|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
641100570
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
[ºñ±Þ¿©]
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹ÝÅõ¸íÇÑ Æú¸®¿¡Æ¿·» Çʸ§ ÁöÁöü¿¡ ÁÖ¼ººÐÀ» ÇÔÀ¯ÇÑ Á¡Âø¼º ¹°ÁúÀÌ µµÆ÷µÇ¾î ÀÖ°í ±× À§¿¡ Åõ¸íÇÑ ¹Ú¸®ÆÇÀÌ ºÎÂøµÇ¾î Àִ Ÿ¿øÇüÀÇ ÆÐÃë [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
Á¦Á¶¿ø |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 3.25±âŸ |
4 ¸Å |
ÆÑ |
8806411005700 |
8806411005717 |
¾àǰ±Ô°Ý 6.5§² |
|
| ÁÖ¼ººÐÄÚµå |
154910CPC
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
È¿´ÉÈ¿°ú
Æó°æ±â ÀÌÈÄÀÇ °ñ´Ù°øÁõ ¿¹¹æ
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¿ë¹ý¿ë·®
ÀÌ ¾àÀº °ñ´Ù°øÁõ¿¡ À¯ÀÇÀûÀÎ À§Ç輺ÀÌ ÀÖ´Â Æó°æ±â ÀÌÈÄ ¿©¼º¿¡°Ô ó¹æµÇ¾î¾ß ÇÑ´Ù. ºñ¿¡½ºÆ®·Î°ÕÀǾàǰÀº ÁÖÀDZí°Ô °í·ÁµÇ¾î¾ß ÇÑ´Ù. ³·Àº °ñ ¹«±âÁú ¹Ðµµ, ³·Àº¿¡½ºÆ®·Î°Õ ¼öÁØ, °ñ´Ù°øÁõÀÇ °¡Á··Â, ÀÌÀüÀÇ °ñÀý, ÀÛÀº °ñ°Ý(³·Àº ½ÅüÁú·®Áö¼ö), ¿¬ÇÑÇǺλö, Èí¿¬, ¾ËÄÚ¿Ã ¼·Ãë°¡ °ñ´Ù°øÁõ¿¡ ´ëÇÑ À§Çè ¿ä¼ÒÀÌ´Ù. Ä¡·á¿¡ ´ëÇÑ ¹ÝÀÀÀº Ä¡·á Àü¿¡´Â Ç÷û ¿¡½ºÆ®¶óµð¿Ã ³óµµ·Î ¿¹ÃøÇÒ ¼ö ÀÖ°í, Ä¡·áÁß¿¡´Â °ñ Çü¼º/Èí¼ö ±×¸®°í/¶Ç´Â °ñ ¹«±âÁú ¹ÐµµÀÇ »ýÈÇÐÀûÁöÇ¥¸¦ ÃøÁ¤ÇÔÀ¸·Î½á Æò°¡ÇÒ ¼ö ÀÖ´Ù.
¿¡½ºÆ®·Î°ÕÀ» ÀÚ±ÃÀ» °¡Áø Æó°æ±â ÀÌÈÄ ¿©¼º¿¡°Ô ó¹æ½Ã Àڱ󻸷¾ÏÀÇ À§Ç輺À» °¨¼Ò½Ã۱â À§Çؼ ÇÁ·Î°Ô½ºÆ¾µµ ÇÔ²² »ç¿ëÇÏ¿©¾ßÇÑ´Ù. ÀÚ±ÃÀÌ ¾ø´Â ¿©¼ºÀÇ °æ¿ì¿¡´Â ÇÁ·Î°Ô½ºÆ¾À» ÇÔ²² ó¹æÇÒ Çʿ䰡 ¾ø´Ù. ÀÚ±ÃÀº °¡Áø ¿©¼º¿¡°Ô ó¹æµÇ¾úÀ» ¶§¿¡´Â, Áø´ÜµÇÁö ¾ÊÀº Áö¼ÓÀû ¶Ç´ÂÀç¹ß¼º ÀÌ»ó ÁúÃâÇ÷ÀÇ °æ¿ì ¾Ç¼ºÁ¾¾çÀ» ¹èÁ¦½Ã۱â À§ÇØ Àڱ󻸷 Ç¥º»°ú °°Àº ÀûÀýÇÑ Áø´ÜÀû ¹æ¹ýÀ» ÃëÇØ¾ß ÇÑ´Ù.
