| |
|
|
|
|
|
 |
| |
|
´ë¿ì¼öµµ¿¡Æäµå¸°¿°»ê¿°Á¤30mg Daewoo Pseudoephedrine HCl Tab. 30mg
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
649600510[A05400451]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1Á¤(2018.03.01)(ÇöÀç¾à°¡)
\12 ¿ø/1Á¤(2017.02.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»öÀÇ ¿øÇüÁ¤Á¦ÀÌ´Ù.
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
30Á¤, 1000Á¤ |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 30¹Ð¸®±×·¥ |
1000 Á¤ |
8806496005107 |
8806496005138 |
»ç¿ëºÒ°¡(Áߺ¹) |
| 30¹Ð¸®±×·¥ |
1000 Á¤ |
8806496005107 |
8806496005121 |
|
| 30¹Ð¸®±×·¥ |
30 Á¤ |
8806496005107 |
8806496005114 |
|
|
| ÁÖ¼ººÐÄÚµå |
220901ATB
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| ´ëÇ¥ÄÚµå |
8806496005107 |
| º¸°ü¹æ¹ý |
Â÷±¤±â¹Ð¿ë±â |
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
´ÙÀ½ Áúȯ¿¡ ÀÇÇÑ ºñÃæÇ÷ ¿ÏÈ : °¨±â, ºÎºñµ¿¿°, »ó±âµµ ¾Ë·¹¸£±â
|
| 1ÀÏ ÃÖ´ë Åõ¿©·® |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¡Û ¼ºÀÎ ¹× 12¼¼ ÀÌ»ó : ¼öµµ¿¡Æäµå¸°¿°»ê¿°À¸·Î¼ 1ȸ 30 ¢¦ 60 mg 1ÀÏ 3 ¢¦ 4ȸ °æ±¸Åõ¿©ÇÑ´Ù. 1ÀÏ ÃÖ´ëÅõ¿©·®Àº 240 mgÀÌ´Ù.
¡Û 6¼¼ ÀÌ»ó ¢¦ 11¼¼ ÀÌÇÏ : ÀÌ ¾àÀ¸·Î¼ 1ȸ 30 mg, 1ÀÏ 3 ¢¦ 4ȸ °æ±¸Åõ¿©ÇÑ´Ù.
ÀÌ ¾àÀÇ 1ÀÏ ÃÑ Åõ¿©È½¼ö´Â 4ȸ¸¦ ÃʰúÇÏÁö ¾ÊÀ¸¸ç ÃÖ¼Ò 4½Ã°£ °£°ÝÀ» À¯ÁöÇÏ¿© Åõ¿©ÇÑ´Ù. ¿¬·É, Áõ»ó¿¡ µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù.
|
| ÁÖ¿ä¾à¹° »óÈ£ÀÛ¿ë |
[º¸±â]
|
| °æ°í |
½´µµ¿¡Æäµå¸° ÇÔÀ¯ ÀǾàǰ º¹¿ë½Ã ±Þ¼º Àü½Å¼º ¹ßÁø¼º ³óÆ÷Áõ(AGEP)°ú °°Àº ÁßÁõ ÇǺΠÀÌ»ó¹ÝÀÀÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ȯÀÚµéÀ» ÁÖÀÇ ±í°Ô ¸ð´ÏÅ͸µÇØ¾ß ÇÑ´Ù. ¹ß¿, È«¹Ý, ´Ù¼öÀÇ ÀÛÀº ³óÆ÷¿Í °°Àº Áõ»óÀÌ °üÂûµÉ °æ¿ì ÀÌ ¾àÀÇ º¹¿ëÀ» Áß´ÜÇϰí ÀûÀýÇÑ Á¶Ä¡¸¦ ÃëÇØ¾ß ÇÑ´Ù.
