| |
|
|
|
|
|
 |
| |
|
¿¡¾î·Îµð¿Ã³ªÀß½ºÇÁ·¹ÀÌ AERODIOL NASAL SPRAY[Estradiol hemihydrate]
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
¼öÀÔÀǾàǰ
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
[E00200211]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/4.2ml/º´(2007.03.01)(ÇöÀç¾à°¡)
\15,213 ¿ø/4.2ml/º´(2007.01.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
ºñ°¿ë ºÐ¹«±â°¡ ºÎÂøµÈ ¹«»öÅõ¸íÇÑ ¾×ü°¡ µç ¹é»ö ºÒÅõ¸í ÇÃ¶ó½ºÆ½ ¿ë±â [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
4.2ml(60ȸ¿ë)/bottle |
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
Æó°æ ÈÄ ¿©¼º¿¡¼ÀÇ ¿¡½ºÆ®·Î°Õ °áÇÌ Áõ»óÀÇ Ä¡·á
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
[ÁÖ¼ººÐÄÚµå:154907CSI ¿¡ µû¸¥ ½É»çÁöħ¿¶÷]
ºñ°³» Åõ¿©.
Ãʱâ Ãßõ¿ë·®Àº ´Üȸ ¿ë·®À¸·Î¼ 24½Ã°£¸¶´Ù 300§¶(2ȸ ºÐ¹«)À» ºñ°ø(Þ¬Íî)¿¡ ºÐ¹«ÇÑ´Ù. ¸ÅÀÏ µ¿ÀÏ ½Ã°£¿¡ Åõ¿©ÇÏ´Â °ÍÀÌ ÁÁ´Ù.
2 ¶Ç´Â 3ÁÖ±âÀÌÈÄ¿¡´Â ´ÙÀ½°ú °°Àº ÀÓ»óÁõ»ó¿¡ µû¶ó ¿ë·®À» Á¶ÀýÇÒ ¼ö ÀÖ´Ù :
- Ç÷°ü¿îµ¿¼ºÀå¾Ö(¾È¸éÈ«Á¶, ¾ß°£¹ßÇÑ), ºñ´¢»ý½Ä±â À§Ãà(Áú °ÇÁ¶°¨, ¼º±³ºÒÄèÁõ, ¿ÜÀ½-Áú À§Ãà) ¶Ç´Â ÁßÃ߽Űæ°è Àå¾Ö(¼ö¸éÀå¾Ö, ÇÇ·Î, ¿ì¿ï°æÇâ)¿Í °°Àº, ¿¡½ºÆ®·ÎÁ¨ °áÇÌÁõ»óÀÌ Áö¼ÓµÈ´Ù¸é, ¾ÆÄ§°ú Àú³áÀ¸·Î ³ª´©¾î 1ÀÏ 3ȸ ¶Ç´Â 4ȸ ºÐ¹«·Î(450§¶ ¶Ç´Â 600§¶) Áõ·®ÇÒ ¼ö ÀÖ´Ù.
- À¯¹æ±äÀå°¨, º¹ºÎ-°ñ¹ÝÀÇ °íÀå(ÍÕíó), ºÒ¾È, ½Å°æÁú ¶Ç´Â °ø°ÝÀû ¼ºÁú°ú °°Àº °í¿¡½ºÆ®·ÎÁ¨¼º ½ÅÈ£°¡ ³ªÅ¸³ª´Â °æ¿ì¿¡´Â 1ÀÏ 1ȸ ºÐ¹«(150§¶)·Î ¿ë·®À» °¨ ¼Ò½ÃÄÑ¾ß ÇÑ´Ù.
¸ðµç ȯÀÚ´Â È¿°ú¸¦ ³ªÅ¸³»´Â °¡Àå ³·Àº ¿ë·®À¸·Î Ä¡·á°¡ Áö¼ÓµÇ¾î¾ß ÇÑ´Ù.
¿¡¾î·Îµð¿ÃÀº ÁÖ±âÀû ¶Ç´Â Áö¼ÓÀû Ä¡·á·Î Åõ¿©µÉ ¼ö ÀÖ´Ù.
- Áֱ⠿ä¹ý : ¿¡¾î·Îµð¿ÃÀ» 21ÀÏ ³»Áö 28ÀÏÀº Åõ¿©Çϰí 2ÀÏ ³»Áö 7ÀÏÀº ÈÞ¾àÇÏ¸é¼ ÁÖ±âÀûÀ¸·Î Åõ¿©ÇÑ´Ù.
- Áö¼Ó ¿ä¹ý : ¿¡¾î·Îµð¿ÃÀ» ÈÞ¾à±â°£¾øÀÌ ¸ÅÀÏ Åõ¿©ÇÑ´Ù.
