| |
|
|
|
|
|
 |
| |
|
노리테이트크림 NORITATE CREAM[Metronidazole]
|
|
일반의약품 | 비급여
|
|
수입의약품
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
비급여
[상병코드조회]
[질병코드조회]
|
| 빠른조회 |
|
| 제품성상 |
백색-유백색 크림 [제형정보 확인] |
| 포장·유통단위 |
1EA |
| 효능효과 |
[적응증 별 검색]
주사
|
| 약물음식간 상호작용 |
[조회]
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
환부를 깨끗이 씻고 건조시킨 후 1일 1회 환부에 얇게 바른다.
[제형별복약지도]
|
| 주요약물 상호작용 |
[조회]
|
| 금기 |
본제의 성분에 과민증인 환자 |
| 이상반응 |
임상시험결과 본제의 치료와 관련된 것으로 판단되는 부작용은 도포부위의 반응, 상태악화, 여드름이었고, 대부분의 부작용은 경증-중등도 정도의 증상을 나타낸다.
|
| 상호작용 |
메트로니다졸 경구제를 복용할 때 쿠마린, 와파린 등의 항응혈작용을 촉진한다는 보고가 있으므로, 항응혈제로 치료를 받는 환자에게 본제를 사용할 때는 주의해야 한다. 단, 본제는 외용제로써 흡수율이 낮으므로 약물상호작용이 나타날 가능성은 적다. |
| Related FDA Approved Drug |
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| 항목 |
내용 |
| BIT 약효분류 |
외용 항진균제 (Antifungals : Skin & Mucous Membrane)
|
| ATC 코드 |
Metronidazole / D06BX01
[코드분류상세설명]
[ATC코드예측]
|
| 복지부분류코드 |
269 (기타의 외피용약 )
|
| Drugs By Indication |
[전체보기]
|
| Drugs By Classification |
[전체보기]
|
|
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : B등급
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
신장애, 간장애시
용량조절 |
유료정보입니다.
|
| Pharmacokinetics |
유료정보입니다.
|
| 병용금기 및 연령대금기 근거조회 |
[병용금기 및 연령대금기 근거조회]
|
| 제형별 복약지도 |
[크림] |
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| Mechanism of Action |
Metronidazole에 대한 Mechanism_Of_Action 정보
Unionized metronidazole is selective for anaerobic bacteria due to their ability to intracellularly reduce metronidazole to its active form. This reduced metronidazole then disrupts DNA's helical structure, inhibiting bacterial nucleic acid synthesis and resulting in bacterial cell death.
|
| Pharmacology |
Metronidazole에 대한 Pharmacology 정보
Metronidazole, a synthetic antibacterial and antiprotozoal agent of the nitroimidazole class, is used against protozoa such as Trichomonas vaginalis, amebiasis, and giardiasis. Metronidazole is extremely effective against anaerobic bacterial infections and is also used to treat Crohn's disease, antibiotic-associated diarrhea, and rosacea.
|
| Metabolism |
Metronidazole에 대한 Metabolism 정보
# Phase_1_Metabolizing_Enzyme:Cytochrome P450 2C9 (CYP2C9)
|
| Protein Binding |
Metronidazole에 대한 단백결합 정보
Less than 20%
|
| Half-life |
Metronidazole에 대한 반감기 정보
8 hours
|
| Absorption |
Metronidazole에 대한 Absorption 정보
Well absorbed
|
| Pharmacokinetics |
Metronidazole의 약물동력학자료
- 흡수 :
- 경구 : 잘 흡수된다.
- 외용 : 1 g을 외용으로 적용했을 때의 혈중농도는 250 mg을 경구로 복용했을 때 혈중농도의 1/10보다 낮다.
