| |
|
|
|
|
|
 |
| |
|
알레기살점안액(페미로라스트칼륨) 5mL ALEGYSAL EYE.[Pemirolast potassium]
|
|
전문의약품 | 삭제 | 신약
|
|
수입의약품
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
650100681
[보험코드에 따른 약품기본정보 직접조회]
\0 원/5mL/병(2020.10.01)(현재약가)
\5,346 원/5mL/병(2018.06.01)(변경전약가)
[상병코드조회]
[질병코드집 다운로드]
[우리집건강주치의 바로가기]
|
| 빠른조회 |
|
| 제품성상 |
투명성이 있는 플라스틱용기에 무색투명한 액이 든 점안제
[제형정보 확인]
|
| 포장·유통단위 |
5ml*1,10/BTL
|
| 주성분코드 |
209630COS
[동일한 주성분코드를 가진 오리지날 또는 제네릭 의약품 조회]
|
| 대표코드 |
8806501006808 |
| 보관방법 |
실온보관, 기밀용기 |
| 약리작용 |
[조회]
|
| 효능효과 |
[적응증 별 검색]
알레르기결막염, 봄철 각막염이나 결막염
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
1회 1방울 1일 2회(아침, 저녁) 점안한다.
|
| 주요약물 상호작용 |
[보기]
|
| 금기 |
이 약의 구성성분에 과민반응의 병력이 있는 환자
|
| 이상반응 |
1) 과민반응 : 때때로 안검염, 드물게 안검피부염 등. 이와 같은 증상이 나타나는 경우에는 투여를 중지한다.
2) 눈 : 때때로 결막충혈, 자극감, 눈곱, 가려움, 작열감, 안구건조증, 불편감, 이물감 드물게 결막염 등. 이와같은 증상이 나타나는 경우에는 투여를 중지한다.
3) 기타 : 때때로 알레르기, 등통증, 기관지염, 기침, 월경통, 발열, 부비동염, 재채기, 코막힘
4) 첨가제 : 이 약은 인산염을 포함하고 있다.
상당한 각막 손상이 있는 일부 환자에서 인산염 함유 점안액의 사용과 연관되어 각막 석회화의 사례가 매우 드물게(0.01% 미만) 보고된 바 있다.
|
| 임부에 대한 투여 |
[임부금기 성분 조회]
임신중의 투여에 대한 안전성은 확립되어 있지 않으므로 임부 또는 임신하고 있을 가능성이 있는 여성에게는 치료상의 유익성이 위험성을 상회한다고 판단되는 경우에만 투여한다.
|
| 수유부에 대한 투여 |
이 약이 사람의 모유로 이행되는지는 알려지지 않으나 랫트에서 유즙으로의 이행이 보고되었고 많은 약물이 모유로 이행되기 때문에 수유부에게는 신중하게 투여한다.
|
| 소아에 대한 투여 |
소아에 대한 투여
미숙아, 신생아, 유아에 대한 안전성은 확립되어 있지 않다(사용경험이 없다.).
|
| 적용상의 주의 |
1) 이 약은 점안용으로만 사용한다.
2) 점안 시 액이 안검피부 등에 닿은 경우, 즉시 씻어낸다.
3) 용기의 끝이 눈꺼풀 및 속눈썹에 닿으면 눈곱이나 진균 등에 의해 약액이 오염 또는 혼탁될 수 있으므로 주의한다. 또한 혼탁된 것은 사용하지 않는다.
4) 이 약에 보존제로 함유된 벤잘코늄염화물이 렌즈에 흡착될 수 있으므로 소프트 렌즈를 착용한 상태에서는 사용하지 않아야 하며, 이 약의 투여 후 적어도 15분이 경과한 후 렌즈를 착용해야 한다(벤잘코늄염화물 함유제제에 한함.).
5) 오염을 방지하기 위해 될 수 있는 한 공동으로 사용하지 않는다.
|
| 보관 및 취급상의 주의 |
1) 어린이의 손이 닿지 않는 곳에 보관한다.
2) 직사일광을 피하고 되도록 서늘한 곳에 밀전하여 보관한다.
