| |
|
|
|
|
|
 |
| |
|
Á©¿¡½ºÆ®¶ó°Ö(¿¡½ºÆ®¶óµð¿Ã) ZELESTRA GEL[Estradiol hemihydrate]
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
672200060[E21750041]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1g(2008.11.01)(ÇöÀç¾à°¡)
\120 ¿ø/1g(2005.06.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹«»ö Åõ¸íÇÑ °ÖÁ¦ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
28°³ |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 2.5±×·¥ |
28 Æ÷ |
Æ÷ |
8806722000609 |
8806722000616 |
|
|
| ÁÖ¼ººÐÄÚµå |
154908COM
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
Æó°æ¿¡ µû¸£´Â ¿¡½ºÆ®·Î°Õ °áÇÌÁõ»ó : ¾È¸éÈ«Á¶, ¼ö¸éÀå¾Ö, ºñ´¢»ý½Ä±âÀÇ À§Ãà, Á¤¼Àå¾Ö
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
[ÁÖ¼ººÐÄÚµå:154908COM ¿¡ µû¸¥ ½É»çÁöħ¿¶÷]
º¸Åë ¼ºÀÎÀº 1ÀÏ 2.5gÀ» µµÆ÷ÇÑ´Ù. 1ÀÏ ÃÖ´ë 5g±îÁö »ç¿ëÇÒ ¼ö ÀÖÀ¸¸ç 1ÀÏ 1ȸ µµÆ÷ÇÑ´Ù.
ȯÀÚÀÇ »óÅ¿¡ µû¶ó ÀûÀÇ Áõ°¨ÇÒ ¼ö ÀÖ´Ù.
ÀÇ»ç¿Í »óÀÇÇÏ¿© ÁÖ±âÀû(3ÁÖ »ç¿ëÈÄ 1ÁÖ°£ ÁßÁö)À¸·Î »ç¿ëÇϰųª ¿¬¼Ó »ç¿ëÇÒ ¼ö ÀÖ´Ù.
|
| ±Ý±â |
1) ¿¡½ºÆ®·Î°Õ ÀÇÁ¸¼º Á¾¾ç(¿¹: À¯¹æ¾Ï, Àڱ󻸷¾Ï) ¶Ç´Â ÂÚ½ÉÀÌ µÇ´Â ȯÀÚ ¹× ±× º´·ÂÀÌ Àִ ȯÀÚ(Á¾¾çÀ» ¾ÇÈ ¶Ç´Â Çö¼ºÈ½Ãų ¼ö ÀÖ´Ù)
2) Àڱ󻸷Áõ, Àڱà ÆòȰ±ÙÁ¾ ¶Ç´Â ¼¶À¯Á¾ ȯÀÚ
3) Áø´ÜÇÏÁö ¾ÊÀº ºñÁ¤»óÀûÀÎ »ý½Ä±â ÃâÇ÷ ȯÀÚ
4) ÁßÁõ °£, ½Å, ½ÉÁúȯ ȯÀÚ
5) Æ÷¸£ÇǸ°Áõ ȯÀÚ
6) Ȱµ¿¼º ½ÉÀç Á¤¸Æ Ç÷ÀüÁõ, Ç÷ÀüÁõ, Ç÷Àü»öÀüÁõ, Ç÷Àü¼º Á¤¸Æ¿°, Æó»öÀüÁõ ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ(Ç÷ÀüÇü¼º °æÇâÀÌ Áõ°¡µÉ ¼ö ÀÖ´Ù)
7) ÀÌ ¾à ¹× ÀÌ ¾à¼ººÐ¿¡ °ú¹ÎÁõ ȯÀÚ
8) ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼º ÀÖ´Â ºÎÀÎ ¹× ¼öÀ¯ºÎ
9) µÎºó-Á¸½¼ ÁõÈıº(Dubin-Johnson syndrome) ¶Ç´Â ·ÎÅÍ ÁõÈıº(Rotor syndrome) ȯÀÚ
