| |
|
|
|
|
|
 |
| |
|
ÄÉÅä¿¥Á¡¾È¾×(ÄÉÅäÆ¼ÆæÇª¸¶¸£»ê¿°) 6mL Keto-M eye Drops.
|
|
ÀϹÝÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
622803571
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/6mL/º´(2023.11.01)(ÇöÀç¾à°¡)
\4,038 ¿ø/6mL/º´(2019.09.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
Åõ¸íÇÑ ÇÃ¶ó½ºÆ½¿ë±â¿¡ µç ¹«»ö Åõ¸íÇÑ ¾×ÀÇ Á¡¾ÈÁ¦
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
6mL/º´ |
| ÁÖ¼ººÐÄÚµå |
180138COS
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| ´ëÇ¥ÄÚµå |
8806228035709 |
| º¸°ü¹æ¹ý |
±â¹Ð¿ë±â, »ó¿Âº¸°ü(15¡É-25¡É) |
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
¾Ë·¯Áö¼º °á¸·¿°
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¼ºÀÎ: 1ȸ1Àû, 1ÀÏ 2-4ȸ ¶Ç´Â »óÅ¿¡ µû¶ó ÀûÀýÈ÷ Á¡¾ÈÇÑ´Ù
À¯.¼Ò¾Æ: ÀÇ»çÀÇ Ã³¹æ¿¡ µû¸¥´Ù.
|
| ±Ý±â |
1) ÀÌ ¾à ¶Ç´Â ÀÌ ¾à ¼ººÐ¿¡ °ú¹ÎÁõ ȯÀÚ
2) 1¼¼ ¹Ì¸¸ÀÇ ¼Ò¾Æ
|
| ½ÅÁßÅõ¿© |
´ÙÀ½°ú °°Àº »ç¶÷Àº À̾àÀ» »ç¿ëÇϱâ Àü¿¡ ¹Ýµå½Ã ÀÇ»ç, Ä¡°úÀÇ»ç, ¾à»ç¿Í »óÀÇÇÒ °Í
1) ÀÇ»çÀÇ Ä¡·á¸¦ ¹Þ°í Àִ ȯÀÚ
2) Å»°¨ÀÛ¿ä¹ý µî ¾Ë·¹¸£±âÀÇ Ä¡·á¸¦ ¹Þ°íÀÖ´Â »ç¶÷
3) ¾à¹° µî¿¡ ÀÇÇØ ¾Ë·¹¸£±â Áõ»óÀ» ÀÏÀ¸Å² ÀûÀÌ ÀÖ´Â »ç¶÷
4) °¡·Á¿òÀ» µ¿¹ÝÇÑ ´«ÀÇ ÅëÁõ
5) ¾Ë·¹¸£±â¿¡ ÀÇÇÑ Áõ»óÀÎÁö´Â ºÐ¸íÇÏÁö ¾ÊÀº »ç¶÷
6) ÀӺΠ¶Ç´Â ¼öÀ¯ºÎ
|
| ÀÌ»ó¹ÝÀÀ |
´ÙÀ½°ú °°Àº °æ¿ì ÀÌ ¾àÀÇ »ç¿ëÀ» Áï°¢ ÁßÁöÇϰí ÀÇ»ç, ¾à»ç¿Í »óÀÇÇÒ °Í. »ó´ã½Ã °¡´ÉÇÑÇÑ ÀÌ Ã·ºÎ¹®¼¸¦ ¼ÒÁöÇÒ °Í
1) ´«ÀÇ ÃæÇ÷, Àڱذ¨, °¡·Á¿òÀÌ Áö¼ÓµÇ°Å³ª, ¾È°Ë¿°(´«²¨Ç®¿°), ¾È°Ë(´«²¨Ç®)ÇǺο°ÀÌ »ý±â´Â °æ¿ì
2) ´«ÀÇ È帲ÀÌ °³¼±µÇÁö ¾Ê´Â °æ¿ì
3) Áõ»óÀÌ ¾Çȵǰųª 1ÁÖ ÀÌ»ó »ç¿ëÇÏ¿©µµ Áõ»óÀÌ °³¼±µÇÁö ¾Ê´Â °æ¿ì
|
| ÀϹÝÀû ÁÖÀÇ |
±âŸ ÀÌ ¾àÀÇ »ç¿ë½Ã ÁÖÀÇÇÒ »çÇ×
1) ÀÌ ¾à Åõ¿©·Î ÀϽÃÀûÀÎ ÀÛ¿°¨(Ȳö°¨)ÀÌ °¡²û ³ªÅ¸³¯ ¼ö ÀÖ°í, ÃæÇ÷, ºÎÁ¾(ºÎ±â), °¡·Á¿òÁõ°ú °°Àº ±¹¼ÒÀÚ±ØÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
2) Á¤ÇØÁø ¿ë¹ý․¿ë·®À» Àß Áöų °Í
3) ÀÌ ¾àÀº Á¡¾È¿ëÀ¸·Î¸¸ »ç¿ëÇÒ °Í
4) ¿ë±âÀÇ ³¡ÀÌ ´«²¨Ç® ¹× ¼Ó´«½ç¿¡ ´êÀ¸¸é ´«°öÀ̳ª °õÆÎÀÌ µî¿¡ ÀÇÇØ ¾à¾×ÀÌ ¿À¿° ¶Ç´Â ȥŹ(È帲)µÉ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÒ °Í. ¶ÇÇÑ È¥Å¹(È帲)µÈ °ÍÀº »ç¿ëÇÏÁö ¸» °Í
5) ¿À¿°À» ¹æÁöÇϱâ À§ÇØ µÉ ¼ö ÀÖ´Â ÇÑ °øµ¿À¸·Î »ç¿ëÇÏÁö ¸» °Í
6) ÀÌ ¾àÀ» ´Ù¸¥ Á¡¾ÈÁ¦¿Í ÇÔ²² »ç¿ëÇÒ °æ¿ì¿¡´Â Àû¾îµµ 5ºÐ ÀÌ»ó ½Ã°£Â÷¸¦ µÎ°í Åõ¿© ÇÒ °Í
