 |
| |
|
´ÏÄÚÆÐÃë(´ÏÄÚÆ¾) NICOPATCH(NICOTINE)
|
|
ÀϹÝÀǾàǰ | ºñ±Þ¿©
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
643600890
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
[ºñ±Þ¿©]
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
ÀÌ ¾àÀº ¹ÝÅõ¸íÇÑ Á¡Âø¼º ¹°ÁúÀ» Ȳ°¥»öÀÇ Æú¸®¿¡½ºÅ׸£Çʸ§ÀÇ ¾Ë·ç¹Ì´½¹ÚÃþ°ú ºÎÁ÷Æ÷°¡ ÇÕÁöµÈ ¸é¿¡ µµÆ÷ÇÏ°í °íü¸é¿¡ ¹æÃ⺸ȣ¸·À» µ¤Àº ÆÐÃëÁ¦ÀÌ´Ù. [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
ÀÚ»çÆ÷Àå´ÜÀ§¿¡ µû¸§ |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 38¹Ð¸®±×·¥ |
1 ¸Å |
Foil |
8806436008908 |
8806436008946 |
2´Ü°è |
| 38¹Ð¸®±×·¥ |
7 ¸Å |
Foil |
8806436008908 |
8806436008922 |
2´Ü°è |
|
| ÁÖ¼ººÐÄÚµå |
A88113CPC
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
±Ý¿¬½Ã º¸Á¶¿ä¹ýÁ¦
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¿ë¹ý¿ë·®
¼ºÀÎ 1ÀÏ 1ȸ 1¸Å¾¿ ÅÐÀÌ ¾ø´Â ½ÅüºÎºÐ(ÆÈ¾ÈÂÊ, ¾ûµ¢ÀÌ µî)¿¡ ºÎÂøÇϵÇ, ¸ÅÀÏ ºÎÂøºÎÀ§¸¦ ¹Ù²Û´Ù.
´ÏÄÚÆÐÃë 30Àº ÀϹÝÀûÀ¸·Î ÇÏ·ç ´ã¹è 20°³ºñ ÀÌ»ó Èí¿¬°¡¿¡°Ô Àû¿ëÇÏ°í ´ÏÄÚÆÐÃë 20Àº ÇÏ·ç 20°³ºñ±îÁöÀÇ Èí¿¬°¡¿¡°Ô Àû¿ëÇÑ´Ù. ´ÏÄÚÆÐÃë 10Àº ¸¶Áö¸· ´Ü°è¿¡ ´ÏÄÚÆ¾ º¸ÃæÀ» °¨¼Ò ½Ã۴µ¥ Àû¿ëÇÑ´Ù.
º¸Åë ´ÙÀ½ °èȹ¿¡ µû¶ó Àû¿ëÇÑ´Ù.
- ½ÉÇÑ Èí¿¬°¡ : ´ÏÄÚÆÐÃë 30À¸·Î ½ÃÀÛÇÏ°í ±× ´ÙÀ½¿¡´Â ´ÏÄÚÆÐÃë 20, ±×¸®°í ¸¶Áö¸·À¸·Î ´ÏÄÚÆÐÃë 10ÀÇ ¼ø¼·Î °¢°¢ 4ÁÖµ¿¾È Àû¿ëÇÑ´Ù.
- º¸Åë Èí¿¬°¡ : ´ÏÄÚÆÐÃë 20À» 8ÁÖµ¿¾È Àû¿ëÇϰí, ±×ÈÄ ´ÏÄÚÆÐÃë 10À» 4ÁÖ°£ Àû¿ëÇÑ´Ù.
Ä¡·á´Â 3°³¿ùÀ» ÃʰúÇÏÁö ¸»¾Æ¾ß ÇÑ´Ù.