ÀÚ±ÃÀ» °¡Áø ¿©¼ºÀÌ ÀÌ ¾àÀ¸·Î Ä¡·áÇÏ´Â °æ¿ì ¸Å 6 ³»Áö 12°³¿ù¸¶´Ù 14Àϰ£ ÇÁ·Î°Ô½ºÆ¾À» Åõ¿©Çϰí ÀÓ»óÀûÀ¸·Î ó¹æµÈ ´ë·Î¶Ç´Â ¸Å³â Àڱ󻸷 »ý°ËÀ» ½Ç½ÃÇÏ´Â °ÍÀÌ ±ÇÀåµÈ´Ù.
Àû¿ë¹æ¹ý
ÀÌ ¾àÀÇ Á¡Âø¸éÀ» ÇϺ¹ºÎÀÇ ±ú²ýÇÏ°í °ÇÁ¶ÇÑ ºÎÀ§¿¡ ºÎÂøÇÑ´Ù. ÀÌ ¾àÀº °¡½¿ ¶Ç´Â±× ÁÖÀ§¿¡ Àû¿ëÇÏÁö ¸»¾Æ¾ß Çϰí, Àû¿ë ºÎÀ§´Â Çã¿ëµÈ ƯÁ¤ Àû¿ë ºÎÀ§µé Áß¿¡¼ Àû¾îµµ ÀÏÁÖÀÏ °£°ÝÀ¸·Î¹Ù²Ù¾î¾ß ÇÑ´Ù. ºÎÂøÇÒ ºÎÀ§´Â ±â¸§±â°¡ ¸¹°Å³ª »óó¸¦ ÀÔ¾ú°Å³ª ¶Ç´Â ÀÚ±ØÀÌ À־ ¾È µÈ´Ù. ¿ÊÀÌ ÇÇºÎ¿Í ¹ÐÂøµÊÀ¸·Î½á º»Á¦¸¦ ¹®Áú·¯ ¶³¾îÁö°Ô ÇÒ ¼ö ÀÖÀ¸¹Ç·Î Ç㸮ºÎÀ§´Â ÇÇÇÑ´Ù. ¾É´Â ºÎÀ§¿¡ Àû¿ëÇÏ´Â °ÍÀº º»Á¦¸¦ Á¦°ÅÇÒ ¼ö ÀÖÀ¸¹Ç·Î ÇÇÇØ¾ß ÇÑ´Ù. À̾àÀº Æ÷ÀåÀ» °³ºÀÇÑ ÈÄ ¹Ú¸®Áö¸¦ Á¦°ÅÇÑ ´ÙÀ½ Áï½Ã ºÎÂøÇØ¾ß ÇÑ´Ù. ÀÌ ¾àÀ» Àû¿ëºÎÀ§¿¡¼ ¾à 10Ãʰ£ ¼Õ°¡¶ôÀ¸·Î ´Ü´ÜÈ÷ ´·¯ ¸ð¼¸® µîÀÌ Àß Á¢ÂøµÇ°Ô ÇÑ´Ù. À̾àÀÌ µé¶ã °æ¿ì, ºÎÂøÀÌ À¯ÁöµÇµµ·Ï ´·¯ ÁØ´Ù. ÀÌ ¾àÀ̶³¾îÁ³´Ù¸é, »õ·Î¿î ÆÐÃ븦 7ÀÏÀÇ ºÎÂø±â°£ Áß ³²Àº ±â°£µ¿¾È ºÎÂøÇØ¾ß ÇÑ´Ù. 7ÀÏÀÇ ºÎÂø±â°£ µ¿¾È¿¡ Ç×»ó ÇѰ³ÀÇ ÆÐÃ븸À» ºÎÂøÇØ¾ß ÇÑ´Ù. ÀÌ ¾àÀÇ »ç¿ë Áß¿¡ ¼ö¿µ, ¸ñ¿å ¶Ç´Â »ç¿ì³ª¸¦ ÇßÀ» °æ¿ì¿¡ ´ëÇѽÃÇèÀº ¾øÀ¸³ª, ÀÌ·¯ÇÑ È°µ¿Àº ÀÌ ¾àÀÇ ºÎÂø·Â ¹× ¿¡½ºÆ®¶óµð¿ÃÀÇ Àü´ÞÀ» °¨¼Ò½Ãų ¼ö ÀÖ´Ù.
