| |
|
|
|
|
|
 |
| |
|
버간점안겔(간시클로버) 5g VIRGAN OPHTHALMIC GEL
|
전문의약품 | 급여
| 
|
|
수입의약품
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
643900431
[보험코드에 따른 약품기본정보 직접조회]
\10,055 원/5g/개(2024.07.01)(현재약가)
\10,063 원/5g/개(2022.01.01)(변경전약가)
[상병코드조회]
[질병코드조회]
|
| 빠른조회 |
|
| 제품성상 |
튜브에 든 무색투명한 점안겔 [제형정보 확인] |
| 포장·유통단위 |
5g
|
| 포장·코드단위 |
| 약품규격 |
단위 |
포장형태 |
대표코드 |
표준코드 |
비고 |
| 5그램 |
1 개 |
튜브 |
8806439004303 |
8806439004310 |
|
|
| 주성분코드 |
164630COO
[동일한 주성분코드를 가진 오리지날 또는 제네릭 의약품 조회]
|
| 허가사항 원문조회 |
[허가사항 원문조회]
|
| 효능효과 |
[적응증 별 검색]
급성표재성 단순포진바이러스에 의한 각막염
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
각막 상피조직이 완전히 재생될 때까지 1회 1방울 1일 5회 감염 안구의 결막내부에 점안한다.
치료 후에도 7일간 1회 1방울 1일 3회 점안한다. 총 투여기간은 21일을 초과하지 않는다.
|
| 금기 |
아시클로버 또는 이 약 및 이 약의 구성성분에 과민반응 환자 |
| 이상반응 |
1) 일시적인 작열감이나 눈자극감 등이 발생할 수 있다.
2) 표층점상각막염, 시력장애가 발생할 수 있다.
3) 국내에서 6년 동안 641명을 대상으로 실시한 시판 후 조사 결과 새롭게 보고 된 알려지지 않은 이상반응은 다음과 같다. : 충혈, 시야흐림, 여포성 결막염
|
| 상호작용 |
1) 이 약과 다른 국소 안구치료를 병행하는 경우 두 약물 간에 적어도 15분의 간격을 두어야 하며 이 약을 가장 마지막에 점적하여야 한다.
2) 이 약과 답손, 펜타미딘, 플루사이스토신, 빈크리스틴, 빈블라스틴, 아드리아마이신, 암포테리신 B, 트리메토프림 ; 설파복합제, 기타 뉴클레오시드 유사체를 병용투여하는 경우 추가적인 독성의 가능성이 있으므로 신중히 사용한다.
3) 이 약과 지도부딘을 병용투여하는 경우 중증의 호중구감소증이 발생할 수 있으므로 병용투여하지 않는다.
4) 이 약과 이미페넴；실라스타틴복합제를 동시에 투여한 환자에서 전신발작이 보고되었다.
5) 프로베네시드와 다른 신장세뇨관의 분비 및 흡수억제 약물은 이 약의 신장 청소율을 감소시키고, 이 약의 반감기를 증가시킨다. |
| Off-label Usage |
[조회]
|
| Related FDA Approved Drug |
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| |
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 축약복약지도 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : C등급
(임부에 대한 치료 이익이 태아에 대한 위험성을 상회할 경우에 한해 사용할 것. -Briggs G, et al. Drugs in Pregnancy and Lactation 7th edit. )
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
| Pharmacokinetics |
유료정보입니다.
|
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| Mechanism of Action |
Ganciclovir에 대한 Mechanism_Of_Action 정보
Ganciclovir's antiviral activity inhibits virus replication. This inhibitory action is highly selective as the drug must be converted to the active form by a virus-encoded cellular enzyme, thymidine kinase (TK). TK catalyzes phosphorylation of ganciclovir to the monophosphate, which is then subsequently converted into the diphosphate by cellular guanylate kinase and into the triphosphate by a number of cellular enzymes. In vitro, ganciclovir triphosphate stops replication of herpes viral DNA. When used as a substrate for viral DNA polymerase, ganciclovir triphosphate competitively inhibits dATP leading to the formation of 'faulty' DNA. This is where ganciclovir triphosphate is incorporated into the DNA strand replacing many of the adenosine bases. This results in the prevention of DNA synthesis, as phosphodiester bridges can longer to be built, destabilizing the strand. Ganciclovir inhibits viral DNA polymerases more effectively than it does cellular polymerase, and chain elongation resumes when ganciclovir is removed.
