| |
|
|
|
|
|
 |
| |
|
¿¤Æ®¸¯½ºÁ¤ L-TRIX TABS.[Levothyroxine Sodium , Liothyronine Sodium]
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
653701030[A11800951]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1Á¤(2018.03.01)(ÇöÀç¾à°¡)
\40 ¿ø/1Á¤(2017.02.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»öÀÇ ¿øÇüÁ¤Á¦
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
1000TABS |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 0.05¹Ð¸®±×·¥ |
1000 Á¤ |
8806537010305 |
8806537010329 |
|
| 0.05¹Ð¸®±×·¥ |
30 Á¤ |
8806537010305 |
8806537010312 |
|
|
| ÁÖ¼ººÐÄÚµå |
296800ATB
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| ´ëÇ¥ÄÚµå |
8806537010305 |
| º¸°ü¹æ¹ý |
±â¹Ð¿ë±â, ½Ç¿Â(1¡30¡É)º¸°ü |
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
1. °©»ó¼±±â´ÉÀúÇÏÁõ, Á¡¾×ºÎÁ¾, Å©·¹Æ¾º´
2. ´Ü¼ø¼º °©»ó¼±Á¾, ¾Æ±Þ¼º ¶Ç´Â ¸¸¼º ¸²ÇÁ±¸¼º °©»ó¼±¿°(ÇϽøðÅ亴)
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¼ºÀÎ : º¸Åë ÃÊȸ·®Àº 1ÀÏ 1ȸ 1/2Á¤À¸·Î Çϸç 2-3ÁÖ °£°ÝÀ¸·Î 1/4Á¤¾¿ Áõ·®ÇÑ´Ù. ƯÈ÷ Çù½ÉÁõ µî ½ÉÇ÷°ü°è Àå¾Ö°¡ ÀǽɵǴ Àå±â°£ Áö¼ÓµÈ Á¡¾×ºÎÁ¾ ȯÀÚ´Â 1/4Á¤ÀÇ ³·Àº ¿ë·®À¸·Î Åõ¿©¸¦ ½ÃÀÛÇÏ´Â °ÍÀÌ ±ÇÀåµÈ´Ù.
À¯Áö·®Àº 1ÀÏ 1ȸ 1-2Á¤À¸·Î ÇÑ´Ù.
´Ü, ¿¬·É ¹× Áõ»ó¿¡ µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù.
|
| °æ°í |
°©»ó¼± ±â´ÉÀÌ Á¤»óÀÎ »ç¶÷ÀÌ Ã¼Áß°¨¼Ò¸¦ À§ÇØ °©»ó¼± È£¸£¸óÁ¦¸¦ ´Üµ¶ ¶Ç´Â ´Ù¸¥ ¾à¹°°ú º´¿ëÅõ¿©ÇÏ´Â °ÍÀº ÀûÀýÇÏÁö ¾ÊÀ¸¸ç È¿°ú°¡ ¾ø´Ù. ƯÈ÷ ½Ä¿å°¨Åð È¿°ú°¡ ÀÖ´Â ±³°¨½Å°æ ÈïºÐ¼º ¾Æ¹Î°ú º´¿ëÅõ¿©½Ã »ý¸íÀ» À§ÇùÇÒ Á¤µµÀÇ ½É°¢ÇÑ µ¶¼ºÀÌ ¹ß»ýÇÒ ¼ö ÀÖ´Ù.
|
| ±Ý±â |
1) ±Þ¼º ½É±Ù°æ»ö, ±Þ¼º ½É±Ù¿°, ±Þ¼º ÀüÃþ ½ÉÀå¿° ȯÀÚ
2) ºÎ½ÅÇÇÁúºÎÀü ȯÀÚ
3) °©»ó¼±Áßµ¶Áõ ȯÀÚ
4) ÀÌ ¾à¿¡ °ú¹ÎÁõ ȯÀÚ
|
| ½ÅÁßÅõ¿© |
1) Çù½ÉÁõ ȯÀÚ ¶Ç´Â ½ÉÁúȯ ÀáÀç °¡´É¼ºÀÌ Å« ³ëÀΠȯÀÚ¸¦ Æ÷ÇÔÇÑ ½ÉÇ÷°ü°è ÀÌ»ó ȯÀÚ
(Åõ¿©¸¦ Àú¿ë·® 1/4-1/2Á¤À¸·Î ½ÃÀÛÇÑ´Ù)
2) ´ç´¢º´ ¹× ¿äºØÁõ ȯÀÚ |
| ÀÌ»ó¹ÝÀÀ |
1) Åõ¿©Áß ÈäÅë, ¸Æ¹Ú¼ö Áõ°¡, ½É°èÇ×Áø, ¹ßÇÑ °ú´Ù, ¿¿¡ ´ëÇÑ ºÒ³»¼º, ½Å°æÁú ¹× ±âŸ ´Ù¸¥ °©»ó¼± È£¸£¸ó Áßµ¶ Áõ»óÀÌ ³ªÅ¸³ª¸é Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
2) °ú·®Åõ¿© ¶Ç´Â ±Þ°ÝÇÑ ¿ë·® Áõ°¡¿¡ ÀÇÇØ ¿ù°æÀÌ»ó, ½Å°æ°ú¹Î, ºÎÁ¤¸Æ, Çù½ÉÁõ µîÀÇ °©»ó¼±±â´ÉÇ×Áø Áõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| ÀϹÝÀû ÁÖÀÇ |
1) ÀϽÃÀû °©»ó¼±±â´ÉÀúÇÏÁõÀ» Á¦¿ÜÇϰí´Â ÀÌ º¸»ó¿ä¹ýÀº °è¼Ó ½Ç½ÃÇÑ´Ù.