|
| ±Ý±â |
1) ÀÌ ¾à ¶Ç´Â ÀÌ ¾àÀÇ ±¸¼º¼ººÐ¿¡ °ú¹Î¹ÝÀÀ ȯÀÚ
2) ±³°¨½Å°æÈïºÐ¼º ¾Æ¹Î·ù¿¡ °ú¹Î¹ÝÀÀ ȯÀÚ
3) ½ÉÇ÷°üÁúȯ ȯÀÚ(ÇãÇ÷½ÉÀ庴, Æó¼âÇ÷°üÁúȯ, °íÇ÷¾Ð Æ÷ÇÔ)
4) ½ÉÇÑ °üµ¿¸ÆÁúȯ ȯÀÚ
5) °©»ó»ù±â´ÉÇ×ÁøÁõ ȯÀÚ
6) ´ç´¢º´ ȯÀÚ
7) ¼öÀ¯ºÎ
8) MAOÀúÇØÁ¦¸¦ Åõ¿©ÁßÀ̰ųª Åõ¿©¸¦ ÁßÁöÇÑ Áö 2ÁÖ À̳»ÀΠȯÀÚ
9) ÁßÁõ ½ÅÀå¾Ö ȯÀÚ
10) Å©·Òģȼ¼Æ÷Á¾ ȯÀÚ
11) Æó¼â°¢³ì³»Àå ȯÀÚ
12) ´Ù¸¥ ±³°¨½Å°æÈïºÐÁ¦ ¶Ç´Â º£Å¸Â÷´ÜÁ¦¸¦ Åõ¿©ÁßÀΠȯÀÚ
|
| ½ÅÁßÅõ¿© |
1) Àü¸³¼±ºñ´ëÁõ ¶Ç´Â ¹æ±¤ ±â´ÉÀÌ»ó ȯÀÚ
2) µð±âÅ»¸®½ºÁ¦Á¦¸¦ Åõ¿© ¹Þ°í Àִ ȯÀÚ
3) ¾È³»¾Ð »ó½Â ȯÀÚ
4) ÁßÁõ °£ºÎÀü ȯÀÚ
5) ½ÅÀå¾Ö ȯÀÚ
6) ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ¿©¼º
7) °í·ÉÀÚ
8) ºñ¸¸ ȯÀÚ
9) °©»ó»ù Áúȯ ȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
1) ¼øÈ¯±â°è : ½É°èÇ×Áø, ºó¸Æ, ºÎÁ¤¸Æ, ¾È¸éâ¹é, ÀúÇ÷¾ÐÀ» ¼ö¹ÝÇÑ ½ÉÇ÷°üÇãÅ»ÀÌ ³ª Ÿ³¯ ¼ö ÀÖ´Ù.
2) Á¤½Å½Å°æ°è : ÆíµÎÅë, µÎÅë, ¾îÁö·¯¿ò, ºÒ¾È, ±äÀå, ¹«·Â°¨, Çã¾à, ºÒ¸é, ȯ°¢, °æ·Ã, ÁßÃ߽Űæ°è ÈïºÐ ¶Ç´Â ¾ïÁ¦ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
3) ¼Òȱâ°è : º¯ºñ, ±¸¿ª, ¼ÒÈÀå¾Ö, ÇãÇ÷¼º ´ëÀå¿° µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
4) °ú¹Î¹ÝÀÀ : ¹ßÁø µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇÑ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
5) ºñ´¢±â°è : ¶§¶§·Î ¿äÀú·ù°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
6) ¸é¿ª°è : ´Ù¸¥ ±³°¨½Å°æÈïºÐ¾à¿¡ ÀÇÇÑ ±³Â÷¹Î°¨µµ°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
7) ´« : Æó¼â°¢³ì³»Àå
8) ÇǺΠ: ±Þ¼º Àü½Å¼º ¹ßÁø¼º ³óÆ÷Áõ(AGEP), ¹ß¿, È«¹Ý, ´Ù¼öÀÇ ÀÛÀº ³óÆ÷¿Í °°Àº ÁßÁõ ÇǺΠÀÌ»ó¹ÝÀÀÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
8) ±âŸ : ±¸°¥, ¹ßÇÑ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
10) ȯ°¢, ¾ÈÀýºÎÀý, ¼ö¸éÀå¾Ö¿Í °°Àº Áõ»óÀÌ ³ªÅ¸³ °æ¿ì Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
|
| ÀϹÝÀû ÁÖÀÇ |
1) 7ÀÏ Á¤µµ Åõ¿©ÇÏ¿©µµ Áõ»óÀÇ °³¼±ÀÌ ¾ø°Å³ª °í¿ÀÌ ³ªÅ¸³ª´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÏ°í ¾à»ç ¶Ç´Â ÀÇ»ç¿Í »óÀÇÇÑ´Ù.
