antimicrobial effects are associated with the attractions between chlorhexidine (cation) and negatively charged bacterial cells. After chlorhexidine is absorpted onto the organism's cell wall, it disrupts the integrity of the cell membrane and causes the leakage of intracellular components of the organisms.
Oxybuprocaine에 대한 Mechanism_Of_Action 정보
Oxybuprocaine binds to sodium channel and reversibly stabilizes the neuronal membrane which decreases its permeability to sodium ions. Depolarization of the neuronal membrane is inhibited thereby blocking the initiation and conduction of nerve impulses.
|
| Pharmacology |
Chlorhexidine에 대한 Pharmacology 정보
Chlorhexidine, a topical antimicrobial agent, is bactericidal. Because of its positive charge, the chlorhexidine molecule reacts with the microbial cell surface to destroy the integrity of the cell membrane. This novel mechanism of action makes it highly unlikely for the development of bacterial resistance.
Oxybuprocaine에 대한 Pharmacology 정보
Oxybuprocaine is a local anaesthetic. It may be less irritating than tetracaine, and the onset and duration of action are similar to tetracaine.
|
| Metabolism |
Chlorhexidine에 대한 Metabolism 정보
# Phase_1_Metabolizing_Enzyme:Not Available
|
| Protein Binding |
Chlorhexidine에 대한 단백결합 정보
87%
Oxybuprocaine에 대한 단백결합 정보
Not Available
|
| Half-life |
Chlorhexidine에 대한 반감기 정보
Not Available
Oxybuprocaine에 대한 반감기 정보
Not Available
|
| Absorption |
Chlorhexidine에 대한 Absorption 정보
Absorption of chlorhexidine from the gastrointestinal tract is very poor. Additionally, an in vivo study in 18 adult patients found no detectable plasma or urine chlorhexidine concentrations following insertion of four periodontal implants under clinical conditions.
Oxybuprocaine에 대한 Absorption 정보
Not Available
|
| Biotransformation |
Oxybuprocaine에 대한 Biotransformation 정보
Not Available
|
| Toxicity |
Chlorhexidine에 대한 Toxicity 정보
LD50= 2g/kg (human, oral); LD50= 3 g/kg (rat, oral); LD50= 2.5 g/kg (mice, oral); LD50= 21 mg/kg (male rat, IV); LD50= 23 mg/kg (female rat, IV); LD50= 25 mg/kg (male mice, IV); LD50= 24 mg/kg (female mice, IV); LD50= 1g/kg (rat, subcutaneous); LD50= 637 mg/kg (male mice, subcutaneous); LD50= 632 mg/kg (female mice, subcutaneous)
Oxybuprocaine에 대한 Toxicity 정보
Not Available
|
| Drug Interactions |
Chlorhexidine에 대한 Drug_Interactions 정보
Not Available
Oxybuprocaine에 대한 Drug_Interactions 정보
Not Available
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Drug Target |
[Drug Target]
|
| Description |
Chlorhexidine에 대한 Description 정보
A disinfectant and topical anti-infective agent used also as mouthwash to prevent oral plaque. [PubChem]
Oxybuprocaine에 대한 Description 정보
Oxybuprocaine is the name of a local anesthetic, which is used especially in ophthalmology and otolaryngology. Oxybuprocaine binds to sodium channels and reversibly stabilizes the neuronal membrane which decreases its permeability to sodium ions.
|
| Dosage Form |
Chlorhexidine에 대한 Dosage_Form 정보
Aerosol TopicalDressing TopicalGel TopicalKit DentalLiquid BuccalLiquid OralLiquid TopicalLotion TopicalOintment TopicalSolution TopicalSponge Topical
Oxybuprocaine에 대한 Dosage_Form 정보
Solution Ophthalmic
|
| Drug Category |
Chlorhexidine에 대한 Drug_Category 정보
Anti-Bacterial AgentsAnti-Infective Agents, LocalAnti-InfectivesDisinfectantsMouthwashes
Oxybuprocaine에 대한 Drug_Category 정보
Anesthetics, Local
|
| Smiles String Canonical |
Chlorhexidine에 대한 Smiles_String_canonical 정보
NC(NC1=CC=C(Cl)C=C1)=NC(N)=NCCCCCCN=C(N)N=C(N)NC1=CC=C(Cl)C=C1
Oxybuprocaine에 대한 Smiles_String_canonical 정보
CCCCOC1=C(N)C=CC(=C1)C(=O)OCCN(CC)CC
|
| Smiles String Isomeric |
Chlorhexidine에 대한 Smiles_String_isomeric 정보
N\C(NC1=CC=C(Cl)C=C1)=N/C(N)=N/CCCCCC\N=C(N)\N=C(/N)NC1=CC=C(Cl)C=C1
Oxybuprocaine에 대한 Smiles_String_isomeric 정보
CCCCOC1=C(N)C=CC(=C1)C(=O)OCCN(CC)CC
|
| InChI Identifier |
Chlorhexidine에 대한 InChI_Identifier 정보
InChI=1/C22H30Cl2N10/c23-15-5-9-17(10-6-15)31-21(27)33-19(25)29-13-3-1-2-4-14-30-20(26)34-22(28)32-18-11-7-16(24)8-12-18/h5-12H,1-4,13-14H2,(H5,25,27,29,31,33)(H5,26,28,30,32,34)/f/h31-32H,25-28H2/b29-19+,30-20+,33-21+,34-22+
Oxybuprocaine에 대한 InChI_Identifier 정보
InChI=1/C17H28N2O3/c1-4-7-11-21-16-13-14(8-9-15(16)18)17(20)22-12-10-19(5-2)6-3/h8-9,13H,4-7,10-12,18H2,1-3H3
|
| Chemical IUPAC Name |
Chlorhexidine에 대한 Chemical_IUPAC_Name 정보
(1E)-2-[6-[[amino-[[amino-[(4-chlorophenyl)amino]methylidene]amino]methylidene]amino]hexyl]-1-[amino-[(4-chlorophenyl)amino]methylidene]guanidine
Oxybuprocaine에 대한 Chemical_IUPAC_Name 정보
2-diethylaminoethyl 4-amino-3-butoxybenzoate
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2024-09-07
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
|
|
|
|
전문/일반