2) ¼Ò¾ÆÀÇ °æ¿ì Ä¡·á óÀ½ ¸î ´Þ »çÀÌ¿¡ ºÎºÐÀûÀÎ Å»¸ðÁõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸³ª ÀϽÃÀû Çö»óÀ¸·Î º¸ÅëÀº ȸº¹µÈ´Ù.
3) °©»ó¼± È£¸£¸óÁ¦¸¦ Åõ¿©Çϴ ȯÀÚÀÇ °æ¿ì Á¤±âÀûÀ¸·Î ÀûÀýÇÑ ÀÓ»óÆò°¡¸¦ ÇÏ¿© °©»ó¼±È£¸£¸ó »óŸ¦ Á¡°ËÇÑ´Ù.
4) °©»ó¼±±â´ÉÀúÇÏÁõÀº °æ±¸¿ë Ç×ÀÀ°íÁ¦ÀÇ ¹Î°¨¼ºÀ» ³·Ãß°í, °©»ó¼±±â´ÉÇ×ÁøÁõÀº °æ±¸¿ë Ç×ÀÀ°íÁ¦ÀÇ ¹Î°¨¼ºÀ» Áõ°¡½ÃŲ´Ù. °©»ó¼±Ä¡·á¸¦ ¹Þ´Â ȯÀÚ¿¡°Ô Ç×ÀÀ°íÁ¦¸¦ º´¿ëÅõ¿©½Ã Ç×ÀÀ°íÁ¦¿¡ ´ëÇÑ ÇÁ·ÎÆ®·Òºó ½Ã°£À» ¼¼¹ÐÈ÷ °üÂûÇϰí ÇÁ·ÎÆ®·Òºó ½Ã°£¿¡ ±Ù°ÅÇØ¼ Ç×ÀÀ°íÁ¦ÀÇ ¿ë·®À» °áÁ¤ÇÑ´Ù.
5) °íÇ÷¾ÐÀ» Æ÷ÇÔÇÑ ½ÉÇ÷°ü°è Áúȯ ȯÀÚ¿¡°Ô ÀÌ ¾àÀ» Åõ¿©ÇÒ °æ¿ì ÈäÅëÀÇ ¹ßÀü ¶Ç´Â ´Ù¸¥ ½ÉÇ÷°ü°è ÁúȯÀÇ ¾ÇȰ¡ ÀÖÀ» °æ¿ì ÀÌ ¾àÀ» °¨·®ÇÏ´Â µî ÁÖÀÇÇÑ´Ù.
6) ´ç´¢º´, ¿äºØÁõ ¶Ç´Â ºÎ½ÅÇÇÁúºÎÀü ȯÀÚ¿¡°Ô °©»ó¼±È£¸£¸ó ¿ä¹ý½Ã ±× Áõ»óÀÇ °µµ¸¦ ½ÉȽÃŰ¹Ç·Î ÀÌ·¯ÇÑ º´ÇàÇÏ´Â ³»ºÐºñ Áúȯ¿¡ ´ëÇÑ ´Ù¾çÇÑ Ä¡·áÀû óġ¸¦ ÀûÀýÈ÷ ÇÑ´Ù.
7) Á¡¾×ºÎÁ¾ È¥¼ö¿¡ ÀÖ¾î ´çÁúÄÚ¸£Æ¼ÄÚÀ̵åÀÇ º´¿ëÅõ¿©°¡ ÇÊ¿äÇÏ´Ù.
8) ÃʱØÀúüÁß ½Å»ý¾Æ Ä¡·á½Ã ºÎ½Å±â´É ¹Ì¼º¼÷À¸·Î ÀÎÇØ ¼øÈ¯ÇãÅ»ÀÌ ¹ß»ýÇÒ ¼ö ÀÖÀ¸¹Ç·Î Ç÷Çà ¿ªÇÐÀû ÁöÇ¥¸¦ ¸ð´ÏÅ͸µÇØ¾ß ÇÑ´Ù.