Áö¼Ó¿ä¹ý(ºñÁÖ±âÀû ¿ä¹ý)Àº ÀÚ±ÃÀûÃâ ¿©¼º ¹× ÈÞ¾à±â°£µ¿¾È ¿¡½ºÆ®·ÎÁ¨°áÇÌÁõ»óÀÌ ¹ß»ýÇÑ È¯ÀÚ¿¡°Ô Àû¿ëµÉ ¼ö ÀÖ´Ù.
ºñ-ÀÚ±ÃÀûÃâ¿©¼º¿¡ Åõ¿©½Ã, ¿¡¾î·Îµð¿ÃÀº ÇÁ·ÎÁ¦½ºÅäÁ¨°ú º´¿ëÅõ¿©µÇ¾î¾ß ÇÏ¸ç ¿¡½ºÆ®·ÎÁ¨-À¯µµ Àڱ󻸷ÀÇ °úÁõ½ÄÀ» ¾ïÁ¦Çϱâ À§Çؼ´Â Áֱ⸶´Ù Àû¾îµµ 12 ÀÏÀº ÇÁ·ÎÁ¦½ºÅäÁ¨ÀÌ Åõ¿©µÇ¾î¾ß ÇÑ´Ù.
- ¿¡¾î·Îµð¿ÃÀÌ ÁÖ±âÀûÀ¸·Î Åõ¿©µÇ´Â °æ¿ì¿¡´Â Àû¾îµµ »ý¸®ÁÖ±âÀÇ ¸¶Áö¸· 12Àϵ¿¾È ÇÁ·ÎÁ¦½ºÅäÁ¨À» ¿¡½ºÆ®¶óµð¿Ã°ú º´¿ëÅõ¿©ÇÑ´Ù.
- ¿¡¾î·Îµð¿ÃÀÌ Áö¼ÓÀûÀ¸·Î Åõ¿©µÇ´Â °æ¿ì¿¡´Â 1°³¿ù¸¶´Ù Àû¾îµµ 12Àϵ¿¾È ÇÁ·ÎÁ¦½ºÅäÁ¨À» º¹¿ëÇÒ °ÍÀ» ÃßõÇÑ´Ù.
ÇÁ·ÎÁ¦½ºÅäÁ¨ Åõ¿©¸¦ Áß´ÜÇÒ ¶§ ÆÄźÃâÇ÷ÀÌ ¹ß»ýÇÒ ¼öµµ ÀÖ´Ù.
´ÙÀ½°ú °°Àº °æ¿ì, ÇÊ¿äÇÏ´Ù¸é Åõ¿©¿ë·®Á¶ÀýÀ» À§ÇØ À§Çè/ÀÕÁ¡ÀÇ ºñÀ²ÀÌ Á¤±âÀûÀ¸·Î ÀçÆò°¡µÇ¾î¾ß ÇÑ´Ù. (6°³¿ù¸¶´Ù)
- ¿¡¾î·Îµð¿Ã Åõ¿©µ¿¾È
- ´Ù¸¥ È£¸£¸ó¿ä¹ý¿¡¼ ¿¡¾î·Îµð¿Ã·Î º¯°æÇÒ ¶§
ÁßÁõÀÇ ºñ°øÆó¼â½Ã¿¡, ¿¡¾î·Îµð¿ÃÀº Ä¡Àº±¸¸¦ ÅëÇÑ Åõ¿©¿¡ ÀÇÇØ ÀϽÃÀûÀ¸·Î °æ±¸ Åõ¿©µÉ ¼ö ÀÖÀ¸¸ç, ÀÌ·¯ÇÑ °æ¿ì¿¡´Â ¿ë·®Àº µÎ¹èÀ̾î¾ß ÇÑ´Ù.
Á¡¾×ºÐºñ°¡ Àִ ȯÀÚ¿¡´Â ÀÌ ¾àÀ» Åõ¿©Çϱâ Àü¿¡ ºñ°³» Á¡¾×À» Á¦°ÅÇØ¾ß ÇÑ´Ù.