Á¦°Å¹æ¹ý
ÇǺÎÀÇ ÀÚ±ØÀ» ÇÇÇϱâ À§Çؼ´Â ÀÌ ¾àÀ» Á¶½É½º·´°í õõÈ÷ Á¦°ÅÇÏ¿©¾ß ÇÑ´Ù. À̾àÀÇ Á¦°Å ÈÄ¿¡ ÇǺο¡ Á¡Âø¹°ÁúÀÌ ³²¾ÆÀÖ´Ù¸é, Á¢Âø ºÎÀ§¸¦ 15ºÐµ¿¾È °ÇÁ¶½ÃŲ´Ù. ±â¸§¼ººÐÀÇ Å©¸²À̳ª ·Î¼ÇÀ¸·Î ºÎÀ§¸¦ Á¢Âø ºÎÀ§¸¦ ºÎµå·´°Ô ¹®Áú·¯ ÁÖ¸é ³²¾ÆÀÖ´Â Á¡Âø¹°ÁúÀ» Á¦°Å½ÃÄÑ ÁØ´Ù.
»ç¿ëµÈ ÆÐÃë´Â ¾à°£ÀÇ È°¼º È£¸£¸óÀ» ¿©ÀüÈ÷ ÇÔÀ¯Çϰí ÀÖÀ¸¹Ç·Î, °¢ ÆÐÃë´Â ¹ö¸®±âÀü¿¡ ÁÖÀDZí°Ô ¹ÝÀ¸·Î Á¢¾î¼ ÆÐÃëÀÇ Á¡Âø¸éÀÌ ¼·Î ºÙ¾îÀÖµµ·Ï ÇÑ´Ù.
|
| ±Ý±â |
1) Áø´ÜµÇÁö ¾ÊÀº ÀÌ»ó »ý½Ä±â ÃâÇ÷ ȯÀÚ
2) À¯¹æ¾ÏÀÌ ¹ß°ßµÇ¾ú°Å³ª ÀǽɵǴ ȯÀÚ ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ
3) ¼º È£¸£¸ó ¿µÇâÀÇ Àü¾Ï»óÅ ¶Ç´Â ¾Ç¼º Á¾¾çÀÌ ¹ß°ßµÇ¾ú°Å³ª ÀǽɵǴ ȯÀÚ
4) Ȱµ¿¼º ½ÉÀç Á¤¸Æ Ç÷ÀüÁõ, Æóµ¿¸Æ »öÀüÁõ, Ç÷Àü»öÀü¼º Áúȯ ¶Ç´Â ÀÌ·¯ÇÑ ÁúȯÀÇ º´·ÂÀÌÀִ ȯÀÚ
5) Ȱµ¿¼º ¶Ç´Â ÃÖ±Ù(Áö³ ¼ö³âÀ̳»)¿¡µ¿¸Æ Ç÷Àü»öÀü¼º Áúȯ(³úÁ¹Áõ, ½É±Ù°æ»öÁõ)ÀÌ Àִ ȯÀÚ
6) °£Àå¾Ö, °£Áúȯ ¶Ç´Â °£ Á¾¾ç(¾ç¼º¶Ç´Â ¾Ç¼º) ȯÀÚ ¶Ç´Â ±×·¯ÇÑ º´·ÂÀÌ Àִ ȯÀÚ
7) ÀÌ ¾àÀÇ ¼ººÐ¿¡ ¾Ë·ÁÁø °ú¹ÎÁõÀÌ Àִ ȯÀÚ
8) ÀÓ½ÅÇÏ¿´°Å³ª ÀÓ½ÅÀÌ ÀǽɵǴ ȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
ÀÓ»ó ½ÃÇèÀÌ ¸Å¿ì ´Ù¾çÇÑ Á¶°ÇÇÏ¿¡¼¼öÇàµÇ±â ¶§¹®¿¡, ¾à¹°ÀÇ ÀÓ»ó ½ÃÇè¿¡¼ ¹ß°ßµÈ ÀÌ»ó¹ÝÀÀ·üÀº ´Ù¸¥ ¾à¹°ÀÇ ÀÓ»ó ½ÃÇè¿¡¼ÀÇ ¹ÝÀÀ·ü°ú Á÷Á¢ÀûÀ¸·Îºñ±³ÇÒ ¼ö ¾ø°í ½ÇÁ¦·Î °üÂûµÈ ¹ÝÀÀ·üÀ» ¹Ý¿µÇÏÁö ¾ÊÀ» ¼öµµ ÀÖ´Ù. ±×·¯³ª, ÀÓ»ó ½ÃÇè¿¡¼ ¾òÀº ÀÌ»ó ¹ÝÀÀ Á¤º¸´Â ¾à¹° »ç¿ë°ú °ü·ÃµÈ °ÍÀ¸·Î º¸ÀÌ´Â À¯ÇØ »ç·Ê¸¦ È®ÀÎÇÏ°í ¹ÝÀÀ·üÀ» ÃßÁ¤Çϴµ¥µµ¿òÀ» ÁØ´Ù.
