| |
|
|
|
|
|
 |
| |
|
¸®³ë¿¡¹Ù½ºÅÚĸ½¶ Rino-Ebastel Cap.
|
Àü¹®ÀǾàǰ | ±Þ¿©
|
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
 | º´¿ë±Ý±â |
|
|
|
|
|
|
 |
Á¦Ç°º° ÀӺαݱ⠰í½Ã |
|
|
|
1µî±Þ: ¿øÄ¢Àû »ç¿ë±Ý±â / 2µî±Þ: ¸íÈ®ÇÑ ÀÓ»óÀû ±Ù°Å ¶Ç´Â »çÀ¯°¡ ÀÖ´Â °æ¿ì ºÎµæÀÌÇÏ°Ô »ç¿ë / Mµî±Þ: ÀÓ»óÀû»óȲ¿¡ µû¶ó 1µî±Þ ¶Ç´Â 2µî±ÞÀ¸·Î ºÐ·ùµÇ´Â ¼ººÐ
| ¼ººÐ¸í |
¼ººÐÄÚµå |
±Ý±âµî±Þ |
°í½Ã¹øÈ£ |
°í½ÃÀÏÀÚ |
ºñ°í |
| pseudoephedrin, ebastine |
260100ACR |
2 |
20160155 |
20161230 |
ebastine, Pseudoephedrine: ÀӺο¡ ´ëÇÑ ¾ÈÀü¼º ¹ÌÈ®¸³. |
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
641900460[A09304941]
Àú°¡¾à ´ëü Àμ¾Æ¼ºê Áö±Þ ´ë»ó
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\300 ¿ø/1ĸ½¶(2024.07.01)(ÇöÀç¾à°¡)
\301 ¿ø/1ĸ½¶(2022.06.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
»óÇϺΠÀû»öÀÇ °æÁúĸ½¶À̸ç, ³»¿ë¹°Àº Èò»ö ¹× ȸ¹é»öÀÇ ±¸Çü°ú¸³ÀÓ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
30ĸ½¶/º´,300ĸ½¶/º´ |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 203.08¹Ð¸®±×·¥ |
100 ĸ½¶ |
º´ |
8806419004606 |
8806419004620 |
|
| 203.08¹Ð¸®±×·¥ |
10 ĸ½¶ |
PTP |
8806419004606 |
8806419004613 |
|
| 203.08¹Ð¸®±×·¥ |
300 ĸ½¶ |
º´ |
8806419004606 |
8806419004651 |
|
| 203.08¹Ð¸®±×·¥ |
30 ĸ½¶ |
º´ |
8806419004606 |
8806419004644 |
|
| 203.08¹Ð¸®±×·¥ |
10 ĸ½¶ |
PTP |
8806419004606 |
8806419004637 |
|
|
| ÁÖ¼ººÐÄÚµå |
260100ACR
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
Ç÷°ü¿îµ¿¼º, ¾Ë·¯Áö¼º ºñ¿° ¹× °¨±â¿¡ °ü·ÃµÈ ºñ¿° Áõ»óÀÇ Ä¡·á
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¡Û ¼ºÀÎ : 1ÀÏ 1ȸ 1ĸ½¶, ½ÉÇÑ °æ¿ì 1ÀÏ 2ȸ 1ĸ½¶ Åõ¿©
¡Û ¸¸ 12¼¼ ÀÌ»ó û¼Ò³â : 1ÀÏ 1ȸ 1ĸ½¶
Ä¡·áÁö¼Ó±â°£Àº Áõ»óÀÌ ½ÉÇÑ °æ¿ì¿¡ ÇÑÇϸç, ÀϹÝÀûÀ¸·Î ÀÇ»çÀÇ Áö½Ã ¾øÀÌ´Â Ç÷°ü¿îµ¿¼º, ¾Ë·¯Áö¼º ºñ¿°¿¡¼ 10ÀÏ ÀÌ»ó, °¨±â¿Í °ü·ÃµÈ ºñ¿°¿¡¼ 3ÀÏ ÀÌ»ó Áö¼ÓÇÏÁö ¾Ê¾Æ¾ß ÇÑ´Ù.
