| |
|
|
|
|
|
 |
| |
|
³ë¸£ÇÁ·ÎÁ¡¾È¾×(³ë¸£Ç÷ϻç½Å)
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
657300130[W21060021]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1ml(2016.10.01)(ÇöÀç¾à°¡)
\404 ¿ø/1ml(2014.03.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
Â÷±¤ ¿ë±â¿¡ µç ¹«»ö ³»Áö ¹ÌȲ»öÀÇ Åõ¸íÇÑ Á¡¾È¾× [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
Á¦Á¶¿ø |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 5¹Ð¸®¸®ÅÍ |
1 °³ |
º´ |
8806573001305 |
8806573001312 |
|
|
| ÁÖ¼ººÐÄÚµå |
482601COS
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
1. À¯È¿±ÕÁ¾
Æ÷µµ±¸±Õ¼Ó, ¿¬¼â±¸±Õ¼Ó, Æó·Å±¸±Õ, À屸±Õ¼Ó, ÄÚ¸®³×¹ÚÅ׸®¿ò¼Ó, ¼Ò±¸±Õ¼Ó, °£±Õ¼Ó, ºê¶õÇϸá¶óīŸ¸±¸®½º, Ŭ·¾½Ã¿¤¶ó¼Ó, ¿£Å׷ιÚÅͼÓ, ¼¼¶óƼ¾Æ¼Ó, ÇÁ·ÎÅ׿콺¼Ó, ½´µµ¸ð³ª½º¼Ó, ³ì³ó±Õ, Çö󺸹ÚÅ׸®¿ò¼Ó, Ç÷È£±Õ¼Ó(ÀÎÇ÷翣ÀÚ±Õ, Haemophilus aegypticus(Koch-Weeks)), ¸ð¶ô¼¿¶ó¼Ó, ¾Æ½Ã³×Åä¹ÚÅͼÓ, ¾ËÄ®¸®°Ô³×½º¼Ó
2. ÀûÀÀÁõ
´«²¨Ç®¿°, ´Ù·¡³¢, ´«¹°ÁÖ¸Ó´Ï¿°, °á¸·¿°, °ËÆÇ¼±¿° °¢¸·¿°, °¢¸·±Ë¾ç, ¼ö¼ú ÈÄ °¨¿°Áõ
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¼ºÀÎ : 1ȸ 1¹æ¿ï 1ÀÏ 3ȸ Á¡¾ÈÇÑ´Ù.
|
| ÁÖ¿ä¾à¹° »óÈ£ÀÛ¿ë |
[Á¶È¸]
|
| ±Ý±â |
1) ÀÌ ¾à ¶Ç´Â Äû³î·Ð°è Ç×±ÕÁ¦¿¡ °ú¹Î¹ÝÀÀ ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ
2) ÀӺΠ¹× ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ¿©¼º, ¼öÀ¯ºÎ
|
| ÀÌ»ó¹ÝÀÀ |
1) ÇǺιßÁø µîÀÇ °ú¹Î¹ÝÀÀÀÌ ³ªÅ¸³¯ °æ¿ì »ç¿ëÀ» ÁßÁöÇÑ´Ù.
2) ´« : °¢¸· Ä§Âø¹°, ¶§¶§·Î µû°¡¿ò µîÀÇ ¾ÈÀÚ±ØÁõ»ó, µå¹°°Ô ´«ÀÇ °¡·Á¿ò, °á¸·ÃæÇ÷, ´«²¨Ç®Á¾Ã¢․¹ßÀû, Ç¥À缺°¢¸·¿°, °¢¸·»óÇǹڸ®, īŸ¸£¼º °á¸·¿° µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ÀÌ¿Í °°Àº Áõ»óÀÌ ³ªÅ¸³ª¸é »ç¿ëÀ» ÁßÁöÇϰí ÀûÀýÇÑ Á¶Ä¡¸¦ ÃëÇÑ´Ù.
3) ÀÌ ¾à ¼ººÐÀ» Æ÷ÇÔÇÑ Àü½ÅÀû Åõ¿©°æ·ÎÀÇ Äû³î·Ð°è ¾à¹°Àº ½ÉÁö¾î 1ȸ Åõ¿©¿¡ ÀÇÇØ¼µµ °ú¹Î¹ÝÀÀÀÇ ¹ß»ýÀÌ º¸°íµÇ¾ú´Ù. ¹ßÀû ¶Ç´Â ¾Ë·¹¸£±â ¹ÝÀÀÀÇ Ãʱâ ¡Èİ¡ ³ªÅ¸³ª¸é ¾à¹° Åõ¿©¸¦ Áï½Ã Áß´ÜÇϰí ÀÇ»ç¿Í »óÀÇÇÑ´Ù.
