| |
|
|
|
|
|
 |
| |
|
³ë¸®Å×ÀÌÆ®Å©¸² NORITATE CREAM[Metronidazole]
|
|
ÀϹÝÀǾàǰ | ºñ±Þ¿©
|
|
¼öÀÔÀǾàǰ
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
ºñ±Þ¿©
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»ö-À¯¹é»ö Å©¸²
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
1EA |
| º¸°ü¹æ¹ý |
±â¹Ð¿ë±â, ½Ç¿Âº¸°ü(ÃÖÀû¿Âµµ: 20-25¡É). |
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
ÁÖ»ç
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
ȯºÎ¸¦ ±ú²ýÀÌ ¾Ä°í °ÇÁ¶½ÃŲ ÈÄ 1ÀÏ 1ȸ ȯºÎ¿¡ ¾ã°Ô ¹Ù¸¥´Ù.
[Á¦Çüº°º¹¾àÁöµµ]
|
| ÁÖ¿ä¾à¹° »óÈ£ÀÛ¿ë |
[º¸±â]
|
| ±Ý±â |
º»Á¦ÀÇ ¼ººÐ¿¡ °ú¹ÎÁõÀΠȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
ÀÓ»ó½ÃÇè°á°ú º»Á¦ÀÇ Ä¡·á¿Í °ü·ÃµÈ °ÍÀ¸·Î ÆÇ´ÜµÇ´Â ºÎÀÛ¿ëÀº µµÆ÷ºÎÀ§ÀÇ ¹ÝÀÀ, »óžÇÈ, ¿©µå¸§À̾ú°í, ´ëºÎºÐÀÇ ºÎÀÛ¿ëÀº °æÁõ-Áߵ Á¤µµÀÇ Áõ»óÀ» ³ªÅ¸³½´Ù.
|
| ÀϹÝÀû ÁÖÀÇ |
- ±¹¼Ò ÇǺÎÀÚ±ØÀ¸·Î ÀǽɵǴ ¹ÝÀÀÀÌ ³ªÅ¸³ª¸é º»Á¦ÀÇ »ç¿ëÀ» Áß´ÜÇÑ´Ù.
- ¸ÞÆ®·Î´Ï´ÙÁ¹À» ¾ó±¼¿¡ ±¹¼Ò µµÆ÷ÇÒ ¶§¿¡ °á¸·¿°ÀÌ ³ªÅ¸³ °ÍÀÌ º¸°íµÈ ¹Ù ÀÖÀ¸¹Ç·Î ´«¿¡ Á¢Ã˵ÇÁö ¾Êµµ·Ï ÇÑ´Ù.
- ¸ÞÆ®·Î´Ï´ÙÁ¹Àº ´ÏÆ®·ÎÀ̴̹ÙÁ¹°èÀ̹ǷΠÇ÷¾×ÁúȯÀÌ Àִ ȯÀÚ¿¡°Ô »ç¿ëÇÒ ¶§´Â ÁÖÀÇÇÏ¿© »ç¿ëÇØ¾ß ÇÑ´Ù.
|
| »óÈ£ÀÛ¿ë |
¸ÞÆ®·Î´Ï´ÙÁ¹ °æ±¸Á¦¸¦ º¹¿ëÇÒ ¶§ Äí¸¶¸°, ¿ÍÆÄ¸° µîÀÇ Ç×ÀÀÇ÷ÀÛ¿ëÀ» ÃËÁøÇÑ´Ù´Â º¸°í°¡ ÀÖÀ¸¹Ç·Î, Ç×ÀÀÇ÷Á¦·Î Ä¡·á¸¦ ¹Þ´Â ȯÀÚ¿¡°Ô º»Á¦¸¦ »ç¿ëÇÒ ¶§´Â ÁÖÀÇÇØ¾ß ÇÑ´Ù. ´Ü, º»Á¦´Â ¿Ü¿ëÁ¦·Î½á Èí¼öÀ²ÀÌ ³·À¸¹Ç·Î ¾à¹°»óÈ£ÀÛ¿ëÀÌ ³ªÅ¸³¯ °¡´É¼ºÀº Àû´Ù. |
| ÀӺο¡ ´ëÇÑ Åõ¿© |
[ÀӺαݱ⠼ººÐ Á¶È¸]
º»Á¦¿¡ ´ëÇØ¼ ÀӺθ¦ ´ë»óÀ¸·ÎÇÑ ÀûÀýÇÑ ½ÃÇèÀÌ ½Ç½ÃµÇÁö ¾Ê¾Ò´Ù. ¸ÞÆ®·Î´Ï´ÙÁ¹Àº ŹÝÀ» Åë°úÇÏ¿© žƿ¡°Ô µµ´ÞÇÏÁö¸¸, ·§Æ® ¹× ¸¶¿ì½º¿¡°Ô °¢°¢ ÀÓ»ó¿ë·®ÀÇ 200 ¹× 20¹è¸¦ °æ±¸Åõ¿©ÇßÀ» ¶§ žƵ¶¼ºÀº ³ªÅ¸³ªÁö ¾Ê¾Ò´Ù. ´Ü, µ¿¹°¿¡¼ÀÇ ½ÃÇè°á°ú·Î½á ½ÇÁ¦ »ç¶÷¿¡°Ô »ç¿ëÇÒ ¶§ÀÇ ¹ÝÀÀÀ» Á¤È®È÷ ¿¹ÃøÇÒ ¼ö ÀÖ´Â °ÍÀº ¾Æ´Ï¹Ç·Î, ÀÓ½ÅÁß¿¡´Â ²À ÇÊ¿äÇÑ °æ¿ì¿¡¸¸ »ç¿ëÇÑ´Ù.