9) ºñ¿ÀƾÀº °©»ó¼± ¸é¿ªºÐ¼®°Ë»ç¿¡ °£¼·À» À¯¹ßÇÏ¿© °Ë»ç °á°ú°¡ ½ÇÁ¦º¸´Ù ³·°Ô ¶Ç´Â ³ô°Ô ÃøÁ¤µÉ ¼ö ÀÖ´Ù. °©»ó¼± ±â´É°Ë»ç°¡ ¿ä±¸µÉ ¶§ ºñ¿Àƾ ¼ººÐÁ¦Á¦¸¦ º¹¿ë ÁßÀΠȯÀÚ´Â ±× »ç½ÇÀ» °Ë»ç¿ø¿¡°Ô ¾Ë·Á¾ß ÇÑ´Ù. °¡´ÉÇÑ °æ¿ì, ºñ¿Àƾ °£¼·¿¡ ¿µÇâÀ» ¹ÞÁö ¾Ê´Â ´ëü °Ë»ç¸¦ ½Ç½ÃÇØ¾ß ÇÑ´Ù. |
| »óÈ£ÀÛ¿ë |
1) °©»ó¼±È£¸£¸óÀº ºñŸ¹ÎKÀÇÁ¸¼º ÀÀ°íÀÎÀÚÀÇ ÀÌÈÀÛ¿ëÀ» Áõ°¡½ÃŰ¹Ç·Î °æ±¸¿ë Ç×ÀÀ°íÁ¦¸¦ Åõ¿©ÁßÀΠȯÀÚ´Â Ç×ÀÀ°íÁ¦ÀÇ ¿ë·®À» °¨·®ÇÑ´Ù.
2) °©»ó¼±È£¸£¸ó ¿ä¹ý Ãʱ⿡´Â Àν¶¸° ¶Ç´Â °æ±¸¿ë Ç÷´ç°ÇÏÁ¦ÀÇ ¿ä±¸·®ÀÌ Áõ°¡µÉ ¼ö ÀÖ´Ù.
3) ÄÝ·¹½ºÆ¼¶ó¹Î ¶Ç´Â ÄÝ·¹½ºÆ¼ÆúÀº Àå°ü ³»¿¡¼ T4 ¹× T3¿Í °áÇÕÇϹǷΠÄÝ·¹½ºÆ¼¶ó¹Î ¶Ç´Â ÀÌ¿Í À¯»çÇÑ ÄÝ·¹½ºÅ×·ÑÀ» Åõ¿©ÇÒ °æ¿ì °©»ó¼±È£¸£¸ó°ú 4-5½Ã°£ÀÇ Åõ¿© °£°ÝÀ» µÐ´Ù.
4) ¿¡½ºÆ®·Î°ÕÀº Ç÷û Ƽ·Ï½Å°áÇձ۷κҸ°(TBG)À» Áõ°¡½ÃŰ¹Ç·Î ¿¡½ºÆ®·Î°Õ ¶Ç´Â ¿¡½ºÆ®·Î°ÕÀ» ÇÔÀ¯ÇÑ °æ±¸ÇÇÀÓÁ¦¸¦ Åõ¿©Çϰí ÀÖ´Â À¯¸®Çü Ƽ·Ï½ÅÄ¡ÀÇ Á¶ÀýÀÌ ºÒ°¡´ÉÇÑ ¹«±â´É¼º °©»ó¼± ȯÀÚ´Â °©»ó¼±È£¸£¸ó ¿ë·®À» Áõ°¡½Ãų Çʿ䰡 ÀÖ´Ù.
5) Ä®½·Á¦Á¦, ¼¼º§¶ó¸Ó, ¶õŸ´½ µîÀÇ Àλ꿰°ú °áÇÕÇÏ´Â ¾à¹°À» º´¿ëÅõ¿©½Ã ÀÌ ¾àÀÇ Èí¼ö°¡ Áö¿¬ ¶Ç´Â °¨¼ÒµÉ ¼ö ÀÖÀ¸¹Ç·Î Åõ¿©°£°Ý¿¡ ÁÖÀÇÇÏ¿© ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.(ÃÖ¼Ò 4½Ã°£ °£°Ý)
6) ·¹º¸Æ¼·Ï½Å°ú ¿À¸£¸®½ºÅ¸Æ® µ¿½Ã º¹¿ë ½Ã °©»ó¼± ÀúÇÏÁõ ¹×/¶Ç´Â °©»ó¼± ÀúÇÏÁõ Á¶Àý ÀúÇϰ¡ ¹ß»ýÇÒ ¼ö ÀÖ´Ù.
7) ºñ¿ÀƾÀº ºñ¿Àƾ/½ºÆ®·¾Å¸ºñµò »óÈ£ÀÛ¿ëÀ» ±â¹ÝÀ¸·Î ÇÏ´Â °©»ó¼± ¸é¿ªºÐ¼®¹ýÀ» ¹æÇØÇÏ¿© °Ë»ç °á°ú°¡ °¨¼ÒÇϰųª Áõ°¡ÇÒ ¼ö ÀÖ´Ù.
8) ¼¼ÀÎÆ®Á¸½º¿öÆ®°¡ Æ÷ÇÔµÈ Á¦Ç°°ú °°Àº È¿¼Ò À¯µµ ¾à¹°Àº ·¹º¸Æ¼·Ï½ÅÀÇ °£ û¼ÒÀ²À» Áõ°¡½ÃÄÑ °©»ó¼± È£¸£¸óÀÇ Ç÷û ³óµµ¸¦ °¨¼Ò½Ãų ¼ö ÀÖ´Ù. °©»ó¼± ´ëü ¿ä¹ýÀ» ¹Þ´Â ȯÀÚ´Â ÀÌ·¯ÇÑ Á¦Ç°À» µ¿½Ã Åõ¿© ½Ã °©»ó¼± È£¸£¸ó ¿ë·®À» ´Ã·Á¾ß ÇÒ ¼ö ÀÖ´Ù.
