| |
|
|
|
|
|
 |
| |
|
Ÿ¹Ì¶ô½Å¿¬°í(Å©·ÎŸ¹ÌÅæ) 50g Tamilaccin Oint.
|
|
ÀϹÝÀǾàǰ | ºñ±Þ¿©
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
Àü¹®/ÀÏ¹Ý |
ÀϹÝ
|
|
Á¦Á¶È¸»ç |
űØÁ¦¾à(ÁÖ)
|
ÆÇ¸Åȸ»ç |
űØÁ¦¾à(ÁÖ)
|
Çã°¡Á¤º¸ |
Á¤»ó
(2009.07.20)
|
BIT ¾àÈ¿ºÐ·ù |
¿È & ÀÌÄ¡·áÁ¦ (Scabicides & Pediculicides)
|
º¹ÁöºÎºÐ·ù |
265[±â»ý¼º ÇǺÎÁúȯ¿ëÁ¦ ] |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå |
|
644803921[644803920] [ºñ±Þ¿©]
|
|
|
ATCÄÚµå |
Other antipruritics / D04AX |
NDCÄÚµå |
[Proprietary Name Search _ ƯÇãµî·Ï¸í,»óÇ¥¸íÀ¸·Î °Ë»ö]
[Active Ingredient Search _ ÁÖ¼ººÐÀ¸·Î °Ë»ö]
[NDC Number Search _ NDCÄÚµå·Î °Ë»ö]
|
¼ººÐ / ÇÔ·® |
[½ÉÆò¿ø ÁÖ¼ººÐÄÚµå ±âÁØ ¼ººÐÇÔ·®Á¤º¸ Á¶È¸]

|
÷°¡Á¦ |
±Û¸®¼¼¸±½ºÅ׾Ʒ¹ÀÌÆ®SE,
¼¼Åº¿Ã,
¼Ò¸£ºñź½ºÅ׾Ʒ¹ÀÌÆ®,
¼ö»êȳªÆ®·ý,
½ºÅ׾Ƹ±¾ËÄÚ¿Ã,
¿¡µ¥Æ®»ê³ªÆ®·ý¼öȹ°,
À¯µ¿ÆÄ¶óÇÉ,
Á¤Á¦¼ö,
Á¶ÇÕÇâ·á(½ºÅ²Äɾî 23538),
Ä«º¸¸Ó940,
ÆÄ¶ó¿Á½Ãº¥Á¶»ê¸ÞÆ¿,
ÆÄ¶ó¿Á½Ãº¥Á¶»êÇÁ·ÎÇÊ,
Æú¸®¼Ò¸£º£ÀÌÆ® 80,
Æú¸®¿Á½Ã¿¡Æ¿·»¼¼Æ¿¿¡Å׸£,
ÇÁ·ÎÇÊ·»±Û¸®ÄÝ
|
|
|
|
|
 |
|
|
|
|
|
|
 |
Á¦Ç°º° ÀӺαݱ⠰í½Ã |
|
|
|
1µî±Þ: ¿øÄ¢Àû »ç¿ë±Ý±â / 2µî±Þ: ¸íÈ®ÇÑ ÀÓ»óÀû ±Ù°Å ¶Ç´Â »çÀ¯°¡ ÀÖ´Â °æ¿ì ºÎµæÀÌÇÏ°Ô »ç¿ë / Mµî±Þ: ÀÓ»óÀû»óȲ¿¡ µû¶ó 1µî±Þ ¶Ç´Â 2µî±ÞÀ¸·Î ºÐ·ùµÇ´Â ¼ººÐ
| ¼ººÐ¸í |
¼ººÐÄÚµå |
±Ý±âµî±Þ |
°í½Ã¹øÈ£ |
°í½ÃÀÏÀÚ |
ºñ°í |
| Crotamiton |
138430COM |
2 |
20200130 |
20201228 |
ÀӺο¡ ´ëÇÑ ¾ÈÀü¼º ¹ÌÈ®¸³, ÀӺο¡°Ô ´ë·® ¶Ç´Â Àå±â°£¿¡ °ÉÃÄ ±¤¹üÀ§ÇÏ°Ô »ç¿ëÇÏÁö ¸» °Í |
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
644803921[644803920]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
[ºñ±Þ¿©]
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
Èò»öÀÇ Å©¸²Çü ¿¬°íÁ¦
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
50±×·¥/Æ©ºê |
| ÁÖ¼ººÐÄÚµå |
138430COM
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| ´ëÇ¥ÄÚµå |
8806448039204 |
| º¸°ü¹æ¹ý |
±â¹Ð¿ë±â, ½Ç¿Â(1-30¡É)º¸°ü |
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
ÇǺΰ¡·Á¿ò
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
°¡º±°Ô ¸ñ¿åÀ» ÇÑ ÈÄ 1ÀÏ 1ȸ ¾ó±¼°ú µÎÇǸ¦ Á¦¿ÜÇϰí Àß °ÇÁ¶µÈ ÇǺΠÀüü¿¡ ¹Ù¸£°í °¡º±°Ô ¸¶»çÁöÇÑ´Ù. ÇÊ¿ä½Ã 24½Ã°£ ÈÄ¿¡ ¹Ýº¹ÇÏ¿© Àû¿ëÇÑ´Ù.