Ä¡·á±º¿¡¼ °¡Àå ºó¹øÈ÷ º¸°íµÈ ÀÀ±Þ ÀÌ»ó °æÇè/ÀÇÇÐ »ç·Ê(5% ÀÌ»ó) ¿ä¾à
| ½Åü°èÀÇ ÀÌ»ó¹ÝÀÀ
| ÀÌ ¾à 14mcg/dayÀ» º¹¿ëÇÑ ±º(208¸í)
| À§¾à±º(209¸í)
| Àü½Å°è
º¹Åë
¿ì¹ß¼º »óÇØ
°¨¿°
ÅëÁõ
| 95(46%)
17(8%)
29(14%)
11(5%)
26(13%)
| 100(48%)
17(8%)
23(11%)
10(5%)
26(12%)
| ½ÉÇ÷°ü°è
| 20(10%)
| 19(9%)
| ¼Òȱâ°è
º¯ºñ
¼ÒȺҷ®
| 52(25%)
11(5%)
11(5%)
| 44(21%)
6(3%)
9(4%)
| ´ë»ç ¹× ¿µ¾ç Àå¾Ö
| 25(12%)
| 22(11%)
| ±Ù°ñ°Ý°è
°üÀýÅë
°üÀý¿°
±ÙÀ°Åë
| 54(26%)
24(12%)
11(5%)
10(5%)
| 51(24%)
13(6%)
15(7%)
6(3%)
| ½Å°æ°è
¾îÁö·¯¿ò
| 30(14%)
11(5%)
| 23(11%)
6(3%)
| È£Èí±â°è
±â°üÁö¿°
»ó±âµµ¿°
| 62(30%)
12(6%)
33(16%)
| 67(32%)
9(4%)
35(17%)
| ÇǺΠ¹× ºÎ¼Ó±â°ü
Àû¿ë ºÎÀ§ ¹ÝÀÀ
À¯¹æÅë
| 50(24%)
18(9%)
10(5%)
| 54(26%)
18(9%)
8(4%)
| ºñ´¢»ý½Ä±â°è
°æ°üÆú¸³
¹é»öÁúºÐºñ¹°
| 66(32%)
13(6%)
22(11%)
| 40(19%)
4(2%)
3(1%)
| ¿¡½ºÆ®·Î°ÕÀ» º¹¿ëÇßÀ» °æ¿ì ´ÙÀ½°ú °°Àº Ãß°¡ÀûÀÎ ÀÌ»ó ¹ÝÀÀÀÌ º¸°íµÇ¾ú´Ù.
