| |
|
|
|
|
|
 |
| |
|
µ¦»ç°ÖÁ¡¾È°Ö(µ¦»ç¸ÞŸ¼ÕÀλ곪Ʈ·ý) DEXAGEL OPHTHALMIC GEL
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
664400010[E23090051]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1g(2016.10.01)(ÇöÀç¾à°¡)
\496 ¿ø/1g(2014.02.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
Æú¸®È£ÀÏ ÀçÁúÀÇ Æ©ºê¿¡ µç ¹«»ö ¶Ç´Â À¯¹é±¤À» ¶ì´Â Åõ¸íÇÑ Á¡¾È°Ö
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
Á¦Á¶¿ø |
| ÁÖ¼ººÐÄÚµå |
142205COO
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| ´ëÇ¥ÄÚµå |
8806644000107 |
| º¸°ü¹æ¹ý |
Â÷±¤±â¹Ð¿ë±â, 1-25¡É º¸°ü |
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
¿Ü¾ÈºÎ ¹× Àü¾ÈºÎÀÇ ½ºÅ×·ÎÀÌµå ¹Î°¨¼º ¿°Áõ : °£°Ë¿°, °á¸·¿°, ȫä¿°
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
Ãʱ⿡´Â 1ȸ 1¹æ¿ïÀ» ¸Å 4½Ã°£¸¶´Ù ÇϺΠ°á¸·³¶¿¡ Á¡ÀûÇϸç, ÀÌÈÄ¿¡´Â 1ȸ 1¹æ¿ï 1ÀÏ 3~4ȸ·Î ÃæºÐÇÏ´Ù.
Ä¡·á±â°£Àº 4ÁÖ¸¦ ÃʰúÇØ¼´Â ¾ÈµÈ´Ù.
|
| ±Ý±â |
1) Ç¥À缺 ´Ü¼øÆ÷Áø °¢¸·¿°(¼öÁö»ó °¢¸·¿°), ¿ìµÎ, ¼öµÎ¸¦ Æ÷ÇÔÇÏ´Â ¹ÙÀÌ·¯½º¼º °¢¸·․°á¸·Áúȯ ȯÀÚ
2) Áø±Õ¼º ¾ÈÁúȯ ȯÀÚ
3) °áÇÙ¼º ¾ÈÁúȯ ȯÀÚ
4) Ä¡·áµÇÁö ¾ÊÀº È³ó¼º °¨¿°È¯ÀÚ
5) ÀÌ ¾à¿¡ °ú¹ÎÁõÀÇ º´·ÂÀÌ Àִ ȯÀÚ
6) °¢¸·»óÇǹڸ® ¹× ±Ë¾çȯÀÚ(°¢¸· õ°øÀÌ »ý±æ ¼ö ÀÖ´Ù.)
7) ³ì³»Àå ȯÀÚ
|
| ½ÅÁßÅõ¿© |
2¼¼ ¹Ì¸¸ÀÇ ¿µ¾Æ
|
| ÀÌ»ó¹ÝÀÀ |
1) ´«
¨ç ¿¬¿ëÇÏ¸é ¶§¶§·Î ¼öÁÖÀÏ ÈÄ¿¡ ¾È¾Ð»ó½Â ¶Ç´Â ½Ã½Å°æ ¼Õ»ó°ú ½Ã·ÂÀúÇÏ ¹× ½Ã¾ß°á¼ÕÀ» ¼ö¹Ý ÇÏ´Â ³ì³»ÀåÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î Á¤±âÀûÀ¸·Î ¾È¾Ð °Ë»ç¸¦ ÇÑ´Ù.
¨è °¢¸·Æ÷Áø, °¢¸·Áø±ÕÁõ, ³ì³ó±Õ°¨¿©Áõ µîÀ» À¯¹ßÇÒ ¼ö ÀÖ´Ù. ÀÌ·¯ÇÑ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÏ °í ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù.
¨é °¢¸·Æ÷Áø, °¢¸·±Ë¾ç ¶Ç´Â ¿Ü»ó µî¿¡ »ç¿ëÇÒ °æ¿ì õ°øÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù.