7) ºÎÁÖÀÇ·Î ÇÏ¿© ÀÌ ¾à 1º´(5ml)À» ±¸°À¸·Î Åõ¿©ÇÏ¿´´Ù ÇØµµ ÄÉÅäÆ¼ÆæÇª¸¶¸£»ê¿°ÀÇ ¼·Ãë·®Àº 1ÀÏ °æ±¸ Åõ¿©±ÇÀå·®º¸´Ù ÇöÀúÈ÷ ÀûÀ¸¹Ç·Î °ú·®Åõ¿©ÀÇ ¿°·Á´Â ¾ø´Ù.
8) ÀÌ ¾à¿¡ º¸Á¸Á¦·Î ÇÔÀ¯µÈ º¥ÀßÄÚ´½¿°È¹°ÀÌ ·»Áî¿¡ ÈíÂøµÉ ¼ö ÀÖÀ¸¹Ç·Î ¼ÒÇÁÆ® ·»Á Âø¿ëÇÑ »óÅ¿¡¼´Â »ç¿ëÇÏÁö ¾Ê¾Æ¾ß Çϸç, ÀÌ ¾àÀÇ Åõ¿© ÈÄ Àû¾îµµ 15ºÐÀÌ °æ°úÇÑ ÈÄ ·»Á Âø¿ëÇÒ °Í
|
| »óÈ£ÀÛ¿ë |
ÀÌ ¾àÀ» »ç¿ëÇÏ´Â µ¿¾È ´ÙÀ½ÀÇ ¾àÀ» »ç¿ëÇÏÁö ¸» °Í.
Á¡¾È¾×°úÀÇ »óÈ£ÀÛ¿ë¿¡ ´ëÇØ¼´Â ¾Ë·ÁÁø ¹Ù ¾øÀ¸³ª, ÄÉÅäÆ¼ÆæÇª¸¶¸£»ê¿°À» °æ±¸Åõ¿©½Ã
1) ÁßÃ߽ŰæÀúÇÏÁ¦, Ç×È÷½ºÅ¸¹Î, ¾ËÄÚ¿ÃÀÇ ÀÛ¿ëÀ» °È½Ãų ¼ö ÀÖÀ¸¸ç
2) °æ±¸ ´ÙÀÌ¾îÆ®¾à°ú º´¿ëÀº Ç÷¼ÒÆÇÀÇ °¡¿ªÀûÀÎ ÀúÇϸ¦ À¯¹ßÇÒ ¼ö ÀÖ´Ù.
|
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
1) 15~25¡É¿¡ º¸°üÇϰí, °³ºÀ ÈÄ 4ÁÖ°¡ Áö³ª¸é »ç¿ëÇÏÁö ¸» °Í
2) ¾î¸°ÀÌÀÇ ¼ÕÀÌ ´êÁö ¾Ê´Â °÷¿¡ º¸°üÇÒ °Í
3) ÀǾàǰÀ» ¿ø·¡ÀÇ ¿ë±â¿¡¼ ²¨³»¾î ´Ù¸¥ ¿ë±â¿¡ º¸°üÇÏ´Â °ÍÀº ÀǾàǰÀÇ ¿À¿ë(À߸ø »ç¿ë)¿¡ µû¸¥ »ç°í ¹ß»ýÀ̳ª ÀǾàǰ ǰÁú ÀúÇÏÀÇ ¿øÀÎÀÌ µÉ ¼ö ÀÖÀ¸¹Ç·Î ¿ø·¡ÀÇ ¿ë±â¿¡ ³Ö°í ²À ´Ý¾Æ º¸°üÇÒ °Í
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
(ketotifen fumarate opthalmic )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Á¦Çüº° º¹¾àÁöµµ |
[Á¡¾È¾×] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Ketotifen¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Ketotifen is a relatively selective, non-competitive histamine antagonist (H1-receptor) and mast cell stabilizer. Ketotifen inhibits the release of mediators from mast cells involved in hypersensitivity reactions. Decreased chemotaxis and activation of eosinophils has also been demonstrated. Ketotifen also inhibits cAMP phosphodiesterase. Properties of ketotifen which may contribute to its antiallergic activity and its ability to affect the underlying pathology of asthma include inhibition of the development of airway hyper-reactivity associated with activation of platelets by PAF (Platelet Activating Factor), inhibition of PAF-induced accumulation of eosinophils and platelets in the airways, suppression of the priming of eosinophils by human recombinant cytokines and antagonism of bronchoconstriction due to leukotrienes. Ketotifen inhibits of the release of allergic mediators such as histamine, leukotrienes C4 and D4(SRS-A) and PAF.