1) Àü½Å°è
°ñ¹ÝÅë, ¹°È¤, ±Çۨ, ¼ö¼ú
2) ´ë»ç ¹× ¿µ¾ç Àå¾Ö
°íÄÝ·¹½ºÅ×·ÑÇ÷Áõ
3) ºñ´¢»ý½Ä±â°è
ÁúÃâÇ÷ ¾ç»óÀÇ º¯È ¹× ºñÁ¤»óÀû¼ÒÅ𼺠ÃâÇ÷À̳ª È帧, ÆÄź ÃâÇ÷, Á¡»ó ÃâÇ÷, ¿ù°æÅë, Àڱà ÆòȰ±ÙÁ¾ Å©±âÀÇ Áõ°¡, Áúĵð´ÙÁõÀ» Æ÷ÇÔÇÑ Áú¿°, °æ°ü ºÐºñ·®ÀÇ º¯È, °æ°ü¿Ü¹øÁõÀÇ º¯È, ³¼Ò¾Ï, Àڱ󻸷Áõ½ÄÁõ, Àڱ󻸷¾Ï, °æºÎ Á¾¾ç, Àڱà Áúȯ, »ý½Ä±âÃâÇ÷, Àڱ󻸷Áúȯ, ¿ÜÀ½Áú Áúȯ, Àڱ󻸷 Æú¸³, ³¼Ò ¹°È¤, ¹è´¢Àå¾Ö, ¿äµµ°¨¿°, ÀÚ±ÃÃâÇ÷, ºñÁ¤»óÀû ÆÕ ½º¹Ì¾î °á°ú, Àڱà Á¾¾ç, °ñ¹ÝÅë, ³¼Ò³¶Æ÷, À¯¹æ³¶Æ÷, ÀÚ±ÃÅ»ÃâÁõ
4) À¯¹æ
¾ÐÅë, ºñ´ë, ÅëÁõ, À¯µÎ ºÐºñ¹°, À¯·çÁõ, ¼¶À¯³¶¼º À¯¹æ º¯È, À¯¹æ¾Ï, Á¥ºÐºñ, À¯¹æ¿ïÇ÷
5) ½ÉÇ÷°ü°è
½ÉÀç ¹× Ç¥Àç Á¤¸Æ Ç÷ÀüÁõ, Æóµ¿¸Æ »öÀüÁõ, Ç÷ÀüÁ¤¸Æ¿°, ½É±Ù°æ»öÁõ, ³úÁ¹Áß, Ç÷¾Ð Áõ°¡, ½Ç½Å
6) À§Àå°ü°è
¿À½É, ±¸Åä, ºñÁ¤»óÀûÀÎ °æ·Ã, °íÀåÁõ, ´ãÁóÁ¤Ã¼È²´Þ, ´ã³¶ÁúȯÀÇ ºóµµ Áõ°¡, ÃéÀå¿°, °£ Ç÷°üÁ¾ÀÇ ºñ´ë, °£±â´ÉÀÌ»ó, À§°íâ, ÀÎÈÄÅë, ¼³»ç, º¹Åë, ¼ÒȺҷ®, °£È¿¼Ò Áõ°¡
7) ÇǺÎ
ÀÌ ¾àÀ» Áߴܽà Áö¼ÓµÉ ¼öÀÖ´Â °£¹Ý ¶Ç´Â ÈæÇÇÁ¾, ´ÙÇü¼º È«¹Ý, °áÀý¼º È«¹Ý, ÃâÇ÷¼º ¹ßÁø, ¸Ó¸®Ä«¶ô ¼Ò½Ç, ´Ù¸ðÁõ, °¡·Á¿òÁõ, ¹ßÁø, ¿©µå¸§, Å»¸ðÁõ, Àû¿ëºÎÀ§¹ÝÀÀ
8) ´«
¸Á¸· Ç÷°ü Ç÷ÀüÁõ, ÄÜÅÃÆ®·»Áî¿¡ ºÒ³»¼º
9) ÁßÃ߽Űæ°è
µÎÅë, ÆíµÎÅë, ¾îÁö·¯¿ò, Á¤½ÅÀû¿ì¿ïÁõ, ¹«µµº´, ½Å°æ°ú¹Î,±âºÐ Àå¾Ö, °ú¹Î¼º, °£ÁúÀÇ ¾ÇÈ, Ä¡¸Å, ºÒ¸éÁõ
10) ±âŸ
üÁß Áõ°¡ ¶Ç´Â °¨¼Ò, ź¼öȹ° ³»¼º °¨¼Ò, Æ÷¸£ÇǸ°ÁõÀÇ ¾ÇÈ, ºÎÁ¾, °üÀýÅë, ÇÏÁö°æ·Ã, ¼º¿åÀÇ º¯È, µÎµå·¯±â ¹× Ç÷°üºÎÁ¾À» Æ÷ÇÔÇÏ´Â ¾Æ³ªÇʶô½Ã½º¹ÝÀÀ, ÀúÄ®½·Ç÷Áõ, õ½ÄÀÇ ¾ÇÈ, Áß¼ºÁö¹æ Áõ°¡, ºÒÄè°¨, ³¶Æ÷
|
| »óÈ£ÀÛ¿ë |
ÀÌ ¾à°úÀÇ »óÈ£ÀÛ¿ë
»ýü ³» ¹× ¿Ü ½ÃÇè¿¡¼ ¿¡½ºÆ®·Î°ÕÀ̽ÎÀÌÅäÅ©·Ò P450 3A4(CYP3A4)¿¡ ÀÇÇØ ºÎºÐÀûÀ¸·Î ´ë»çµÊÀÌ ³ªÅ¸³µ´Ù. ±×·¯¹Ç·Î, CYP3A4ÀÇ À¯µµÁ¦³ª ¾ïÁ¦Á¦´Â ¿¡½ºÆ®·Î°Õ ¾à¹° ´ë»ç¿¡¿µÇâÀ» ¹ÌÄ¥ ¼ö ÀÖ´Ù. ¼¼ÀÎÆ® Á¸½ºÇ® Á¦Á¦, Æä³ë¹Ù¸£ºñÅ», Ä«¸£¹Ù¸¶Á¦ÇÉ ¹× ¸®ÆÊÇǽŰú °°Àº CYP3A4ÀÇ À¯µµÁ¦´Â ¿¡½ºÆ®·Î°ÕÀÇÇ÷Àå ³óµµ¸¦ °¨¼Ò½ÃÄÑ Ä¡·á È¿°ú¸¦ °¨¼Ò½Ã۰í Àڱà ÃâÇ÷ ¾ç»óÀ» º¯È½Ãų ¼ö ÀÖ´Ù. ¿¡¸®½º·Î¸¶À̽Å, Ŭ·¡¸®½º·Î¸¶À̽Å, ÄÉÅäÄÚ³ªÁ¹, ÀÌÆ®¶óÄÚ³ªÁ¹, ¸®Å䳪ºñ¾î ¹× ÀÚ¸ùÁ꽺¿Í °°Àº CYP3A4ÀÇ ¾ïÁ¦Á¦´Â ¿¡½ºÆ®·Î°ÕÀÇÇ÷Àå ³óµµ¸¦ Áõ°¡½ÃÄÑ ºÎ¹ÝÀÀÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù.