[Á¦Çüº°º¹¾àÁöµµ]
|
| ±Ý±â |
- ÀÌ ¾àÀÇ ¼ººÐ Áß Çϳª¿¡ °ú¹ÎÇÏ´Ù°í ¾Ë·ÁÁø ȯÀÚ
- Áø´ÜµÇÁö ¾ÊÀº »ý½Ä±â ÃâÇ÷
- Áö³ 2³âÀ̳»ÀÇ È°µ¿¼º Á¤¸ÆÇ÷Àü»öÀüÁõ(ÁßÁõÀÇ Á¤¸Æ Ç÷ÀüÁõ, Æó»öÀüÁõ)
- Àç¹ß¼º Á¤¸Æ Ç÷Àü»öÀüÁõÀÇ º´·Â ¶Ç´Â Ç×ÀÀ°íÁ¦ Ä¡·á¸¦ ¹ÞÀº ÀûÀº ¾øÀ¸³ª Ç÷Àü¹ßÇö°æÇâÀÌ ÀÖ´Ù°í ¾Ë·ÁÁø ȯÀÚ
- À¯¹æ¾Ï ¶Ç´Â ±× ¿Ü ¿¡½ºÆ®·ÎÁ¨ ÀÇÁ¸¼º Á¾¾çÀ¸·Î ¾Ë·ÁÁø ¶Ç´Â ÀǽÉÀÌ µÇ´Â ȯÀÚ
- ±Þ¼º ¶Ç´Â ¸¸¼º °£Áúȯ ¶Ç´Â °£±â´É°Ë»ç¿¡¼ Á¤»óÀ¸·Î µÇµ¹¾Æ°¡Áö ¸øÇÑ´Ù°í Áø´ÜµÈ °£Áúȯ º´·Â
- ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀÎ ¹× ¼öÀ¯ºÎ
|
| ½ÅÁßÅõ¿© |
´ÙÀ½ÀÇ °æ¿ì Áß Çϳª¿¡ ÇØ´çÇϰųª ÀÌÀü¿¡ ¹ß»ýÇÑ ÀûÀÌ ÀÖ°í/°Å³ª Àӽŵ¿¾È ¶Ç´Â ÀÌÀü È£¸£¸ó Åõ¿©½Ã ¾ÇÈµÈ ÀûÀÌ ÀÖ´Â °æ¿ì¿¡´Â, ¾à¹° Åõ¿©ÀÇ ÀÕÁ¡ ÀÌ °¡´ÉÇÑ À§ÇèÀ» »óÈ¸ÇØ¾ß ÇÑ´Ù. À̵éÀÇ °æ¿ì, ȯÀڴ öÀúÇÑ °ü¸®¸¦ ¹Þ¾Æ ¾ß ÇÏ¸ç µå¹® °æ¿ì HRT·Î ÀÎÇØ À̵é Áõ»óÀÌ Àç¹ßÇϰųª ¾Ç鵃 ¼ö ÀÖ´Ù´Â °ÍÀÌ °í·ÁµÇ¾î¾ß ÇÑ´Ù.
- ¿¡½ºÆ®·ÎÁ¨ ÀÇÁ¸¼º Á¾¾ç
- ÆòȰ±ÙÁ¾, Àڱ󻸷Áõ, Àڱà ³»¸· °úÁõ½Ä
- À¯¹æÀÇ ¼¶À¯³¶Æ÷¼º Áúȯ
- Ç÷Àü»öÀüÁõ Àå¾ÖÀÇ º´·Â ¶Ç´Â ÀÌÀÇ À§Çè ¿ä¼Ò°¡ ÀÖ´Â °æ¿ì
- õ½Ä
- °íÇ÷¾Ð
- Ç÷°ü Åðȸ¦ µ¿¹ÝÇÏ´Â ´ç´¢º´
- °£Áúȯ (Æ÷¸£ÇǸ°Áõ, °£¼±Á¾)
- ´ã¼®Áõ
- ÆíµÎÅë ¶Ç´Â (ÁßÁõÀÇ) µÎÅë
- °£Áú
- ÇÁ·Î·¢Æ¾Á¾
- Àü½Å¼º È«¹Ý¼º ·çÇÁ½º
- ºñ(Þ¬)ÃâÇ÷
|
| ÀÌ»ó¹ÝÀÀ |
- ÀÌ ¾à Åõ¿©Áß °¡Àå ºó¹øÇÏ°Ô º¸°íµÈ ºÎÀÛ¿ë(>10%)Àº Åõ¿© ºÎÀ§¿¡¼ÀÇ ¹ÝÀÀÀÌ´Ù ; Â´Â µíÇÑ ¾¥½Ã´Â µíÇÑ ´À³¦, Àçä±â ¹× ºñ·ç.
- ÀÌ ¾à Åõ¿©Áß ¶Ç´Â ´Ù¸¥ ºñ-°æ±¸¿ë ¿¡½ºÆ®¶óµð¿Ã Åõ¿©¿¡¼ º¸°íµÈ ±×¿Ü ºÎÀÛ¿ëÀº ´ÙÀ½°ú °°´Ù.
