| |
|
|
|
|
|
 |
| |
|
º£·ç¸»¾× 13mL VERRUMAL SOLUTION
|
Àü¹®ÀǾàǰ | ºñ±Þ¿©
|
|
|
¼öÀÔÀǾàǰ
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
 |
Á¦Ç°º° ÀӺαݱ⠰í½Ã |
|
|
|
1µî±Þ: ¿øÄ¢Àû »ç¿ë±Ý±â / 2µî±Þ: ¸íÈ®ÇÑ ÀÓ»óÀû ±Ù°Å ¶Ç´Â »çÀ¯°¡ ÀÖ´Â °æ¿ì ºÎµæÀÌÇÏ°Ô »ç¿ë / Mµî±Þ: ÀÓ»óÀû»óȲ¿¡ µû¶ó 1µî±Þ ¶Ç´Â 2µî±ÞÀ¸·Î ºÐ·ùµÇ´Â ¼ººÐ
| ¼ººÐ¸í |
¼ººÐÄÚµå |
±Ý±âµî±Þ |
°í½Ã¹øÈ£ |
°í½ÃÀÏÀÚ |
ºñ°í |
| fluorouracil |
700800CLQ |
1 |
20160155 |
20161230 |
µ¿¹°½ÇÇè¿¡¼ ´ÙÁöÁõ, ±¸°³¿ µî ±âÇüÀ¯¹ß ÀÛ¿ë º¸°í. |
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
642501991[642501990]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
[ºñ±Þ¿©]
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
ÀÌ ¾àÀº ¹«»ö¡¾à°£ ³ë¶õ ÁÖȲ»öÀÇ Åõ¸íÇϰí Á¡¼ºÀÌ ÀÖ´Â ¾×Á¦·Î ¾Æ¼¼Æ®»ê¿¡Æ¿ ³¿»õ°¡ ³´Ù. [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
13¹Ð¸®¸®ÅÍ/º´. |
| ÁÖ¼ººÐÄÚµå |
700800CLQ
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
»ç¸¶±Í
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
1ÀÏ 2¢¦3ȸ »ç¸¶±Í À§¿¡ Á÷Á¢ ¹Ù¸£¸ç ¸Å¹ø °¢È ºÎÀ§¸¦ ¹þ°Ü ³½ ÈÄ »õ·Î ¹Ù¸¥´Ù.
|
| ±Ý±â |
1) ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀÎ ¹× ¼öÀ¯ºÎ
2) ÀÌ ¾à¿¡ °ú¹ÎÁõ ȯÀÚ
3) ¼Ò¾Æ
4) ÁßÁõÀÇ ½ÅÀå¾Ö ȯÀÚ
5) ÁßÁõÀÇ Æó±â´É Àå¾Ö ȯÀÚ
6) Ç÷¾×¼øÈ¯Àå¾Ö ȯÀÚ
7) ´«ÁÖÀ§, Á¡¸· µî
|
| ÀÌ»ó¹ÝÀÀ |
1) ÇǺÎ
¨ç ¶§¶§·Î Àû¿ë ºÎÀ§ÀÇ ÀÛ¿°¨, È«¹Ý, °¡·Á¿ò ¹× µÎµå·¯±â, ¸Æ°ü ºÎÁ¾°ú °°Àº °ú¹Î¹ÝÀÀÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù.
¨è µå¹°°Ô Á¢Ã˼º ÇǺΠ¾Ë·¹¸£±â ¹ÝÀÀ, ÇǺÎÀÇ ¹Ì¶õ(Áø¹«¸§) ¹ÝÀÀÀÌ ÀϾ ¼ö ÀÖ´Ù.
¨é µå¹°°Ô ÇǺΠħ½Ä¹ÝÀÀÀÌ ÀϾ ¼ö ÀÖÀ¸¸ç ƯÈ÷ »ç¸¶±Í ÁÖÀ§ ÇǺΰ¡ ¹é»öÀ¸·Î º¯Çϰųª ¹þ°ÜÁú ¼ö ÀÖ´Ù. ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â »ç¿ëºóµµ¸¦ ÁÙÀ̰í Á¡°ËÇÑ´Ù.
