| |
|
|
|
|
|
 |
| |
|
´õ¸ðÇȽºÁúÁ¤(Áú»ê¼¼¸£Å¸ÄÚ³ªÁ¹) DERMOFIX VAGINAL TAB.
|
Àü¹®ÀǾàǰ | ±Þ¿©
|
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
642200120[A13102681]
Àú°¡¾à ´ëü Àμ¾Æ¼ºê Áö±Þ ´ë»ó
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\3,649 ¿ø/1Á¤(2026.01.01)(ÇöÀç¾à°¡)
\3,686 ¿ø/1Á¤(2024.07.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»ö ³»Áö ¹Ì»öÀÇ ÆòÆòÇÑ Àå»ç¹æÇü Á¤Á¦
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
1Á¤/PTP |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 500¹Ð¸®±×·¥ |
1 °³ |
8806422001203 |
8806422001210 |
|
|
| ÁÖ¼ººÐÄÚµå |
226902CTB
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| ´ëÇ¥ÄÚµå |
8806422001203 |
| º¸°ü¹æ¹ý |
½Ç¿Âº¸Á¸(1-30¡É), ±â¹Ð¿ë±â |
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
ĵð´Ù¼º Áú¿°
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
- º¸Åë ¼ºÀο¡¼ ¼¼¸£Å¸ÄÚ³ªÁ¹Áú»ê¿°À¸·Î¼ 1ÀÏ 1ȸ 500 mgÀ» ±â±¸¸¦ »ç¿ëÇÏ¿© Áú¾ÈÀ¸·Î ±í¼÷È÷ »ðÀÔÇϸç Ãëħ½Ã¿¡ Åõ¿©ÇÏ´Â °ÍÀÌ ÁÁ´Ù.
- 1ȸ Åõ¿©ÈÄ Áõ»óÀÌ Áö¼ÓµÇ´Â ȯÀÚÀÇ °æ¿ì¿¡´Â 1 ¡ 2ÁÖ ÈÄ¿¡ 500 mgÀ» ´Ù½Ã Åõ¿©ÇÑ´Ù.
- ¿Ã¹Ù¸¥ Åõ¿©¸¦ À§ÇÑ Âü°í»çÇ×
¡¤ È¿°úÀûÀÎ ±¹¼ÒÀÛ¿ë ¹× Áú Èí¼ö¸¦ À§ÇØ Ãëħ½Ã Åõ¿©ÇÏ´Â °ÍÀÌ ÁÁ´Ù.
¡¤ Áß¼º ¶Ç´Â ¾ËÄ«¸®¼º ºñ´©·Î Áú ºÎÀ§¸¦ ¼¼Ã´ ÈÄ, ´©¿ö¼ ´Ù¸®¸¦ ¾à°£ ±¸ºÎ¸° »óÅ¿¡¼ 1ȸ¿ë ±â±¸¸¦ »ç¿ëÇÏ¿© Á¤Á¦¸¦ Áú¾ÈÀ¸·Î ±í¼÷È÷ ³Ö´Â´Ù.
¡¤ ±¹¼Ò ÀÚ±ØÀ» ÇÇÇϱâ À§Çؼ´Â °¡±ÞÀû ¸é³»ÀǸ¦ ÀÔ´Â °ÍÀÌ ÁÁ´Ù.
|
| ±Ý±â |
ÀÌ ¾à ¶Ç´Â ÀÌ ¾àÀÇ ±¸¼º¼ººÐ, À̴̹ÙÁ¹ Ç×Áø±Õ¾à¿¡ °ú¹Î¹ÝÀÀÀÌ Àִ ȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
1) ÀÌ ¾à¹°ÀÇ ÀÌ»ó¹ÝÀÀÀº Åë»óÀûÀ¸·Î ¹Ì¹ÌÇϰí ÀϽÃÀûÀÎ °ÍÀ¸·Î¼, ¶§¶§·Î ºñ´¢»ý½Ä±âÀÇ º¯È(¿äµµÀÇ ÀÛ¿°¨, Áú °¡·Á¿òÁõ, ¿ä½Ç±Ý, ¹æ±¤¿°, Áú¿°)¸¦ ¾ß±â½Ãų ¼ö ÀÖÀ¸¸ç µå¹°°Ô ¾Ë·¹¸£±â¼º º¯È(È«¹Ý, ¹ßÁø, °¡·Á¿ò, Á¢ÃËÇǺο°), ½Å°æÀû º¯È(µÎÅë)°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ȯÀÚ°¡ ±Ø½ÉÇÑ µÎÅë, °¡·Á¿ò, °ú¹Î¹ÝÀÀÀ» º¸ÀÌ´Â °æ¿ì Áï½Ã Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
2) ±¹³» ½ÃÆÇÈÄ Á¶»ç°á°ú
±¹³»¿¡¼ Àç½É»ç¸¦ À§ÇÏ¿© 6³â µ¿¾È 5,008¸íÀ» ´ë»óÀ¸·Î ½Ç½ÃÇÑ ½ÃÆÇ ÈÄ Á¶»ç°á°ú °¡·Á¿ò, ±¸¿ªÀÌ °¢ 1·Ê¾¿ º¸°íµÇ¾ú´Ù.