|
| ±Ý±â |
1) ÀÌ ¾à¿¡ ÇÔÀ¯µÈ ´ÏÄÚÆ¾, ºÎÇüÁ¦ ¶Ç´Â ¹Ú¸®¸·, ÁöÁöü, Á¢ÂøÁ¦ µî ÀÌ ¾àÀÇ ´Ù¸¥ ±¸¼º¼ººÐ¿¡ °ú¹Î¼ºÀÌ Àִ ȯÀÚ
2) °Ç¼±, ¸¸¼ºÇǺο°, µÎµå·¯±â¿Í °°Àº ¸¸¼ºÇǺÎÁúȯÀÌ Àִ ȯÀÚ, Àü½ÅÀûÀÎ ÇǺÎÁúȯ ȯÀÚ ¶Ç´Â °ú¹Î¼º ÇǺο° ȯÀÚ
3) ºÒ¾ÈÁ¤ Çù½ÉÁõ ¶Ç´Â Çù½ÉÁõ ¾ÇÈ[ÇÁ¸°Áî¸ÞÅ» Çù½ÉÁõ(Prinzmetal's angina : º¯Çü¼º Çù½ÉÁõ) Æ÷ÇÔ] ȯÀÚ, ÃÖ±Ù 3°³¿ù À̳»¿¡ ½É±Ù°æ»öÀ» °æÇèÇÑ È¯ÀÚ, ±Þ¼º °æ»öÁõ Èıâ(post-infarction period) ȯÀÚ, ÁßÁõÀÇ ½ÉºÎÁ¤¸Æ ȯÀÚ µî ÀÓ»óÀûÀ¸·Î °ü·ÃÀÌ ÀÖ´Â ½ÉºÎÁ¤¸Æ ȯÀÚ, Àü½Å °íÇ÷¾Ð ¶Ç´Â ¸»ÃÊÇ÷°üÁúȯ µî ÁßÁõÀÇ ½ÉÇ÷°ü°è Áúȯ ȯÀÚ
4) ±Þ¼º ³úÁ¹ÁßÀ̳ª ÃÖ±Ù ³úÇ÷°ü ÀÌ»óÀÌ ÀÖ¾ú´ø ȯÀÚ µî ³úÇ÷°ü¼º ÁúȯÀÌ Àִ ȯÀÚ
5) ÀÓºÎ
´ÏÄÚÆ¾Àº ¾î¶² ÇüÅ·εµ ÀӽŠÁßÀÏ ¶§ Åõ¿©µÇ¾î¼´Â ¾ÈµÈ´Ù. ´ÏÄÚÆ¾Àº ŹÝÀ» Åë°úÇÏ¿© ¿ë·® ºñ·ÊÀûÀ¸·Î žÆÀÇ È£Èí°ú ¼øÈ¯¿¡ ¿µÇâÀ» ¹ÌÄ¥ »Ó ¾Æ´Ï¶ó µ¿¹°½ÃÇè¿¡¼ ´ÏÄÚÆ¾Àº ÅÂÀÚÀÇ ºñƯÀÌÀû ¼ºÀå Áö¿¬ ¹× °ñ°Ý°è ÀÌ»óÀ» ¾ß±âÇÏ¿´´Ù. µû¶ó¼ ´ÏÄÚÆ¾Àº ÀÓ»êºÎ¿¡ Åõ¿©µÇ¾úÀ» ¶§ žƿ¡ ÇØ¸¦ ¹ÌÄ¥ ¼ö ÀÖ´Ù°í ÃßÁ¤µÈ´Ù. ¶ÇÇÑ Èí¿¬ÀÌ ¸ðü ¹× žÆÀÇ °Ç°¿¡ ¹ÌÄ¡´Â ÇØ·Î¿î ¿µÇâÀº ¸Í¹éÈ÷ È®¸³µÇ¾î ÀÖ´Ù. ±×·¯¹Ç·Î ÀÓ»êºÎ´Â ´ÏÄÚÆ¾ ´ëü¿ä¹ýÀ» ½Ç½ÃÇÏÁö ¾Ê°í Èí¿¬À» Áß´ÜÇÏ¿©¾ß ÇÑ´Ù.
6) ¼öÀ¯ºÎ
´ÏÄÚÆ¾Àº Ä¡·á¿ë·®¿¡µµ ¸ðÀ¯ ÁßÀ¸·Î ºÐºñµÇ¾î À¯¾Æ¿¡°Ô ¿µÇâÀ» ¹ÌÄ¥ ¼ö ÀÖ´Ù. µû¶ó¼ ÀÌ ¾àÀº ¼öÀ¯ºÎ¿¡°Ô »ç¿ëµÇ¾î¼´Â ¾ÈµÈ´Ù.
