| |
|
|
|
|
|
 |
| |
|
·ÎÆä¸®µåĸ½¶ LOPERIDE CAP.
|
|
ÀϹÝÀǾàǰ | ºñ±Þ¿©
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
643500580
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
[ºñ±Þ¿©]
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
Ȳ»ö°¡·ç°¡ µé¾îÀÖ´Â »óºÎ µîȲ»ö, ÇϺΠÀ¯¹é»öÀÇ °æÁú ݼ¿Á¦
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
10ĸ½¶ |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 5¹Ð¸®±×·¥ |
20 ĸ½¶ |
8806435005809 |
8806435005830 |
|
| 5¹Ð¸®±×·¥ |
20 ĸ½¶ |
8806435005809 |
8806435005823 |
|
| 5¹Ð¸®±×·¥ |
10 ĸ½¶ |
8806435005809 |
8806435005816 |
|
|
| ÁÖ¼ººÐÄÚµå |
291500ACH
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| ´ëÇ¥ÄÚµå |
8806435005809 |
| º¸°ü¹æ¹ý |
±â¹Ð¿ë±â, ½Ç¿Â(1-30¡É)º¸°ü |
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
¼³»ç, ¹±Àº º¯, üÇÔ, Åä»ç
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¼ºÀÎ ¹× 15¼¼ ÀÌ»ó : 1ȸ 2ĸ½¶, 1ÀÏ 2ȸ º¹¿ëÇÑ´Ù.
¼³»ç°¡ ¸ØÃß¸é º¹¿ëÇÏÁö ¸» °Í.
º¹¿ë°£°ÝÀº 4½Ã°£ ÀÌ»óÀ¸·Î ÇÒ °Í.
|
| ±Ý±â |
1) ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ¿©¼º, ¼öÀ¯ºÎ
2) ¸¸ 15¼¼ ¹Ì¸¸ÀÇ ¼Ò¾Æ
3) ÀÌ ¾à ¶Ç´Â ÀÌ ¾àÀÇ ¼ººÐ¿¡ ÀÇÇÑ ¾Ë·¹¸£±â Áõ»óÀ» ÀÏÀ¸Å²ÀûÀÌ ÀÖ´Â »ç¶÷
4) ÀÌ ¾àÀº À¯´çÀ» ÇÔÀ¯Çϰí ÀÖÀ¸¹Ç·Î, °¥¶ôÅä¿À½º ºÒ³»¼º(galactose intolerance), Lapp À¯´çºÐÇØÈ¿¼Ò °áÇÌÁõ(Lapp lactase deficiency) ¶Ç´Â Æ÷µµ´ç-°¥¶ôÅä¿À½º Èí¼öÀå¾Ö(glucose-galactose malabsorption) µîÀÇ À¯ÀüÀûÀÎ ¹®Á¦°¡ Àִ ȯÀÚ¿¡°Ô´Â Åõ¿©ÇÏ¸é ¾ÈµÈ´Ù.
|
| ½ÅÁßÅõ¿© |
1) ¹ß¿À» ¼ö¹ÝÇÏ´Â ¼³»ç°¡ ÀÖ´Â »ç¶÷, Ç÷º¯ÀÌ ÀÖ´Â »ç¶÷ ¶Ç´Â Á¡¾×º¯ÀÌ °è¼ÓµÇ´Â »ç¶÷
2) ±Þ¼º±âÀÇ °Ý½ÉÇÑ ¼³»ç°¡ ÀÖ´Â »ç¶÷ ¶Ç´Â ¸Þ½º²¨¿ò, º¹Åë, º¹ºÎÆØ¸¸, ±¸Åä µîÀÇ Áõ»óÀ» ¼ö¹ÝÇÏ´Â ¼³»ç°¡ ÀÖ´Â »ç¶÷ : ÀÌ ¾àÀ¸·Î ¹«¸®ÇÏ°Ô ¼³»ç¸¦ ¸ØÃß¸é ¿ÀÈ÷·Á º´¼¼¸¦ ¾ÇȽÃŰ´Â ÀÏÀÌ ÀÖ´Ù.