10) Ȳ´Þ ¹× Ư¹ß¼º Ȳ´ÞÀÇ º´·ÂÀÌ Àִ ȯÀÚ
11) °â»ó ÀûÇ÷±¸¼º ºóÇ÷ ȯÀÚ
12) ÀÌ(ì¼) °æÈÁõ ȯÀÚ
13) ÀÌ(ì¼)ÇØ¸éÈÁõ ȯÀÚ
14) ³úÇϼöüÁ¾¾ç ȯÀÚ
15) °áÇÕÁ¶Á÷¿° ȯÀÚ
16) ¿Ü»óȯÀÚ(ȸº¹±âȯÀÚµµ Æ÷ÇÔ)
17) ¿Ü°ú¼ö¼úÀü ȯÀÚ
|
| ½ÅÁßÅõ¿© |
1) °Ë»ç·Î È®ÀεǾú°Å³ª, ÃßÃøµÇ´Â À¯¹æ¾Ï À¯¹æ¾ÏÀÇ º´·Â ¶Ç´Â °¡Á··ÂÀÌ Àְųª ¹ßº´À§Ç輺ÀÌ ³ôÀº ȯÀÚ(À¯¹æ¾ÏÀÇ º´·ÂÀÌ Àִ ȯÀÚ¿¡°Ô´Â ¿¡½ºÆ®·Î°ÕÀ» Åõ¿©ÇÏÁö ¾Ê´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù. À¯¹æ¾ÏÀÇ °¡Á··ÂÀÌ Àְųª ¹ßº´À§Ç輺ÀÌ Å« ¿©¼ºÀÌ ÀÌ ¾àÀ» »ç¿ëÇÏ´Â °æ¿ì¿¡´Â Á¤±âÀûÀÎ À¯¹æ°ËÁøÀ» ½ÃÇàÇϸç À¯¹æÀÚ°¡Áø´Ü¿¡ ´ëÇÑ ±³À°À» ¹Þ¾Æ¾ß ÇÑ´Ù. ƯÈ÷ À¯¹æ¾ÏÀÇ À§Ç輺ÀÌ ³ôÀº ȯÀÚ¿¡ ´ëÇØ¼´Â ÀÌ ¾àÀÇ Ä¡·áÀü°ú Ä¡·á °³½Ã ÈÄ Á¤±âÀûÀ¸·Î À¯¹æÁ¶¿µ¼úÀ» ½Ç½ÃÇÏ´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù).
2) °íÇ÷¾Ð, õ½Ä, ½ÉºÎÀü, ½Å¡¤°£±â´É ÀÌ»ó, ÆíµÎÅë, °£Áú ȯÀÚ(È£¸£¸ó ´ëü ¿ä¹ý¿¡ ÀÇÇØ ±× Áõ»óÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù. °£Áú¼º ¹ßÀÛÀÌ Áõ°¡ÇÏ´Â °æ¿ì¿¡´Â È£¸£¸ó ´ëü ¿ä¹ýÀ» Áß´ÜÇϰí ÁÖÀDZí°Ô ȯÀÚ¸¦ °üÂûÇÑ´Ù. È£¸£¸ó ´ëü ¿ä¹ý Áß ÀÌ·¯ÇÑ ÁúȯÀÌ ¾Çȵǰųª ¾Ç鵃 ¼ö ÀÖÀ¸¸é °³°³Àο¡ µû¶ó Ä¡·áÀÇ À¯Àͼº°ú À§Ç輺¿¡ ´ëÇØ¼ ÀçÆò°¡ÇÑ´Ù)
3) ¿¡½ºÆ®·Î°Õ°ú °ü·ÃµÈ Ȳ´Þ ¶Ç´Â °¡·Á¿òÀÇ º´·ÂÀÌ Àִ ȯÀÚ (Åõ¿© Áß ´ãÁó¿ïü¼º Ȳ´ÞÀÌ ³ªÅ¸³ª´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí ÁÖÀDZí°Ô °üÂûÇÑ´Ù.)
4) °¡Á·¼º °úÁß¼ºÁö¹æÇ÷Áõ ȯÀÚ(È£¸£¸ó ´ëü ¿ä¹ýÀ» ½Ç½ÃÇϱâ Àü¿¡ ÁöÁú¾çÀ» °¨¼Ò½ÃŰ´Â óġ¸¦ ÇÏ´Â °ÍÀÌ ±ÇÀåµÈ´Ù.)
5) ´ç´¢º´ ȯÀÚ(°æÇÇ ¿¡½ºÆ®¶óµð¿ÃÁ¦Á¦¸¦ Æ÷ÇÔÇÑ ¿¡½ºÆ®·Î°ÕÀÌ Åº¼öȹ° ´ë»ç¸¦ ¹æÇØÇÑ´Ù´Â º¸°í´Â ¾ø¾úÀ¸³ª, ´ç´¢º´ ȯÀÚÀÇ °æ¿ì¿¡ ´õ ¸¹Àº À¯¿ëÇÑ Á¤º¸°¡ ¹ßÇ¥µÉ ¶§±îÁö ÀÌ ¾àÀÇ Åõ¿© Ãʱ⿡ ¸ð´ÏÅ͸µÇÑ´Ù.)