¨ê Àå±â°£ »ç¿ëÀ¸·Î µå¹°°Ô Èij¶ÇϹ鳻Àå, °¢¸·¿¬È°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
¨ë ¹é³»Àå ¼ö¼úÈÄ ±¹¼ÒÅõ¿©½Ã µå¹°°Ô ¿©°ú¼º ¼öÆ÷°¡ º¸°íµÇ¾ú´Ù.
¨ì »ó´çÇÑ °¢¸· ¼Õ»óÀÌ ÀÖ´Â ÀϺΠȯÀÚ¿¡¼ Àλ꿰 ÇÔÀ¯ Á¡¾È¾×ÀÇ »ç¿ë°ú ¿¬°üµÇ¾î °¢¸· ¼®È¸ÈÀÇ »ç·Ê°¡ ¸Å¿ì µå¹°°Ô(0.01% ¹Ì¸¸) º¸°íµÈ ¹Ù ÀÖ´Ù.
2) ÇǺΠ: Àå±â»ç¿ë¿¡ ÀÇÇØ â»óÄ¡À¯ÀÇ Áö¿¬À» ÀÏÀ¸Å³¼ö ÀÖ´Ù.
3) ³»ºÐºñ°è :
¨ç Àå±â»ç¿ë¿¡ ÀÇÇØ Çϼöü, ºÎ½ÅÇÇÁú°è ±â´ÉÀÌ ¾ïÁ¦µÉ ¼ö ÀÖ´Ù.
¨è ´ç´¢º´È¯ÀÚ¿¡¼ Ç÷´ç »ó½ÂÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
4) ¹ÙÀÌ·¯½º°¨¿°, Áø±Õ°¨¿°ÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù.
5) °ú¹ÎÁõ : µå¹°°Ô Àڱذ¨ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î °ú¹ÎÁõ»óÀÌ ³ªÅ¸³ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
6) °¨¿°Áõ À¯¹ß : ±Í ¶Ç´Â ÄÚÀÇ ±¹¼Ò¿¡ ȳó¼ºÀÇ °¨¿°ÁõÀ» À¯¹ßÇÒ ¼ö ÀÖ´Ù.
|
| ÀϹÝÀû ÁÖÀÇ |
1) ÀÇ»çÀÇ Áø´Ü¾øÀÌ ÃæÇ÷µÈ ´«¿¡ ±¹¼Ò ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀ̵åÁ¦¿Ü Åõ¿©´Â ½Ç¸íÀ» ÃÊ·¡ÇÒ ¼ö ÀÖ´Ù.
2) ´Ù¸¥ ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀ̵åÁ¦¿Í ¸¶Âù°¡Áö·Î µ¦»ç¸ÞŸ¼Õµµ ȯÀÚÀÇ ¼¼±Õ¿¡ ´ëÇÑ ÀúÇ×¼ºÀ» ³ª»Ú°Ô ÇÏ¿© °¨¿°À» ¾ß±âÇÒ ¼ö ÀÖ´Ù. °¨¿°ÀÌ ÀÖÀ» °æ¿ì ¾ÈÀüÇÏ°Ô Ä¡·áµÉ ¶§±îÁö ÀÌ ¾à¹°ÀÇ Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
3) ½ºÅ×·ÎÀ̵强 ¹é³»Àå ¹× ³ì³»Àå À¯¹ß °¡´É¼ºÀÌ ÀÖÀ¸¹Ç·Î 10ÀÏ ÀÌ»ó Àå±â Åõ¿©½Ã ¼Ò¾Æ³ª ºñÇùÁ¶ÀûÀΠȯÀÚ¶ó ÇÒÁö¶óµµ Á¤±âÀûÀÎ ¾È°ú °Ë»ç(¾È¾ÐÃøÁ¤ ¹× ¼öÁ¤Ã¼ °Ë»ç µî)¸¦ ÇÑ´Ù.
4) ´Ü¼ø Æ÷ÁøÀÇ º´·ÂÀÌ Àִ ȯÀÚ¿¡°Ô ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀ̵å Åõ¿©½Ã Æ÷Áø¼º °¢¸·ÁúȯÀÇ ¾ÇÈ À§ÇèÀ» ¹æÁöÇϱâ À§ÇØ ÀÚÁÖ ¼¼±Øµî °Ë»ç¸¦ ÇÑ´Ù.