2) ½´µµ¿¡Æäµå¸° ¼ººÐ°ú °ü·ÃÇÏ¿© ÇãÇ÷¼º ´ëÀå¿°ÀÇ Áõ»ó(±Þ°ÝÇÑ º¹Åë, Á÷Àå ÃâÇ÷ µî)ÀÌ ¹ßÇöµÉ ¼ö ÀÖ´Ù. ÀÌ °æ¿ì ÀÌ ¾àÀÇ º¹¿ëÀ» Áß´ÜÇØ¾ß ÇÑ´Ù.
|
| »óÈ£ÀÛ¿ë |
1) ±³°¨½Å°æÈïºÐ¾à°ú º´¿ëÇÒ °æ¿ì ÀÌ ¾àÀÇ ÀÛ¿ëÀÌ Áõ°¡µÉ ¼ö ÀÖÀ¸¹Ç·Î °¨·®ÇÏ´Â µî ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
2) Ŭ·Î·ÎÆ÷¸§, ½ÃŬ·ÎÇÁ·ÎÆÇ, ÇÒ·Îź µî ÇҷΰÕÈ ¸¶ÃëÁ¦¿Í º´¿ëÇÒ °æ¿ì ½É½Ç¼º ºÎÁ¤¸ÆÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î º´¿ëÅõ¿©ÇÏÁö ¾Ê´Â´Ù.
3) °íÇ÷¾Ð¾à, »ïȯ°è Ç׿ì¿ï¾à µî°ú º´¿ëÅõ¿©½Ã¿¡´Â Ç÷¾ÐÀ» °üÂûÇÏ¸é¼ ½ÅÁßÈ÷ Åõ¿© ÇÑ´Ù.
4) °½É¹è´çü¸¦ Åõ¿© ¹Þ´Â ȯÀÚÀÇ °æ¿ì ºÎÁ¤¸ÆÀÇ À§ÇèÀÌ Áõ°¡ ÇÒ ¼ö ÀÖ´Ù.
5) ¸Æ°¢¾ËÄ®·ÎÀ̵带 Åõ¿© ¹Þ´Â ȯÀÚÀÇ °æ¿ì ¸Æ°¢Áßµ¶ÀÇ À§ÇèÀÌ Áõ°¡ ÇÒ ¼ö ÀÖ´Ù.
6) ½Ä¿å¾ïÁ¦Á¦ ¹× ¾ÏÆäŸ¹Î°ú °°Àº Á¤½ÅÈïºÐÁ¦¸¦ Åõ¿© ¹Þ´Â ȯÀÚÀÇ °æ¿ì °íÇ÷¾ÐÀÌ ³ªÅ¸³¯ ÀÖ´Ù.