|
| Pharmacology |
Ketotifen¿¡ ´ëÇÑ Pharmacology Á¤º¸ Ketotifen is a fast acting non-competitive histamine antagonist. It inhibits the release of mediators from mast cells. It is a non-bronchodilator antiasthmatic drug (when taken orally).
|
| Protein Binding |
Ketotifen¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 75%
|
| Half-life |
Ketotifen¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 21 hours (for elimination)
|
| Absorption |
Ketotifen¿¡ ´ëÇÑ Absorption Á¤º¸ Following oral administration absorption is at least 60%
|
| Pharmacokinetics |
Ketotifen FumarateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : °æ±¸ Åõ¿©½Ã ½Å¼ÓÈ÷, 90% ÀÌ»ó Èí¼ö (Èí¼ö¹Ý°¨±â°¡ 1½Ã°£ ¹Ì¸¸)
- ÃÖ°íÇ÷Áß³óµµ µµ´Þ½Ã°£ : 2½Ã°£
- ´Ü¹é°áÇÕ : 75% ÀÌ»ó, ´Ü¹éģȵµ´Â ÀÛ´Ù.
- ¹Ý°¨±â : ¾à 22 ½Ã°£
- ´ë»ç : °£´ë»ç Å
- ¼Ò½Ç : ¿ø¾à¹°°ú ´ë»çü¸¦ Àüü·Î ºÃÀ» ¶§ ´¢¸¦ ÅëÇØ 30-50%, ³ª¸ÓÁö´Â ´ëº¯À» ÅëÇØ ¹è¼³µÊ
- °£ºÎÀü½Ã ´ë»ç°¡ ÀúÇϵǾî Ç÷Áß³óµµ°¡ »ó½ÂµÉ ¼ö ÀÖÀ½
|
| Biotransformation |
Ketotifen¿¡ ´ëÇÑ Biotransformation Á¤º¸ Primarily hepatic. The main metabolite found in both plasma and urine is the inactive ketotifen-N-glucuronide. Nor-ketotifen, the N-demethylated metabolite, and the 10-alpha-hydroxyl derivative are the only other metabolites detectable in human urine.
|
| Toxicity |
Ketotifen¿¡ ´ëÇÑ Toxicity Á¤º¸ Adverse reactions include headaches, conjunctival injection and rhinitis.
|
| Drug Interactions |
Ketotifen¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Ketotifen¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take without regard to meals.
|
| Drug Target |
[Drug Target]
|
| Description |
Ketotifen¿¡ ´ëÇÑ Description Á¤º¸ A cycloheptathiophene blocker of histamine H1 receptors and release of inflammatory mediators. It has been proposed for the treatment of asthma, rhinitis, skin allergies, and anaphylaxis. [PubChem]
Fumarate¿¡ ´ëÇÑ Description Á¤º¸ Not Available
|
| Dosage Form |
Ketotifen¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Liquid OphthalmicSolution OphthalmicSyrup OralTablet Oral
Fumarate¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Solution Respiratory (inhalation)
|
| Drug Category |
Ketotifen¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Allergic AgentsAntipruriticsHistamine H1 Antagonists
Fumarate¿¡ ´ëÇÑ Drug_Category Á¤º¸ Not Available
|
| Smiles String Canonical |
Ketotifen¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CN1CCC(CC1)=C1C2=CC=CC=C2CC(=O)C2=C1C=CS2
Fumarate¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ [O-]C(=O)C=CC([O-])=O
|
| Smiles String Isomeric |
Ketotifen¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CN1CC\C(CC1)=C1C2=CC=CC=C2CC(=O)C2=C\1C=CS2
Fumarate¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ [O-]C(=O)\C=C\C([O-])=O
|
| InChI Identifier |
Ketotifen¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C19H19NOS/c1-20-9-6-13(7-10-20)18-15-5-3-2-4-14(15)12-17(21)19-16(18)8-11-22-19/h2-5,8,11H,6-7,9-10,12H2,1H3
Fumarate¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/p-2/b2-1+/fC4H2O4/q-2
|
| Chemical IUPAC Name |
Fumarate¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ but-2-enedioic acid
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2026-03-06
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|