| |
|
|
|
|
|
 |
| |
|
¼ÁÅä½ÃÇÁ·ÎÁ¡À̾×0.2% 0.5mL SEPTOCIPRO EAR DROPS 0.2%
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
¼öÀÔÀǾàǰ
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
651300441
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/0.5mL/º´(2016.12.01)(ÇöÀç¾à°¡)
\469 ¿ø/0.5mL/º´(2016.01.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
1ȸ¿ë ¹ÝÅõ¸í ÇÃ¶ó½ºÆ½ ¿ë±â¿¡ µç ½Å ³¿»õ°¡ ¾à°£ ³ª´Â ¾àÇÑ Á¡¼ºÀ» ¶ì´Â ¹«»ö Åõ¸íÇÑ Á¡ÀÌÁ¦
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
0.5ml/tube x 20°³ |
| ÁÖ¼ººÐÄÚµå |
134130CLQ
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| ´ëÇ¥ÄÚµå |
8806513004403 |
| º¸°ü¹æ¹ý |
±â¹Ð¿ë±â, ½Ç¿Â(1-30¡É) º¸°ü |
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
Pseudomonas aeruginosa, Staphylococcus aureus, Proteus mirabilis µî¿¡ ÀÇÇÑ ±Þ¼º ¿ÜÀ̵µ¿°ÀÇ Ä¡·á
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
[ÁÖ¼ººÐÄÚµå:134107CLQ ¿¡ µû¸¥ ½É»çÁöħ¿¶÷]
[Á¦Çüº°º¹¾àÁöµµ]
|
| ÁÖ¿ä¾à¹° »óÈ£ÀÛ¿ë |
[º¸±â]
|
| ±Ý±â |
1) ÀÌ ¾à ¶Ç´Â ±âŸ Äû³î·Ð°è Ç×±ÕÁ¦¿¡ °ú¹ÎÁõÀÇ º´·ÂÀÌ ÀÖ´Â »ç¶÷
2) °í¸· õ°øÀÌ Àִ ȯÀÚ
3) ¼öµÎ³ª ´Ü¼ø Æ÷Áø °¨¿°Áõ µî ¿ÜÀ̵µÀÇ ¹ÙÀÌ·¯½º °¨¿°ÁõÀÌ Àִ ȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
1) µÎÅë, ¼Ò¾ç°¨, Â´Â µíÇÑ ÅëÁõ, µ¿Åë, Çö±âÁõ ¹× ¾àÀÌ ÀÔÀ¸·Î ³Ñ¾î°¡´Â Çö»ó µîÀÌ 0.1~ 1 %ÀÇ ºóµµ·Î º¸°íµÇ¾ú´Ù.
2) °ú¹Î¼ºÀÎ »ç¶÷¿¡¼ ±¹¼Ò ¾Ë·¯Áö ¹ÝÀÀÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| ÀϹÝÀû ÁÖÀÇ |
1) ÇǺΠ¹ßÁøÀ̳ª ¾Ë·¯Áö ¹ÝÀÀ µîÀÌ ³ªÅ¸³¯ °æ¿ì Áï½Ã »ç¿ëÀ» ÁßÁöÇϰí ÀÇ»ç¿Í »ó´ãÇÑ´Ù.
2) °¨¿°±â°£À» ¿¬Àå½Ãų ¼ö ÀÖÀ¸¹Ç·Î, Á¦Ç°À» »ç¿ëÇÑ ÈÄ Å»Áö¸éÀ̳ª ±×¿Í À¯»çÇÑ ¹°Áú·Î ±Í¸¦ ¸·¾Æ³õ¾Æ¼´Â ¾ÈµÈ´Ù. ¸î¸î ¿¹¿¡¼ ±Í¿¡ ĵð´Ù ¾ËºñĽºÀÇ Áߺ¹°¨¿°ÀÌ °üÂûµÇ¾ú´Ù.