|
| »óÈ£ÀÛ¿ë |
1) °£È¿¼Ò À¯µµ ¾à¹°µé [Ç×Àü°£Á¦(Ä«¸£¹Ù¸¶Á¦ÇÉ, Æä³ë¹Ù¸£ºñÅ», Æä´ÏÅäÀÎ, ÇÁ¸®¹Ìµ·), ¹Ù¸£ºñÅ»°è ¾à¹°, ±×¸®¼¼¿ÀÇ®ºó, ¸®ÆÊÇǽеî]°ú º´¿ëÅõ¿©½Ã ¿¡½ºÆ®·Î°ÕÀÇ ´ë»ç¸¦ Áõ°¡½ÃÄÑ ÀÌ ¾àÀÇ È¿°ú¸¦ °¨¼Ò½Ãų ¼ö ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇÑ ¾àÀ¸·Î Ä¡·áÇÏ´Â µ¿¾È°ú ÁßÁö ÀÌÈÄ¿¡µµ »óȲ¿¡ µû¶ó ¿¡½ºÆ®·Î°ÕÀÇ Åõ¿©·®À» Á¶ÀýÇÑ´Ù. ±×·¯³ª, °æÇÇ Àû¿ëÇÑ ¿¡½ºÆ®¶óµð¿Ã¿¡ Űġ´Â ¿µÇâÀÌ ¾î´À Á¤µµÀÎÁö´Â ¹àÇôÁ® ÀÖÁö ¾Ê´Ù.
2) ³Æ÷È£¸£¸ó(ÁÖ·Î °áÇÕÇü ¿¡½ºÆ®·Î°Õ, ÇÕ¼º ¿¡½ºÆ®·Î°Õ)Àº ³»´ç·ÂÀÇ º¯È¸¦ ÀÏÀ¸ÄÑ Ç÷´ç»ó½ÂÀÛ¿ëÀ» ³ªÅ¸³»¹Ç·Î Ç÷´ç°ÇÏÁ¦¿Í º´¿ëÅõ¿©½Ã Ç÷´ç°ÇÏÀÛ¿ëÀÌ °¨¼ÒµÉ ¼ö ÀÖ´Ù. ±×·¯¹Ç·Î ´ç´¢º´ ȯÀÚ¿¡ ÀÌ ¾à Åõ¿©½Ã Ç÷´ç°ÇÏÁ¦ÀÇ ¿ë·®À» Á¶ÀýÇÏ´Â µî ÁÖÀÇÇÑ´Ù.
3) »çÀÌŬ·Î½ºÆ÷¸°À» º´¿ëÅõ¿©½Ã »çÀÌŬ·Î½ºÆ÷¸°ÀÇ °£ ¹èÃâ °¨¼Ò¿¡ ÀÇÇØ ¼øÈ¯ÇÏ´Â »çÀÌŬ¸°½ºÆ÷¸°ÀÇ ³óµµ, Å©·¹¾ÆÆ¼´ÑÇ÷Áõ ¹× Æ®¶õ½º¾Æ¹Ì³ªÁ¦ÀÇ Áõ°¡°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. °æÇÇ Àû¿ëÇÑ ¿¡½ºÆ®¶óµð¿Ã¿¡ ´ëÇÑ ÀÌ·¯ÇÑ ¹æÇØÀÇ Á¸Àç´Â ¾Ë·ÁÁ® ÀÖÁö ¾Ê´Ù.
|
| Related FDA Approved Drug |
±âÁØ ¼ººÐ: ESTRADIOL HEMIHYDRATEESTRASORB (ESTRADIOL HEMIHYDRATE)
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Xµî±Þ
(estradiol valerate 1mg )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
ÀÓ»êºÎ ¶Ç´Â ÀӽŰèȹÁß º¹¿ë±ÝÁö |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Estradiol¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Estradiol¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Estradiol enters target cells freely (e.g., female organs, breasts, hypothalamus, pituitary) and interacts with a target cell receptor. When the estrogen receptor has bound its ligand it can enter the nucleus of the target cell, and regulate gene transcription which leads to formation of messenger RNA. The mRNA interacts with ribosomes to produce specific proteins that express the effect of estradiol upon the target cell. Estrogens increase the hepatic synthesis of sex hormone binding globulin (SHBG), thyroid-binding globulin (TBG), and other serum proteins and suppress follicle-stimulating hormone (FSH) from the anterior pituitary.
|
| Pharmacology |
Estradiol¿¡ ´ëÇÑ Pharmacology Á¤º¸ Estradiol, the principal intracellular human estrogen, is substantially more active than its metabolites, estrone and estriol, at the cellular level.