9) ÇÁ·ÎÅæ ÆßÇÁ ¾ïÁ¦Á¦(PPI)¿ÍÀÇ º´¿ëÅõ¿©´Â °©»ó¼± È£¸£¸óÀÇ Èí¼ö¸¦ °¨¼Ò½Ãų ¼ö ÀÖ´Ù. º´¿ë Ä¡·á µ¿¾È °©»ó¼± ±â´ÉÀÇ Á¤±âÀû ¸ð´ÏÅ͸µ ¹× ÀÓ»ó ¸ð´ÏÅ͸µÀÌ ±ÇÀåµÇ¸ç, °©»ó¼± È£¸£¸óÀÇ ¿ë·®À» ´Ã·Á¾ß ÇÒ ¼öµµ ÀÖ´Ù. PPI Ä¡·á°¡ ³¡³¯ ¶§µµ ÁÖÀǸ¦ ±â¿ï¿©¾ß ÇÑ´Ù. |
| ÀӺο¡ ´ëÇÑ Åõ¿© |
[ÀӺαݱ⠼ººÐ Á¶È¸]
°©»ó¼±È£¸£¸óÀº ÅÂ¹Ý °ü¹®À» ½±°Ô Åë°úÇÏÁö ¾Ê´Â´Ù. ÇöÀç±îÁöÀÇ ÀÓ»ó°æÇè °á°ú ÀӺο¡ °©»ó¼± È£¸£¸óÀ» Åõ¿©ÇßÀ» ¶§ žƿ¡ ´ëÇÑ ºÎÀÛ¿ëÀÌ ³ªÅ¸³ªÁö ¾Ê¾ÒÀ¸¹Ç·Î ÀӽŠÁß¿¡µµ Ä¡·á¸¦ Áß´ÜÇÏÁö ¾Ê´Â´Ù.
|
| ¼öÀ¯ºÎ¿¡ ´ëÇÑ Åõ¿© |
°©»ó¼±È£¸£¸óÀº ¼Ò·® À¯ÁóÀ¸·Î ºÐºñµÈ´Ù. ½É°¢ÇÑ ºÎÀÛ¿ë°ú °ü·ÃÀÌ ¾øÀ¸¸ç Á¾¾çÀ» ¹ß»ý½ÃŰÁö ¾ÊÀ¸³ª ÀÌ ¾àÀ» ¼öÀ¯ºÎ¿¡ Åõ¿©½Ã ÁÖÀÇÇÑ´Ù. |
| ¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿© |
1) ÀӺδ Å¾ƿ¡°Ô °©»ó¼±È£¸£¸óÀ» °ÅÀÇ Àü´ÞÇÏÁö ¾ÊÀ¸¹Ç·Î ¼±Ãµ¼º °©»ó¼±±â´ÉÀúÇÏÁõÀÇ ¹ß»ý ºóµµ´Â ºñ±³Àû ³ôÀº ÆíÀÌ´Ù(1 : 4,000). °©»ó¼±È£¸£¸ó °áÇÌÀº ¼ºÀå°ú ¹ß´Þ¿¡ À¯ÇØÇÑ ¿µÇâÀ» ÁÙ ¼ö ÀÖÀ¸¹Ç·Î ½Å»ý¾ÆÀÇ °æ¿ì Ç÷û ·¹º¸Ä¡·Ï½Å(T4) ¹× °©»ó¼±ÀÚ±ØÈ£¸£¸ó(TSH)Ä¡¸¦ Á¤±âÀûÀ¸·Î ÃøÁ¤ÇÏ´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù.
2) À¯¾ÆÀÇ °æ¿ì °ú·®Åõ¿©¿¡ ÀÇÇØ µÎ°³°ñ Á¶±âºÀÇÕÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
3) ¼±Ãµ¼º ¹× ÈÄõ¼º °©»ó¼± ÀúÇÏÁõ ¼Ò¾Æ ȯÀÚÀÇ °æ¿ì, ºÒÃæºÐÇÑ Ä¡·á´Â ÀÎÁö ¹ß´Þ°ú ¼±Çü ¼ºÀå¿¡ ºÎÁ¤Àû ¿µÇâÀ» ¹ÌÄ¥ ¼ö ÀÖÀ¸¸ç, °úÀ× Ä¡·á´Â µÎ°³°ñ À¯ÇÕÁõ°ú °ñ¿¬·É °¡¼ÓÈ¿Í ¿¬°üÀÌ ÀÖ´Ù. |
| °ú·®Åõ¿© ¹× óġ |
1) Áõ»ó : ¸ðµç ¸é¿¡¼ ³»Àμº È£¸£¸ó À¯·¡ÀÇ »óÅÂ¿Í À¯»çÇÑ °ú½ÅÁø´ë»ç¸¦ ÃÊ·¡ÇÑ´Ù.