5) ±¹¼Ò ½ºÅ×·ÎÀ̵åÁ¦´Â Ä¡·áµÇÁö ¾ÊÀº ´«ÀÇ ±Þ¼º È³ó¼º °¨¿°À» ÀºÆó ¶Ç´Â ¾ÇȽÃų ¼ö ÀÖ´Ù.
6) ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀ̵å´Â ¸Ó½ºÅ¸µå °¡½º °¢¸·¿° ¹× ¼î±×·» °¢°á¸·¿°¿¡´Â È¿°ú°¡ ¾ø´Ù.
7) ÄÜÅÃÆ®·»Áî Âø¿ëÀÚ´Â ÀÌ ¾à Åõ¿©Àü ·»Á Á¦°ÅÇϰí Àû¾îµµ Åõ¿© 30ºÐ ÀÌÈÄ¿¡ ÀçÂø¿ëÇÑ´Ù.
8) ¿°ÁõÀ̳ª ÅëÁõÀÌ 48½Ã°£ ÀÌ»ó Áö¼ÓµÇ°Å³ª ¾ÇȵǸé Åõ¿©¸¦ ÁßÁöÇϰí ÀÇ»ç¿Í »óÀÇÇÑ´Ù.
9) Á¡¾È½Ã ÀϽÃÀûÀÎ ½Ã·ÂºÒ¼±¸íÀÌ »ý±æ ¼ö ÀÖÀ¸¹Ç·Î ½Ã¾ß°¡ ¼±¸íÇØÁú ¶§±îÁö ¿îÀüÀ̳ª À§ÇèÇÑ ±â°èÁ¶ÀÛÀ» ÇÏÁö ¾Êµµ·Ï ÁÖÀÇÇÑ´Ù.
|
| »óÈ£ÀÛ¿ë |
´Ù¸¥ ¾à¹°°úÀÇ Æ¯º°ÇÑ »óÈ£ÀÛ¿ëÀº º¸°íµÇÁö ¾Ê¾Ò´Ù. ±×·³¿¡µµ ºÒ±¸Çϰí ÀÌ ¾àÀ» ´Ù¸¥ Á¡¾È¾×/Á¡¾ÈÁ¦¿Í º´¿ëÇÒ °æ¿ì¿¡´Â Àû¾îµµ 5ºÐÀÇ °£·ÂÀ» µÎ°í »ç¿ëÇÏ¿©¾ß Çϸç, ÀÌ ¾àÀº Á¦ÀÏ ¸¶Áö¸·¿¡ Åõ¿©ÇÏ¿©¾ß ÇÑ´Ù.
|
| ÀӺο¡ ´ëÇÑ Åõ¿© |
[ÀӺαݱ⠼ººÐ Á¶È¸]
1) ÀÓ½ÅÁßÀÇ Åõ¿©¿¡ °üÇÑ ¾ÈÀü¼ºÀÌ È®¸³µÇ¾î ÀÖÁö ¾ÊÀ¸¹Ç·Î ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀο¡´Â Àå±â°£ ¶Ç´Â ºó¹øÇÏ°Ô »ç¿ëÇÏÁö ¾Ê´Â´Ù.
2) ÀÓ½ÅÁß »ó´ç·®ÀÇ ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀ̵带 Åõ¿©ÇÑ »ê¸ð¿¡¼ ÅÂ¾î³ ½Å»ý¾Æ´Â ºÎ½Å±â´ÉÀúÇÏÁõÀÇ ÁõÈÄÀ¯¹«¸¦ Àß °üÂûÇÑ´Ù.
|
| ¼öÀ¯ºÎ¿¡ ´ëÇÑ Åõ¿© |
±¹¼Ò ½ºÅ×·ÎÀ̵å´Â Àü½Å Èí¼öµÇ¹Ç·Î ÀÌ ¾àÀÇ ½É°¢ÇÑ ºÎÀÛ¿ëÀ» °í·ÁÇØ ¼öÀ¯Áß´Ü ¶Ç´Â ¼öÀ¯Áß ¾à¹° Åõ¿© ÁßÁö ¿©ºÎ¸¦ °áÁ¤ÇÑ´Ù.