|
| ±Ý±â |
1) ÀÌ ¾à ¹× ÀÌ ¾à ¼ººÐ¿¡ °ú¹ÎÁõ ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ
2) ±Þ¼º ·çǪ½º¼º ÇǺο° ȯÀÚ
|
| ½ÅÁßÅõ¿© |
ÀÌ ¾àÀº ÇÁ·ÎÇÊ·»±Û¸®ÄÝÀ» ÇÔÀ¯Çϰí ÀÖÀ¸¹Ç·Î ÀÌ ¼ººÐ¿¡ °ú¹ÎÇϰųª ¾Ë·¹¸£±â º´·ÂÀÌ Àִ ȯÀÚ¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
|
| ÀÌ»ó¹ÝÀÀ |
1) ÇǺÎÀÇ Àڱذ¨ µî °ú¹ÎÁõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¸ç ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
2) ÀÌ ¾àÀ» ¹Ù¸¥ Á÷ÈÄ¿¡ °æ¹ÌÇÑ ¿°¨ÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸³ª º¸Åë ´Ü½Ã°£³»¿¡ »ç¶óÁø´Ù.
3) ¿°¨, ÀÛ¿°¨, ¹ßÀû, È«¹Ý, ºÐºñ¹°ÀÇ Áõ°¡, ħÀ±, Á¢Ã˼º ¾Ë·¹¸£±â ¹ÝÀÀÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| ÀϹÝÀû ÁÖÀÇ |
È³ó¼º ÇǺο°, ½ÀÀ±, ¹Ì¶õ(Áþ¹«¸§) µî¿¡´Â À̸¦ ¹Ì¸® Ä¡·áÇÑ ÈÄ ÀÌ ¾àÀ» »ç¿ëÇÑ´Ù.
|
| ÀӺο¡ ´ëÇÑ Åõ¿© |
[ÀӺαݱ⠼ººÐ Á¶È¸]
ÀÓ½ÅÁßÀÇ ÀÌ ¾à Åõ¿©¿¡ ´ëÇÑ ¾ÈÀü¼ºÀÌ È®¸³µÇ¾î ÀÖÁö ¾ÊÀ¸¹Ç·Î ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀο¡´Â Ä¡·á»óÀÇ À¯ÀͼºÀÌ À§Ç輺À» »óȸ[¿ôµº]ÇÑ´Ù°í ÆÇ´ÜµÇ´Â °æ¿ì¿¡¸¸ Åõ¿©Çϸç, ´ë·® ¶Ç´Â Àå±â°£¿¡ °ÉÃÄ ±¤¹üÀ§ÇÏ°Ô »ç¿ëÇÏÁö ¸¶½Ê½Ã¿À.
