| |
|
|
|
|
|
 |
| |
|
¾ÆÅ©·¹À롅 ACREIN GEL[Isotretinoin]
|
|
ÀϹÝÀǾàǰ | ¹Ì»ý»ê
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
ºñ±Þ¿©
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¿¡Åº¿Ã ³¿»õ°¡ ³ª´Â ¿¬È²³ì»öÀÇ °ÖÁ¦ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
10G |
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
°æÁõ ¶Ç´Â ÁߵÀÇ ½É»ó¼º¿©µå¸§(º¸Åë¿©µå¸§)
[Drugbank ÀÇ ¼ººÐÁ¤º¸¿¶÷] [Isotretinoin]
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
1ÀÏ 1¡2ȸ Àû´ç·®À» ȯºÎ¿¡ ¿¯°Ô ¹Ù¸¥´Ù. Ä¡·áÈ¿°ú´Â 6¡8ÁÖ ÈÄ¿¡ ³ªÅ¸³´Ù.
|
| ±Ý±â |
- ÀÌ ¾à ¶Ç´Â ÀÌ ¾à ¼ººÐ¿¡ °ú¹ÎÁõÀÇ º´·ÂÀÌ Àִ ȯÀÚ
- ÇǺλóÇÇÁ¾ ¹× ±× º´·Â ¶Ç´Â °¡Á··ÂÀÌ Àִ ȯÀÚ
- ½ÀÁø, Àý»ó, Âû°ú»ó ȯÀÚ
- ž籤¼±¿¡ ź ȯÀÚ(ž籤¼±¿¡ ´ëÇÑ °¨¼ö¼ºÀÌ Áõ°¡µÉ ¼ö ÀÖÀ¸¹Ç·Î ¿ÏÀüÈ÷ ȸº¹µÉ ¶§±îÁö ÀÌ ¾àÀ» »ç¿ëÇÏÁö ¾Ê´Â´Ù)
- ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀÎ ¹× ¼öÀ¯ºÎ
|
| ÀÌ»ó¹ÝÀÀ |
- ÀÚÅë(í©÷Ô), ÀÛ¿°¨, ÀÚ±Ø, È«¹Ý, °¡ÇÇ, Àû¿ëºÎÀ§ÀÇ ¹Ú¸®°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
- ÁßÁõÀÇ ÀÚ±Ø Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â ÀÌ ¾à Åõ¿©¸¦ Á¶ÀýÇϰųª ÁßÁöÇϰí Áö¼ÓÀûÀÎ ÀÚ±ØÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù. ÁßÁöÇÏ´Â Áï½Ã ¹ÝÀÀÀÌ »ç¶óÁø´Ù.
|
| »óÈ£ÀÛ¿ë |
´Ù¸¥ ¿Ü¿ëÁ¦ ƯÈ÷ °¢Áú¿ëÇØÁ¦(¿¹ : °ú»êȺ¥Á¶ÀÏ) ¶Ç´Â ¿¬¸¶Á¦¿Í º´¿ë½Ã ÁÖÀÇÇÑ´Ù. |
| Off-label Usage |
[Á¶È¸]
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Xµî±Þ
(ÀӺΠÅõ¿© ±Ý±â )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
ÀÓ»êºÎ ¶Ç´Â ÀӽŰèȹÁß º¹¿ë±ÝÁö |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Isotretinoin¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Isotretinoin¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Isotretinoin noticeably reduces the production of sebum and shrinks the sebaceous glands. It stabilises keratinization and prevents comedones from forming. The exact mechanism of action is unknown, however it is known that it alters DNA transcription.
|
| Pharmacology |
Isotretinoin¿¡ ´ëÇÑ Pharmacology Á¤º¸ Isotretinoin, a retinoid, is indicated in the treatment of severe recalcitrant nodular acne. Nodules are inflammatory lesions with a diameter of 5 mm or greater. The nodules may become suppurative or hemorrhagic. "Severe," by definition, means "many" as opposed to "few or several" nodules. Clinical improvement in nodular acne patients occurs in association with a reduction in sebum secretion. The decrease in sebum secretion is temporary and is related to the dose and duration of treatment with Accutane, and reflects a reduction in sebaceous gland size and an inhibition of sebaceous gland differentiation.
|
| Protein Binding |
Isotretinoin¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 99.9%
|
| Half-life |
Isotretinoin¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 17-50 hours
|
| Pharmacokinetics |
IsotretinoinÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : À½½Ä¹°À̳ª ¿ìÀ¯¿¡ ÀÇÇØ Èí¼ö°¡ Áõ°¡ÇÑ´Ù.