|
| ¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿© |
À¯․¼Ò¾Æ¿¡ ´ëÇÑ ¾ÈÀü¼ºÀÌ È®¸³µÇ¾î ÀÕÁö ¾Æ´ÏÇϹǷΠƯÈ÷ 2¼¼¹Ì¸¸ÀÇ °æ¿ì¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
|
| °í·ÉÀÚ¿¡ ´ëÇÑ Åõ¿© |
ÀϹÝÀûÀ¸·Î °í·ÉÀÚ´Â »ý¸®±â´ÉÀÌ ÀúÇϵǾî ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù. |
| Àû¿ë»óÀÇ ÁÖÀÇ |
1) Á¡¾È¿ëÀ¸·Î¸¸ »ç¿ëÇÑ´Ù.
2) Á¡¾È½Ã ¿ë±âÀÇ ÀÔ±¸°¡ Á÷Á¢ ´«¿¡ ´êÁö ¾Êµµ·Ï ÁÖÀÇÇÑ´Ù.
3) ¿À¿°À» ¹æÁöÇϱâ À§ÇØ µÉ ¼ö ÀÖ´Â ÇÑ °øµ¿À¸·Î »ç¿ëÇÏÁö ¾Ê´Â´Ù.
|
| °ú·®Åõ¿© ¹× óġ |
Àå±â ÁýÁßÅõ¿©½Ã Àü½ÅÈ¿°ú°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
1) ¼Ò¾ÆÀÇ ¼ÕÀÌ ´êÁö ¾Ê´Â °÷¿¡ º¸°üÇÑ´Ù.
2) Á÷»çÀϱ¤À» ÇÇÇÏ°í µÇµµ·Ï ½À±â°¡ ÀûÀº ¼´ÃÇÑ °÷¿¡ º¸°üÇÑ´Ù.
3) °³ºÀÈÄ 6ÁÖ°¡ °æ°úÇßÀ» °æ¿ì ³²Àº ¾×À» »ç¿ëÇÏÁö ¾Êµµ·Ï ÇÑ´Ù.
4) ¿À¿ëÀ» ¸·°í ǰÁúÀÇ º¸Á¸À» À§ÇÏ¿© ´Ù¸¥ ¿ë±â¿¡ ¹Ù²Ù¾î ³ÖÁö ¾Ê´Â´Ù.
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
(dexamethasone; )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Dexamethasone¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Dexamethasone¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Dexamethasone is a glucocorticoid agonist. Unbound dexamethasone crosses cell membranes and binds with high affinity to specific cytoplasmic receptors. This results in a modification of transcription and, hence, protein synthesis in order to achieve inhibition of leukocyte infiltration at the site of inflammation, interference in the function of mediators of inflammatory response, suppression of humoral immune responses, and reduction in edema or scar tissue. The antiinflammatory actions of dexamethasone are thought to involve phospholipase A2 inhibitory proteins, lipocortins, which control the biosynthesis of potent mediators of inflammation such as prostaglandins and leukotrienes.
|
| Pharmacology |
Dexamethasone¿¡ ´ëÇÑ Pharmacology Á¤º¸ Dexamethasone and its derivatives, dexamethasone sodium phosphate and dexamethasone acetate, are synthetic glucocorticoids. Used for its antiinflammatory or immunosuppressive properties and ability to penetrate the CNS, dexamethasone is used alone to manage cerebral edema and with tobramycin to treat corticosteroid-responsive inflammatory ocular conditions.
|
| Protein Binding |
Dexamethasone¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 70%
|
| Half-life |
Dexamethasone¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 36-54 hours
|
| Absorption |
Dexamethasone¿¡ ´ëÇÑ Absorption Á¤º¸ 80-90%
|
| Pharmacokinetics |
Dexamethasone sodium phosphateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ´ë»çÈ¿°ú Áö¼Ó½Ã°£ : 72½Ã°£±îÁö Áö¼ÓµÉ ¼ö ÀÖ´Ù. Acetate´Â ÀÛ¿ë ¹ßÇö ½Ã°£À» ÃËÁø½ÃŲ Àå½Ã°£ Áö¼ÓÇü repository Á¦Á¦ÀÌ´Ù.