3) ´Ù¸¥ Ç×±ÕÁ¦¿Í ¸¶Âù°¡Áö·Î ÀÌ ¾àÀ» »ç¿ëÇÔÀ¸·Î½á Áø±Õ µî°ú °°Àº ºñ°¨¼ö¼º±ÕÀÌ °úµµÇÏ°Ô ¼ºÀåÇÒ ¼ö ÀÖ´Ù. 1ÁÖÀÏÀ» Ä¡·áÇÏ¿©µµ °¨¿°ÁõÀÇ °³¼±ÀÌ ¾øÀ» ¶§¿¡´Â ±ÕÀ» ¹è¾çÇÏ¿© ´õ ³ªÀº Ä¡·á¸¦ ÇÒ ¼ö ÀÖµµ·Ï ÇÏ¿©¾ß ÇÑ´Ù. |
| »óÈ£ÀÛ¿ë |
1) ÀÌ ¾àÀÇ »ç¿ë¿¡ ÀÖ¾î¼ Æ¯Á¤ÇÑ ¾à¹°ÀÇ »óÈ£ÀÛ¿ëÀº ¿¬±¸µÇÁö ¾Ê¾Ò´Ù.
2) Ÿ Á¡ÀÌ¿ë ÀǾàǰ°úÀÇ µ¿½Ã »ç¿ëÀº ÇÇÇϵµ·Ï ÇÑ´Ù.
|
| ÀӺο¡ ´ëÇÑ Åõ¿© |
[ÀӺαݱ⠼ººÐ Á¶È¸]
1) ´Ù¸¥ Äû³î·Ð°è Ç×»ýÁ¦¿Í ¸¶Âù°¡Áö·Î ½ÃÇÁ·ÎÇ÷ϻç½ÅÀ» Àü½ÅÀûÀ¸·Î Åõ¿©ÇÏ¿´À» ¶§ ¹Ì¼º¼÷ µ¿¹°¿¡ °üÀýº´ÁõÀ» À¯¹ßÇÏ´Â °ÍÀÌ ¾Ë·ÁÁ® ÀÖÀ¸¸ç, ¸ðÀ¯ ÁßÀ¸·Î ÀÌÇàÇÏ´Â °ÍÀÌ °üÂûµÇ¾ú´Ù. ÀÌ ¾àÀ» ±Í¿¡ ±¹¼Ò Àû¿ëÇÏ¿´À» ¶§ ¸ðÀ¯ ÁßÀ¸·Î ÀÌÇàµÉ Á¤µµ·Î ÃæºÐÇÑ Àü½ÅÀû Èí¼ö°¡ µÇ´ÂÁö¿¡ ´ëÇØ¼´Â ¾Ë·ÁÁ® ÀÖÁö ¾Ê´Ù. ¼öÀ¯¸¦ ¹Þ´Â À¯¾Æ¿¡°Ô ÁßÁõÀÇ ºÎÀÛ¿ëÀÌ »ý±æ ¼öµµ Àֱ⠶§¹®¿¡ ÀÌ ¾àÀÇ À¯Àͼº°ú À§Ç輺¿¡ ´ëÇÏ¿© ½ÅÁßÇÏ°Ô Æò°¡ÇÑ ÈÄ ¼öÀ¯¸¦ Áß´ÜÇÒ °ÍÀÎÁö Åõ¾àÀ» Áß´ÜÇÒ °ÍÀÎÁö¸¦ °áÁ¤ÇÏ¿©¾ß ÇÑ´Ù.
2) ÀÌ ¾àÀº ÀÓ½ÅÁßÀÇ Åõ¿©¿¡ ´ëÇÑ ¾ÈÀü¼ºÀÌ È®¸³µÇ¾îÀÖÁö ¾ÊÀ¸¹Ç·Î ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀο¡´Â Ä¡·á»óÀÇ À¯ÀͼºÀÌ À§Ç輺À» »óȸÇÑ´Ù°í ÆÇ´ÜµÇ´Â °æ¿ì¿¡¸¸ Åõ¿©ÇÑ´Ù
|
| ¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿© |
2 ¼¼ ÀÌÇÏÀÇ ¼Ò¾ÆÈ¯ÀÚ¿¡ ´ëÇÑ ¾ÈÀü¼º¡¤À¯È¿¼ºÀÌ È®¸³µÇ¾î ÀÖÁö ¾Ê´Ù. |
| Àû¿ë»óÀÇ ÁÖÀÇ |
1) Á¡¾È¿ëÀ̳ª ÁÖ»ç¿ëÀ¸·Î »ç¿ëÇÏÁö ¸» °Í
2) »ç¿ë½Ã ¾à¾×ÀÇ ¿Âµµ°¡ ³·À¸¸é ¾îÁö·¯¿òÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î À̸¦ ÇÇÇϱâ À§ÇÏ¿© ¿ë±â¸¦ 1~2 ºÐ Á¤µµ ¼ÕÀ¸·Î Àâ¾Æ µû¶æÇÏ°Ô ÇÑ ÈÄ Åõ¿©Çϸç, »ç¿ëÀü Àß Èçµé¾î¼ »ç¿ëÇÑ´Ù.