|
| ¼öÀ¯ºÎ¿¡ ´ëÇÑ Åõ¿© |
¸ÞÆ®·Î´Ï´ÙÁ¹À» °æ±¸Åõ¿©ÇÒ ¶§ Ç÷Àå¿¡¼ ¹ß°ßµÇ´Â ³óµµ¿Í À¯»çÇÑ ³óµµ¸¦ À¯ÁóÀ¸·Î ºÐºñµÈ´Ù. ¸ÞÆ®·Î´Ï´ÙÁ¹À» ±¹¼Ò µµÆ÷ÇÑ ÈÄÀÇ Ç÷Áß³óµµ°¡ °æ±¸Åõ¿©½Ãº¸´Ù À¯ÀÇÇÏ°Ô ³·Áö¸¸, »ê¸ð¿¡ ´ëÇÑ ¾à¹°ÀÇ Á߿伺 ¹× À¯¾Æ¿¡ ´ëÇÑ À§Ç輺À» °í·ÁÇÏ¿© ¼öÀ¯¸¦ Áß´ÜÇÒ °ÍÀÎÁö ¾à¹°Åõ¿©¸¦ Áß´ÜÇÒ °ÍÀÎÁö¸¦ °áÁ¤ÇØ¾ß ÇÑ´Ù. |
| ¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿© |
¼Ò¾Æ¿¡ ´ëÇÑ ¾ÈÀü¼º ¹× À¯È¿¼ºÀº È®¸³µÇ¾î ÀÖÁö ¾Ê´Ù. |
| Àû¿ë»óÀÇ ÁÖÀÇ |
º»Á¦´Â ¿Ü¿ëÀ¸·Î¸¸ »ç¿ëÇÑ´Ù. |
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
±â¹Ð¿ë±â, ½Ç¿Âº¸°ü(ÃÖÀû¿Âµµ: 20-25¡É). |
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Bµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| Á¦Çüº° º¹¾àÁöµµ |
[Å©¸²] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Metronidazole¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Unionized metronidazole is selective for anaerobic bacteria due to their ability to intracellularly reduce metronidazole to its active form. This reduced metronidazole then disrupts DNA's helical structure, inhibiting bacterial nucleic acid synthesis and resulting in bacterial cell death.
|
| Pharmacology |
Metronidazole¿¡ ´ëÇÑ Pharmacology Á¤º¸ Metronidazole, a synthetic antibacterial and antiprotozoal agent of the nitroimidazole class, is used against protozoa such as Trichomonas vaginalis, amebiasis, and giardiasis. Metronidazole is extremely effective against anaerobic bacterial infections and is also used to treat Crohn's disease, antibiotic-associated diarrhea, and rosacea.
|
| Metabolism |
Metronidazole¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 2C9 (CYP2C9)
|
| Protein Binding |
Metronidazole¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Less than 20%
|
| Half-life |
Metronidazole¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 8 hours
|
| Absorption |
Metronidazole¿¡ ´ëÇÑ Absorption Á¤º¸ Well absorbed
|
| Pharmacokinetics |
MetronidazoleÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö :
- °æ±¸ : Àß Èí¼öµÈ´Ù.
- ¿Ü¿ë : 1 gÀ» ¿Ü¿ëÀ¸·Î Àû¿ëÇßÀ» ¶§ÀÇ Ç÷Áß³óµµ´Â 250 mgÀ» °æ±¸·Î º¹¿ëÇßÀ» ¶§ Ç÷Áß³óµµÀÇ 1/10º¸´Ù ³·´Ù.