|
| ÁÖ¿ä¾à¹° »óÈ£ÀÛ¿ë |
[Á¶È¸]
|
| ±Ý±â |
1) ÀÌ ¾àÀÇ ÁÖ¼ººÐ ¹× ÷°¡Á¦ ¼ººÐ¿¡ °ú¹ÎÁõÀÌ Àִ ȯÀÚ
2) ÀÌ ¾àÀº ¼öµµ¿¡Æäµå¸°ÀÌ ÇÔÀ¯µÇ¾î ÀÖÀ¸¹Ç·Î, Çù¿ì°¢¼º ³ì³»Àå, ´¢Àú·ù, ÁßÁõ °íÇ÷¾Ð, °ü»óºÎÀü, °©»ó¼±±â´ÉÇ×ÁøÁõÀ» °¡Áø ȯÀÚ ¹× ¸ð³ë¾Æ¹Î¿Á½Ã´ÙÁ¦ ÀúÇØÁ¦(IMAO)·Î Ä¡·á¹Þ°í Àִ ȯÀÚ ¶Ç´Â 2ÁÖ°£ Ä¡·á¸¦ ¹ÞÀº ȯÀÚ
3) ÁßÁõÀÇ °£Àå¾Ö ȯÀÚ
4) 12¼¼ ÀÌÇÏÀÇ ¾î¸°ÀÌ
5) ÀӺΠ¶Ç´Â ¼öÀ¯ºÎ
6) ÀÌ ¾àÀº À¯´çÀ» ÇÔÀ¯Çϰí ÀÖÀ¸¹Ç·Î, °¥¶ôÅä¿À½º ºÒ³»¼º(galactose intolerance), Lapp À¯´çºÐÇØÈ¿¼Ò °áÇÌÁõ(Lapp lactase deficiency) ¶Ç´Â Æ÷µµ´ç-°¥¶ôÅä¿À½º Èí¼öÀå¾Ö(glucose-galactose malabsorption) µîÀÇ À¯ÀüÀûÀÎ ¹®Á¦°¡ Àִ ȯÀÚ¿¡°Ô´Â Åõ¿©ÇÏ¸é ¾È µÈ´Ù.(ÇÔÀ¯Á¦Ç°¿¡ ÇÑÇÔ)
7) ÁßÁõ ±Þ¼º ¶Ç´Â ¸¸¼º ½ÅÀåÁúȯ/½ÅºÎÀü ȯÀÚ |
| ½ÅÁßÅõ¿© |
1) ³ì³»Àå
2) °íÇ÷¾Ð
3) ½ÉÁúȯ ȯÀÚ
4) ´ç´¢º´ (ÀÌ ¾àÀº ¹é´çÀ» ÇÔÀ¯ÇϹǷΠƯÈ÷ ÁÖÀÇÇØ¾ß ÇÑ´Ù.)
5) Àü¸³¼± ºñ´ëÁõ ȯÀÚ
6) °£Àå¾Ö ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ (°£Àå¾Ö¸¦ ¾ÇȽÃŰ°Å³ª Àç¹ß½Ãų ¼ö ÀÖ´Ù.)