7) 18¼¼ ¹Ì¸¸ÀÇ ¼Ò¾Æ ¹× û¼Ò³â(¾ÈÀü¼ºÀ¯È¿¼ºÀÌ È®¸³µÇÁö ¾ÊÀ½)
8) ºñÈí¿¬ÀÚ ¹× ÀϽÃÀû Èí¿¬ÀÚ
|
| ½ÅÁßÅõ¿© |
1) À§¿° ¹× ±Þ¼º À§±Ë¾ç µî ¼Òȼº±Ë¾ç ȯÀÚ
2) Æó»ö¼º µ¿¸ÆÁúȯ, ¾ÈÁ¤Çü Çù½ÉÁõ, ½ÉºÎÀü, ºñ´ë»ó¼º ½ÉºÎÀü, ½É±Ù°æ»ö, ½ÉºÎÁ¤¸Æ, Ç÷°ü°æ·Ã, Á¶ÀýµÇÁö ¾Ê´Â °íÇ÷¾Ð, µ¿¸ÆÇ÷°ü ¹ÙÀÌÆÐ½º ÀÌ½Ä ¶Ç´Â Ç÷°ü¼ºÇü¼ú ȯÀÚ µî ½ÉÇ÷°ü°è Áúȯ ȯÀÚ
3) °í·ÉÀÚ, ½Å°£ºÎÀü ȯÀÚ : °í·ÉÀÚ, ½Å°£ºÎÀü ȯÀÚ¿¡ ´ëÇÑ ´ÏÄÚÆ¾ÀÇ ¾à¹°µ¿·ÂÇÐÀº ¿¬±¸µÇÁö ¾Ê¾ÒÀ¸³ª ´ÏÄÚÆ¾ÀÌ ±¤¹üÀ§ÇÏ°Ô ´ë»çµÇ°í ÃÑ Àü½Å û¼ÒÀ²ÀÌ °£Ç÷·ù¿¡ ÀÇÁ¸ÇÑ´Ù´Â Á¡¿¡¼ ºñÃß¾î º¼ ¶§, °£Àå¾Ö°¡ ¾à¹°ÀÇ µ¿Å¿¡ ¿µÇâÀ» ¹ÌÄ¥ ¼ö ÀÖÀ¸¸ç(û¼ÒÀ² °¨¼Ò), ÁßÁõÀÇ ½ÅÀå¾Ö´Â ´ÏÄÚÆ¾À̳ª ±× ´ë»ç¹°ÀÇ ¹è¼³¿¡ ¿µÇâÀ» ¹ÌÄ¥ ¼ö ÀÖ´Ù.
4) ´ç´¢º´ ȯÀÚ(´ç´¢ ȯÀÚ´Â Èí¿¬À» Áß´ÜÇÑ °á°ú·Î¼ Àν¶¸° Åõ¿©·®ÀÇ °¨¼Ò°¡ ÇÊ¿äÇÒ ¼ö ÀÖ´Ù.)
5) °©»ó¼±±â´ÉÇ×ÁøÁõ ¶Ç´Â Å©·Òģȼº¼¼Æ÷Á¾ ȯÀÚ(´ÏÄÚÆ¾ÀÌ ºÎ½Å¿¡¼ Ä«Å×ÄݾƹÎÀÇ ºÐºñ¸¦ ÀÏÀ¸Å²´Ù.)
|
| ÀÌ»ó¹ÝÀÀ |
¿øÄ¢ÀûÀ¸·Î ÀÌ ¾àÀº Èí¿¬À¸·Î ÀÎÇÑ °Í°ú À¯»çÇÑ ÀÌ»ó¹ÝÀÀÀ» ³ªÅ¸³½´Ù.
ÀÌ ¾àÀ¸·Î µµ´ÞµÇ´Â ÃÖ°í Ç÷Áß ´ÏÄÚÆ¾ ³óµµ´Â Èí¿¬½Ã¿¡ ºñÇØ ³·°í »óÇϺ¯µ¿ÀÌ ÀûÀ¸¹Ç·Î, ÀÌ ¾àÀ¸·Î Ä¡·á Áß ³ªÅ¸³ª´Â ´ÏÄÚÆ¾ °ü·Ã ÀÌ»ó¹ÝÀÀÀº Èí¿¬½Ãº¸´Ù ´ú ¶Ñ·ÇÇϸç, ¾îÁö·¯¿ò, µÎÅë, ¼ö¸éÀå¾Ö µî ÀϺΠÁõ»óÀº ±Ý¿¬½ÃÀÇ ±Ý´Ü Áõ»óµé°ú ±¸ºÐÇϱâ Èûµé´Ù. ¶ÇÇÑ ±Ý¿¬°ú °ü·ÃÇÏ¿© ÁýÁß·Â ÀúÇÏ, ÇÇ·Î, ºÒ¾È, Àڱذú¹Î¼º, ½Ä¿åÁõ°¡¿Í °°Àº ´Ù¸¥ ÁÖ°üÀû °¨°¢ÀÌ ¹ß»ýÇÒ ¼ö ÀÖ´Ù.