7) ¿Á½ÃÅä½ÅÀ» Åõ¿© ¹Þ´Â ȯÀÚÀÇ °æ¿ì °íÇ÷¾ÐÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| ÀӺο¡ ´ëÇÑ Åõ¿© |
[ÀӺαݱ⠼ººÐ Á¶È¸]
ÀÓ½ÅÁßÀÇ Åõ¿©¿¡ ´ëÇÑ ¾ÈÀü¼ºÀÌ È®¸³µÇ¾î ÀÖÁö ¾ÊÀ¸¹Ç·Î ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ¿©¼º¿¡´Â Ä¡·á»óÀÇ À¯ÀͼºÀÌ À§Ç輺À» »óȸÇÑ´Ù°í ÆÇ´ÜµÇ´Â °æ¿ì¿¡¸¸ Åõ¿©ÇÑ´Ù.
|
| ¼öÀ¯ºÎ¿¡ ´ëÇÑ Åõ¿© |
¸ðÀ¯·ÎÀÇ ÀÌÇàÀÌ º¸°íµÇ¾î ÀÖÀ¸¹Ç·Î ¼öÀ¯Áß¿¡´Â Åõ¿©¸¦ ÇÇÇÏ°í ºÎµæÀÌÇÑ °æ¿ì¿¡ ´Â ¼öÀ¯¸¦ Áß´ÜÇÑ´Ù.
|
| ¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿© |
¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿©
2¼¼ ¹Ì¸¸ÀÇ ¼Ò¾Æ´Â ÀÇ»çÀÇ Áö½Ã¿¡ µû¶ó Åõ¿©ÇÑ´Ù.
°í·ÉÀÚ¿¡ ´ëÇÑ Åõ¿©
°í·ÉÀڴ ƯÈ÷ ÀÌ ¾à¿¡ ÀÇÇÑ ÀÌ»ó¹ÝÀÀÀÌ ³ªÅ¸³ª±â ½±°í °ú·®Åõ¿©½Ã ȯ°¢, °æ·Ã, ÁßÃ߽Űæ°è ¾ïÁ¦ ¹× »ç¸ÁÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù.
|
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
Â÷±¤±â¹Ð¿ë±â |
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
º¯ºñ°¡ »ý±æ¼ö ÀÖ½À´Ï´Ù. |
|
 |
¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Ephedrine¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Pseudoephedrine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Pseudoephedrine acts directly on both alpha- and, to a lesser degree, beta-adrenergic receptors. Through direct action on alpha-adrenergic receptors in the mucosa of the respiratory tract, pseudoephedrine produces vasoconstriction. Pseudoephedrine relaxes bronchial smooth muscle by stimulating beta2-adrenergic receptors. Like ephedrine, pseudoephedrine releasing norepinephrine from its storage sites, an indirect effect.
|
| Pharmacology |
Pseudoephedrine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Pseudoephedrine is a sympathomimetic agent, structurally similar to ephedrine, used to relieve nasal and sinus congestion and reduce air-travel-related otalgia in adults. The salts pseudoephedrine hydrochloride and pseudoephedrine sulfate are found in many over-the-counter preparations either as single-ingredient preparations, or more commonly in combination with antihistamines and/or paracetamol/ibuprofen. Unlike antihistamines, which modify the systemic histamine-mediated allergic response, pseudoephedrine only serves to relieve nasal congestion commonly associated with colds or allergies. The advantage of oral pseudoephedrine over topical nasal preparations, such as oxymetazoline, is that it does not cause rebound congestion (rhinitis medicamentosa).
|
| Metabolism |
Pseudoephedrine¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Monoamine oxidase type A (MAO-A)
|
| Protein Binding |
Pseudoephedrine¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Pseudoephedrine does not bind to human plasma proteins over the concentration range of 50 to 2000 ng/mL
|
| Half-life |
Pseudoephedrine¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 9-16 hours
|
| Absorption |
Pseudoephedrine¿¡ ´ëÇÑ Absorption Á¤º¸ Pseudoephedrine is readily and almost completely absorbed from the GI tract and there is no evidence of first-pass metabolism.