- »ýü³»ÀÌ¿ë·ü : °æ±¸ : 23-25%
- ºÐÆ÷ : ÅÂ¹Ý Åë°ú, À¯Áó ºÐºñ
- ´Ü¹é°áÇÕ : 99.9%
- ´ë»ç : °£´ë»ç
- ÁÖ È°¼ºÇü ´ë»çü´Â 4-oxo-isotretinoinÀÌ¸ç ±âŸ tretinoin, 4-oxo-tretinoin µîÀÇ ´ë»çü°¡ Á¸ÀçÇÑ´Ù.
- Åõ¿© 6½Ã°£ ÀÌÈÄ¿¡´Â 4-oxo-isotretinoinÀÇ Ç÷Áß³óµµ°¡ isotretinoinÀÇ Ç÷Á߳󵵺¸´Ù ³ô´Ù.
- ¹Ý°¨±â :
- Isotretinoin : 10-20 ½Ã°£
- 4-oxo-isotretinoin : 17-50 ½Ã°£ (Æò±Õ 25½Ã°£)
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ :
- Isotretinoin : ¾à 3½Ã°£
- 4-oxo-isotretin
|
| Biotransformation |
Isotretinoin¿¡ ´ëÇÑ Biotransformation Á¤º¸ Not Available
|
| Toxicity |
Isotretinoin¿¡ ´ëÇÑ Toxicity Á¤º¸ Not Available
|
| Drug Interactions |
Isotretinoin¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Anisindione Retinoids decreases the anticoagulant effectDicumarol Retinoids decreases the anticoagulant effectAcenocoumarol Retinoids decreases the anticoagulant effectWarfarin Retinoids decreases the anticoagulant effectCarbamazepine Isotretinoine decreases the effect of carbamazepineDemeclocycline Increased risk of intracranial hypertensionDoxycycline Increased risk of intracranial hypertensionMinocycline Increased risk of intracranial hypertensionMethacycline Increased risk of intracranial hypertensionOxytetracycline Increased risk of intracranial hypertensionTetracycline Increased risk of intracranial hypertensionRolitetracycline Increased risk of intracranial hypertension
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Isotretinoin¿¡ ´ëÇÑ Food Interaction Á¤º¸ Avoid alcohol.Take with food to increase absorption.Take with a full glass of water Do not take supplements containing Vitamin A.
|
| Drug Target |
[Drug Target]
|
| Description |
Isotretinoin¿¡ ´ëÇÑ Description Á¤º¸ Isotretinoin is a medication used for the treatment of severe acne. It is sometimes used in prevention of certain skin cancers. It is a retinoid, meaning it derives from vitamin A and is found in small quantities naturally in the body. Isotretinoin binds to and activates nuclear retinoic acid receptors (RAR), thereby regulating cell proliferation and differentiation. This agent also exhibits immunomodulatory and anti-inflammatory responses and inhibits ornithine decarboxylase, thereby decreasing polyamine synthesis and keratinization.
|
| Dosage Form |
Isotretinoin¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Capsule Oral
|
| Drug Category |
Isotretinoin¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-acne AgentsAntineoplastic AgentsKeratolytic AgentsSkin and Mucous Membrane Agents
|
| Smiles String Canonical |
Isotretinoin¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(O)=O
|
| Smiles String Isomeric |
Isotretinoin¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CC(\C=C\C1=C(C)CCCC1(C)C)=C/C=C/C(C)=C/C(O)=O
|
| InChI Identifier |
Isotretinoin¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C20H28O2/c1-15(8-6-9-16(2)14-19(21)22)11-12-18-17(3)10-7-13-20(18,4)5/h6,8-9,11-12,14H,7,10,13H2,1-5H3,(H,21,22)/f/h21H
|
| Chemical IUPAC Name |
Isotretinoin¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexenyl)nona-2,4,6,8-tetraenoic acid
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2024-09-07
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|