¾ËÄڿðúÀÇ »óÈ£ÀÛ¿ë
È£¸£¸ó ´ëü ¿ä¹ý Áß¿¡ ±Þ¼º ¾ËÄÚ¿Ã ¼·Ãë´Â ¼øÈ¯ÇÏ´Â ¿¡½ºÆ®¶óµð¿Ã ¼öÄ¡¸¦Áõ°¡½Ãų ¼ö ÀÖ´Ù.
|
| Related FDA Approved Drug |
±âÁØ ¼ººÐ: ESTRADIOL HEMIHYDRATEESTRASORB (ESTRADIOL HEMIHYDRATE)
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Xµî±Þ
(estradiol; )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
º¯ºñ°¡ »ý±æ¼ö ÀÖ½À´Ï´Ù. |
|
 |
¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| Á¦Çüº° º¹¾àÁöµµ |
[ÆÐÃë] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Estradiol¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Estradiol¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Estradiol enters target cells freely (e.g., female organs, breasts, hypothalamus, pituitary) and interacts with a target cell receptor. When the estrogen receptor has bound its ligand it can enter the nucleus of the target cell, and regulate gene transcription which leads to formation of messenger RNA. The mRNA interacts with ribosomes to produce specific proteins that express the effect of estradiol upon the target cell. Estrogens increase the hepatic synthesis of sex hormone binding globulin (SHBG), thyroid-binding globulin (TBG), and other serum proteins and suppress follicle-stimulating hormone (FSH) from the anterior pituitary.
|
| Pharmacology |
Estradiol¿¡ ´ëÇÑ Pharmacology Á¤º¸ Estradiol, the principal intracellular human estrogen, is substantially more active than its metabolites, estrone and estriol, at the cellular level.