- ´ë»ç : °£¿¡¼ ´ë»ç
- ¹Ý°¨±â
- Á¤»ó ½Å±â´É : 1.8¡3.5½Ã°£
- »ý¸®Àû ¹Ý°¨±â : 36¡54½Ã°£
- ÃÖ´ëÈ¿°ú ¹ßÇö½Ã°£
- °æ±¸ : 1¡2½Ã°£ À̳»
- ±ÙÀ°ÁÖ»ç : 8½Ã°£ À̳»
- ¼Ò½Ç : ´¢³ª º¯À¸·Î ¹è¼³
|
| Biotransformation |
Dexamethasone¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic.
|
| Toxicity |
Dexamethasone¿¡ ´ëÇÑ Toxicity Á¤º¸ Oral, rat LD50: >3 gm/kg. Signs of overdose include retinal toxicity, glaucoma, subcapsular cataract, gastrointestinal bleeding, pancreatitis, aseptic bone necrosis, osteoporosis, myopathies, obesity, edemas, hypertension, proteinuria, diabetes, sleep disturbances, psychiatric syndromes, delayed wound healing, atrophy and fragility of the skin, ecchymosis, and pseudotumor cerebri.
|
| Drug Interactions |
Dexamethasone¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Ambenonium The corticosteroid decreases the effect of anticholinesterasesAminoglutethimide Aminogluthetimide decreases the effect of dexamethasoneAmobarbital The barbiturate decreases the effect of the corticosteroidAnisindione The corticosteroid alters the anticoagulant effectAprepitant Aprepitant increases the effect and toxicity of dexamethasoneAprobarbital The barbiturate decreases the effect of the corticosteroidAspirin The corticosteroid decreases the effect of salicylatesButabarbital The barbiturate decreases the effect of the corticosteroidButalbital The barbiturate decreases the effect of the corticosteroidButethal The barbiturate decreases the effect of the corticosteroidDicumarol The corticosteroid alters the anticoagulant effectDihydroquinidine barbiturate The barbiturate decreases the effect of the corticosteroidEdrophonium The corticosteroid decreases the effect of anticholinesterasesEthotoin The enzyme inducer decreases the effect of the corticosteroidFosphenytoin The enzyme inducer decreases the effect of the corticosteroidHeptabarbital The barbiturate decreases the effect of the corticosteroidHexobarbital The barbiturate decreases the effect of the corticosteroidImatinib Decreases levels of imatinibMephenytoin The enzyme inducer decreases the effect of the corticosteroidMethohexital The barbiturate decreases the effect of the corticosteroidMethylphenobarbital The barbiturate decreases the effect of the corticosteroidMidodrine Increased arterial pressureNeostigmine The corticosteroid decreases the effect of anticholinesterasesPentobarbital The barbiturate decreases the effect of the corticosteroidPhenobarbital The barbiturate decreases the effect of the corticosteroidPhenytoin The enzyme inducer decreases the effect of the corticosteroidPrimidone The barbiturate decreases the effect of the corticosteroidPyridostigmine The corticosteroid decreases the effect of anticholinesterasesQuinidine barbiturate The barbiturate decreases the effect of the corticosteroidRifampin The enzyme inducer decreases the effect of the corticosteroidSecobarbital The barbiturate decreases the effect of the corticosteroidSunitinib Possible decrease in sunitinib levelsTalbutal The barbiturate decreases the effect of the corticosteroidWarfarin The corticosteroid alters the anticoagulant effectBismuth The corticosteroid decreases the effect of salicylatesAcenocoumarol The corticosteroid alters the anticoagulant effectSalicylate-magnesium The corticosteroid decreases the effect of salicylatesSalsalate The corticosteroid decreases the effect of salicylates
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Dexamethasone¿¡ ´ëÇÑ Description Á¤º¸ An anti-inflammatory 9-fluoro-glucocorticoid. [PubChem]