7) QT ¿¬ÀåÀ» ÀÏÀ¸Å°±â ½¬¿î ȯÀÚ [ÀúÄ®·ýÇ÷Áõ, Àú¸¶±×³×½·Ç÷Áõ, ¼±Ãµ¼º QT ¿¬Àå ÁõÈıº, Åõ¼®Áß, ¾Æ½ºÅ×¹ÌÁ¹, º£ÇÁ¸®µô, ½Ã»çÇÁ¸®µå, ½ºÆÄ¸£Ç÷ϻç½Å, ¥âÂ÷´ÜÁ¦¸¦ Á¦¿ÜÇÑ Ç׺ÎÁ¤¸Æ¾à, ÀÌ´¢Á¦, Á¤½Åº´Ä¡·áÁ¦ (Æä³ëÄ¡¾ÆÁø°è, ºÎÆ¿·ÎÆä³í°è, »ïȯ°è¡¤»çȯ°è Ç׿ì¿ï¾à µî), ÇÁ·ÎºÎÄÝ µî QT ¿¬ÀåÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù°í ¾Ë·ÁÁ® ÀÖ´Â ¾à¹°À» Åõ¿© ÁßÀΠȯÀÚ]
8) °£´ë»çÈ¿¼ÒÀÎ CYP3A4 È¿¼Ò¸¦ ¾ïÁ¦ÇÏ´Â ´ÙÀ½ ¾à¹°À» º¹¿ë ÁßÀΠȯÀÚ
- ¾ÆÁ¹°è Ç×Áø±ÕÁ¦ : ÄÉÅäÄÚ³ªÁ¹
- ¸¶Å©·Î¶óÀ̵å°è Ç×»ý¹°Áú : ¿¡¸®½º·Î¸¶À̽Å
9) 60¼¼ ÀÌ»óÀÇ ³ëÀÎ |
| ÀÌ»ó¹ÝÀÀ |
1) ¿¡¹Ù½ºÆ¾ °ü·Ã ÀÌ»ó¹ÝÀÀ
- ¼øÈ¯±â°è : µå¹°°Ô ½É°èÇ×ÁøÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
- Á¤½Å½Å°æ°è : Á¹À½, ½Å°æ°ú¹Î, ¸¶ºñ°¨, ¹«·ÂÁõ, ÀDZâ¼Òħ, ÈïºÐ, ¶§¶§·Î ±Çۨ, µå¹°°Ô µÎÅëÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
- ¼Òȱâ°è : ±¸¿ª, ±¸Åä, º¹Åë, À§ÀåÀå¾Ö ¶§¶§·Î ±¸°¥, À§ºÎºÒÄè°¨, µå¹°°Ô ºñ¤ý±¸°³»°ÇÁ¶, ¼³¿°, ¼³»ç, º¯ºñ°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
- °£ : ¶§¶§·Î AST¡¤ALT, LDH, Al-PÀÇ »ó½ÂÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
- °ú¹ÎÁõ : ¹ßÁø, ºÎÁ¾ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
- ±âŸ : °æ¹ÌÇÑ Ã¼ÁßÁõ°¡, È£»ê±¸Áõ´ÙÁõ, ÈäºÎ¾Ð¹Ú°¨, BUN »ó½Â, ´ç´¢¸¦ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. À¯»ç¾à(Å׸£Æä³ªµò µî)¿¡ ÀÇÇØ QT¿¬Àå, ½É½Ç¼º ºÎÁ¤¸Æ(Å丣»çµå µå Æ÷ÀÎÆ® Æ÷ÇÔ)ÀÌ ³ªÅ¸³µ´Ù´Â º¸°í°¡ ÀÖ´Ù.
2) ½´µµ¿¡Æäµå¸° ¶§¹®¿¡ ƯÈ÷ ±³°¨½Å°æÈïºÐÁ¦ÀÇ °ú¹ÎÁõÀΠȯÀÚ¿¡¼, ±¸°°ÇÁ¶, °ú¹ÎÁõ, ÈïºÐ, ºÒ¸é, Çö±â, µÎÅëÀÌ ³ªÅ¸³¯ ¼ö ÀÖ°í, Àå±âÅõ¿©½Ã ¿À½É, ±¸Å並 ÀÏÀ¸Å³ ¼ö ÀÖ´Ù. ¶ÇÇÑ ºó¹Ú, µ¿°è¸¦ ÀÏÀ¸Å³ ¼ö ÀÖ´Ù. ±Þ¼º Àü½Å¼º ¹ßÁø¼º ³óÆ÷Áõ(AGEP), ¹ß¿, È«¹Ý, ´Ù¼öÀÇ ÀÛÀº ³óÆ÷¿Í °°Àº ÁßÁõ ÇǺΠÀÌ»ó¹ÝÀÀÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. °¡¿ªÀû Èijú º´Áõ ÁõÈıº, °¡¿ªÀû ³úÇ÷°ü ¼öÃà ÁõÈıºÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ±âŸ ´Ù¸¥ Áõ»óÀÌ ³ªÅ¸³ª¸é ÀÇ»ç¿Í »ó´ãÇØ¾ß ÇÑ´Ù.