- ¿¹¿ÜÀûÀ¸·Î ¿¡½ºÆ®·ÎÁ¨À» Åõ¿©¹ÞÀº ¿©¼º¿¡¼ °¥»ö¹Ý, ´ÙÇü È«¹Ý, °áÀý¼º È«¹Ý ±×¸®°í °£¼±Á¾ÀÌ º¸°íµÈ ÀûÀÌ ÀÖ¾ú´Ù. ÁßÁõÀÇ ´Ù¸® ¶Ç´Â °ñ¹Ý¿¡¼ ÀÇ Á¤¸Æ Ç÷ÀüÁõ ¹× Æó»öÀüÁõ°ú °°Àº Á¤¸ÆÇ÷Àü»öÀü Àå¾Ö°¡ HRT ºñ»ç¿ë ÀÚº¸´Ù HRT »ç¿ëÀÚ¿¡¼ ´õ ºó¹øÇÏ´Ù.
|
| »óÈ£ÀÛ¿ë |
¾à¹°Åõ¿©Áß ÁÖÀǰ¡ ¿ä±¸µÇ´Â º´¿ë¾àÁ¦
- È¿¼ÒÀ¯µµÁ¦
Ç×Àü°£Á¦(Ä«¹Ù¸¶Á¦ÇÉ, Æä³ë¹ÙºñÅ», Æä´ÏÅäÀÎ, ÇÁ¸®¹Ìµ·), ¹ÙºñÃò·¹ÀÌÆ®,±×¸®¼¼¿ÀÇúó, ¸®ÆÄºÎƾ, ¸®ÆÊÇǽŠ: ¿¡½ºÆ®·ÎÁ¨ È¿´ÉÀÌ °¨¼ÒµÉ ¼ö ÀÖ´Ù.
ÀÌµé ¾à¹°ÀÇ Åõ¿© Áß ¹× Åõ¿©ÈÄ¿¡´Â ÀÓ»óÀû ¸ð´ÏÅ͸µ°ú ÇÔ²² ¿¡½ºÆ®·ÎÁ¨ ¿ë·®À» Á¶ÀýÇÑ´Ù.
- ºñ°Åõ¿©¿ë ÄÚ¸£Æ¼ÄÚ ½ºÅ×·ÎÀ̵å·ù ¹× Ç÷°ü ¼öÃà ¾à¹°.
ºñ°¿ë ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀ̵å·ù ¶Ç´Â ºñ°¿ë Ç÷°ü ¼öÃà¾à¹°°úÀÇ º´¿ë Åõ¿©½ÃÀÇ ¿µÇâÀº ¿¬±¸µÇÁö ¾Ê¾Ò´Ù. ÀÌ ¾àÀº ºñ°¿ë ÄÚ¸£Æ¼ÄÚÀ̵å·ù ¶Ç´Â ºñ°¿ë Ç÷°ü ¼öÃà¾à¹° Åõ¿©ÈÄ¿¡ ¹Ù·Î Áï½Ã Åõ¿©µÇ¾î¼´Â ¾ÈµÈ´Ù.
|
| Related FDA Approved Drug |
±âÁØ ¼ººÐ: ESTRADIOL HEMIHYDRATEESTRASORB (ESTRADIOL HEMIHYDRATE)
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Xµî±Þ
(estradiol. ÀӺΠÅõ¿© ±Ý±â )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
ÀÓ»êºÎ ¶Ç´Â ÀӽŰèȹÁß º¹¿ë±ÝÁö |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Estradiol¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Estradiol¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Estradiol enters target cells freely (e.g., female organs, breasts, hypothalamus, pituitary) and interacts with a target cell receptor. When the estrogen receptor has bound its ligand it can enter the nucleus of the target cell, and regulate gene transcription which leads to formation of messenger RNA. The mRNA interacts with ribosomes to produce specific proteins that express the effect of estradiol upon the target cell. Estrogens increase the hepatic synthesis of sex hormone binding globulin (SHBG), thyroid-binding globulin (TBG), and other serum proteins and suppress follicle-stimulating hormone (FSH) from the anterior pituitary.
|
| Pharmacology |
Estradiol¿¡ ´ëÇÑ Pharmacology Á¤º¸ Estradiol, the principal intracellular human estrogen, is substantially more active than its metabolites, estrone and estriol, at the cellular level.