2) óġ : °ú·®Åõ¿©ÀÇ Áõ»óÀÌ ³ªÅ¸³ª¸é °¨·® ¶Ç´Â Åõ¿©¸¦ ÀϽÃÀûÀ¸·Î ÁßÁöÇÑ´Ù. Ä¡·á´Â Àú¿ë·®¿¡¼ Àç°³ÇÑ´Ù. Á¤»óÀο¡¼ Á¤»óÀûÀÎ ½Ã»óÇϺÎ-³úÇϼöü-°©»ó¼± ÃàÀÇ ±â´ÉÀº °©»ó¼± ¾ïÁ¦ ÈÄ 6-8ÁÖ ³»¿¡ ȸº¹µÈ´Ù. °©»ó¼±È£¸£¸óÀ» ±Þ¼º °ú·®Åõ¿©½Ã ¾à¹°ÀÇ À§Àå°ü Èí¼ö¸¦ ¸·¾Æ ÁÖ·Î ±³°¨½Å°æ ÈïºÐ¿¡ ÀÇÇÑ ÁßÃß ¹× ¸»ÃÊ¿¡ÀÇ ¿µÇâÀ» ÁÙÀδÙ. À§Àå°ü¿¡¼ÀÇ ¾à¹° Èí¼ö¸¦ ¸·°í È¥¼ö, °æ·Ã ¶Ç´Â ±¸¿ª¹Ý»ç¼Ò½Ç µîÀ» ¹æÁöÇϱâ À§ÇØ ¸ÕÀú ±¸Å並 À¯¹ßÇϰí, ´ëÁõ¿ä¹ýÀ¸·Î Ä¡·áÇÑ´Ù.
»ê¼Ò¸¦ °ø±ÞÇØ ȯ±â¸¦ À¯ÁöÇÑ´Ù. ¿ïÇ÷¼º ½ÉºÎÀüÀ¸·Î ¹ßÀüÇÒ °æ¿ì °½É¹è´çü¸¦ Åõ¿©ÇÑ´Ù. ÇÊ¿ä½Ã ¹ß¿, ÀúÇ÷´çÁõ ¶Ç´Â ¼öºÐ¼Ò½Ç¿¡ ´ëÇØ ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù. ±³°¨½Å°æÈïºÐÁõ»ó¿¡´Â ±Ý±â»çÇ×ÀÌ ¾ø´Â °æ¿ì¿¡ ±³°¨½Å°æÂ÷´Ü¾à¹° ƯÈ÷ ÇÁ·ÎÇÁ¶ó³î·ÑÀ» ÃÊȸ·®À¸·Î 1-3mgÀ» 10ºÐ ÀÌ»ó Á¤¸ÆÁÖ»çÇϰųª 1ÀÏ 80-160mgÀ» °æ±¸Åõ¿©ÇÑ´Ù. |
ÀÓ»ó°Ë»çÄ¡¿¡ÀÇÇÑ ¿µÇâ |
1) Ƽ·Ï½Å°áÇձ۷κҸ°(TBG)ÀÇ ³óµµ º¯È¸¦ T4 ¹× T3Ä¡ÀÇ ÇØ¼®¿¡ ÀÖ¾î °í·ÁÇÑ´Ù. ±×·± °æ¿ì¿¡´Â ºñ°áÇÕÈ£¸£¸óÀÇ ³óµµÄ¡¸¦ ÃøÁ¤ÇÑ´Ù. ÀÓ½Å, ¿¡½ºÆ®·Î°Õ, ¿¡½ºÆ®·Î°Õ ÇÔÀ¯ °æ±¸¿ë ÇÇÀÓ¾à ¹× Àü¿°¼º °£¿°Àº Ƽ·Ï½Å°áÇձ۷κҸ°ÀÇ ³óµµ¸¦ Áõ°¡½ÃŰ´Â ¹Ý¸é ½ÅÁõ, ¼±´Üºñ´ëÁõ ¹× ¾Èµå·Î°Õ ¶Ç´Â ÄÚ¸£Æ¼ÄÚÀÌµå ¿ä¹ý µ¿¾È¿¡´Â °¨¼ÒµÈ´Ù. °¡Á·¼º Ƽ·Ï½Å°áÇÕ ±Û·ÎºÒ¸°Ç÷Áõ ¹× °í±Û·ÎºÒ¸°Ç÷ÁõÀÌ º¸°íµÇ¾ú´Ù. Ƽ·Ï½Å°áÇձ۷κҸ° °áÇÌÀÇ È®·üÀº ¾à 1/9,000ÀÌ´Ù. ¾ËºÎ¹Î°ú Ä¡·Ï½ÅÀÇ °áÇÕÀº »ì¸®½Ç»ê¿¡ ÀÇÇØ ¾ïÁ¦µÈ´Ù.
2) ÀǾà¿ë ¶Ç´Â ½ÄÀ̼º ¿ä¿Àµå´Â ¸ðµç ¹æ»ç¼± ¿ä¿Àµå ÈíÂø »ýü³»(in vivo) ½ÃÇèÀ» ¹æÇØÇÏ¿© ³·Àº ÈíÂøÀ²À» º¸À̴µ¥, À̰ÍÀº È£¸£¸ó »ýÇÕ¼ºÀÌ ½ÇÁ¦·Î °¨¼ÒÇÔÀ» ¹Ý¿µÇÏ´Â °ÍÀº ¾Æ´Ï´Ù.