|
| ¼öÀ¯ºÎ¿¡ ´ëÇÑ Åõ¿© |
ÀÌ ¾àÀÇ ¸ðÀ¯·ÎÀÇ ÀÌÇà ¿©ºÎ¿¡ ´ëÇØ ¾Ë·ÁÁ® ÀÖÁö ¾ÊÀ¸³ª ¼öÀ¯ºÎ¿¡ Åõ¿©½Ã À¯¹æºÎÀ§¿¡ Àû¿ëÇÏÁö ¾Ê½À´Ï´Ù. |
| ¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿© |
¿µ¤ýÀ¯¾Æ ¹× ¼Ò¾Æ¿¡ Åõ¿©½Ã ±¤¹üÀ§ÇÏ°Ô Àû¿ëÇÏÁö ¾Ê½À´Ï´Ù. |
| °í·ÉÀÚ¿¡ ´ëÇÑ Åõ¿© |
ÀϹÝÀûÀ¸·Î °í·ÉÀÚ[³ëÀÎ]´Â »ý¸®±â´ÉÀÌ ÀúÇϵǾî ÀÖÀ¸¹Ç·Î ´ë·® ¶Ç´Â Àå±â°£¿¡ °ÉÃÄ ±¤¹üÀ§ÇÏ°Ô Àû¿ëÇÏÁö ¾Ê½À´Ï´Ù.
|
| Àû¿ë»óÀÇ ÁÖÀÇ |
- ÀÌ ¾àÀº ¾È°ú¿ëÀ¸·Î »ç¿ëÇÏÁö ¾Ê´Â´Ù.
- ±Ý¼Ó¿¡ Á¢ÃËµÇ¸é º¯ÁúµÉ ¼ö ÀÖÀ¸¹Ç·Î ±Ý¼ÓÁÖ°Æ, ±Ý¼Ó¿ë±â´Â °¡´ÉÇÑ »ç¿ëÇÏÁö ¾Ê´Â´Ù. ½ºÅ×Àη¹½º¿¬°íÁÖ°ÆÀ» »ç¿ëÇÏ¿© ¼ÒºÐÇÏ´Â °ÍÀº ÁöÀåÀÌ ¾ø´Ù.
- ÇÃ¶ó½ºÆ½ ¿ë±â¿¡ ¼ÒºÐÇÏ¿© Àå±â°£ º¸°üÇÏ´Â °æ¿ì¿¡´Â º¯»ö µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î °¡´ÉÇÑ »¡¸® »ç¿ëÇÑ´Ù.
|
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
- ¾î¸°ÀÌÀÇ ¼ÕÀÌ ´êÁö ¾Ê´Â °÷¿¡ º¸°üÇÑ´Ù.
- °í¿ÂÀ» ÇÇÇÏ¿© º¸°üÇÑ´Ù.
|
| Related FDA Approved Drug |
±âÁØ ¼ººÐ: CROTAMITONCROTAN (CROTAMITON)
EURAX (CROTAMITON)
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Á¦Çüº° º¹¾àÁöµµ |
[Å©¸²] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Crotamiton¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Crotamiton relieves itching by producing what is called a counter-irritation. As crotamiton evaporates from the skin, it produces a cooling effect. This cooling effect helps to divert your body's attention away from the itching.
|
| Pharmacology |
Crotamiton¿¡ ´ëÇÑ Pharmacology Á¤º¸ Crotamiton is usually used to treat pruritis (itching of the skin) caused by scabies or sunburn. Crotamiton relieves itching by producing what is called a counter-irritation. As crotamiton evaporates from the skin, it produces a cooling effect. This cooling effect helps to divert your body's attention away from the itching. Due to this cooling effect it is also effective for the relief of sunburn. The drug is also believed to kill scabies through an unknown mechanism.
|
| Metabolism |
Crotamiton¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Not Available
|
| Protein Binding |
Crotamiton¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Not Available
|
| Half-life |
Crotamiton¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ Not Available
|
| Absorption |
Crotamiton¿¡ ´ëÇÑ Absorption Á¤º¸ 10 % absorbed when applied locally.
