| |
|
|
|
|
|
 |
| |
|
¾ÆÄ«Æ¼³îÁÖ AKATINOL A.IV.[Memantine HCl]
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
[A15300801]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/2ml/1¾ÚÇÃ(2003.10.01)(ÇöÀç¾à°¡)
\1,184 ¿ø/2ml/1¾ÚÇÃ(2001.11.04)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹«»öÀÇ Åõ¸íÇÑ ¾×ÀÌµç °¥»öÀÇ ¾ÚÇà [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
10,50A.IV |
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
1. ³úô¼ö°æ·Ã
2. ÆÄŲ½¼ÁõÈıº
3. ´ë³ú¼Õ»ó¿¡ ÀÇÇÑ ÀǽÄÀå¾Ö(È¥¼ö)
[Drugbank ÀÇ ¼ººÐÁ¤º¸¿¶÷] [Memantine]
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
[ÁÖ¼ººÐÄÚµå:190001BIJ ¿¡ µû¸¥ ½É»çÁöħ¿¶÷]
¼ºÀÎ
¿°»ê¸Þ¸¸Æ¾À¸·Î¼ º¸Åë ùÁÖ¿¡´Â 1ÀÏ 10mgÀ¸·Î ½ÃÀÛÇÏ¿© 1ÁÖ °£°ÝÀ¸·Î 10mg¾¿ Áõ·®ÇÏ¿© À¯Áö·®À¸·Î¼ 1ÀÏ 20-30mgÀ» õõÈ÷ Á¤¸ÆÁÖ»çÇÑ´Ù. ¿¹¹ÎÇÑ °æ¿ì´Â 1ÀÏ 5mgÀ¸·Î ½ÃÀÛÇÏ¿© ÀÇ»çÀÇ Áö½Ã¿¡ µû¶ó 1ÁÖ °£°ÝÀ¸·Î 5mg¾¿ Áõ·®ÇÒ ¼ö ÀÖ´Ù.
4-14¼¼ ¼Ò¾Æ
À¯Áö·®À¸·Î 1ÀÏ Ã¼Áß kg´ç 0.5mgÀ» Á¤¸ÆÁÖ»çÇÑ´Ù.
¿¬·É, Áõ»ó¿¡ µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù.
|
| ±Ý±â |
- ÁßÁõÀÇ °£Áúȯ ȯÀÚ
- ÁßÁõÀÇ ½Å±â´ÉÀå¾Ö ȯÀÚ
- °úµµÇÑ Âø¶õ»óÅÂÀÇ È¯ÀÚ
- °£Áú ȯÀÚ
- ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀÎ, ¼öÀ¯ºÎ
|
| ÀÌ»ó¹ÝÀÀ |
- ÁßÃ߽Űæ°è :
¹ßÀÛÀÇ ¼ÒÀÎÀÌ Àִ ȯÀÚ¿¡¼ °æ·Ã¿ªÄ¡ÀÇ ÀúÇϰ¡ º¸°íµÇ¾î ÀÖ´Ù. ¶§¶§·Î ¾îÁö·¯¿ò, ¼ö¸éÀå¾Ö, ³»Àμº ¹× ¿îµ¿¼º ºÒ¾È, °úµµÇÑ ÈïºÐ, ÇÇ·Î, µÎÅë, µÎÁß µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
¼Òȱâ°è : ±¸¿ª, ±¸°¥µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| »óÈ£ÀÛ¿ë |
- ÀÌ ¾àÀº ¹Ù¸£ºñÅ»°è ¾à¹°, Ç×Á¤½Åº´¾à, Ç×Äݸ°È¿´É¾à, ·¹º¸µµÆÄ ¹× µµÆÄ¹ÎÈ¿´É¾à(ºê·Î¸ðÅ©¸³Æ¾ µî), ¾Æ¸¸Å¸µòÀÇ È¿°ú¿Í ºÎÀÛ¿ëÀ» Áõ°½Ãų ¼ö ÀÖÀ¸¹Ç·Î º´¿ë½Ã¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
- ´ÜÆ®·Ñ·»À̳ª ¹ÙŬ·ÎÆæ°ú º´¿ëÅõ¿©Çϸé ÀÛ¿ëÀÌ º¯°æµÉ ¼ö ÀÖÀ¸¹Ç·Î ¿ë·®Á¶ÀýÀÌ ÇÊ¿äÇÏ´Ù.