3) ÀûÀýÇÑ ¿ë·® ´ëü¿¡µµ ºÒ±¸ÇÏ°í °©»ó¼±±â´ÉÀúÇÏÁõÀÇ Áö¼ÓÀÌ ÀÓ»óÀû ¹× ½ÇÇè½ÇÀû Áõ°Å·Î ³ªÅ¸³ª´Â °ÍÀº ȯÀÚÀÇ ³·Àº ¼øÀÀ¼º, ³·Àº Èí¼öÀ², º¯À¸·ÎÀÇ ¹èÃâ°ú´Ù ¶Ç´Â Á¦Á¦ÀÇ ºñȰ¼ºÈ¸¦ ÀǹÌÇÏ¸ç °©»ó¼±È£¸£¸ó¿¡ ´ëÇÑ ¼¼Æ÷³» ÀúÇ×Àº ¸Å¿ì µå¹°´Ù. |
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
±â¹Ð¿ë±â, ½Ç¿Â(1¡30¡É)º¸°ü |
| ±âŸ |
¸®¿ÀÄ¡·Î´Ñ³ªÆ®·ýÀÇ Åõ¿©¿¡ ÀÇÇØ µå¹°°Ô ¼ï, ¿ïÇ÷¼º ½ÉºÎÀüÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù´Â º¸°í°¡ ÀÖ´Ù. °ú·®Åõ¿©¿¡ ÀÇÇØ ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î °¨·® ¶Ç´Â ÈÞ¾àÇÏ´Â µî ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù. |
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Aµî±Þ
(levothyroxine, liothyronine )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Thyroxin¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Levothyroxine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Levothyroxine acts like the endogenous thyroid hormone thyroxine (T4, a tetra-iodinated tyrosine derivative). In the liver and kidney, T4 is converted to T3, the active metabolite. In order to increase solubility, the thyroid hormones attach to thyroid hormone binding proteins, thyroxin-binding globulin, and thyroxin-binding prealbumin (transthyretin). Transport and binding to thyroid hormone receptors in the cytoplasm and nucleus then takes place. Thus by acting as a replacement for natural thyroxine, symptoms of thyroxine deficiency are relieved.
Liothyronine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ The thyroid hormones, thyroxine (T4) and triiodothyronine (liothyronine or T3), are tyrosine-based hormones produced by the thyroid gland. An important component in the synthesis is iodine. The major form of thyroid hormone in the blood is thyroxine (T4). This is converted to the active liothyronine within cells by deiodinases. liothyronine acts on the body to increase the basal metabolic rate, affect protein synthesis and increase the body's sensitivity to catecholamines (such as adrenaline). The thyroid hormones are essential to proper development and differentiation of all cells of the human body. To various extents they regulate protein, fat and carbohydrate metabolism. But they have their most pronounced effects on how human cells use energetic compounds.
|
| Pharmacology |
Levothyroxine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Levothyroxine (T4) is a synthetically prepared levo isomer of thyroxine, the major hormone secreted from the thyroid gland. Thyroxine is released from thyroglobulin by proteolysis and secreted into the blood. Thyroxine is peripherally deiodinated to form triiodothyronine which exerts a broad spectrum of stimulatory effects on cell metabolism. Thyroid hormone increases the metabolic rate of cells of all tissues in the body. In the fetus and newborn, thyroid hormone is important for the growth and development of all tissues including bones and the brain. In adults, thyroid hormone helps to maintain brain function, food metabolism, and body temperature, among other effects. The symptoms of thyroid deficiency relieved by levothyroxine include slow speech, lack of energy, weight gain, hair loss, dry thick skin and unusual sensitivity to cold.
Liothyronine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Thyroid hormone drugs are natural or synthetic preparations containing tetraiodothyronine (T4, levothyroxine) or triiodothyronine (T3, liothyronine) or both. T4 and T3 are produced in the human thyroid gland by the iodination and coupling of the amino acid tyrosine. Liothyronine (T3) contains three atoms of iodine and is formed by the coupling of one molecule of diiodotyrosine (DIT) with one molecule of monoiodotyrosine (MIT). These hormones enhance oxygen consumption by most tissues of the body and increase the basal metabolic rate and the metabolism of carbohydrates, lipids and proteins. Thus, they exert a profound influence on every organ system in the body and are of particular importance in the development of the central nervous system.
|
| Metabolism |
Levothyroxine¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 3A4 (CYP3A4)
|
| Protein Binding |
Levothyroxine¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ > 99%
Liothyronine¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 99.7%
|
| Half-life |
Levothyroxine¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 6 to 7 days
Liothyronine¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 2.5 days
|
| Absorption |
Levothyroxine¿¡ ´ëÇÑ Absorption Á¤º¸ Bioavailability varies from 48% to 80%. Human studies have confirmed the importance of an intact jejunum and ileum for levothyroxine absorption and have shown some absorption from the duodenum.