2) ¹Ì°¢ : ¹Ì°¢ÀÇ ÀÎÁöº¯È°¡ ÀϾ ¼ö ÀÖ´Ù.
|
| »óÈ£ÀÛ¿ë |
1) ¸ÞÅ䯮·º¼¼ÀÌÆ®¿Í º´¿ë½Ã ¸ÞÅ䯮·º¼¼ÀÌÆ®ÀÇ µ¶¼ºÀÌ Áõ°¡ÇÒ ¼ö ÀÖ´Ù.
2) ¼³Æ÷´Ò¿ì·¹¾Æ¿Í º´¿ëÅõ¿©½Ã Ç÷´çÀúÇÏÀÛ¿ëÀÌ Áõ°¡ÇÒ ¼ö ÀÖ´Ù.
3) ÀÌ ¾àÀº ´Ù¸¥ ±¹¼Ò Àû¿ë ¾à¹°ÀÇ Èí¼ö¸¦ ÃËÁø½Ãų ¼ö ÀÖ´Ù.
4) ¼³¸°´Ú°ú º´¿ë½Ã ¸»ÃʽŰæ Àå¾Ö¸¦ À¯¹ßÇÒ ¼ö ÀÖ´Ù.
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Xµî±Þ
(fluorouracil topical )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
ÀÓ»êºÎ ¶Ç´Â ÀӽŰèȹÁß º¹¿ë±ÝÁö |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Fluorouracil¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Salicylic acid¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Fluorouracil¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Fluorouracil inhibits thymidylate synthetase, leading to inhibition of DNA and RNA synthesis and cell death.
|
| Pharmacology |
Fluorouracil¿¡ ´ëÇÑ Pharmacology Á¤º¸ Fluorouracil is an antineoplastic anti-metabolite. Anti-metabolites masquerade as purine or pyrimidine - which become the building blocks of DNA. They prevent these substances becoming incorporated in to DNA during the "S" phase (of the cell cycle), stopping normal development and division. Fluorouracil blocks an enzyme which converts the cytosine nucleotide into the deoxy derivative. In addition, DNA synthesis is further inhibited because Fluorouracil blocks the incorporation of the thymidine nucleotide into the DNA strand.
|
| Protein Binding |
Fluorouracil¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 8-12%
|
| Half-life |
Fluorouracil¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 10-20 minutes
|
| Absorption |
Fluorouracil¿¡ ´ëÇÑ Absorption Á¤º¸ 28-100%
|
| Pharmacokinetics |
FluorouracilÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : °æ±¸ : ºÒ±ÔÄ¢ÇÏ¿© °ÅÀÇ »ç¿ëÇÏÁö ¾Ê´Â´Ù.
- »ýü³»ÀÌ¿ë·ü : °æ±¸ : 75% ÀÌÇÏ (ºÒ±ÔÄ¢ÇÏ´Ù.)
- ºÐÆ÷ : Vd : ü¾×ÀÇ ¾à 22%
- ¼¼Æ÷¿Ü¾×, ³úô¼ö¾×°ú ´Á¸·¾×, º¹¼ö µî¿¡ Àß ºÐÆ÷µÈ´Ù.
- ´ë»ç : 90%°¡ Ȱ¼ºÃ¼·Î ´ë»çµÇ¾î ÀÛ¿ëÇÑ´Ù.
- ÀÏÂ÷ÀûÀ¸·Î °£¿¡¼ dehydrogenase¿¡ ÀÇÇØ ´ë»çµÇ¹Ç·Î °£ºÎÀü ȯÀÚ (Ç÷Áß bilirubinÀÌ 5 mg/dL ÀÌ»ó)¿¡°Ô´Â Åõ¿©¸¦ »ï°£´Ù.
- ¹Ý°¨±â (ÀÌ»ó¼º) : Ãʱâ : 6-20 ºÐ
- 400-600 mg/m2 Åõ¿©½Ã Á¤»óÁ¶Á÷¿¡¼ ¼¼Æ÷µ¶¼º ¿ªÄ¡ ÀÌ»óÀÇ ³óµµ·Î »ó½ÂÇÏ¿© 6½Ã°£ µ¿¾È Áö¼ÓµÈ´Ù.