|
| Metabolism |
Estradiol¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 1A2 (CYP1A2)Cytochrome P450 2A6 (CYP2A6)Glucuronosyltransferase
|
| Absorption |
Estradiol¿¡ ´ëÇÑ Absorption Á¤º¸ 43%
|
| Toxicity |
Estradiol¿¡ ´ëÇÑ Toxicity Á¤º¸ Can cause nausea and vomiting, and withdrawal bleeding may occur in females.
|
| Drug Interactions |
Estradiol¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Amobarbital The enzyme inducer decreases the effect of hormonesAprobarbital The enzyme inducer decreases the effect of hormonesButabarbital The enzyme inducer decreases the effect of hormonesButalbital The enzyme inducer decreases the effect of hormonesButethal The enzyme inducer decreases the effect of hormonesEthotoin The enzyme inducer decreases the effect of hormonesFosphenytoin The enzyme inducer decreases the effect of hormonesGriseofulvin The enzyme inducer decreases the effect of hormonesHeptabarbital The enzyme inducer decreases the effect of hormonesHexobarbital The enzyme inducer decreases the effect of hormonesMephenytoin The enzyme inducer decreases the effect of hormonesMethohexital The enzyme inducer decreases the effect of hormonesMethylphenobarbital The enzyme inducer decreases the effect of hormonesPentobarbital The enzyme inducer decreases the effect of hormonesPhenobarbital The enzyme inducer decreases the effect of hormonesPhenytoin The enzyme inducer decreases the effect of hormonesPrednisolone The estrogenic agent increases the effect of corticosteroidPrednisone The estrogenic agent increases the effect of corticosteroidPrimidone The enzyme inducer decreases the effect of hormonesSecobarbital The enzyme inducer decreases the effect of hormonesTalbutal The enzyme inducer decreases the effect of hormonesRaloxifene Association not recommendedUrsodeoxycholic acid Estrogens decreases the effect of ursodiol
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Estradiol¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take with food to decrease nausea.
|
| Drug Target |
[Drug Target]
|
| Description |
Estradiol¿¡ ´ëÇÑ Description Á¤º¸ Generally refers to the 17-beta-isomer of estradiol, an aromatized C18 steroid with hydroxyl group at 3-beta- and 17-beta-position. Estradiol-17-beta is the most potent form of mammalian estrogenic steroids. In humans, it is produced primarily by the cyclic ovaries and the placenta. It is also produced by the adipose tissue of men and postmenopausal women. The 17-alpha-isomer of estradiol binds weakly to estrogen receptors (receptors, estrogen) and exhibits little estrogenic activity in estrogen-responsive tissues. Various isomers can be synthesized. [PubChem]
|
| Dosage Form |
Estradiol¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Disc TransdermalGel TransdermalLiquid IntramuscularPatch TransdermalRing IntravaginalTablet IntravaginalTablet Oral
|
| Drug Category |
Estradiol¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-menopausal AgentsAnticholesteremic AgentsEstrogens
|
| Smiles String Canonical |
Estradiol¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC12CCC3C(CCC4=C3C=CC(O)=C4)C1CCC2O
|
| Smiles String Isomeric |
Estradiol¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@]12CC[C@H]3[C@@H](CCC4=C3C=CC(O)=C4)[C@@H]1CC[C@@H]2O
|
| InChI Identifier |
Estradiol¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1
|
| Chemical IUPAC Name |
Estradiol¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol
|
| Drug-Induced Toxicity Related Proteins |
ESTRADIOL ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Myc proto-oncogene protein Drug:estradiol Toxicity:cytotoxic responses . [¹Ù·Î°¡±â] Replated Protein:3-hydroxy-3-methylglutaryl-coenzyme A reductase Drug:estradiol Toxicity:stimulate steroidogenesis. [¹Ù·Î°¡±â] Replated Protein:Stromelysin-2 Drug:estradiol Toxicity:nonbacterial prostatitis. [¹Ù·Î°¡±â] Replated Protein:Transcription factor E2F1 Drug:estradiol Toxicity:cytotoxic responses. [¹Ù·Î°¡±â] Replated Protein:Glucocorticoid receptor Drug:estradiol Toxicity:glucocorticoid resistance. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2021-12-09
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|