|
| Biotransformation |
Crotamiton¿¡ ´ëÇÑ Biotransformation Á¤º¸ Not Available
|
| Toxicity |
Crotamiton¿¡ ´ëÇÑ Toxicity Á¤º¸ Not Available
|
| Drug Interactions |
Crotamiton¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Acetohexamide The beta-blocker decreases the symptoms of hypoglycemiaChlorpropamide The beta-blocker decreases the symptoms of hypoglycemiaCimetidine Cimetidine increases the effect of the beta-blockerClonidine Increased hypertension when clonidine stoppedDisopyramide The beta-blocker increases toxicity of disopyramideGliclazide The beta-blocker decreases the symptoms of hypoglycemiaGlipizide The beta-blocker decreases the symptoms of hypoglycemiaGlisoxepide The beta-blocker decreases the symptoms of hypoglycemiaGlibenclamide The beta-blocker decreases the symptoms of hypoglycemiaGlycodiazine The beta-blocker decreases the symptoms of hypoglycemiaInsulin The beta-blocker decreases the symptoms of hypoglycemiaLidocaine The beta-blocker increases the effect and toxicity of lidocainePropafenone Propafenone increases the effect of beta-blockerRepaglinide The beta-blocker decreases the symptoms of hypoglycemiaRifampin Rifampin decreases the effect of the metabolized beta-blockerTelithromycin Telithromycin may possibly increase metoprolol effectTolazamide The beta-blocker decreases the symptoms of hypoglycemiaTolbutamide The beta-blocker decreases the symptoms of hypoglycemiaAmobarbital The barbiturate decreases the effect of metabolized beta-blockerAprobarbital The barbiturate decreases the effect of metabolized beta-blockerButalbital The barbiturate decreases the effect of metabolized beta-blockerButabarbital The barbiturate decreases the effect of metabolized beta-blockerButethal The barbiturate decreases the effect of metabolized beta-blockerDihydroquinidine barbiturate The barbiturate decreases the effect of metabolized beta-blockerHeptabarbital The barbiturate decreases the effect of metabolized beta-blockerHexobarbital The barbiturate decreases the effect of metabolized beta-blockerMethohexital The barbiturate decreases the effect of metabolized beta-blockerMethylphenobarbital The barbiturate decreases the effect of metabolized beta-blockerPentobarbital The barbiturate decreases the effect of metabolized beta-blockerPhenobarbital The barbiturate decreases the effect of metabolized beta-blockerPrimidone The barbiturate decreases the effect of metabolized beta-blockerQuinidine barbiturate The barbiturate decreases the effect of metabolized beta-blockerSecobarbital The barbiturate decreases the effect of metabolized beta-blockerTalbutal The barbiturate decreases the effect of metabolized beta-blockerCitalopram The SSRI increases the effect of the beta-blockerEscitalopram The SSRI increases the effect of the beta-blockerFluoxetine The SSRI increases the effect of the beta-blockerSertraline The SSRI increases the effect of the beta-blockerParoxetine The SSRI increases the effect of the beta-blockerDihydroergotamine Ischemia with risk of gangreneDihydroergotoxine Ischemia with risk of gangreneErgonovine Ischemia with risk of gangreneErgotamine Ischemia with risk of gangreneMethysergide Ischemia with risk of gangreneVerapamil Increased effect of both drugsHydralazine Increased effect of both drugsDiltiazem Increased risk of bradycardiaEpinephrine Hypertension, then bradycardiaFenoterol AntagonismFormoterol AntagonismIsoproterenol AntagonismOrciprenaline AntagonismPirbuterol AntagonismPrazosin Risk of hypotension at the beginning of therapyProcaterol AntagonismSalbutamol AntagonismSalmeterol AntagonismTerbutaline AntagonismIbuprofen Risk of inhibition of renal prostaglandinsIndomethacin Risk of inhibition of renal prostaglandinsPiroxicam Risk of inhibition of renal prostaglandins
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Crotamiton¿¡ ´ëÇÑ Food Interaction Á¤º¸ Not Available
|
| Description |
Crotamiton¿¡ ´ëÇÑ Description Á¤º¸ Crotamiton is a scabicidal and antipruritic agent available as a cream or lotion for topical use only. It is a colorless to slightly yellowish oil, having a faint amine-like odor. It is miscible with alcohol and with methanol.
|
| Dosage Form |
Crotamiton¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Cream Topical
|
| Drug Category |
Crotamiton¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antiparasitic AgentsAntipruriticsPesticidesScabicides
|
| Smiles String Canonical |
Crotamiton¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CCN(C(=O)C=CC)C1=CC=CC=C1C
|
| Smiles String Isomeric |
Crotamiton¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CCN(C(=O)\C=C\C)C1=CC=CC=C1C
|
| InChI Identifier |
Crotamiton¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C13H17NO/c1-4-8-13(15)14(5-2)12-10-7-6-9-11(12)3/h4,6-10H,5H2,1-3H3
|
| Chemical IUPAC Name |
Crotamiton¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ N-ethyl-N-(2-methylphenyl)but-2-enamide
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2026-03-04
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|