| |
|
|
|
|
|
 |
| |
|
ÄÞºñ½ºÅ͸¥¾ØÀ¯µðÁ¡¾È¾× [Neomycin Sulfate , Polymyxin B Sulfate]
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
[E25340021]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/0.4ml(2007.03.01)(ÇöÀç¾à°¡)
\382 ¿ø/0.4ml(2003.12.24)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»ö ÇÃ¶ó½ºÆ½ º´¿¡ ¹ÌȲ»öÀÇ Åõ¸íÇ× ¾×À» ÇÔÀ¯ÇÑ Á¡¾ÈÁ¦ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
Ȳ»êÆú¸®¹Í½ÅB, Ȳ»ê³×¿À¸¶À̽а¨¼ö¼º ±Õ¿¡ ÀÇÇÑ °á¸· ¹× ´©³¶ÀÇ °¨¿°Ä¡·á
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
º¸Åë ¼ºÀο¡¼ 1ȸ 1¹æ¿ï, 1ÀÏ 3-5ȸ ÀÏÁ¤ÇÑ ½Ã°£°£°ÝÀ» À¯ÁöÇÏ¿© °á¸·³¶¿¡ Á¡¾ÈÇÑ´Ù.
Á¡¾È ÈÄ ³²Àº ¾×°ú ¿ë±â´Â ¹Ù·Î ¹ö¸°´Ù.
|
| ÁÖ¿ä¾à¹° »óÈ£ÀÛ¿ë |
[Á¶È¸]
|
| ±Ý±â |
1) ÀÌ ¾à ¹× ÀÌ ¾àÀÇ ¼ººÐ¿¡ °ú¹ÎÁõÀÇ º´·ÂÀÌ Àִ ȯÀÚ
2) ½Å»ý¾Æ
|
| ½ÅÁßÅõ¿© |
1) ¹ÙÀÌ·¯½º³ª Áø±Õ ¹× °áÇÙ¼º ¾ÈÁúȯ¿¡ Áߺ¹ °¨¿°µÇ¾î Àִ ȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
1) ³×¿À¸¶À̽б¹¼Ò Åõ¿©ÈÄ °¡·Á¿ò, ¹ßÀû, °á¸· ¹× ´«²¨Ç®ÀÇ ºÎÁ¾ µî ¾Ë·¹¸£±â ¹ÝÀÀÀÌ ¿¬±¸¸¦ ÅëÇÏ¿© º¸°íµÇ¾úÀ¸³ª µå¹°°Ô Æú¸®¹Í½ÅÀ» Åõ¿© ÈÄ ÀÌ·¯ÇÑ ¹ÝÀÀÀÌ ¹ß»ýÇÏ¿´´Ù.
2) ³×¿À¸¶À̽б¹¼Ò Åõ¿©½Ã ±Í, ½ÅÀå, ½Å°æ¿¡ µ¶¼ºÀ» ³ªÅ¸³¾ ¼ö ÀÖ´Ù.
3) ÀÌ ¾àÀÇ Àå±â Åõ¿©¿¡ ÀÇÇØ Áø±ÕÀ» Æ÷ÇÔÇÑ ºñ°¨¼ö¼º ¹Ì»ý¹°ÀÌ °úµµÇÏ°Ô Áõ½ÄµÇ¾ú´Ù.
4) ÀÌ ¾à¿¡ ´ëÇÑ ¼¼±Õ ³»¼ºÀÌ »ý±æ ¼ö ÀÖÀ¸¹Ç·Î, È³ó¼º ºÐºñ¹°, ¿°Áõ, ÅëÁõÀÌ ¾ÇȵǸé ÀÌ ¾àÀÇ Åõ¿©¸¦ ÁßÁöÇϰí ÀÇ»ç¿Í »ó´ãÇÑ´Ù.
5) ÷°¡Á¦ : ÀÌ ¾àÀº Àλ꿰À» Æ÷ÇÔÇϰí ÀÖ´Ù.
»ó´çÇÑ °¢¸· ¼Õ»óÀÌ ÀÖ´Â ÀϺΠȯÀÚ¿¡¼ Àλ꿰 ÇÔÀ¯ Á¡¾È¾×ÀÇ »ç¿ë°ú ¿¬°üµÇ¾î °¢¸· ¼®È¸ÈÀÇ »ç·Ê°¡ ¸Å¿ì µå¹°°Ô(0.01% ¹Ì¸¸) º¸°íµÈ ¹Ù ÀÖ´Ù.
|
| »óÈ£ÀÛ¿ë |
ÇöÀç±îÁö ¾Ë·ÁÁø ´Ù¸¥ ¾à¹°°úÀÇ »óÈ£ÀÛ¿ëÀº ¾ø´Ù.
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| Á¦Çüº° º¹¾àÁöµµ |
[Á¡¾È¾×] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Neomycin¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Aminoglycosides like neomycin "irreversibly" bind to specific 30S-subunit proteins and 16S rRNA. Specifically neomycin binds to four nucleotides of 16S rRNA and a single amino acid of protein S12. This interferes with decoding site in the vicinity of nucleotide 1400 in 16S rRNA of 30S subunit. This region interacts with the wobble base in the anticodon of tRNA. This leads to interference with the initiation complex, misreading of mRNA so incorrect amino acids are inserted into the polypeptide leading to nonfunctional or toxic peptides and the breakup of polysomes into nonfunctional monosomes.