- 2 °³ÀÇ ´ë»çü (FdUMP, FUTP)´Â Á¶Á÷ÀÇ À¯Çü¿¡ µû¶ó ¹Ý°¨±â°¡ ´Þ¶óÁö´Âµ¥, ÀÌµé ´ë»çüÀÇ ÀÓ»óÀû È¿°ú´Â ¹àÇôÁ® ÀÖÁö ¾Ê´Ù.
- ¼Ò½Ç : 5%°¡ ¹Ìº¯Èü·Î 6½Ã°£³»¿¡ ½Å¹è¼³µÇ°í, ¸¹Àº ¾çÀÌ Æó¸¦ ÅëÇØ CO2ÀÇ ÇüÅ·Π¼Ò½ÇµÈ´Ù.
Salicylic AcidÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- »ýü³»ÀÌ¿ë·ü : methyl salicylate ¿¬°íÁ¦ : 15-22%
- ºÐÆ÷ : ºÐÆ÷¿ëÀû : 0.17 L/kg
- ´Ü¹é°áÇÕ : 50-80%
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : ¿Ü¿ë : ¹ÐºÀÆ÷´ë¹ý Àû¿ë½Ã 5½Ã°£ À̳»
- ¼Ò½Ç : ´¢Áß ¹è¼³ÇüÅ´ °æ±¸¿Í´Â ¾à°£ ´Þ¶ó¼, ¿Ü¿ë½Ã glucuronide Æ÷ÇÕü (42%)°¡ »ó´ëÀûÀ¸·Î ¸¹À¸¸ç, salicyluric acid (52%)¿Í ¹Ìº¯Èü (6%)´Â »ó´ëÀûÀ¸·Î Àû´Ù.
|
| Biotransformation |
Fluorouracil¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic
|
| Toxicity |
Fluorouracil¿¡ ´ëÇÑ Toxicity Á¤º¸ LD50=230mg/kg (orally in mice)
|
| Drug Interactions |
Fluorouracil¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Anisindione The antineoplasic agent increases the anticoagulant effectDicumarol The antineoplasic agent increases the anticoagulant effectAcenocoumarol The antineoplasic agent increases the anticoagulant effectWarfarin The antineoplasic agent increases the anticoagulant effectEthotoin Fluorouracil increases the effect of hydantoinFosphenytoin Fluorouracil increases the effect of hydantoinMephenytoin Fluorouracil increases the effect of hydantoinPhenytoin Fluorouracil increases the effect of hydantoinMetronidazole Risk of 5-FU toxicity when associated with metronidazoleCimetidine Cimetidine increases the effect and toxicity of fluorouracil
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Fluorouracil¿¡ ´ëÇÑ Description Á¤º¸ A pyrimidine analog that is an antineoplastic antimetabolite. It interferes with DNA synthesis by blocking the thymidylate synthetase conversion of deoxyuridylic acid to thymidylic acid. [PubChem]
|
| Dosage Form |
Fluorouracil¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Cream TopicalSolution Intravenous
|
| Drug Category |
Fluorouracil¿¡ ´ëÇÑ Drug_Category Á¤º¸ AntimetabolitesAntimetabolites, AntineoplasticAntineoplastic AgentsImmunosuppressive Agents
|
| Smiles String Canonical |
Fluorouracil¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ FC1=CNC(=O)NC1=O
|
| Smiles String Isomeric |
Fluorouracil¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ FC1=CNC(=O)NC1=O
|
| InChI Identifier |
Fluorouracil¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C4H3FN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9)/f/h6-7H
|
| Chemical IUPAC Name |
Fluorouracil¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 5-fluoro-1H-pyrimidine-2,4-dione
|
| Drug-Induced Toxicity Related Proteins |
FLUOROURACIL ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Dihydropyrimidine dehydrogenase Drug:Fluorouracil Toxicity:Neurotoxicity. [¹Ù·Î°¡±â] Replated Protein:Dihydropyrimidine dehydrogenase Drug:Fluorouracil Toxicity:myelotoxicity. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2024-01-16
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|