3)½ÃÆÇ ÈÄ »ç¿ë Áß¿¡ ¾Æ³ªÇʶô½Ã½º¼îÅ©°¡ º¸°íµÇ¾ú´Ù.
|
| »óÈ£ÀÛ¿ë |
1) ÀÌ ¾àÀº ÇǺξ˷¯Áö½ÃÇèÀ» ¹æÇØÇÒ ¼ö ÀÖÀ¸¹Ç·Î Ä¡·áÁß´ÜÈÄ 5-7ÀÏ ÈıîÁö´Â ½Ç½ÃµÇ¾î¼´Â ¾ÈµÈ´Ù.
2) ÀÌ ¾àÀº ´Ù¸¥ Ç×È÷½ºÅ¸¹ÎÁ¦¿Í È¿°ú¸¦ Áõ°½Ãų ¼ö ÀÖ´Ù.
3) ÀÌ ¾àÀº ¸ð³ë¾Æ¹Î¿Á½Ã´ÙÁ¦ ÀúÇØÁ¦(IMAO) º´¿ë Åõ¿©½Ã ½É°¢ÇÑ Ç÷°ü¼º °íÇ÷¾ÐÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î º´¿ëÅõ¿©ÇÏÁö ¾Ê¾Æ¾ß ÇÑ´Ù. ¶ÇÇÑ, ´Ù¸¥ ¾à¹°(¸ÞÄ¥µµÆÄ, ¸ÞÄ«¹Ð¾Æ¹Î, ¸®¼ÇÉ, ¸Æ°¢ ¾ËÄ®·ÎÀ̵å)ÀÇ Ç÷¾Ð°ÇÏÈ¿°ú¸¦ °¨¼Ò½Ãų ¼ö ÀÖ´Ù.
4) ´Ù¸¥ ±³°¨½Å°æÈïºÐ¼º ¾à¹°°úÀÇ º´¿ëÅõ¿©´Â »ó°¡È¿°ú¸¦ ÀÏÀ¸Å°¸ç, µ¶¼ºÀ» Áõ°¡½Ãų ¼ö ÀÖ´Ù. À¯»çÇÏ°Ô ÀϺÎÀÇ Ç×°íÇ÷¾ÐÁ¦(º£Å¸-Â÷´ÜÁ¦)¿Í »óÈ£ÀÛ¿ëÇÒ ¼ö ÀÖ´Ù.
5) ÀÌ ¾àÀÇ ¼ººÐÀº ¾ËÄÚ¿ÃÀÇ È¿°ú¸¦ Áõ´ë½ÃŰÁö ¾Ê´Â´Ù.
6) ÀÌ ¾à¿¡ ÇÔÀ¯µÈ ¿¡¹Ù½ºÆ¾À» ¿¡¸®½º·Î¸¶À̽Űú º´¿ëÅõ¿©½Ã, ¿¡¸®½º·Î¸¶À̽ÅÀÌ ÀÌ ¾àÀÇ ´ë»ç¸¦ ¾ïÁ¦ÇÏ¿© Ç÷Áß ³óµµ¸¦ 2¹è »ó½Â ½ÃÄ×´Ù´Â º¸°í°¡ ÀÖ´Ù.