|
| Pharmacology |
Ganciclovir에 대한 Pharmacology 정보
Ganciclovir is a synthetic nucleoside analogue of 2'-deoxyguanosine that inhibits replication of herpes viruses both in vitro and in vivo. Sensitive human viruses include cytomegalovirus (CMV), herpes simplex virus -1 and -2 (HSV-1, HSV-2), Epstein-Barr virus (EBV) and varicella zoster virus (VZV), however clinical studies have been limited to assessment of efficacy in patients with CMV infection. Ganciclovir is a prodrug that is structurally similar to acyclovir. It inhibits virus replication by its encorporation into viral DNA. This encorporation inhibits dATP and leads to defective DNA, ceasing or retarding the viral machinery required to spread the virus to other cells.
|
| Protein Binding |
Ganciclovir에 대한 단백결합 정보
1 to 2%
|
| Half-life |
Ganciclovir에 대한 반감기 정보
2.5 to 3.6 hours (mean 2.9 hours) when administered intravenously in adults. 3.1 to 5.5 hours when administered orally in adults. Renal function impairment causes a marked increase in half life (9 to 30 hours intravenously, 15.7 to 18.2 hours orally).
|
| Absorption |
Ganciclovir에 대한 Absorption 정보
Poorly absorbed systemically following oral administration. Bioavailability under fasting conditions is approximately 5%, and when administered with food, 6 to 9% (about 30% with a fatty meal).
|
| Pharmacokinetics |
Ganciclovir의 약물동력학자료
- 생체내이용률 : 경구 : 공복시 : 5%
- 음식물 섭취시 : 6-9%
- 지방식이 : 28-31%
- 단백결합 : 1-2%
- 반감기 : 1.7-5.8 시간, 신 손상시 연장
- 소실 : 94-99%가 미변화체로 신배설
|
| Biotransformation |
Ganciclovir에 대한 Biotransformation 정보
Little to no metabolism, about 90% of plasma ganciclovir is eliminated unchanged in the urine.
|
| Toxicity |
Ganciclovir에 대한 Toxicity 정보
Oral, mouse LD50: > 2g/kg. Intravenous, dog LD50: > 150mg/kg. Symptoms of overdose include irreversible pancytopenia, worsening GI symptoms, and acute renal failure. Suspected cancer agent.
|
| Drug Interactions |
Ganciclovir에 대한 Drug_Interactions 정보
Didanosine The antiviral agent increases the effect and toxicity of didanosineProbenecid Probenecid increases the effect and toxicity of ganciclovir/valganciclovirZidovudine Hematotoxicity
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Food Interaction |
Ganciclovir에 대한 Food Interaction 정보
Take with food, food increases bioavailability.
|
| Drug Target |
[Drug Target]
|
| Description |
Ganciclovir에 대한 Description 정보
An acyclovir analog that is a potent inhibitor of the Herpesvirus family including cytomegalovirus. Ganciclovir is used to treat complications from AIDS-associated cytomegalovirus infections. [PubChem]
|
| Dosage Form |
Ganciclovir에 대한 Dosage_Form 정보
Capsule OralImplant IntravitrealPowder, for solution Intravenous
|
| Drug Category |
Ganciclovir에 대한 Drug_Category 정보
Antiviral Agents
|
| Smiles String Canonical |
Ganciclovir에 대한 Smiles_String_canonical 정보
NC1=NC(=O)C2=C(N1)N(COC(CO)CO)C=N2
|
| Smiles String Isomeric |
Ganciclovir에 대한 Smiles_String_isomeric 정보
NC1=NC(=O)C2=C(N1)N(COC(CO)CO)C=N2
|
| InChI Identifier |
Ganciclovir에 대한 InChI_Identifier 정보
InChI=1/C9H13N5O4/c10-9-12-7-6(8(17)13-9)11-3-14(7)4-18-5(1-15)2-16/h3,5,15-16H,1-2,4H2,(H3,10,12,13,17)/f/h12H,10H2
|
| Chemical IUPAC Name |
Ganciclovir에 대한 Chemical_IUPAC_Name 정보
2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)-3H-purin-6-one
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2025-06-30
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
|
|
|
|
전문/일반