|
| Pharmacokinetics |
Pseudoephedrine HClÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ºñÃæÇ÷Á¦°Å È¿°úÀÇ ¹ßÇö½Ã°£ (°æ±¸Åõ¿©½Ã) : 15-30ºÐ
- ÀÛ¿ëÁö¼Ó½Ã°£ : 4-6 ½Ã°£ (¼¹æÇü Á¦Á¦´Â 12½Ã°£ Áö¼Ó)
- ´ë»ç : °£¿¡¼ ÀϺΠ´ë»ç
- ¹Ý°¨±â : 9-16 ½Ã°£
- ¼Ò½Ç : Åõ¿©·®ÀÇ 70-90%°¡ ¹Ìº¯Èü·Î, 1-6%°¡ norpseudoephedrineÀ¸·Î ¼Òº¯À¸·Î ¹è¼³µÊ. ½Å¹è¼³Àº ´¢ pH¿Í ´¢·®¿¡ ÀÇÇØ º¯ÈµÇ¸ç ¾ËÄ®¸®´¢´Â pseudoephedrineÀÇ ½Å¹è¼³À» °¨¼Ò½ÃÅ´.
|
| Biotransformation |
Pseudoephedrine¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic.
|
| Toxicity |
Pseudoephedrine¿¡ ´ëÇÑ Toxicity Á¤º¸ Common adverse reactions include nervousness, restlessness, and insomnia. Rare adverse reactions include difficult/painful urination, dizziness/lightheadedness, heart palpitations, headache, increased sweating, nausea/vomiting, trembling, troubled breathing, unusual paleness, and weakness.
|
| Drug Interactions |
Pseudoephedrine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Alseroxylon Increased arterial pressureIsocarboxazid Increased arterial pressureLinezolid Possible increase of arterial pressureMethyldopa Increased arterial pressureBromocriptine The sympathomimetic increases the toxicity of bromocriptineTranylcypromine Increased arterial pressureMidodrine Increased arterial pressureMoclobemide Moclobemide increases the sympathomimetic effectPargyline Increased arterial pressurePhenelzine Increased arterial pressureRasagiline Increased arterial pressureReserpine Increased arterial pressureTrimipramine The tricyclic increases the sympathomimetic effectProtriptyline The tricyclic increases the sympathomimetic effectNortriptyline The tricyclic increases the sympathomimetic effectAmitriptyline The tricyclic increases the sympathomimetic effectAmoxapine The tricyclic increases the sympathomimetic effectClomipramine The tricyclic increases the sympathomimetic effectImipramine The tricyclic increases the sympathomimetic effectDesipramine The tricyclic increases the sympathomimetic effectDoxepin The tricyclic increases the sympathomimetic effectDeserpidine Increased arterial pressureGuanethidine The agent decreases the effect of guanethidine
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Pseudoephedrine¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take without regard to meals.
|
| Drug Target |
[Drug Target]
|
| Description |
Pseudoephedrine¿¡ ´ëÇÑ Description Á¤º¸ An alpha- and beta-adrenergic agonist that may also enhance release of norepinephrine. It has been used in the treatment of several disorders including asthma, heart failure, rhinitis, and urinary incontinence, and for its central nervous system stimulatory effects in the treatment of narcolepsy and depression. It has become less extensively used with the advent of more selective agonists. [PubChem]
|
| Drug Category |
Pseudoephedrine¿¡ ´ëÇÑ Drug_Category Á¤º¸ Adrenergic AgentsBronchodilator AgentsCentral Nervous System AgentsNasal DecongestantsSympathomimeticsVasoconstrictor Agents
|
| Smiles String Canonical |
Pseudoephedrine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CNC(C)C(O)C1=CC=CC=C1
|
| Smiles String Isomeric |
Pseudoephedrine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CN[C@@H](C)[C@@H](O)C1=CC=CC=C1
|
| InChI Identifier |
Pseudoephedrine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C10H15NO/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,10-12H,1-2H3/t8-,10+/m0/s1
|
| Chemical IUPAC Name |
Pseudoephedrine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (1S,2S)-2-methylamino-1-phenylpropan-1-ol
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2026-02-02
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|