| |
|
|
|
|
|
 |
| |
|
호스타실린주400만단위 HOSTACILLIN-AQU V.IM.[Penicillin G potassium , Procaine penicillin G]
|
|
전문의약품 | 삭제
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
652104200[A07400031]
[보험코드에 따른 약품기본정보 직접조회]
\0 원/10ml/1병(2004.08.01)(현재약가)
\1,107 원/10ml/1병(2002.11.15)(변경전약가)
[상병코드조회]
[질병코드조회]
|
| 빠른조회 |
|
| 제품성상 |
거의 백색의 분말 [제형정보 확인] |
| 포장·유통단위 |
1V.IM |
| 허가사항 원문조회 |
[허가사항 원문조회]
|
| 효능효과 |
[적응증 별 검색]
- 유효균종: 연쇄구균, (페니실린G감수성) 포도구균, 폐렴구균, 임균, 디프테리아균, 매독균
- 적응증: 편도염, 인두염, 후두염, 부비동염, 중이염, 단독, 성홍열, 폐렴, 기관지염, 임질, 매독, 디프테리아(항독소와 병용투여), 농가진, 봉와직염, 유선염, 림프절염
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
[주성분코드:328700BIJ 에 따른 심사지침열람]
페니실린 G로서 성인 1회 40만 단위를 1일 1-2회 근육주사한다.
연령, 증상에 따라 적절히 증감한다.
|
| 주요약물 상호작용 |
[조회]
|
| 금기 |
페니실린 또는 프로카인에 과민증의 병력이 있는 환자 |
| 신중투여 |
- 페니실린계 또는 세팔로스포린계 약물 및 다른 알러지에 과민증의 병력이 있는 환자
- 알러지 또는 천식의 병력이 있는 환자
- 중증 신장애 환자
|
| 이상반응 |
- 과민증:
반점상구진, 박탈성 피부염, 발진, 두드러기, 오한, 발열, 부종, 관절통, 쇠약 등이 타나날 수 있으며 이러한 증상이 나타난 경우에는 투여를 중지한다.
혈액: 용혈성빈혈, 백혈구 감소증, 혈소판 감소증이 나타날 수 있다.
소화기계: 구역, 구토, 복통, 설사 등이 나타날 수 있다.
프로카인에 의한 중독반응으로 불안, 혼란, 초조, 우울, 허약, 발작, 환각, 호전성을 포함한 정신장애가 나타날 수 있는데, 이러한 반응은 일시적인 것으로 15-30분간 지속되며 특히 1회에 과용량을 투여하였을 때 발생한다.
|
| 상호작용 |
프로베네시드와 병용투여에 의해 페니실린의 배설이 지연된다. |
| Related FDA Approved Drug |
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| |
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : B등급
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
| 병용금기 및 연령대금기 근거조회 |
[병용금기 및 연령대금기 근거조회]
|
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| 독성정보 |
Potassium에 대한 독성정보 : 정보보기
출처: 국립독성과학원 독성물질정보DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
potassium에 대한 Mechanism_Of_Action 정보
Potassium is the major cation (positive ion) inside animal cells, while sodium is the major cation outside animal cells. The concentration differences of these charged particles causes a difference in electric potential between the inside and outside of cells, known as the membrane potential. The balance between potassium and sodium is maintained by ion pumps in the cell membrane. The cell membrane potential created by potassium and sodium ions allows the cell generate an action potential?봞 "spike" of electrical discharge. The ability of cells to produce electrical discharge is critical for body functions such as neurotransmission, muscle contraction, and heart function. Potassium is also an essential mineral needed to regulate water balance, blood pressure and levels of acidity.
Procaine에 대한 Mechanism_Of_Action 정보
Procaine acts mainly by inhibiting sodium influx through voltage gated sodium channels in the neuronal cell membrane of peripheral nerves. When the influx of sodium is interrupted, an action potential cannot arise and signal conduction is thus inhibited. The receptor site is thought to be located at the cytoplasmic (inner) portion of the sodium channel. Procaine has also been shown to bind or antagonize the function of N-methyl-D-aspartate (NMDA) receptors as well as nicotinic acetylcholine receptors and the serotonin receptor-ion channel complex.
|
| Pharmacology |
potassium에 대한 Pharmacology 정보
Not Available
Procaine에 대한 Pharmacology 정보
Procaine is an anesthetic agent indicated for production of local or regional anesthesia, particularly for oral surgery. Procaine (like cocaine) has the advantage of constricting blood vessels which reduces bleeding, unlike other local anesthetics like lidocaine. Procaine is an ester anesthetic. It is metabolized in the plasma by the enzyme pseudocholinesterase through hydrolysis into para-aminobenzoic acid (PABA), which is then excreted by the kidneys into the urine.