3) º¯ºñ¸¦ ÇÇÇÏÁö ¾ÊÀ¸¸é ¾È µÇ´Â Ç×¹®Áúȯ µîÀÌ ÀÖ´Â »ç¶÷(ÀÌ ¾àÀÇ º¹¿ë¿¡ ÀÇÇØ º¯ºñ°¡ »ý±â´Â ÀÏÀÌ ÀÖ´Ù)
4) ÀÇ»çÀÇ Ä¡·á¸¦ ¹Þ°í ÀÖ´Â »ç¶÷ ¶Ç´Â ´Ù¸¥ ¾à¹°À» º¹¿ëÇϰí ÀÖ´Â »ç¶÷
5) °í·ÉÀÚ
6) ÀÌ ¾àÀº Ȳ»ö5È£(¼±¼Â¿»·Î¿ì FCF, Sunset Yellow FCF)¸¦ ÇÔÀ¯Çϰí ÀÖÀ¸¹Ç·Î ÀÌ ¼ººÐ¿¡ °ú¹ÎÇϰųª ¾Ë·¹¸£±â º´·ÂÀÌ Àִ ȯÀÚ¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÒ °Í. |
| ÀÌ»ó¹ÝÀÀ |
´ÙÀ½°ú °°Àº °æ¿ì ÀÌ ¾àÀÇ º¹¿ëÀ» Áï°¢ ÁßÁöÇϰí ÀÇ»ç, Ä¡°úÀÇ»ç, ¾à»ç¿Í »óÀÇÇÒ °Í. »ó´ã½Ã ÀÌ Ã·ºÎ¹®¼¸¦ ¼ÒÁöÇÒ °Í.
1) ¾Ë·¹¸£±â Áõ»ó : ¹ßÁø, ¹ßÀû, °¡·Á¿ò
2) ¼Òȱâ°è : º¯ºñ, º¹ºÎÆØ¸¸°¨, º¹ºÎºÒÄè°¨, º¹Åë, ±¸¿ª, ±¸Åä, ½Ä¿åºÎÁø, ±Þ¼ºÃéÀå¿°
3) Á¤½Å½Å°æ°è : ¾îÁö·³
4) 2Àϰ£ º¹¿ëÇÏ¿©µµ Áõ»óÀÇ °³¼±ÀÌ ¾øÀ» °æ¿ì
|
| ÀϹÝÀû ÁÖÀÇ |
Á¤ÇØÁø ¿ë¹ý․¿ë·®À» Àß Áöų °Í.
|
| »óÈ£ÀÛ¿ë |
ÀÌ ¾àÀ» º¹¿ëÇÏ´Â µ¿¾È ´ÙÀ½ÀÇ ¾àÀ» º¹¿ëÇÏÁö ¸» °Í.
À§ÀåÁøÅ롤Áø°æÁ¦ |
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
1) ¾î¸°ÀÌÀÇ ¼ÕÀÌ ´êÁö ¾Ê´Â °÷¿¡ º¸°üÇÒ °Í.
2) ÀǾàǰÀ» ¿ø·¡ ¿ë±â¿¡¼ ²¨³»¾î ´Ù¸¥ ¿ë±â¿¡ º¸°üÇÏ´Â °ÍÀº ÀǾàǰ ¿À¿ë¿¡ µû¸¥ »ç°í ¹ß»ýÀ̳ª ÀǾàǰ ǰÁú ÀúÇÏÀÇ ¿øÀÎÀÌ µÉ ¼ö ÀÖÀ¸¹Ç·Î ¿ø·¡ÀÇ ¿ë±â¿¡ ³Ö°í ²À ´Ý¾Æ º¸°üÇÒ °Í.
3) Á÷»ç±¤¼±À» ÇÇÇÏ°í µÇµµ·Ï ½À±â°¡ ÀûÀº ¼´ÃÇÑ °÷¿¡ º¸°üÇÒ °Í.
|
| ±âŸ |
ÀÌ ¾àÀ» º¹¿ëÇÏ´Â µ¿¾È ´ÙÀ½ÀÇ ÇàÀ§¸¦ ÇÏÁö ¸» °Í.
1) Â÷·® ¶Ç´Â ±â°èÀåÄ¡ÀÇ ¿îÀüÁ¶ÀÛ(Á¹À½ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù)
2) À½ÁÖ
3) ·ÎÆä¶ó¹Ìµå¿°»ê¿°ÀÇ ¿À¡¤³²¿ë¿¡ ÀÇÇÑ °ú·®(ÀÏÀÏ º¹¿ë·®ÀÌ 40mgºÎÅÍ 792mg±îÁö º¸°íµÊ) º¹¿ë½Ã QT°£°Ý ¿¬Àå, Áß´ëÇÑ ½É½ÇºÎÁ¤¸Æ, »ç¸Á»ç·Ê°¡ º¸°íµÇ¾úÀ¸¹Ç·Î °ú·®À¸·Î º¹¿ëÇÏÁö ¾Ê´Â´Ù.