|
| Pharmacology |
Neomycin¿¡ ´ëÇÑ Pharmacology Á¤º¸ Neomycin is an aminoglycoside antibiotic. Aminoglycosides work by binding to the bacterial 30S ribosomal subunit, causing misreading of t-RNA, leaving the bacterium unable to synthesize proteins vital to its growth. Aminoglycosides are useful primarily in infections involving aerobic, Gram-negative bacteria, such as Pseudomonas, Acinetobacter, and Enterobacter. In addition, some mycobacteria, including the bacteria that cause tuberculosis, are susceptible to aminoglycosides. Infections caused by Gram-positive bacteria can also be treated with aminoglycosides, but other types of antibiotics are more potent and less damaging to the host. In the past the aminoglycosides have been used in conjunction with penicillin-related antibiotics in streptococcal infections for their synergistic effects, particularly in endocarditis. Aminoglycosides are mostly ineffective against anaerobic bacteria, fungi and viruses.
|
| Protein Binding |
Neomycin¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Protein binding studies have shown that the degree of aminoglycoside protein binding is low and, depending upon the methods used for testing, may be between 0% and 30%.
|
| Half-life |
Neomycin¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 2 to 3 hours
|
| Absorption |
Neomycin¿¡ ´ëÇÑ Absorption Á¤º¸ Poorly absorbed from the normal gastrointestinal tract. Although only approximately 3% of neomycin is absorbed through intact intestinal mucosa, significant amounts may be absorbed through ulcerated or denuded mucosa or if inflammation is present.
|
| Pharmacokinetics |
Neomycin SulfateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : °æ±¸, °æÇÇ : Èí¼öµÇ´Â ¾çÀÌ ¹Ì¹ÌÇÏ´Ù. (3%)
- ºÐÆ÷ : ºÐÆ÷¿ëÀû : 0.36 L/kg
- ´ë»ç : ¼Ò·®ÀÌ °£¿¡¼ ´ë»çµÈ´Ù.
- ¹Ý°¨±â : 3 ½Ã°£ (³ªÀÌ¿Í ½Å±â´É¿¡ ÀÇÁ¸)
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ :
- °æ±¸ : 1-4 ½Ã°£
- ±ÙÀ°ÁÖ»ç : 2 ½Ã°£ À̳»
- ¼Ò½Ç :
- ÁÖ»çÁ¦ : ½Å¹è¼³ (30-50%°¡ ¹Ìº¯Èü·Î ¹è¼³)
- °æ±¸ : 97%°¡ ¹Ìº¯Èü·Î º¯¹è¼³
Polymyxin B SulfateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö :
- º¹¸·¿¡¼ Àß Èí¼öµÈ´Ù.
- À§Àå°ü(½Å»ý¾Æ Á¦¿Ü), Á¡¸·, ÇǺο¡¼´Â Àß Èí¼öµÇÁö ¾Ê´Â´Ù.
- ºÐÆ÷ :
- ³úô¼ö¾×À¸·ÎÀÇ ºÐÆ÷´Â ¹Ì¹ÌÇÏ´Ù.
- ŹÝÅë°ú
- ¹Ý°¨±â : 4.5-6 ½Ã°£, ½Å±â´É ÀúÇϽà ¿¬ÀåµÈ´Ù.
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : IM : 2½Ã°£ À̳»
- ¼Ò½Ç : »ç±¸Ã¼ ¿©°ú¸¦ ÅëÇØ 60% ÀÌ»óÀÌ ¹Ìº¯Èü·Î ½Å¹è¼³µÈ´Ù.
|
| Biotransformation |
Neomycin¿¡ ´ëÇÑ Biotransformation Á¤º¸ Neomycin undergoes negligible biotransformation after parenteral administration.
|
| Toxicity |
Neomycin¿¡ ´ëÇÑ Toxicity Á¤º¸ LD50 = 200 mg/kg (rat). Because of low absorption, it is unlikely that acute overdosage would occur with oral neomycin. However, prolonged administration could result in sufficient systemic drug levels to produce neurotoxicity, ototoxicity and/or nephrotoxicity.
|
| Drug Interactions |
Neomycin¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Neomycin¿¡ ´ëÇÑ Description Á¤º¸ A component of neomycin that is produced by Streptomyces fradiae. On hydrolysis it yields neamine and neobiosamine B. (From Merck Index, 11th ed)
|
| Drug Category |
Neomycin¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Bacterial AgentsAntibiotics
|
| Smiles String Canonical |
Neomycin¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ NCC1OC(OC2C(N)CC(N)C(O)C2OC2OC(CO)C(OC3OC(CN)C(O)C(O)C3N)C2O)C(N)C(O)C1O
|
| Smiles String Isomeric |
Neomycin¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O
|
| InChI Identifier |
Neomycin¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C23H46N6O13/c24-2-7-13(32)15(34)10(28)21(37-7)40-18-6(27)1-5(26)12(31)20(18)42-23-17(36)19(9(4-30)39-23)41-22-11(29)16(35)14(33)8(3-25)38-22/h5-23,30-36H,1-4,24-29H2/t5-,6+,7-,8+,9-,10-,11-,12+,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23+/m1/s1
|
| Chemical IUPAC Name |
Neomycin¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (2R,3S,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-2-[(2S,3R,4S,5R)-4-[(2R,3R,4R,5S,6S)-3-amino-6-(aminomethyl)-4,5-dihydroxyoxan-2-yl]oxy-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-3-hydroxycyclohexyl]oxyoxane-3,4-diol
|
| Drug-Induced Toxicity Related Proteins |
NEOMYCIN ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:NMDA receptor-regulated protein Drug:neomycin Toxicity:excitotoxic activation. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2015-12-15
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|