|
| Protein Binding |
Procaine에 대한 단백결합 정보
Not Available
|
| Half-life |
Procaine에 대한 반감기 정보
7.7 minutes
|
| Absorption |
potassium에 대한 Absorption 정보
Not Available
Procaine에 대한 Absorption 정보
Not Available
|
| Biotransformation |
Procaine에 대한 Biotransformation 정보
Hydrolysis by plasma esterases to PABA
|
| Toxicity |
potassium에 대한 Toxicity 정보
Not Available
Procaine에 대한 Toxicity 정보
Not Available
|
| Drug Interactions |
potassium에 대한 Drug_Interactions 정보
Amiloride Increased risk of hyperkaliemiaBenazepril Increased risk of hyperkaliemiaCandesartan Increased risk of hyperkaliemiaCaptopril Increased risk of hyperkaliemiaCilazapril Increased risk of hyperkaliemiaDrospirenone Increased risk of hyperkaliemiaEnalapril Increased risk of hyperkaliemiaEplerenone This association presents an increased risk of hyperkaliemiaEprosartan Increased risk of hyperkaliemiaForasartan Increased risk of hyperkaliemiaFosinopril Increased risk of hyperkaliemiaIrbesartan Increased risk of hyperkaliemiaLisinopril Increased risk of hyperkaliemiaLosartan Increased risk of hyperkaliemiaMoexipril Increased risk of hyperkaliemiaPerindopril Increased risk of hyperkaliemiaPolystyrene sulfonate Antagonism of actionQuinapril Increased risk of hyperkaliemiaRamipril Increased risk of hyperkaliemiaSaprisartan Increased risk of hyperkaliemiaSpirapril Increased risk of hyperkaliemiaSpironolactone Increased risk of hyperkaliemiaTasosartan Increased risk of hyperkaliemiaTelmisartan Increased risk of hyperkaliemiaTrandolapril Increased risk of hyperkaliemiaTriamterene Increased risk of hyperkaliemiaValsartan Increased risk of hyperkaliemia
Procaine에 대한 Drug_Interactions 정보
Aluminium Formation of non-absorbable complexesBismuth Formation of non-absorbable complexesCalcium Formation of non-absorbable complexesDihydroxyaluminium Formation of non-absorbable complexesEstramustine Increases the levels of estramustineMagnesium oxide Formation of non-absorbable complexesMagnesium Formation of non-absorbable complexesSucralfate Formation of non-absorbable complexesIron Formation of non-absorbable complexes
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Drug Target |
[Drug Target]
|
| Description |
potassium에 대한 Description 정보
Potassium is the major cation (positive ion) inside animal cells, while sodium is the major cation outside animal cells. The concentration differences of these charged particles causes a difference in electric potential between the inside and outside of cells, known as the membrane potential. The balance between potassium and sodium is maintained by ion pumps in the cell membrane. The cell membrane potential created by potassium and sodium ions allows the cell generate an action potential?봞 "spike" of electrical discharge. The ability of cells to produce electrical discharge is critical for body functions such as neurotransmission, muscle contraction, and heart function. Potassium is also an essential mineral needed to regulate water balance, blood pressure and levels of acidity.
Procaine에 대한 Description 정보
A local anesthetic of the ester type that has a slow onset and a short duration of action. It is mainly used for infiltration anesthesia, peripheral nerve block, and spinal block. (From Martindale, The Extra Pharmacopoeia, 30th ed, p1016). [PubChem]
|
| Dosage Form |
potassium에 대한 Dosage_Form 정보
Aerosol OralCapsule OralCapsule, extended release OralElixir OralLiquid IntravenousLiquid OralLiquid SublingualPowder OralPowder, for solution OralSolution IntravenousSolution OralSolution / drops OralTablet OralTablet, extended release Oral
Procaine에 대한 Dosage_Form 정보
Capsule OralSolution InfiltrationSolution IntramuscularTablet, extended release Oral
|
| Drug Category |
Procaine에 대한 Drug_Category 정보
AnestheticsAnesthetics, LocalLocal Anesthetics
|
| Smiles String Canonical |
potassium에 대한 Smiles_String_canonical 정보
Not Available
Procaine에 대한 Smiles_String_canonical 정보
CCN(CC)CCOC(=O)C1=CC=C(N)C=C1
|
| Smiles String Isomeric |
potassium에 대한 Smiles_String_isomeric 정보
Not Available
Procaine에 대한 Smiles_String_isomeric 정보
CCN(CC)CCOC(=O)C1=CC=C(N)C=C1
|
| InChI Identifier |
potassium에 대한 InChI_Identifier 정보
Not Available
Procaine에 대한 InChI_Identifier 정보
InChI=1/C13H20N2O2/c1-3-15(4-2)9-10-17-13(16)11-5-7-12(14)8-6-11/h5-8H,3-4,9-10,14H2,1-2H3
|
| Chemical IUPAC Name |
potassium에 대한 Chemical_IUPAC_Name 정보
Not Available
Procaine에 대한 Chemical_IUPAC_Name 정보
2-diethylaminoethyl 4-aminobenzoate
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2021-12-09
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
[의약품병용/연령대금기 고시근거로 바로가기] 제목 없음
2008년 8월 1일 약가화일상 8월달 신규등재 및 삭제되는 품목 포함한 병용연령 금기 품목리스트 기준
1. 현재 검색한 제품에 대한 병용금기 제품 존재여부 및 검색
현재 이제품에 대한 병용금기에 해당하는 청구코드별 제품내역 공지내용이 없습니다
2. 연령대금기 존재여부
현재 이제품에 대한 연령금기에 해당하는 청구코드별 공지내용이 없습니다
|
|
|
|
전문/일반