- ºÐÆ÷ :
- À¯Áó ºÐºñ
- Ç÷¾×¿¡¼ ³úô¼ö¾×À¸·ÎÀÇ È®»ê : ¿°ÁõÀÇ À¯¹«¿Í ¹«°üÇÏ°Ô ÀûÀýÇÑ ³óµµ¿¡ µµ´Þ (ÀϹÝÀûÀ¸·Î MICs ÀÌ»ó)
- ³úô¼ö¾×´ë Ç÷¾×ÀÇ ³óµµºñ(%) :
- Á¤»ó ³ú¸· : 16-43
- ¿°Áõ¼º ³ú¸· : 100
- ´Ü¹é°áÇÕ : 20% ÀÌÇÏ
- ´ë»ç : 30-60%°¡ °£´ë»ç
- ¹Ý°¨±â :
- ½Å»ý¾Æ : 25-75 ½Ã°£
- ¼Ò¾Æ ¹× ¼ºÀÎ : 6-8 ½Ã°£, °£Áúȯ½Ã ¹Ý°¨±â Áõ°¡
- ¸»±â ½ÅÁúȯ : 21 ½Ã°£
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : 1-2 ½Ã°£ À̳»
- ¼Ò½Ç : ½Å¹è¼³ (20%´Â ¹Ì´ë»çü·Î) µÇ°Å³ª º¯¹è¼³ (6-15%)
|
| Biotransformation |
Metronidazole¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic
|
| Toxicity |
Metronidazole¿¡ ´ëÇÑ Toxicity Á¤º¸ Convulsive seizures and peripheral neuropathy, the latter characterized mainly by numbness or paresthesia of an extremity, LD50=500 mg/kg/day (orally in rat)
|
| Drug Interactions |
Metronidazole¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Amobarbital The barbiturate decreases the effect of metronidazoleAprobarbital The barbiturate decreases the effect of metronidazoleButabarbital The barbiturate decreases the effect of metronidazoleButalbital The barbiturate decreases the effect of metronidazoleButethal The barbiturate decreases the effect of metronidazoleBusulfan Metronidazole increases the effect/toxicity of busulfanCarbamazepine Metronidazole increases the effect of carbamazepineDihydroquinidine barbiturate The barbiturate decreases the effect of metronidazoleHeptabarbital The barbiturate decreases the effect of metronidazoleHexobarbital The barbiturate decreases the effect of metronidazoleMethohexital The barbiturate decreases the effect of metronidazoleMethylphenobarbital The barbiturate decreases the effect of metronidazolePentobarbital The barbiturate decreases the effect of metronidazolePhenobarbital The barbiturate decreases the effect of metronidazolePrimidone The barbiturate decreases the effect of metronidazoleQuinidine barbiturate The barbiturate decreases the effect of metronidazoleSecobarbital The barbiturate decreases the effect of metronidazoleTalbutal The barbiturate decreases the effect of metronidazoleTacrolimus Metronidazole increases the levels/toxicity of tacrolimusLithium Metronidazole increases the effect and toxicity of lithiumDisulfiram Possible acute psychosis and confusionFluorouracil Risk of 5-FU toxicity when associated with metronidazoleAmprenavir Increased risk of side effects (oral solution)Anisindione Metronidazole increases the anticoagulant effectWarfarin Metronidazole increases the anticoagulant effectAcenocoumarol Metronidazole increases the anticoagulant effectDicumarol Metronidazole increases the anticoagulant effect
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Metronidazole¿¡ ´ëÇÑ Food Interaction Á¤º¸ Avoid alcohol.Take with food to reduce irritation.
|
| Drug Target |
[Drug Target]
|
| Description |
Metronidazole¿¡ ´ëÇÑ Description Á¤º¸ A nitroimidazole used to treat amebiasis; vaginitis; trichomonas infections; giardiasis; anaerobic bacteria; and treponemal infections. It has also been proposed as a radiation sensitizer for hypoxic cells. According to the Fourth Annual Report on Carcinogens (NTP 85-002, 1985, p133), this substance may reasonably be anticipated to be a carcinogen (Merck, 11th ed).
|
| Dosage Form |
Metronidazole¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Capsule OralCream IntravaginalCream TopicalGel IntravaginalGel TopicalLiquid IntravenousLotion TopicalSolution IntravenousTablet OralTablet, extended release Oral
|
| Drug Category |
Metronidazole¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Infective AgentsAnti-InfectivesAntiprotozoal AgentsAntiprotozoalsRadiation-Sensitizing Agents
|
| Smiles String Canonical |
Metronidazole¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC1=NC=C(N1CCO)[N+]([O-])=O
|
| Smiles String Isomeric |
Metronidazole¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CC1=NC=C(N1CCO)[N+]([O-])=O
|
| InChI Identifier |
Metronidazole¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C6H9N3O3/c1-5-7-4-6(9(11)12)8(5)2-3-10/h4,10H,2-3H2,1H3
|
| Chemical IUPAC Name |
Metronidazole¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 2-(2-methyl-5-nitroimidazol-1-yl)ethanol
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2022-07-05
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|