3) Ä¡·á°¡ ³¡³ª°í »ç¿ëÇÏ°í ³²Àº ¾×Àº ¹ö¸°´Ù. |
| °ú·®Åõ¿© ¹× óġ |
0.5 mLÀÇ 1ȸ¿ë ¿ë±â¿¡ µç Á¦Á¦ Ư¼º°ú ±Í¿¡ Àû¿ëÇÏ´Â Åõ¿©°æ·Î¸¦ °í·ÁÇØº¼ ¶§ °ú·®Åõ¿©ÀÇ °¡´É¼ºÀº °ÅÀÇ ¾øÀ¸³ª, °ú·®Åõ¿©³ª »ç°í·Î À߸ø ¸¶½Å °æ¿ì¿¡´Â ÀûÀýÇÑ ÀÓ»óÁ¶Ä¡¸¦ ÃëÇÑ´Ù. |
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
1) ¾î¸°ÀÌÀÇ ¼ÕÀÌ ´êÁö ¾Ê´Â °÷¿¡ º¸°üÇÑ´Ù.
2) ´Ù¸¥ ¿ë±â¿¡ ¹Ù²Ù¾î ³Ö´Â °ÍÀº »ç°í¿øÀÎÀÌ µÇ°Å³ª ǰÁúÀ¯Áö¸é¿¡¼ ¹Ù¶÷Á÷ÇÏÁö ¾ÊÀ¸¹Ç·Î À̸¦ ÁÖÀÇÇÑ´Ù.
3) Á÷»ç±¤¼±À» ÇÇÇÏ°í µÇµµ·Ï ½À±â°¡ ÀûÀº ¼´ÃÇÑ °÷¿¡ º¸°üÇÑ´Ù. |
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| Á¦Çüº° º¹¾àÁöµµ |
[Á¡ÀÌ] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Ciprofloxacin¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ The bactericidal action of ciprofloxacin results from inhibition of the enzymes topoisomerase II (DNA gyrase) and topoisomerase IV, which are required for bacterial DNA replication, transcription, repair, and recombination.
|
| Pharmacology |
Ciprofloxacin¿¡ ´ëÇÑ Pharmacology Á¤º¸ Ciprofloxacin is a broad-spectrum antiinfective agent of the fluoroquinolone class. Ciprofloxacin has in vitro activity against a wide range of gram-negative and gram-positive microorganisms. The mechanism of action of quinolones, including ciprofloxacin, is different from that of other antimicrobial agents such as beta-lactams, macrolides, tetracyclines, or aminoglycosides; therefore, organisms resistant to these drugs may be susceptible to ciprofloxacin. There is no known cross-resistance between ciprofloxacin and other classes of antimicrobials. Notably the drug has 100 times higher affinity for bacterial DNA gyrase than for mammalian.
|
| Absorption |
Ciprofloxacin¿¡ ´ëÇÑ Absorption Á¤º¸ Rapidly and well absorbed from the gastrointestinal tract after oral administration. The absolute bioavailability is approximately 70% with no substantial loss by first pass metabolism.
|
| Pharmacokinetics |
Ciprofloxacin HClÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : °æ±¸ : À§Àå°ü¿¡¼ ºü¸£°Ô Èí¼öµÈ´Ù.
- »ýü³»ÀÌ¿ë·ü : 50-80%
- ºÐÆ÷ : ÅÂ¹Ý Åë°ú, À¯Áó ºÐºñ, ü³»¿¡ ³Î¸® ºÐÆ÷
- ÈçÈ÷ Á¶Á÷³óµµ°¡ Ç÷Á߳󵵺¸´Ù ³ô´Ù.
- ½ÅÀå, ¹æ±¤, °£, Æó, ºÎÀΰúÀû Á¶Á÷, Àü¸³¼±¿¡ ³ôÀº ³óµµ·Î ºÐÆ÷ÇÑ´Ù.