ÀÌ ¾àÀÇ ÁÖµÈ ÀÌ»ó¹ÝÀÀÀº Á¦Á¦ Àû¿ë ºÎÀ§ÀÇ ÇǺιÝÀÀÀ¸·Î¼, ÆÐÃë Àû¿ë ºÎÀ§ÀÇ È«¹Ý ¶Ç´Â °¡·Á¿òÁõÀ̾ú´Ù. ¾à 20% ȯÀÚ¿¡¼ Åõ¿© ùÁÖ µ¿¾È °æ¹ÌÇÑ ±¹¼Ò ÇǺιÝÀÀÀÌ ³ªÅ¸³µ´Ù. ºÎÁ¾, ÀÛ¿°¨, ¼öÆ÷, ÇÇÁø ¶Ç´Â Àû¿ë ºÎÀ§ÀÇ Á¶ÀÓ ¶ÇÇÑ º¸°íµÇ¾úÀ¸¸ç, ÀÌ·± ¹ÝÀÀµéÀº ´ëºÎºÐ ¿ÏÈÇß°í 48½Ã°£ À̳»¿¡ ȸº¹µÇ¾ú´Ù. Á» ´õ ½ÉÇÑ °æ¿ì¿¡´Â È«¹Ý ¹× ħÀ±ÀÌ 1-3ÁÖ±îÁö Áö¼ÓµÇ¾ú´Ù. Áß¿äÇÑ ÇǺιÝÀÀÀº Ä¡·á°³½Ã ÈÄ 3-8ÁÖ »çÀÌ¿¡ ¹ß»ýµÇ¾ú°í, µå¹® °æ¿ì Àû¿ëºÎÀ§ À̿ܿ¡±îÁö È®ÀåµÇ¾ú´Ù.
1) ÁßÃ߽Űæ°è : µÎÅë, ¾îÁö·¯¿ò, ¼ö¸éÀå¾Ö, ºÒ¾È, °¨Á¤ÀÇ ºÒ¾ÈÁ¤, ÃÊÁ¶, ºñÁ¤»óÀûÀÎ ²Þ, È¥¸ù, µ¿¿ä, ÁýÁßÀå¾Ö, ÇÇ·Î, ÆíµÎÅë, ¿¬Ãà, ÇÏÁö°æ·ÃÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
2) ½ÉÇ÷°ü°è : Ç÷¾ÐÀÇ º¯È, °íÇ÷¾Ð, ½É°èÇ×ÁøÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
3) ¼Òȱâ°è : ±¸¿ª, º¹ºÎ µ¿Åë, ¼ÒȺҷ®, º¯ºñ, ¼³»ç, ±¸Åä, À§±Ë¾ç, ¿¬ÇÏ °ï¶õ, ¹èº¯ ÀÌ»ó, ½Ä¿åÁõ°¡°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
4) È£Èí±â°è : °¨±â ¹× ÀÎÇ÷翣ÀÚ Áõ»ó, ±âħ, Àεο°, ºñ¿°, ºÎºñ°¿°, »óºÎ È£Èí±âÁõ»ó, ±â°üÁö¿°, È£Èí°ï¶õÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
5) ÇǺΠ: È«¹Ý, ºÎÁ¾, ¾Ë·¯Áö, ÇÇÁø, Ç츣Æä½ºÁø, °¡·Á¿òÁõ, µÎµå·¯±â, ¿©µå¸§, µå¹°°Ô ÇǺÎÅ»»öÀÌ º¸°íµÇ¾úÀ¸¸ç, ÀÌ·¯ÇÑ Áõ»óÀÌ ÀϾ °æ¿ì¿¡´Â Ä¡·á¸¦ ÁßÁöÇÑ´Ù.
6) °¨°¢±â°è : ¹Ì°¢µµÂø, ½Ã¾ßÀÌ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
7) ±âŸ : ¿ù°æ°ï¶õÁõ, ±ÙÀ°Åë, °üÀýÅë, Ä¡Åë, ¹èÅë, ÈäÅë, µ¿Åë, ÀÌÅë, ¾È¸éÈ«Á¶, ±¹¼ÒºÎÁ¾, üÁßÁõ°¡, ±¸°¥, °íâ, Ä¡Àº¿°, °©»ó¼± ±â´ÉÀå¾Ö, Àӯļ± µ¿Åë, ¹æ±¤¿°, ¹ßÇÑÁõ°¡°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| Off-label Usage |
[Á¶È¸]
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
ÀÓ»êºÎ ¶Ç´Â ÀӽŰèȹÁß º¹¿ë±ÝÁö |
|
 |
º¯ºñ°¡ »ý±æ¼ö ÀÖ½À´Ï´Ù. |
|
 |
¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| Á¦Çüº° º¹¾àÁöµµ |
[ÆÐÃë] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Nicotine¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Nicotine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Nicotine binds to the nicotinic acetylcholine receptor. Stimulation of nicotinic receptors leads to a variety of cholinergic and adrenergic effects; tachycardia or bradycardia mediated by either stimulation or interference with sympathetic or parasympathetic pathways, stimulation of receptors in the carotic and aortic bodies, release of epinephrine from the adrenal medulla, and stimulation of the chemoreceptor-trigger zone.