Liothyronine¿¡ ´ëÇÑ Absorption Á¤º¸ Almost totally absorbed, 95 percent in 4 hours.
|
| Pharmacokinetics |
Levothyroxine SodiumÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- T4¿Í T3 ºñ±³
|
°©»ó¼±¿¡¼ ºÐºñµÇ´Â ºñÀ² |
»ý¹°ÇÐÀû È¿·Â |
´Ü¹é°áÇÕ |
¹Ý°¨±â |
| Levothyroxine (T4) |
20 |
1 |
99.97% |
7ÀÏ* |
| Liothyronine (T3) |
1 |
4 |
99.70% |
38½Ã°£* |
* °©»ó¼± ±â´ÉÇ×ÁøÁõÀÇ °æ¿ì ¹Ý°¨±â°¡ °¨¼ÒÇÔ
|
Èí¼ö |
´ë»ç ¹× ¼Ò½Ç |
ÀÛ¿ë¹ßÇö½Ã°£ |
ÀÛ¿ëÁö¼Ó½Ã°£ |
| Levothyroxine (T4) |
BA 74-93% À½½Ä¹°¿¡ ÀÇÇØ °¨¼Ò |
30%´Â Å»¿ä¿ÀµåÈ 20%´Â °£´ë»ç ÈÄ ´ëº¯ ¹è¼³ |
3-5ÀÏ |
7-10ÀÏ |
| Liothyronine (T3) |
BA >95% ¿ïÇ÷¼º ½ÉºÎÀü ½Ã °¨¼Ò |
´ëºÎºÐÀÌ Å»¿ä¿ÀµåÈµÇ¾î ´ë»çü·Î ´¢¹è¼³ |
1-3ÀÏ |
3-5ÀÏ |
- ÀÛ¿ë¹ßÇö½Ã°£ :
- °æ±¸ : 3-5 ÀÏ
- Á¤¸ÆÁÖ»ç : 6-8 ½Ã°£
- Myxedema coma : Á¤¸ÆÁÖ»ç : 6-12 ½Ã°£
- °©»ó¼± ±â´ÉÀúÇÏÁõÀÇ ¿ÏÈ : 2-4 ÁÖ
- ÃÖ´ëÈ¿°ú ¹ßÇö½Ã°£ :
-
°©»ó¼± ±â´ÉÀúÇÏÁõ : °æ±¸ : 4-6 ÁÖ
myxedema coma : Á¤¸ÆÁÖ»ç : 24 ½Ã°£
- ÀÛ¿ëÁö¼Ó½Ã°£ : °©»ó¼± ±â´ÉÀúÇÏÁõ : ¼öÁÖ
- »ýü³»ÀÌ¿ë·ü : °æ±¸ : Á¤Á¦ : 50-80 %
- ºÐÆ÷¿ëÀû : 8.7-9.7 L
- ´ë»ç :
- Ç÷Áß : 85 % : 50%°¡ Ȱ¼ºÇüÀÎ T3(triiodothyronine)À¸·Î Àüȯ
- °£ : °£°æº¯È¯ÀÚÀÇ °æ¿ì T4ÀÇ Áõ°¡¿Í T3ÀÇ °¨¼Ò¸¦ º¸ÀÓ
- ¹Ý°¨±â : 5.3-9.5 ÀÏ(7 ÀÏ)
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : 2-4 ½Ã°£
- ¼Ò½Ç :
- ´¢¿Í º¯À¸·Î ¹è¼³
- total body clearance : 0.84-1.37 L/day
- º¯À¸·Î 50% ¹è¼³
Liothyronine SodiumÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- T4¿Í T3 ºñ±³
|
°©»ó¼±¿¡¼ ºÐºñµÇ´Â ºñÀ² |
»ý¹°ÇÐÀû È¿·Â |
´Ü¹é°áÇÕ |
¹Ý°¨±â |
| Levothyroxine (T4) |
20 |
1 |
99.97% |
7ÀÏ* |
| Liothyronine (T3) |
1 |
4 |
99.70% |
38½Ã°£* |
* °©»ó¼± ±â´ÉÇ×ÁøÁõÀÇ °æ¿ì ¹Ý°¨±â°¡ °¨¼ÒÇÔ
|
Èí¼ö |
´ë»ç ¹× ¼Ò½Ç |
ÀÛ¿ë¹ßÇö½Ã°£ |
ÀÛ¿ëÁö¼Ó½Ã°£ |
| Levothyroxine (T4) |
BA 74-93% À½½Ä¹°¿¡ ÀÇÇØ °¨¼Ò |
30%´Â Å»¿ä¿ÀµåÈ 20%´Â °£´ë»ç ÈÄ ´ëº¯ ¹è¼³ |
3-5ÀÏ |
7-10ÀÏ |
| Liothyronine (T3) |
BA >95% ¿ïÇ÷¼º ½ÉºÎÀü ½Ã °¨¼Ò |
´ëºÎºÐÀÌ Å»¿ä¿ÀµåÈµÇ¾î ´ë»çü·Î ´¢¹è¼³ |
1-3ÀÏ |
3-5ÀÏ |
- ÀÛ¿ë¹ßÇö½Ã°£ :
- °æ±¸ : ¼ö½Ã°£
- Á¤¸ÆÁÖ»ç : 2-4 ½Ã°£
- ÃÖ´ë¾àÈ¿¹ßÇö½Ã°£ : 2-3 ÀÏ
- ÃÖ´ëÇ÷Áß³óµµµµ´Þ½Ã°£ : °æ±¸ : 1-2 ½Ã°£
- »ýü³»ÀÌ¿ë·ü : 85-90 %
- ´ë»ç : °£¿¡¼ ºñȰ¼ºÇüÀ¸·Î ´ë»ç
- ºÐÆ÷¿ëÀû : 41-45 L
- ¹Ý°¨±â : 25 ½Ã°£
- ¼Ò½Ç : ´¢·Î ¹è¼³
|
| Biotransformation |
Levothyroxine¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic (primarily via cytochrome P450 isozyme 3A4).