- ³úô¼ö¾× ´ë Ç÷¾×ÀÇ ³óµµºñ (%)
- Á¤»ó ³ú¸· : 10
- ¿°Áõ¼º ³ú¸· : 14-37
- ´Ü¹é°áÇÕ : 16-43%
- ´ë»ç : ºÎºÐÀûÀ¸·Î °£´ë»ç
- ¹Ý°¨±â :
- ¼Ò¾Æ : 2.5½Ã°£
- Á¤»ó ½Å±â´ÉÀÇ ¼ºÀÎ : 3-5 ½Ã°£
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : °æ±¸ : 0.5-2 ½Ã°£
- ¼Ò½Ç : 30-50%°¡ ¹Ìº¯Èü·Î ½Å¹è¼³, 20-40%°¡ ´ãÁóÀ» ÅëÇØ º¯¹è¼³
|
| Toxicity |
Ciprofloxacin¿¡ ´ëÇÑ Toxicity Á¤º¸ The major adverse effect seen with use of is gastrointestinal irritation, common with many antibiotics.
|
| Drug Interactions |
Ciprofloxacin¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Aluminium Formation of non-absorbable complexesMethotrexate Increases methotrexate toxicity Aminophylline The quinolone increases the effect of theophyllineAnisindione The quinolone increases the anticoagulant effectBismuth Formation of non-absorbable complexesCaffeine The quinolone increases the effect and toxicity of caffeineCalcium Formation of non-absorbable complexesClozapine Ciprofloxacin may increase clozapine serum levelsCyclosporine The quinolone increases the effect and toxicity of cyclosporineDicumarol The quinolone increases the anticoagulant effectDihydroxyaluminium Formation of non-absorbable complexesDyphylline The quinolone increases the effect of theophyllineDuloxetine Increases the effect/toxicity of duloxetineDyphylline The quinolone increases the effect of theophyllineEthotoin Decreases the hydantoin effectFoscarnet Increased risk of convulsionsFosphenytoin Decreases the hydantoin effectMagnesium oxide Formation of non-absorbable complexesMagnesium Formation of non-absorbable complexesMephenytoin Decreases the hydantoin effectAcenocoumarol The quinolone increases the anticoagulant effectOxtriphylline The quinolone increases the effect of theophyllinePhenytoin Decreases the hydantoin effectProcainamide The quinolone increases the effect of procainamideRasagiline Increases effect/toxicity of rasagilineRopinirole The quinolone increases the effect and toxicity of ropiniroleSevelamer Sevelamer decreases ciprofloxacin bioavailabilitySildenafil The quinolone increases sildenafil levelsSucralfate Formation of non-absorbable complexesTheophylline The quinolone increases the effect of theophyllineTizanidine Increases the effect/toxicity of tizanidineWarfarin The quinolone increases the anticoagulant effectIron Formation of non-absorbable complexesZinc Formation of non-absorbable complexes
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Ciprofloxacin¿¡ ´ëÇÑ Description Á¤º¸ A broad-spectrum antimicrobial carboxyfluoroquinoline. [PubChem]
|
| Dosage Form |
Ciprofloxacin¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Ointment OphthalmicSolution IntravenousSolution OphthalmicSuspension OralTablet OralTablet, extended release Oral
|
| Drug Category |
Ciprofloxacin¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Infective AgentsAnti-InfectivesNucleic Acid Synthesis InhibitorsQuinolones
|
| Smiles String Canonical |
Ciprofloxacin¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ OC(=O)C1=CN(C2CC2)C2=CC(N3CCNCC3)=C(F)C=C2C1=O
|
| Smiles String Isomeric |
Ciprofloxacin¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ OC(=O)C1=CN(C2CC2)C2=CC(N3CCNCC3)=C(F)C=C2C1=O
|
| InChI Identifier |
Ciprofloxacin¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C17H18FN3O3/c18-13-7-11-14(8-15(13)20-5-3-19-4-6-20)21(10-1-2-10)9-12(16(11)22)17(23)24/h7-10,19H,1-6H2,(H,23,24)/f/h23H
|
| Chemical IUPAC Name |
Ciprofloxacin¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid
|
| Drug-Induced Toxicity Related Proteins |
CIPROFLOXACIN ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Alanine aminotransferase Drug:ciprofloxacin Toxicity:Fulminant hepatic failure. [¹Ù·Î°¡±â] Replated Protein:Alanine aminotransferase Drug:ciprofloxacin Toxicity:significant haematological or biochemical toxicity. [¹Ù·Î°¡±â] Replated Protein:Aspartate aminotransferase Drug:ciprofloxacin Toxicity:Fulminant hepatic failure. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2023-12-02
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|