|
| Absorption |
Estradiol¿¡ ´ëÇÑ Absorption Á¤º¸ 43%
|
| Pharmacokinetics |
Estradiol hemihydrateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : À§Àå°ü¿¡¼ ½Å¼ÓÈ÷ Èí¼ö
Àå°£¼øÈ¯(enterohepatic recirculation)
- ºÐÆ÷ : ÅÂ¹Ý Åë°ú, À¯ÁóºÐºñ
- ´Ü¹é°áÇÕ : 80 %
- ¹Ý°¨±â : 50-60 ºÐ
- ´ë»ç : °£¿¡¼ ºñȰ¼º ¹°Áú·Î ´ë»ç
- ¼Ò½Ç : ¼Òº¯°ú ´ãÁóÀ¸·Î ¹è¼³
|
| Toxicity |
Estradiol¿¡ ´ëÇÑ Toxicity Á¤º¸ Can cause nausea and vomiting, and withdrawal bleeding may occur in females.
|
| Drug Interactions |
Estradiol¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Amobarbital The enzyme inducer decreases the effect of hormonesAprobarbital The enzyme inducer decreases the effect of hormonesButabarbital The enzyme inducer decreases the effect of hormonesButalbital The enzyme inducer decreases the effect of hormonesButethal The enzyme inducer decreases the effect of hormonesEthotoin The enzyme inducer decreases the effect of hormonesFosphenytoin The enzyme inducer decreases the effect of hormonesGriseofulvin The enzyme inducer decreases the effect of hormonesHeptabarbital The enzyme inducer decreases the effect of hormonesHexobarbital The enzyme inducer decreases the effect of hormonesMephenytoin The enzyme inducer decreases the effect of hormonesMethohexital The enzyme inducer decreases the effect of hormonesMethylphenobarbital The enzyme inducer decreases the effect of hormonesPentobarbital The enzyme inducer decreases the effect of hormonesPhenobarbital The enzyme inducer decreases the effect of hormonesPhenytoin The enzyme inducer decreases the effect of hormonesPrednisolone The estrogenic agent increases the effect of corticosteroidPrednisone The estrogenic agent increases the effect of corticosteroidPrimidone The enzyme inducer decreases the effect of hormonesSecobarbital The enzyme inducer decreases the effect of hormonesTalbutal The enzyme inducer decreases the effect of hormonesRaloxifene Association not recommendedUrsodeoxycholic acid Estrogens decreases the effect of ursodiol
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Estradiol¿¡ ´ëÇÑ Description Á¤º¸ Generally refers to the 17-beta-isomer of estradiol, an aromatized C18 steroid with hydroxyl group at 3-beta- and 17-beta-position. Estradiol-17-beta is the most potent form of mammalian estrogenic steroids. In humans, it is produced primarily by the cyclic ovaries and the placenta. It is also produced by the adipose tissue of men and postmenopausal women. The 17-alpha-isomer of estradiol binds weakly to estrogen receptors (receptors, estrogen) and exhibits little estrogenic activity in estrogen-responsive tissues. Various isomers can be synthesized. [PubChem]
|
| Dosage Form |
Estradiol¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Disc TransdermalGel TransdermalLiquid IntramuscularPatch TransdermalRing IntravaginalTablet IntravaginalTablet Oral
|
| Drug Category |
Estradiol¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-menopausal AgentsAnticholesteremic AgentsEstrogens
|
| Smiles String Canonical |
Estradiol¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC12CCC3C(CCC4=C3C=CC(O)=C4)C1CCC2O
|
| Smiles String Isomeric |
Estradiol¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@]12CC[C@H]3[C@@H](CCC4=C3C=CC(O)=C4)[C@@H]1CC[C@@H]2O
|
| InChI Identifier |
Estradiol¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1
|
| Chemical IUPAC Name |
Estradiol¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol
|
| Drug-Induced Toxicity Related Proteins |
ESTRADIOL ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Myc proto-oncogene protein Drug:estradiol Toxicity:cytotoxic responses . [¹Ù·Î°¡±â] Replated Protein:3-hydroxy-3-methylglutaryl-coenzyme A reductase Drug:estradiol Toxicity:stimulate steroidogenesis. [¹Ù·Î°¡±â] Replated Protein:Stromelysin-2 Drug:estradiol Toxicity:nonbacterial prostatitis. [¹Ù·Î°¡±â] Replated Protein:Transcription factor E2F1 Drug:estradiol Toxicity:cytotoxic responses. [¹Ù·Î°¡±â] Replated Protein:Glucocorticoid receptor Drug:estradiol Toxicity:glucocorticoid resistance. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2020-05-11
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|