3) 오용을 막고 품질의 보존을 위하여 다른 용기에 바꾸어 넣지 않는다.
|
| 기타 |
동물을 이용한 생식독성 시험 : 랫트의 생식능력 및 임신초기 생식 독성 시험에서 400 mg/kg/day 투여 시 모체독성(체중증가의 유의적인 억제와 사료섭취량의 감소)과 착상수 및 생존태자수의 유의적인 감소가 관찰되었다. 랫트의 기형발생 시험에서는 250 및 400 mg/kg/day 투여 시 모체독성(체중증가 억제 및 사료섭취량 감소)과 생존 태자의 체중감소 및 골격변이의 유의적인 발현 등이 관찰되었다. 토끼의 기형발생 시험에서는 150 mg/kg/day 투여 시 모체독성(체중증가 억제 및 사료섭취량 감소)은 관찰되었으나 태자에의 영향은 인정되지 않았다.
랫트의 주산․수유기 시험에서는 250 및 400 mg/kg/day 투여 시 모체독성(체중증가 억제 및 사료섭취량 감소)과 출생자의 신체발달 지연경향이 나타났다.
|
| Related FDA Approved Drug |
기준 성분: PEMIROLAST POTASSIUMALAMAST (PEMIROLAST POTASSIUM)
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| |
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 축약복약지도 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : C등급
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
| 제형별 복약지도 |
[점안액] |
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| 독성정보 |
Potassium에 대한 독성정보 : 정보보기
출처: 국립독성과학원 독성물질정보DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Pemirolast에 대한 Mechanism_Of_Action 정보
Pemirolast binds to the histamine H1 receptor. This blocks the action of endogenous histamine, which subsequently leads to temporary relief of the negative symptoms brought on by histamine. Pemirolast has also been observed to block antigen-stimulated calcium ion influx into mast cells. Pemirolast inhibits the chemotaxis of eosinophils into ocular tissue, and prevents inflammatory mediator release from human eosinophils.
potassium에 대한 Mechanism_Of_Action 정보
Potassium is the major cation (positive ion) inside animal cells, while sodium is the major cation outside animal cells. The concentration differences of these charged particles causes a difference in electric potential between the inside and outside of cells, known as the membrane potential. The balance between potassium and sodium is maintained by ion pumps in the cell membrane. The cell membrane potential created by potassium and sodium ions allows the cell generate an action potential?봞 "spike" of electrical discharge. The ability of cells to produce electrical discharge is critical for body functions such as neurotransmission, muscle contraction, and heart function. Potassium is also an essential mineral needed to regulate water balance, blood pressure and levels of acidity.
|
| Pharmacology |
Pemirolast에 대한 Pharmacology 정보
Pemirolast is used for the prophylactic treatment of itching of the eye associated with allergic conjunctivitis. Pemirolast potassium is a mast cell stabilizer that inhibits the in vivo Type I immediate hypersensitivity reaction. Pemirolast inhibits the antigen-induced release of inflammatory mediators (e.g., histamine, leukotriene C4, D4, E4) from human mast cells. Allergic reactions lead to cell-degranulation and the release of histamine (and other chemical mediators) from the mast cell or basophil. Once released, histamine can react with local or widespread tissues through histamine receptors. Histamine, acting on H1-receptors, produces pruritis, vasodilatation, Pemirolast is a histamine H1 antagonist. It competes with histamine for the normal H1-receptor sites on effector cells of blood vessels. It provides effective, temporary relief of watery and itchy eyes.