Liothyronine¿¡ ´ëÇÑ Biotransformation Á¤º¸ Not Available
|
| Toxicity |
Levothyroxine¿¡ ´ëÇÑ Toxicity Á¤º¸ LD50=20 mg/kg (orally in rat). Hypermetabolic state indistinguishable from thyrotoxicosis of endogenous origin. Symptoms of thyrotoxicosis include weight loss, increased appetite, palpitations, nervousness, diarrhea, abdominal cramps, sweating, tachycardia, increased pulse and blood pressure, cardiac arrhythmias, tremors, insomnia, heat intolerance, fever, and menstrual irregularities.
|
| Drug Interactions |
Levothyroxine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Anisindione Thyroid hormones increase the anticoagulant effectAcenocoumarol Thyroid hormones increase the anticoagulant effectDicumarol Thyroid hormones increase the anticoagulant effectWarfarin Thyroid hormones increase the anticoagulant effectCalcium Calcium decreases absorption of levothyroxineIron Iron decreases absorption of levothyroxineColestipol The resin decreases the absorption of thyroid hormonesCholestyramine The resin decreases the absorption of thyroid hormonesDigoxin The thyroid hormone decreases the effect of digoxinRaloxifene Raloxifene decreases absorption of levothyroxineSucralfate Sucralfate decreases the effect of levothyroxine
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Levothyroxine¿¡ ´ëÇÑ Food Interaction Á¤º¸ No iron within 4 hours of taking this medication.Take 30-60 minutes before breakfast.Consistent administration in relation to meals is recommended.
|
| Drug Target |
[Drug Target]
|
| Description |
Levothyroxine¿¡ ´ëÇÑ Description Á¤º¸ The major hormone derived from the thyroid gland. Thyroxine is synthesized via the iodination of tyrosines (monoiodotyrosine) and the coupling of iodotyrosines (diiodotyrosine) in the thyroglobulin. Thyroxine is released from thyroglobulin by proteolysis and secreted into the blood. Thyroxine is peripherally deiodinated to form triiodothyronine which exerts a broad spectrum of stimulatory effects on cell metabolism. [PubChem]
Liothyronine¿¡ ´ëÇÑ Description Á¤º¸ A T3 thyroid hormone normally synthesized and secreted by the thyroid gland in much smaller quantities than thyroxine (T4). Most T3 is derived from peripheral monodeiodination of T4 at the 5&
|
| Dosage Form |
Levothyroxine¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Powder, for solution IntravenousTablet Oral
Liothyronine¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Tablet Oral
|
| Drug Category |
Levothyroxine¿¡ ´ëÇÑ Drug_Category Á¤º¸ AnticoagulantsAntithyroid Agents
Liothyronine¿¡ ´ëÇÑ Drug_Category Á¤º¸ Hormone Replacement Agents
|
| Smiles String Canonical |
Levothyroxine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ NC(CC1=CC(I)=C(OC2=CC(I)=C(O)C(I)=C2)C(I)=C1)C(O)=O
Liothyronine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ NC(CC1=CC(I)=C(OC2=CC(I)=C(O)C=C2)C(I)=C1)C(O)=O
|
| Smiles String Isomeric |
Levothyroxine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ N[C@@H](CC1=CC(I)=C(OC2=CC(I)=C(O)C(I)=C2)C(I)=C1)C(O)=O
Liothyronine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ N[C@@H](CC1=CC(I)=C(OC2=CC(I)=C(O)C=C2)C(I)=C1)C(O)=O
|
| InChI Identifier |
Levothyroxine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C15H11I4NO4/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23/h1-2,4-5,12,21H,3,20H2,(H,22,23)/t12-/m0/s1/f/h22H
Liothyronine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C15H12I3NO4/c16-9-6-8(1-2-13(9)20)23-14-10(17)3-7(4-11(14)18)5-12(19)15(21)22/h1-4,6,12,20H,5,19H2,(H,21,22)/t12-/m0/s1/f/h21H
|
| Chemical IUPAC Name |
Levothyroxine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (2S)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid
Liothyronine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (2S)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]propanoic acid
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2026-03-04
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|