|
| ÀϹÝÀû ÁÖÀÇ |
1) ¿îÀü´É·Â¿¡ ´ëÇÑ ¿µÇâÀº ¾Ë·ÁÁöÁö ¾Ê¾Ò´Ù.
2)»ê¼º(ĵð´Ù±ÕÀÇ Áõ½ÄÀ» ÃËÁø½ÃŰ´Â pH) ºñ´©¸¦ »ç¿ëÇÏ´Â °ÍÀº ±ÇÀåµÇÁö ¾Ê´Â´Ù.
3) »ý¸®±â°£ Áß¿¡µµ Åõ¿© °¡´ÉÇÏ´Ù.
|
| »óÈ£ÀÛ¿ë |
1) ¶óÅØ½º ÀçÁúÀÇ ÇÇÀӱⱸ(Æä¼¸® ¶Ç´Â Äܵ¼)´Â ÆÄ¿ÀÇ À§ÇèÀÌ ÀÖÀ¸¹Ç·Î »ç¿ëÇÏÁö ¾Ê´Â´Ù.
2) ÀÌ ¾àÀº »ìÁ¤ÀÚÁ¦ÀÇ ÇÇÀÓÈ¿°ú¸¦ ºÒȰ¼ºÈÇÒ ¼ö ÀÖ´Ù.
|
| ÀӺο¡ ´ëÇÑ Åõ¿© |
[ÀӺαݱ⠼ººÐ Á¶È¸]
ÀӺΠ¹× ¼öÀ¯ºÎ¿¡ ´ëÇÑ ¾ÈÀü¼ºÀÌ È®¸³µÇÁö ¾Ê¾ÒÀ¸¹Ç·Î ÀӺΠ¹× ¼öÀ¯ºÎ¿¡´Â Ä¡·á»óÀÇ À¯ÀͼºÀÌ À§Ç輺À» »óȸÇÑ´Ù°í ÆÇ´ÜµÇ´Â °æ¿ì¿¡¸¸ Åõ¿©ÇÑ´Ù.
|
| ¼öÀ¯ºÎ¿¡ ´ëÇÑ Åõ¿© |
ÀӺΠ¹× ¼öÀ¯ºÎ¿¡ ´ëÇÑ ¾ÈÀü¼ºÀÌ È®¸³µÇÁö ¾Ê¾ÒÀ¸¹Ç·Î ÀӺΠ¹× ¼öÀ¯ºÎ¿¡´Â Ä¡·á»óÀÇ À¯ÀͼºÀÌ À§Ç輺À» »óȸÇÑ´Ù°í ÆÇ´ÜµÇ´Â °æ¿ì¿¡¸¸ Åõ¿©ÇÑ´Ù.
|
| ¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿© |
¼Ò¾Æ ¹× °í·ÉÀÚ¿¡ ´ëÇÑ È®½ÇÇÑ Á¤º¸´Â ¾øÀ¸³ª Ưº°ÇÑ ¹®Á¦´Â ¿¹»óµÇÁö ¾Ê´Â´Ù. |
| °í·ÉÀÚ¿¡ ´ëÇÑ Åõ¿© |
¼Ò¾Æ ¹× °í·ÉÀÚ¿¡ ´ëÇÑ È®½ÇÇÑ Á¤º¸´Â ¾øÀ¸³ª Ưº°ÇÑ ¹®Á¦´Â ¿¹»óµÇÁö ¾Ê´Â´Ù. |
| Àû¿ë»óÀÇ ÁÖÀÇ |
È¿°úÀûÀÎ ±¹¼ÒÀÛ¿ë ¹× Áú Èí¼ö¸¦ À§ÇØ Ãëħ ½Ã Åõ¿©ÇÏ´Â °ÍÀÌ ÁÁÀ¸¸ç ¾à¹°ÀÌ Áú ¿Ü·Î Èê·¯³ª¿Ã °¡´É¼ºÀÌ ÀÖÀ¸¹Ç·Î ¼Ó¿Ê º¸È£¿¡ À¯ÀÇÇÑ´Ù.
|
| °ú·®Åõ¿© ¹× óġ |
ÁúÁ¤Àº ±¹¼Ò Áú »ðÀÔºÎÀ§¿¡ ¿¬¼ÓÀûÀÎ »ç¿ëÀ¸·Î ÀÎÇÑ Áßµ¶ÀÇ °¡´É¼ºÀÌ ¾øµµ·Ï ÁÖÀÇÇØ¾ß ÇÑ´Ù.
|
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
1) ¾î¸°ÀÌÀÇ ¼ÕÀÌ ´êÁö ¾Ê´Â °÷¿¡ º¸°üÇÑ´Ù.