|
| Pharmacology |
Nicotine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Nicotine, the primary alkaloid in tobacco products binds stereo-selectively to nicotinic-cholinergic receptors on autonomic ganglia, the adrenal medulla, neuromuscular junctions and in the brain. Nicotine exerts two effects, a stimulant effect exerted at the locus ceruleus and a reward effect in the limbic system. Itranvenous administration of nicotine causes release of acetylcholine, norepinephrine, dopamine, serotonine, vasopressin, beta-endorphin and ACTH. Nicotine is a highly addictive substance. Nicotine also induces peripheral vasoconstriction, tachycardia and elevated blood pressure. Nicotine inhalers and patches are used to treat smoking withdrawl syndrome. Nicotine is classified as a stimulant of autonomic ganglia.
|
| Metabolism |
Nicotine¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 2A6 (CYP2A6)Cytochrome P450 2E1 (CYP2E1)Cytochrome P450 2A13 (CYP2A13)Monoamine oxidase type A (MAO-A)Monoamine oxidase type B (MAO-B)Cytochrome P450 2B6 (CYP2B6)
|
| Absorption |
Nicotine¿¡ ´ëÇÑ Absorption Á¤º¸ Absorption of nicotine through the buccal mucosa is relatively slow and the high and rapid rise followed by the decline in nicotine arterial plasma concentrations seen with cigarette smoking are not achieved with the inhaler. About 10% of absorbed nicotine is excreted unchanged in urine.
Nicotine¿¡ ´ëÇÑ Absorption Á¤º¸ Absorption of nicotine through the buccal mucosa is relatively slow and the high and rapid rise followed by the decline in nicotine arterial plasma concentrations seen with cigarette smoking are not achieved with the inhaler. About 10% of absorbed nicotine is excreted unchanged in urine.
Nicotine¿¡ ´ëÇÑ Absorption Á¤º¸ Absorption of nicotine through the buccal mucosa is relatively slow and the high and rapid rise followed by the decline in nicotine arterial plasma concentrations seen with cigarette smoking are not achieved with the inhaler. About 10% of absorbed nicotine is excreted unchanged in urine.
|
| Toxicity |
Nicotine¿¡ ´ëÇÑ Toxicity Á¤º¸ Symptoms of overdose include nausea, abdominal pain, vomiting, diarrhea, diaphoresis, flushing, dizziness, disturbed hearing and vision, confusion, weakness, palpitations, altered respiration and hypotension. LD50= 24 mg/kg (orally in mice).
|
| Drug Interactions |
Nicotine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Nicotine¿¡ ´ëÇÑ Description Á¤º¸ Nicotine is highly toxic alkaloid. It is the prototypical agonist at nicotinic cholinergic receptors where it dramatically stimulates neurons and ultimately blocks synaptic transmission. Nicotine is also important medically because of its presence in tobacco smoke. [PubChem]
|
| Drug Category |
Nicotine¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-craving AgentsAutonomic drugsCentral Nervous System AgentsGanglionic StimulantsNicotinic Agonists
|
| Smiles String Canonical |
Nicotine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CN1CCCC1C1=CN=CC=C1
Nicotine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CN1CCCC1C1=CN=CC=C1
Nicotine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CN1CCCC1C1=CN=CC=C1
|
| Smiles String Isomeric |
Nicotine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CN1CCC[C@@H]1C1=CN=CC=C1
|
| InChI Identifier |
Nicotine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C10H14N2/c1-12-7-3-5-10(12)9-4-2-6-11-8-9/h2,4,6,8,10H,3,5,7H2,1H3
|
| Chemical IUPAC Name |
Nicotine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 3-(1-methylpyrrolidin-2-yl)pyridine
|
| Drug-Induced Toxicity Related Proteins |
NICOTINE ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Cytochrome P450 1A2 Drug:Nicotine Toxicity:tardive dyskinesia in schizophrenia. [¹Ù·Î°¡±â] Replated Protein:Choline O-acetyltransferase Drug:nicotine Toxicity:development of tolerance. [¹Ù·Î°¡±â] Replated Protein:Collagen Drug:nicotine Toxicity:reduced cell proliferation, disrupted cell architecture, disintegration of cells, and extracellular matrix. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2026-03-04
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|