|
| Related FDA Approved Drug |
±âÁØ ¼ººÐ: MEMANTINE HYDROCHLORIDENAMENDA (MEMANTINE HYDROCHLORIDE)
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Bµî±Þ
(memantine; )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
ÀÓ»êºÎ ¶Ç´Â ÀӽŰèȹÁß º¹¿ë±ÝÁö |
|
 |
¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Memantine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Memantine exerts its action through uncompetitive NMDA receptor antagonism, binding preferentially to the NMDA receptor-operated cation channels. Prolonged increased levels of glutamate in the brain of demented patients are sufficient to counter the voltage-dependent block of NMDA receptors by Mg2+ ions and allow continuous influx of Ca2+ ions into cells and ultimately neuronal degeneration. Studies suggest that memantine binds more effectively than Mg2+ ions at the NMDA receptor, and thereby effectively blocks this prolonged influx of Ca2+ ions through the NMDA channel whilst preserving the transient physiological activation of the channels by higher concentrations of synaptically released glutamate. Thus memantine protects against chronically elevated concentrations of glutamate.
|
| Pharmacology |
Memantine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Memantine, an amantadine derivative, is an NMDA receptor antagonist used in the treatment of Alzheimer's disease. It differs from traditional agents used in Alzheimer's disease by acting on glutamatergic neurotransmission, rather than cholinergic. There is some evidence that dysfunction of glutamatergic neurotransmission, manifested as neuronal excitotoxicity, is involved in the aetiology of Alzheimer's disease (Cacabelos et al., 1999). As such, targeting the glutamatergic system, specifically NMDA receptors, was a novel approach to treatment in view of the limited efficacy of existing drugs targeting the cholinergic system. A systematic review of randomised controlled trials found that memantine has a positive effect on cognition, mood, behaviour, and the ability to perform daily activities. There is no evidence that memantine prevents or slows neurodegeneration in patients with Alzheimer's disease.
|
| Metabolism |
Memantine¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 2B6 (CYP2B6)
|
| Protein Binding |
Memantine¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 45%
|
| Half-life |
Memantine¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 60-100 hours
|
| Absorption |
Memantine¿¡ ´ëÇÑ Absorption Á¤º¸ Well absorbed orally with a bioavailability of approximately 100%. Peak plasma concentrations are reached in 3-7 hours. Food has no effect on absorption.
|
| Biotransformation |
Memantine¿¡ ´ëÇÑ Biotransformation Á¤º¸ Excreted largely unchanged. About 20% is metabolized to 1-amino-3-hydroxymethyl-5-methyl-adamantane and 3-amino-1-hydroxy-5,7-dimethyl-adamantane.
|
| Toxicity |
Memantine¿¡ ´ëÇÑ Toxicity Á¤º¸ Side effects include pain, abnormal crying, leg pain, fever, increased apetite. Adverse drug reactions include: dizziness, confusion, headache, hallucinations, tiredness. Less common side effects include: vomiting, anxiety, hypertonia, cystitis, and increased libido. Doses of up to 400 mg have been tolerated.
|
| Drug Interactions |
Memantine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Acetazolamide Possible increased levels of memantineDichlorphenamide Possible increased levels of memantineMethazolamide Possible increased levels of memantineSodium bicarbonate Possible increased levels of memantineAmantadine Increased risk of CNS adverse effects with this associationDextromethorphan Increased risk of CNS adverse effects with this associationKetamine Increased risk of CNS adverse effects with this association
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Memantine¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take without regard to meals.
|
| Drug Target |
[Drug Target]
|
| Description |
Memantine¿¡ ´ëÇÑ Description Á¤º¸ Amantadine derivative that has some dopaminergic effects. It has been proposed as an antiparkinson agent. [PubChem]
|
| Drug Category |
Memantine¿¡ ´ëÇÑ Drug_Category Á¤º¸ AntidyskineticsAntiparkinson AgentsCentral Nervous System AgentsDopamine AgentsExcitatory Amino Acid Antagonists
|
| Smiles String Canonical |
Memantine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC12CC3CC(C)(C1)CC(N)(C3)C2
|
| Smiles String Isomeric |
Memantine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@@]12C[C@H]3C[C@@](C)(C1)C[C@](N)(C3)C2
|
| InChI Identifier |
Memantine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C12H21N/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10/h9H,3-8,13H2,1-2H3
|
| Chemical IUPAC Name |
Memantine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 3,5-dimethyladamantan-1-amine
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2015-01-16
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|