| |
|
|
|
|
|
 |
| |
|
¿µÀÏ¿°»êÇÇ·»Á¦ÇÉÁ¤ [Pirenzepine HCl]
|
|
Àü¹®ÀǾàǰ | ºñ±Þ¿©
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
649403780[A16601981]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1Á¤(2002.05.11)(ÇöÀç¾à°¡)
\104 ¿ø/1Á¤(2002.01.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
1. ÁÖÈ¿´ÉÈ¿°ú : À§½ÊÀÌÁöÀå±Ë¾ç
2. ´ÙÀ½ ÁúȯÀÇ À§Á¡¸· º´º¯(¹Ì¶õ, ÃâÇ÷, ¹ßÀû, ºÎÂøÁ¡¾×) ¹× ¼ÒȰüÁõ»óÀÇ °³¼±: ±Þ¼ºÀ§¿°, ¸¸¼ºÀ§¿°ÀÇ ±Þ¼º¾Çȱâ
[Drugbank ÀÇ ¼ººÐÁ¤º¸¿¶÷] [Pirenzepine]
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
[ÁÖ¼ººÐÄÚµå:213701ATB ¿¡ µû¸¥ ½É»çÁöħ¿¶÷]
¼ºÀÎ: ¿°»êÇÇ·»Á¦ÇÉÀ¸·Î¼ 1ȸ 25mgÀ» 1ÀÏ 3-4ȸ °æ¿ìÅõ¿©ÇÑ´Ù. ½Ä»ç 30ºÐÀü¿¡ ¼Ò·®ÀÇ ¹°°ú ÇÔ²² Åõ¿©ÇÏ´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù.
¿¬·É, Áõ»ó¿¡ µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù.
|
| ±Ý±â |
ÇÇ·»Á¦ÇÉ¿¡ °ú¹ÎÁõÀÇ º´·ÂÀÌ Àִ ȯÀÚ |
| ½ÅÁßÅõ¿© |
- Àü¸³¼±ºñ´ë ȯÀÚ(¹è´¢°ï¶õÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù.)
- ±âÁú¼º À¯¹®ÇùÂø ȯÀÚ
- ¸¶ºñ¼º ÀåÆó½ÄÁõ ȯÀÚ
- Æó¼â°¢ ³ì³»Àå ȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
- ¼Òȱâ°è:
¶§¶§·Î ±¸°¥, º¯ºñ, ¼³»ç, ±¸¿ª, ±¸Åä, ÆØ¸¸°¨, µå¹°°Ô Ä¡À°ÅëÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
°ú¹ÎÁõ: ¶§¶§·Î ¹ßÁø µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
Ç÷¾×: ¸Å¿ì µå¹°°Ô Ç÷¼ÒÆÇ °¨¼ÒÁõ, ¹«°ú¸³±¸ÁõÀÌ º¸°íµÇ¾î ÀÖ´Ù.
°£Àå: µå¹°°Ô GOT,GPT°¡ »ó½ÂÇÒ ¼ö ÀÖ´Ù.
¼øÈ¯±â°è: µå¹°°Ô ½É°èÇ×ÁøÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
ºñ´¢±â°è: µå¹°°Ô ¹è´¢°ï¶õ, ÀÜ´¢°¨ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
±âŸ: µå¹°°Ô µÎÁß°¨, ±â¸³¼º Çö±â, Å»·Â°¨, ½Ã¾ß¸ù·Õ, ´±ÀÇ °ÇÁ¶°¨À» ¼ö¹ÝÇÏ´Â À¯·ç, ´«ÀÇ Á¶ÀýÀå¾Ö°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
º¯ºñ°¡ »ý±æ¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Pirenzepine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Pirenzepine is a muscarinic receptor antagonist and binds to the muscarinic acetylcholine receptor. The muscarinic acetylcholine receptor mediates various cellular responses, including inhibition of adenylate cyclase, breakdown of phosphoinositides and modulation of potassium channels through the action of G proteins.