|
| Drug Category |
Dexamethasone¿¡ ´ëÇÑ Drug_Category Á¤º¸ Adrenergic AgentsAnti-inflammatory AgentsAntiemeticsAntineoplastic Agents, HormonalGlucocorticoids
|
| Smiles String Canonical |
Dexamethasone¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC1CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1(O)C(=O)CO
|
| Smiles String Isomeric |
Dexamethasone¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)[C@@]1(O)C(=O)CO
|
| InChI Identifier |
Dexamethasone¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C22H29FO5/c1-12-8-16-15-5-4-13-9-14(25)6-7-19(13,2)21(15,23)17(26)10-20(16,3)22(12,28)18(27)11-24/h6-7,9,12,15-17,24,26,28H,4-5,8,10-11H2,1-3H3/t12-,15+,16+,17+,19+,20+,21+,22+/m1/s1
|
| Chemical IUPAC Name |
Dexamethasone¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one
|
| Drug-Induced Toxicity Related Proteins |
DEXAMETHASONE ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Brain-cadherin (BR-cadherin) Drug:dexamethasone Toxicity:osteoblast differentiation. [¹Ù·Î°¡±â] Replated Protein:Glucocorticoid-induced leucine zipper (GILZ) Drug:dexamethasone Toxicity:apoptosis. [¹Ù·Î°¡±â] Replated Protein:Signal transducer and activator of transcription 3 Drug:dexamethasone Toxicity:apoptosis. [¹Ù·Î°¡±â] Replated Protein:Heme oxygenase 1 Drug:dexamethasone Toxicity:oxidative injury. [¹Ù·Î°¡±â] Replated Protein:Alkaline phosphatase Drug:dexamethasone Toxicity:osteoblast differentiation. [¹Ù·Î°¡±â] Replated Protein:Interleukin-6 Drug:dexamethasone Toxicity:apoptosis. [¹Ù·Î°¡±â] Replated Protein:Ornithine decarboxylase Drug:dexamethasone Toxicity:pathogenesis of peptic ulcers. [¹Ù·Î°¡±â] Replated Protein:Aromatic-L-amino-acid decarboxylase Drug:dexamethasone Toxicity:pathogenesis of peptic ulcers. [¹Ù·Î°¡±â] Replated Protein:Interleukin-4 Drug:dexamethasone Toxicity:dexamethasone-induced differentiation of mouse myeloid leukemia cells. [¹Ù·Î°¡±â] Replated Protein:Gastrin Drug:dexamethasone Toxicity:pathogenesis of peptic ulcers. [¹Ù·Î°¡±â] Replated Protein:Interleukin-4 Drug:dexamethasone Toxicity:dexamethasone-induced differentiation of mouse myeloid leukemia cells. [¹Ù·Î°¡±â] Replated Protein:Cadherin-11 Drug:dexamethasone Toxicity:osteoblast differentiation. [¹Ù·Î°¡±â] Replated Protein:Haptoglobin Drug:dexamethasone Toxicity:hepatic lipidosis(fatty liver). [¹Ù·Î°¡±â] Replated Protein:Interferon alpha-7 Drug:dexamethasone Toxicity:apoptosis. [¹Ù·Î°¡±â] Replated Protein:C-jun-amino-terminal kinase-interacting protein Drug:dexamethasone Toxicity:apoptosis of multiple myeloma cells. [¹Ù·Î°¡±â] Replated Protein:Mitogen-activated protein kinase Drug:dexamethasone Toxicity:Dex-induced apoptosis. [¹Ù·Î°¡±â] Replated Protein:Cadherin-4 Drug:dexamethasone Toxicity:osteoblast differentiation. [¹Ù·Î°¡±â] Replated Protein:Glucose transporter 4 Drug:dexamethasone Toxicity:cushing's syndrome. [¹Ù·Î°¡±â] Replated Protein:Nuclear factor NF-kappa-B Drug:dexamethasone Toxicity:pulmonary inflammation. [¹Ù·Î°¡±â] Replated Protein:Signal transducer and activator of transcription 3 Drug:dexamethasone Toxicity:oxidative injury such as endotoxins and heme. [¹Ù·Î°¡±â] Replated Protein:Thrombomodulin Drug:dexamethasone Toxicity:deep venous thrombosis (DVT). [¹Ù·Î°¡±â] Replated Protein:Islet amyloid polypeptide Drug:dexamethasone Toxicity:marked stimulatory effect. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2026-03-06
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|