potassium에 대한 Pharmacology 정보
Not Available
|
| Metabolism |
potassium에 대한 Metabolism 정보
# Phase_1_Metabolizing_Enzyme:Cytochrome P450 11B2 (CYP11B2)
|
| Protein Binding |
Pemirolast에 대한 단백결합 정보
Not Available
|
| Half-life |
Pemirolast에 대한 반감기 정보
4.5 hours (Ophthalmic)
|
| Absorption |
Pemirolast에 대한 Absorption 정보
Not Available
potassium에 대한 Absorption 정보
Not Available
|
| Biotransformation |
Pemirolast에 대한 Biotransformation 정보
Hepatic (Ophthalmic)
|
| Toxicity |
Pemirolast에 대한 Toxicity 정보
Not Available
potassium에 대한 Toxicity 정보
Not Available
|
| Drug Interactions |
Pemirolast에 대한 Drug_Interactions 정보
Not Available
potassium에 대한 Drug_Interactions 정보
Amiloride Increased risk of hyperkaliemiaBenazepril Increased risk of hyperkaliemiaCandesartan Increased risk of hyperkaliemiaCaptopril Increased risk of hyperkaliemiaCilazapril Increased risk of hyperkaliemiaDrospirenone Increased risk of hyperkaliemiaEnalapril Increased risk of hyperkaliemiaEplerenone This association presents an increased risk of hyperkaliemiaEprosartan Increased risk of hyperkaliemiaForasartan Increased risk of hyperkaliemiaFosinopril Increased risk of hyperkaliemiaIrbesartan Increased risk of hyperkaliemiaLisinopril Increased risk of hyperkaliemiaLosartan Increased risk of hyperkaliemiaMoexipril Increased risk of hyperkaliemiaPerindopril Increased risk of hyperkaliemiaPolystyrene sulfonate Antagonism of actionQuinapril Increased risk of hyperkaliemiaRamipril Increased risk of hyperkaliemiaSaprisartan Increased risk of hyperkaliemiaSpirapril Increased risk of hyperkaliemiaSpironolactone Increased risk of hyperkaliemiaTasosartan Increased risk of hyperkaliemiaTelmisartan Increased risk of hyperkaliemiaTrandolapril Increased risk of hyperkaliemiaTriamterene Increased risk of hyperkaliemiaValsartan Increased risk of hyperkaliemia
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Food Interaction |
potassium에 대한 Food Interaction 정보
Not Available
|
| Drug Target |
[Drug Target]
|
| Description |
Pemirolast에 대한 Description 정보
Pemirolast is an antiallergic agent. Pemirolast potassium is a slightly yellow powder soluble in water; as an ophthalmic aqueous sterile solution is used for the prevention of itching of the eyes caused by allergies such as hay fever, and allergic conjunctivitis. Pemirolast is potentially useful for prophylaxis of pulmonary hypersensitivity reactions to drugs such as paclitaxel.
potassium에 대한 Description 정보
Potassium is the major cation (positive ion) inside animal cells, while sodium is the major cation outside animal cells. The concentration differences of these charged particles causes a difference in electric potential between the inside and outside of cells, known as the membrane potential. The balance between potassium and sodium is maintained by ion pumps in the cell membrane. The cell membrane potential created by potassium and sodium ions allows the cell generate an action potential?봞 "spike" of electrical discharge. The ability of cells to produce electrical discharge is critical for body functions such as neurotransmission, muscle contraction, and heart function. Potassium is also an essential mineral needed to regulate water balance, blood pressure and levels of acidity.
|
| Dosage Form |
Pemirolast에 대한 Dosage_Form 정보
Solution / drops Ophthalmic
potassium에 대한 Dosage_Form 정보
Aerosol OralCapsule OralCapsule, extended release OralElixir OralLiquid IntravenousLiquid OralLiquid SublingualPowder OralPowder, for solution OralSolution IntravenousSolution OralSolution / drops OralTablet OralTablet, extended release Oral
|
| Drug Category |
Pemirolast에 대한 Drug_Category 정보
Anti-Allergic AgentsAntipruriticsHistamine AntagonistsOphthalmics
|
| Smiles String Canonical |
Pemirolast에 대한 Smiles_String_canonical 정보
CC1=CC=CN2C(=O)C(=CN=C12)C1=NNN=N1
potassium에 대한 Smiles_String_canonical 정보
Not Available
|
| Smiles String Isomeric |
Pemirolast에 대한 Smiles_String_isomeric 정보
CC1=CC=CN2C(=O)C(=CN=C12)C1=NNN=N1
potassium에 대한 Smiles_String_isomeric 정보
Not Available
|
| InChI Identifier |
Pemirolast에 대한 InChI_Identifier 정보
InChI=1/C10H8N6O/c1-6-3-2-4-16-9(6)11-5-7(10(16)17)8-12-14-15-13-8/h2-5H,1H3,(H,12,13,14,15)/f/h14H
potassium에 대한 InChI_Identifier 정보
Not Available
|
| Chemical IUPAC Name |
Pemirolast에 대한 Chemical_IUPAC_Name 정보
9-methyl-3-(2H-tetrazol-5-yl)pyrido[2,1-b]pyrimidin-4-one
potassium에 대한 Chemical_IUPAC_Name 정보
Not Available
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2021-12-09
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
|
|
|
|
전문/일반
