| |
|
|
|
|
|
 |
| |
|
ºñŸÄÞÁ¡¾È¾× VITACOM EYE DROP[Flavine adenine dinucleotide sodium , Sodium chondroitin sulfate]
|
|
ÀϹÝÀǾàǰ | ¹Ì»ý»ê
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
ºñ±Þ¿©
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
´ãȲ»öÀÇ ¾à°£ÀÇ Á¡¼ºÀÌ ÀÖ´Â Á¡¾È¾×
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| º¸°ü¹æ¹ý |
Â÷±¤±â¹Ð¿ë±â |
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
°¢¸· ÁúȯÁß ºñŸ¹Î B2ÀÇ °áÇÌ ¶Ç´Â ´ë»çÀå¾Ö°¡ °ü°èµÇ°í ¶ÇÇÑ °¢¸·Áúȯ ¶ÇÇÑ °¢¸·º¸È£¸¦ ÇÊ¿ä·Î ÇÏ´Â °æ¿ì
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
1ȸ 1-2Àû, 1ÀÏ 3-6ȸ Á¡ÀûÇÑ´Ù.
[Á¦Çüº°º¹¾àÁöµµ]
|
| ÀÌ»ó¹ÝÀÀ |
- °ú¹ÎÁõ:
±¹¼ÒÀûÀ¸·Î °¡·Á¿ò, ÃæÇ÷µîÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â »ç¿ëÀ» ÁßÁöÇÑ´Ù.
µå¹°°Ô ´«¿¡ ´ëÇÑ Àڱذ¨ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| Àû¿ë»óÀÇ ÁÖÀÇ |
ÀÌ ¾à¿¡ ÷°¡Á¦·Î ÇÔÀ¯µÈ ÇÁ·ÎÇÊ·»±Û¸®ÄÝ¿¡ ÀÇÇÏ¿© ¾Ë·¹¸£±â¸¦ ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ ¼ººÐ¿¡ °ú¹ÎÇϰųª ¾Ë·¹¸£±â Àü·ÂÀÌ ÀÖ´Â »ç¶÷Àº »ç¿ëÀü¿¡ ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »óÀÇÇÒ °Í |
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
Â÷±¤±â¹Ð¿ë±â |
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| BIT ¾àÈ¿ºÐ·ù |
±âŸ ¾È°ú¿ë¾à(Other Eye Preparations)
|
| º¹ÁöºÎºÐ·ùÄÚµå |
131 (¾È°ú¿ëÁ¦ )
|
| Drugs By Indication |
[Àüüº¸±â]
|
| Drugs By Classification |
[Àüüº¸±â]
|
|
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
adenine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Adenine forms adenosine, a nucleoside, when attached to ribose, and deoxyadenosine when attached to deoxyribose, and it forms adenosine triphosphate (ATP), a nucleotide, when three phosphate groups are added to adenosine. Adenosine triphosphate is used in cellular metabolism as one of the basic methods of transferring chemical energy between reactions. In older literature, adenine was sometimes called Vitamin B4Not Available
|
| Pharmacology |
adenine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Adenine (sometimes known as vitamin B4) combines with the sugar ribose to form adenosine, which in turn can be bonded with from one to three phosphoric acid units, yielding AMP, ADP and ATP . These adenine derivatives perform important functions in cellular metabolism. Adenine is one of four nitrogenous bases utilized in the synthesis of nucleic acids. A modified form of adenosine monophosphate (cyclic AMP) is an imporant secondary messenger in the propagation of many hormonal stimuli. Adenine is an integral part of the structure of many coenzymes. Adenosine (adenine with a ribose group) causes transient heart block in the AV node of the heart. In individuals suspected of suffering from a supraventricular tachycardia (SVT), adenosine is used to help identify the rhythm. Certain SVTs can be successfully terminated with adenosine.
|
| Metabolism |
adenine¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Glucuronosyltransferase
|
| Biotransformation |
adenine¿¡ ´ëÇÑ Biotransformation Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
adenine¿¡ ´ëÇÑ Description Á¤º¸ A purine base and a fundamental unit of adenine nucleotides. [PubChem]
|
| Drug Category |
adenine¿¡ ´ëÇÑ Drug_Category Á¤º¸ Dietary supplementMicronutrient
|
| Smiles String Canonical |
adenine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ NC1=C2NC=NC2=NC=N1
|
| Smiles String Isomeric |
adenine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ NC1=C2NC=NC2=NC=N1
|
| InChI Identifier |
adenine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C5H5N5/c6-4-3-5(9-1-7-3)10-2-8-4/h1-2H,(H3,6,7,8,9,10)/f/h7H,6H2
|
| Chemical IUPAC Name |
adenine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 7H-purin-6-amine
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2015-02-03
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|