7) ÀÌ ¾à¿¡ ÇÔÀ¯µÈ ¿¡¹Ù½ºÆ¾À» ÄÉÅäÄÚ³ªÁ¹ ¶Ç´Â ¿¡¸®½º·Î¸¶À̽Űú º´¿ë Åõ¿©½Ã ÄÉÅäÄÚ³ªÁ¹ ¶Ç´Â ¿¡¸£½º·Î¸¶À̽дܵ¶Åõ¿© ½Ã º¸´Ù QT °£°ÝÀÌ 10msec »ó½ÂÇÏ´Â °ÍÀ¸·Î º¸°íµÇ¾ú´Ù. |
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
641900460[A09304941]
Àú°¡¾à ´ëü Àμ¾Æ¼ºê Áö±Þ ´ë»ó
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\300 ¿ø/1ĸ½¶(2024.07.01)(Ãֽžడ)
\301 ¿ø/1ĸ½¶(2022.06.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
|
| Á¦Ç°¼º»ó |
»óÇϺΠÀû»öÀÇ °æÁúĸ½¶À̸ç, ³»¿ë¹°Àº Èò»ö ¹× ȸ¹é»öÀÇ ±¸Çü°ú¸³ÀÓ
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| ´ëü°ü·Ã |
´ëÁ¶¾à |
| Æ÷À塤À¯Åë´ÜÀ§ |
30ĸ½¶/º´,300ĸ½¶/º´ |
| º¸°ü¹æ¹ý |
¹ÐÆó¿ë±â, ½Ç¿Âº¸°ü(1-30¡É) |
µ¿ÀÏÁÖ¼ººÐÄÚµå °Ë»ö¼øÀ§ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
ÀÓ»êºÎ ¶Ç´Â ÀӽŰèȹÁß º¹¿ë±ÝÁö |
|
 |
º¯ºñ°¡ »ý±æ¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
[domperidone]
[domperidone maleate (as domperidone)]
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Ephedrine¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Pseudoephedrine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Pseudoephedrine acts directly on both alpha- and, to a lesser degree, beta-adrenergic receptors. Through direct action on alpha-adrenergic receptors in the mucosa of the respiratory tract, pseudoephedrine produces vasoconstriction. Pseudoephedrine relaxes bronchial smooth muscle by stimulating beta2-adrenergic receptors. Like ephedrine, pseudoephedrine releasing norepinephrine from its storage sites, an indirect effect.
|
| Pharmacology |
Pseudoephedrine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Pseudoephedrine is a sympathomimetic agent, structurally similar to ephedrine, used to relieve nasal and sinus congestion and reduce air-travel-related otalgia in adults. The salts pseudoephedrine hydrochloride and pseudoephedrine sulfate are found in many over-the-counter preparations either as single-ingredient preparations, or more commonly in combination with antihistamines and/or paracetamol/ibuprofen. Unlike antihistamines, which modify the systemic histamine-mediated allergic response, pseudoephedrine only serves to relieve nasal congestion commonly associated with colds or allergies. The advantage of oral pseudoephedrine over topical nasal preparations, such as oxymetazoline, is that it does not cause rebound congestion (rhinitis medicamentosa).
|
| Metabolism |
Pseudoephedrine¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Monoamine oxidase type A (MAO-A)
|
| Protein Binding |
Pseudoephedrine¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Pseudoephedrine does not bind to human plasma proteins over the concentration range of 50 to 2000 ng/mL
|
| Half-life |
Pseudoephedrine¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 9-16 hours
|
| Absorption |
Pseudoephedrine¿¡ ´ëÇÑ Absorption Á¤º¸ Pseudoephedrine is readily and almost completely absorbed from the GI tract and there is no evidence of first-pass metabolism.
|
| Pharmacokinetics |
Pseudoephedrine HClÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ºñÃæÇ÷Á¦°Å È¿°úÀÇ ¹ßÇö½Ã°£ (°æ±¸Åõ¿©½Ã) : 15-30ºÐ
- ÀÛ¿ëÁö¼Ó½Ã°£ : 4-6 ½Ã°£ (¼¹æÇü Á¦Á¦´Â 12½Ã°£ Áö¼Ó)
- ´ë»ç : °£¿¡¼ ÀϺΠ´ë»ç
- ¹Ý°¨±â : 9-16 ½Ã°£
- ¼Ò½Ç : Åõ¿©·®ÀÇ 70-90%°¡ ¹Ìº¯Èü·Î, 1-6%°¡ norpseudoephedrineÀ¸·Î ¼Òº¯À¸·Î ¹è¼³µÊ. ½Å¹è¼³Àº ´¢ pH¿Í ´¢·®¿¡ ÀÇÇØ º¯ÈµÇ¸ç ¾ËÄ®¸®´¢´Â pseudoephedrineÀÇ ½Å¹è¼³À» °¨¼Ò½ÃÅ´.
EbastineÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ÀÛ¿ë¹ßÇö½Ã°£ : 1-3 ½Ã°£
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : 1-1.5 ½Ã°£
- Èí¼ö : À§Àå°üÀ¸·ÎºÎÅÍ ½Å¼ÓÇÏ°Ô Èí¼öµÊ.
- ºÐÆ÷ : À§, Àå°ü, °£ µî¿¡ °í³óµµ·Î ºÐÆ÷ÇÔ.
- ´ë»ç : °£¿¡¼ carebastineÀ¸·Î ½Å¼ÓÇÏ°Ô ´ë»çµÊ.
- ¹Ý°¨±â : 13½Ã°£
|
| Biotransformation |
Pseudoephedrine¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic.
|
| Toxicity |
Pseudoephedrine¿¡ ´ëÇÑ Toxicity Á¤º¸ Common adverse reactions include nervousness, restlessness, and insomnia. Rare adverse reactions include difficult/painful urination, dizziness/lightheadedness, heart palpitations, headache, increased sweating, nausea/vomiting, trembling, troubled breathing, unusual paleness, and weakness.
|
| Drug Interactions |
Pseudoephedrine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Alseroxylon Increased arterial pressureIsocarboxazid Increased arterial pressureLinezolid Possible increase of arterial pressureMethyldopa Increased arterial pressureBromocriptine The sympathomimetic increases the toxicity of bromocriptineTranylcypromine Increased arterial pressureMidodrine Increased arterial pressureMoclobemide Moclobemide increases the sympathomimetic effectPargyline Increased arterial pressurePhenelzine Increased arterial pressureRasagiline Increased arterial pressureReserpine Increased arterial pressureTrimipramine The tricyclic increases the sympathomimetic effectProtriptyline The tricyclic increases the sympathomimetic effectNortriptyline The tricyclic increases the sympathomimetic effectAmitriptyline The tricyclic increases the sympathomimetic effectAmoxapine The tricyclic increases the sympathomimetic effectClomipramine The tricyclic increases the sympathomimetic effectImipramine The tricyclic increases the sympathomimetic effectDesipramine The tricyclic increases the sympathomimetic effectDoxepin The tricyclic increases the sympathomimetic effectDeserpidine Increased arterial pressureGuanethidine The agent decreases the effect of guanethidine
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Pseudoephedrine¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take without regard to meals.
|
| Drug Target |
[Drug Target]
|
| Description |
Pseudoephedrine¿¡ ´ëÇÑ Description Á¤º¸ An alpha- and beta-adrenergic agonist that may also enhance release of norepinephrine. It has been used in the treatment of several disorders including asthma, heart failure, rhinitis, and urinary incontinence, and for its central nervous system stimulatory effects in the treatment of narcolepsy and depression. It has become less extensively used with the advent of more selective agonists. [PubChem]
|
| Dosage Form |
Pseudoephedrine¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Liquid OralSyrup OralTablet OralTablet, extended release Oral
|
| Drug Category |
Pseudoephedrine¿¡ ´ëÇÑ Drug_Category Á¤º¸ Adrenergic AgentsBronchodilator AgentsCentral Nervous System AgentsNasal DecongestantsSympathomimeticsVasoconstrictor Agents
|
| Smiles String Canonical |
Pseudoephedrine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CNC(C)C(O)C1=CC=CC=C1
|
| Smiles String Isomeric |
Pseudoephedrine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CN[C@@H](C)[C@@H](O)C1=CC=CC=C1
|
| InChI Identifier |
Pseudoephedrine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C10H15NO/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,10-12H,1-2H3/t8-,10+/m0/s1
|
| Chemical IUPAC Name |
Pseudoephedrine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (1S,2S)-2-methylamino-1-phenylpropan-1-ol
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-07-22
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|