|
| Protein Binding |
Estradiol¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ >95%
|
| Half-life |
Estradiol¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 36 hours
|
| Absorption |
Estradiol¿¡ ´ëÇÑ Absorption Á¤º¸ 43%
|
| Pharmacokinetics |
Estradiol hemihydrateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : À§Àå°ü¿¡¼ ½Å¼ÓÈ÷ Èí¼ö
Àå°£¼øÈ¯(enterohepatic recirculation)
- ºÐÆ÷ : ÅÂ¹Ý Åë°ú, À¯ÁóºÐºñ
- ´Ü¹é°áÇÕ : 80 %
- ¹Ý°¨±â : 50-60 ºÐ
- ´ë»ç : °£¿¡¼ ºñȰ¼º ¹°Áú·Î ´ë»ç
- ¼Ò½Ç : ¼Òº¯°ú ´ãÁóÀ¸·Î ¹è¼³
|
| Biotransformation |
Estradiol¿¡ ´ëÇÑ Biotransformation Á¤º¸ Exogenous estrogens are metabolized using the same mechanism as endogenous estrogens. Estrogens are partially metabolized by cytochrome P450.
|
| Toxicity |
Estradiol¿¡ ´ëÇÑ Toxicity Á¤º¸ Can cause nausea and vomiting, and withdrawal bleeding may occur in females.
|
| Drug Interactions |
Estradiol¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Amobarbital The enzyme inducer decreases the effect of hormonesAprobarbital The enzyme inducer decreases the effect of hormonesButabarbital The enzyme inducer decreases the effect of hormonesButalbital The enzyme inducer decreases the effect of hormonesButethal The enzyme inducer decreases the effect of hormonesEthotoin The enzyme inducer decreases the effect of hormonesFosphenytoin The enzyme inducer decreases the effect of hormonesGriseofulvin The enzyme inducer decreases the effect of hormonesHeptabarbital The enzyme inducer decreases the effect of hormonesHexobarbital The enzyme inducer decreases the effect of hormonesMephenytoin The enzyme inducer decreases the effect of hormonesMethohexital The enzyme inducer decreases the effect of hormonesMethylphenobarbital The enzyme inducer decreases the effect of hormonesPentobarbital The enzyme inducer decreases the effect of hormonesPhenobarbital The enzyme inducer decreases the effect of hormonesPhenytoin The enzyme inducer decreases the effect of hormonesPrednisolone The estrogenic agent increases the effect of corticosteroidPrednisone The estrogenic agent increases the effect of corticosteroidPrimidone The enzyme inducer decreases the effect of hormonesSecobarbital The enzyme inducer decreases the effect of hormonesTalbutal The enzyme inducer decreases the effect of hormonesRaloxifene Association not recommendedUrsodeoxycholic acid Estrogens decreases the effect of ursodiol
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Estradiol¿¡ ´ëÇÑ Description Á¤º¸ Generally refers to the 17-beta-isomer of estradiol, an aromatized C18 steroid with hydroxyl group at 3-beta- and 17-beta-position. Estradiol-17-beta is the most potent form of mammalian estrogenic steroids. In humans, it is produced primarily by the cyclic ovaries and the placenta. It is also produced by the adipose tissue of men and postmenopausal women. The 17-alpha-isomer of estradiol binds weakly to estrogen receptors (receptors, estrogen) and exhibits little estrogenic activity in estrogen-responsive tissues. Various isomers can be synthesized. [PubChem]
|
| Dosage Form |
Estradiol¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Disc TransdermalGel TransdermalLiquid IntramuscularPatch TransdermalRing IntravaginalTablet IntravaginalTablet Oral
|
| Drug Category |
Estradiol¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-menopausal AgentsAnticholesteremic AgentsEstrogens
|
| Smiles String Canonical |
Estradiol¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC12CCC3C(CCC4=C3C=CC(O)=C4)C1CCC2O
|
| Smiles String Isomeric |
Estradiol¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@]12CC[C@H]3[C@@H](CCC4=C3C=CC(O)=C4)[C@@H]1CC[C@@H]2O
|
| InChI Identifier |
Estradiol¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1
|
| Chemical IUPAC Name |
Estradiol¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol
|
| Drug-Induced Toxicity Related Proteins |
ESTRADIOL ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Myc proto-oncogene protein Drug:estradiol Toxicity:cytotoxic responses . [¹Ù·Î°¡±â] Replated Protein:3-hydroxy-3-methylglutaryl-coenzyme A reductase Drug:estradiol Toxicity:stimulate steroidogenesis. [¹Ù·Î°¡±â] Replated Protein:Stromelysin-2 Drug:estradiol Toxicity:nonbacterial prostatitis. [¹Ù·Î°¡±â] Replated Protein:Transcription factor E2F1 Drug:estradiol Toxicity:cytotoxic responses. [¹Ù·Î°¡±â] Replated Protein:Glucocorticoid receptor Drug:estradiol Toxicity:glucocorticoid resistance. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2016-05-10
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|