2) ´Ù¸¥ ¿ë±â¿¡ ¹Ù²Ù¾î ³Ö´Â °ÍÀº »ç°í¿øÀÎÀÌ µÇ°Å³ª ǰÁú À¯Áö¸é¿¡¼ ¹Ù¶÷Á÷ÇÏÁö ¾ÊÀ¸¹Ç·Î À̸¦ ÁÖÀÇÇÑ´Ù.
|
| Related FDA Approved Drug |
±âÁØ ¼ººÐ: SERTACONAZOLE NITRATEERTACZO (SERTACONAZOLE NITRATE)
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
(sertaconazole; )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Á¦Çüº° º¹¾àÁöµµ |
[ÁúÁ¤] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Sertaconazole¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Sertaconazole interacts with 14-¥á demethylase, a cytochrome P-450 enzyme necessary to convert lanosterol to ergosterol. As ergosterol is an essential component of the fungal cell membrane, inhibition of its synthesis results in increased cellular permeability causing leakage of cellular contents. Sertaconazole may also inhibit endogenous respiration, interact with membrane phospholipids, inhibit the transformation of yeasts to mycelial forms, inhibit purine uptake, and impair triglyceride and/or phospholipid biosynthesis.
|
| Pharmacology |
Sertaconazole¿¡ ´ëÇÑ Pharmacology Á¤º¸ Sertaconazole is an imidazole/triazole type antifungal agent. Sertaconazole is a highly selective inhibitor of fungal cytochrome P-450 sterol C-14 ¥á-demethylation via the inhibition of the enzyme cytochrome P450 14¥á-demethylase. This enzyme converts lanosterol to ergosterol, and is required in fungal cell wall synthesis. The subsequent loss of normal sterols correlates with the accumulation of 14 ¥á-methyl sterols in fungi and may be partly responsible for the fungistatic activity of fluconazole. Mammalian cell demethylation is much less sensitive to fluconazole inhibition. Sertaconazole exhibits in vitro activity against Cryptococcus neoformans and Candida spp. Fungistatic activity has also been demonstrated in normal and immunocompromised animal models for systemic and intracranial fungal infections due to Cryptococcus neoformans and for systemic infections due to Candida albicans.
|
| Protein Binding |
Sertaconazole¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ >99% to plasma
|
| Absorption |
Sertaconazole¿¡ ´ëÇÑ Absorption Á¤º¸ Bioavailability is negligible.
|
| Pharmacokinetics |
Sertaconazole nitrateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : 2% Å©¸²Á¦ÀÇ ¿Ü¿ë Àû¿ë½Ã Àü½ÅÀûÀÎ Èí¼ö´Â ¹«½ÃÇÒ ¸¸Å Àû´Ù.
- ºÐÆ÷ : ÇǺΠÀû¿ë½Ã Ç¥ÇÇ¿¡ °í³óµµ·Î Á¸ÀçÇÑ´Ù.
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Sertaconazole¿¡ ´ëÇÑ Description Á¤º¸ Sertaconazole nitrate is an antifungal medication of the imidazole class. It is available as a cream to treat skin infections such as athlete's foot. [Wikipedia]
|
| Drug Category |
Sertaconazole¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antifungal Agents
|
| Smiles String Canonical |
Sertaconazole¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ ClC1=CC(Cl)=C(C=C1)C(CN1C=CN=C1)OCC1=CSC2=C1C=CC=C2Cl
|
| Smiles String Isomeric |
Sertaconazole¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ ClC1=CC(Cl)=C(C=C1)[C@@H](CN1C=CN=C1)OCC1=CSC2=C1C=CC=C2Cl
|
| InChI Identifier |
Sertaconazole¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C20H15Cl3N2OS/c21-14-4-5-16(18(23)8-14)19(9-25-7-6-24-12-25)26-10-13-11-27-20-15(13)2-1-3-17(20)22/h1-8,11-12,19H,9-10H2
|
| Chemical IUPAC Name |
Sertaconazole¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 1-[2-[(7-chloro-1-benzothiophen-3-yl)methoxy]-2-(2,4-dichlorophenyl)ethyl]imidazole
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2026-02-02
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|