- 분포 :
- 유즙 분비
- 혈액에서 뇌척수액으로의 확산 : 염증의 유무와 무관하게 적절한 농도에 도달 (일반적으로 MICs 이상)
- 뇌척수액대 혈액의 농도비(%) :
- 정상 뇌막 : 16-43
- 염증성 뇌막 : 100
- 단백결합 : 20% 이하
- 대사 : 30-60%가 간대사
- 반감기 :
- 신생아 : 25-75 시간
- 소아 및 성인 : 6-8 시간, 간질환시 반감기 증가
- 말기 신질환 : 21 시간
- 혈중최고농도 도달시간 : 1-2 시간 이내
- 소실 : 신배설 (20%는 미대사체로) 되거나 변배설 (6-15%)
|
| Biotransformation |
Metronidazole에 대한 Biotransformation 정보
Hepatic
|
| Toxicity |
Metronidazole에 대한 Toxicity 정보
Convulsive seizures and peripheral neuropathy, the latter characterized mainly by numbness or paresthesia of an extremity, LD50=500 mg/kg/day (orally in rat)
|
| Drug Interactions |
Metronidazole에 대한 Drug_Interactions 정보
Amobarbital The barbiturate decreases the effect of metronidazoleAprobarbital The barbiturate decreases the effect of metronidazoleButabarbital The barbiturate decreases the effect of metronidazoleButalbital The barbiturate decreases the effect of metronidazoleButethal The barbiturate decreases the effect of metronidazoleBusulfan Metronidazole increases the effect/toxicity of busulfanCarbamazepine Metronidazole increases the effect of carbamazepineDihydroquinidine barbiturate The barbiturate decreases the effect of metronidazoleHeptabarbital The barbiturate decreases the effect of metronidazoleHexobarbital The barbiturate decreases the effect of metronidazoleMethohexital The barbiturate decreases the effect of metronidazoleMethylphenobarbital The barbiturate decreases the effect of metronidazolePentobarbital The barbiturate decreases the effect of metronidazolePhenobarbital The barbiturate decreases the effect of metronidazolePrimidone The barbiturate decreases the effect of metronidazoleQuinidine barbiturate The barbiturate decreases the effect of metronidazoleSecobarbital The barbiturate decreases the effect of metronidazoleTalbutal The barbiturate decreases the effect of metronidazoleTacrolimus Metronidazole increases the levels/toxicity of tacrolimusLithium Metronidazole increases the effect and toxicity of lithiumDisulfiram Possible acute psychosis and confusionFluorouracil Risk of 5-FU toxicity when associated with metronidazoleAmprenavir Increased risk of side effects (oral solution)Anisindione Metronidazole increases the anticoagulant effectWarfarin Metronidazole increases the anticoagulant effectAcenocoumarol Metronidazole increases the anticoagulant effectDicumarol Metronidazole increases the anticoagulant effect
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Food Interaction |
Metronidazole에 대한 Food Interaction 정보
Avoid alcohol.Take with food to reduce irritation.
|
| Drug Target |
[Drug Target]
|
| Description |
Metronidazole에 대한 Description 정보
A nitroimidazole used to treat amebiasis; vaginitis; trichomonas infections; giardiasis; anaerobic bacteria; and treponemal infections. It has also been proposed as a radiation sensitizer for hypoxic cells. According to the Fourth Annual Report on Carcinogens (NTP 85-002, 1985, p133), this substance may reasonably be anticipated to be a carcinogen (Merck, 11th ed).
|
| Dosage Form |
Metronidazole에 대한 Dosage_Form 정보
Capsule OralCream IntravaginalCream TopicalGel IntravaginalGel TopicalLiquid IntravenousLotion TopicalSolution IntravenousTablet OralTablet, extended release Oral
|
| Drug Category |
Metronidazole에 대한 Drug_Category 정보
Anti-Infective AgentsAnti-InfectivesAntiprotozoal AgentsAntiprotozoalsRadiation-Sensitizing Agents
|
| Smiles String Canonical |
Metronidazole에 대한 Smiles_String_canonical 정보
CC1=NC=C(N1CCO)[N+]([O-])=O
|
| Smiles String Isomeric |
Metronidazole에 대한 Smiles_String_isomeric 정보
CC1=NC=C(N1CCO)[N+]([O-])=O
|
| InChI Identifier |
Metronidazole에 대한 InChI_Identifier 정보
InChI=1/C6H9N3O3/c1-5-7-4-6(9(11)12)8(5)2-3-10/h4,10H,2-3H2,1H3
|
| Chemical IUPAC Name |
Metronidazole에 대한 Chemical_IUPAC_Name 정보
2-(2-methyl-5-nitroimidazol-1-yl)ethanol
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2022-07-05
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
|
|
|
|
전문/일반