|
| Pharmacology |
Pirenzepine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Pirenzepine belongs to a group of medications called antispasmodics/anticholinergics. These medications are used to relieve cramps or spasms of the stomach, intestines, and bladder. Pirenzepine is used to treat duodenal or stomach ulcers or intestine problems. It can be used together with antacids or other medicine in the treatment of peptic ulcer. It may also be used to prevent nausea, vomiting, and motion sickness.
|
| Metabolism |
Pirenzepine¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Not Available
|
| Protein Binding |
Pirenzepine¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Not Available
|
| Half-life |
Pirenzepine¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ Not Available
|
| Absorption |
Pirenzepine¿¡ ´ëÇÑ Absorption Á¤º¸ Not Available
|
| Pharmacokinetics |
Pirenzepine HClÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ÃÖ°í Ç÷Áß ³óµµ µµ´Þ½Ã°£ : °æ±¸ : 2 ½Ã°£
- BA : °æ±¸ : 20-30% , À½½Ä°ú ÇÔ²² º¹¿ë½Ã 10-20%·Î °¨¼Ò
- ÃѴܹé°áÇÕÀ² : 10%
- ¹è¼³ : ½Å¹è¼³(°ÅÀÇ 100%)
- Total body clearance : 250 mL/minute
- ¹Ý°¨±â : ¸ð¾à¹°ÀÇ ¼Ò½Ç ¹Ý°¨½Ã : 11½Ã°£
|
| Biotransformation |
Pirenzepine¿¡ ´ëÇÑ Biotransformation Á¤º¸ Not Available
|
| Toxicity |
Pirenzepine¿¡ ´ëÇÑ Toxicity Á¤º¸ Not Available
|
| Drug Interactions |
Pirenzepine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Pirenzepine¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take 30 minutes before breakfast and at bedtime.
|
| Drug Target |
[Drug Target]
|
| Description |
Pirenzepine¿¡ ´ëÇÑ Description Á¤º¸ An antimuscarinic agent that inhibits gastric secretion at lower doses than are required to affect gastrointestinal motility, salivary, central nervous system, cardiovascular, ocular, and urinary function. It promotes the healing of duodenal ulcers and due to its cytoprotective action is beneficial in the prevention of duodenal ulcer recurrence. It also potentiates the effect of other antiulcer agents such as cimetidine and ranitidine. It is generally well tolerated by patients. [PubChem]
|
| Dosage Form |
Pirenzepine¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Not Available
|
| Drug Category |
Pirenzepine¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Ulcer AgentsAntimuscarinicsAntispasmodicsMuscarinic Antagonists
|
| Smiles String Canonical |
Pirenzepine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CN1CCN(CC1)CC(=O)N1C2=CC=CC=C2C(=O)NC2=C1N=CC=C2
|
| Smiles String Isomeric |
Pirenzepine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CN1CCN(CC1)CC(=O)N1C2=CC=CC=C2C(=O)NC2=C1N=CC=C2
|
| InChI Identifier |
Pirenzepine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C19H21N5O2/c1-22-9-11-23(12-10-22)13-17(25)24-16-7-3-2-5-14(16)19(26)21-15-6-4-8-20-18(15)24/h2-8H,9-13H2,1H3,(H,21,26)/f/h21H
|
| Chemical IUPAC Name |
Pirenzepine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 11-[2-(4-methylpiperazin-1-yl)acetyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one
|
| Drug-Induced Toxicity Related Proteins |
PIRENZEPINE ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Muscarinic acetylcholine receptor Drug:pirenzepine Toxicity:impair working memory. [¹Ù·Î°¡±â] Replated Protein:Muscarinic acetylcholine receptor Drug:pirenzepine Toxicity:impair working memory. [¹Ù·Î°¡±â] Replated Protein:Calcineurin Drug:pirenzepine Toxicity:secondary hyperparathyroidism. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2026-03-04
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|