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Bµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
º¯ºñ°¡ »ý±æ¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Loperamide¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Loperamide¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ In vitro and animal studies show that Loperamide acts by slowing intestinal motility and by affecting water and electrolyte movement through the bowel. Loperamide inhibits peristaltic activity by a direct effect on the circular and longitudinal muscles of the intestinal wall. It is a non-selective calcium channel blocker and binds to opioid mu-receptors. Evidence also suggests that at higher concentrations it binds to NMDA receptors and to calmodulin.
|
| Pharmacology |
Loperamide¿¡ ´ëÇÑ Pharmacology Á¤º¸ Loperamide is a synthetic anti-diarrheal indicated for the control and symptomatic relief of acute nonspecific diarrhea and of chronic diarrhea associated with inflammatory bowel disease. Loperamide is also indicated for reducing the volume of discharge from ileostomies. In man, Loperamide prolongs the transit time of the intestinal contents. It reduces the daily fecal volume, increases the viscosity and bulk density, and diminishes the loss of fluid and electrolytes. Tolerance to the antidiarrheal effect has not been observed. Loperamide is an opioid receptor agonist and acts on the mu opioid receptors in the myenteric plexus large intestines; it does not affect the central nervous system like other opioids. It works specifically by decreasing the activity of the myenteric plexus which decreases the motility of the circular and longitudinal smooth muscles of the intestinal wall. This increases the amount of time substances stay in the intestine, allowing for more water to be absorbed out of the fecal matter. Loperamide also decreases colonic mass movements and suppresses the gastrocolic reflex.
|
| Metabolism |
Loperamide¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 3A4 (CYP3A4)
|
| Protein Binding |
Loperamide¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 97%
|
| Half-life |
Loperamide¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 9.1 to 14.4 hours (average 10.8 hours)
|
| Absorption |
Loperamide¿¡ ´ëÇÑ Absorption Á¤º¸ Not significantly absorbed from the gut
|
| Pharmacokinetics |
Loperamide HClÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ÀÛ¿ë¹ßÇö½Ã°£ : °æ±¸ : 1-3 ½Ã°£
- ÀÛ¿ëÁö¼Ó½Ã°£ : 4 ½Ã°£
- Èí¼ö : °æ±¸ : 40 %
- ´Ü¹é°áÇÕ :97 %
- ´ë»ç : °£¿¡¼ ¹ÌȰ¼º ´ë»çü·Î ´ë»ç (Glucuronide)
- ¹Ý°¨±â : 7-15 ½Ã°£
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : 5 ½Ã°£
- ¼Ò½Ç : ¹Ìº¯Èü(30-40 %)·Î ´¢ ¹× º¯À¸·Î ¹è¼³
|
| Biotransformation |
Loperamide¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic
|
| Toxicity |
Loperamide¿¡ ´ëÇÑ Toxicity Á¤º¸ Oral, mouse: LD50 = 105 mg/kg. Symptoms of overdose include constipation, drowsiness, lethargy, and nausea.
|
| Drug Interactions |
Loperamide¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Loperamide¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take without regard to meals. Increase liquid intake.
|
| Drug Target |
[Drug Target]
|
| Description |
Berberine¿¡ ´ëÇÑ Description Á¤º¸ An alkaloid from Hydrastis canadensis L., Berberidaceae. It is also found in many other plants. It is relatively toxic parenterally, but has been used orally for various parasitic and fungal infections and as antidiarrheal. [PubChem]
Loperamide¿¡ ´ëÇÑ Description Á¤º¸ One of the long-acting synthetic antidiarrheals; it is not significantly absorbed from the gut, and has no effect on the adrenergic system or central nervous system, but may antagonize histamine and interfere with acetylcholine release locally. [PubChem]
|
| Dosage Form |
Loperamide¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Solution OralTablet Oral
|
| Drug Category |
Berberine¿¡ ´ëÇÑ Drug_Category Á¤º¸ Not Available
Loperamide¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antidiarrheals
|
| Smiles String Canonical |
Berberine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ COC1=CC=C2C=C3C4=CC5=C(OCO5)C=C4CC[N+]3=CC2=C1OC
Loperamide¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CN(C)C(=O)C(CCN1CCC(O)(CC1)C1=CC=C(Cl)C=C1)(C1=CC=CC=C1)C1=CC=CC=C1
|
| Smiles String Isomeric |
Berberine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ COC1=CC=C2C=C3C4=CC5=C(OCO5)C=C4CC[N+]3=CC2=C1OC
Loperamide¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CN(C)C(=O)C(CCN1CCC(O)(CC1)C1=CC=C(Cl)C=C1)(C1=CC=CC=C1)C1=CC=CC=C1
|
| InChI Identifier |
Berberine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C20H18NO4/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2/h3-4,7-10H,5-6,11H2,1-2H3/q+1
Loperamide¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C29H33ClN2O2/c1-31(2)27(33)29(24-9-5-3-6-10-24,25-11-7-4-8-12-25)19-22-32-20-17-28(34,18-21-32)23-13-15-26(30)16-14-23/h3-16,34H,17-22H2,1-2H3
|
| Chemical IUPAC Name |
Berberine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 16,17-dimethoxy-5,7-dioxa-13$l^{5}-azapentacyclo[11.8.0.0^{2,10}.0^{4,8}.0^{15,20}]henicosa-1(21),2(10),3,8,13,15(20),16,18-octaen-13-ylium
Loperamide¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-N,N-dimethyl-2,2-di(phenyl)butanamide
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2026-02-05
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|