4) ³ë¸£Ç÷ϻç½Å °æ±¸¿ë Á¦Á¦¿¡¼ µå¹°°Ô ¼îÅ©°¡ ³ªÅ¸³ª´Â °æ¿ì°¡ ÀÖÀ¸¸ç ¹ßÁø․¹ßÀû, °¡·Á¿ò, µå¹°°Ô ºÎÁ¾, ¹ß¿, ±¤¹Î°¨¹ÝÀÀ µîÀÌ ³ªÅ¸³µ´Ù´Â º¸°í°¡ ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³ª´Â °æ¿ì Åõ¿©¸¦ ÁßÁöÇϰí ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù.
5) º¸Á¸Á¦ÀÎ ¿°Èº¥ÀßÄÚ´½À¸·Î ÀÎÇÏ¿© Á¢Ã˼º ÇǺο°, ¿°ÁõÀÌ »ý±æ ¼ö ÀÖ´Ù(¿°Èº¥ÀßÄÚ´½ ÇÔÀ¯Á¦Á¦¿¡ ÇÑÇÔ.).
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
ÀÓ»êºÎ ¶Ç´Â ÀӽŰèȹÁß º¹¿ë±ÝÁö |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| Á¦Çüº° º¹¾àÁöµµ |
[Á¡¾È¾×] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Norfloxacin¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ The bactericidal action of Norfloxacin results from inhibition of the enzymes topoisomerase II (DNA gyrase) and topoisomerase IV, which are required for bacterial DNA replication, transcription, repair, and recombination. Norfloxacin is a broad-spectrum antibiotic that is active against both gram-positive and gram-negative bacterias. The fluorine atom at the 6 position increases potency against gram-negative organisms, and the piperazine moiety at the 7 position is responsible for anti-pseudomonal activity
|
| Pharmacology |
Norfloxacin¿¡ ´ëÇÑ Pharmacology Á¤º¸ Norfloxacin is a quinolone/fluoroquinolone antibiotic. Norfloxacin is bactericidal and its mode of action depends on blocking of bacterial DNA replication by binding itself to an enzyme called DNA gyrase, which allows the untwisting required to replicate one DNA double helix into two. Notably the drug has 100 times higher affinity for bacterial DNA gyrase than for mammalian.
|
| Absorption |
Norfloxacin¿¡ ´ëÇÑ Absorption Á¤º¸ Rapid
|
| Pharmacokinetics |
NorfloxacinÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : °æ±¸ : ºü¸£°Ô Èí¼öµÈ´Ù.
- »ýü³»ÀÌ¿ë·ü : 40%±îÁö
- ºÐÆ÷ : ŹÝÅë°ú, ¼Ò·®ÀÌ À¯Áó ºÐºñ
- ´Ü¹é°áÇÕ : 15%
- ´ë»ç : °£´ë»ç
- ¹Ý°¨±â : 4.8½Ã°£, ½ÅÀå¾Ö½Ã Áõ°¡
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : 1-2½Ã°£ À̳»
- ¼Ò½Ç : ½Å¹è¼³ ¹× º¯¹è¼³ (30%)
|
| Drug Interactions |
Norfloxacin¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Aluminium Formation of non-absorbable complexesBismuth Formation of non-absorbable complexesCalcium Formation of non-absorbable complexesMagnesium oxide Formation of non-absorbable complexesMagnesium Formation of non-absorbable complexesIron Formation of non-absorbable complexesZinc Formation of non-absorbable complexesSucralfate Formation of non-absorbable complexesTheophylline The quinolone increases the effect of theophyllineOxtriphylline The quinolone increases the effect of theophyllineAminophylline The quinolone increases the effect of theophyllineDyphylline The quinolone increases the effect of theophyllineAnisindione The quinolone increases the anticoagulant effectAcenocoumarol The quinolone increases the anticoagulant effectDicumarol The quinolone increases the anticoagulant effectWarfarin The quinolone increases the anticoagulant effectCaffeine The quinolone increases the effect and toxicity of caffeineCyclosporine The quinolone increases the effect and toxicity of cyclosporineClozapine Ciprofloxacin may increase clozapine serum levelsFoscarnet Increased risk of convulsions
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Norfloxacin¿¡ ´ëÇÑ Description Á¤º¸ A synthetic fluoroquinolone (fluoroquinolones) with broad-spectrum antibacterial activity against most gram-negative and gram-positive bacteria. Norfloxacin inhibits bacterial DNA gyrase. [PubChem]
|
| Drug Category |
Norfloxacin¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Bacterial AgentsAnti-InfectivesEnzyme InhibitorsNucleic Acid Synthesis InhibitorsQuinolones
|
| Smiles String Canonical |
Norfloxacin¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CCN1C=C(C(O)=O)C(=O)C2=CC(F)=C(C=C12)N1CCNCC1
|
| Smiles String Isomeric |
Norfloxacin¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CCN1C=C(C(O)=O)C(=O)C2=CC(F)=C(C=C12)N1CCNCC1
|
| InChI Identifier |
Norfloxacin¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C16H18FN3O3/c1-2-19-9-11(16(22)23)15(21)10-7-12(17)14(8-13(10)19)20-5-3-18-4-6-20/h7-9,18H,2-6H2,1H3,(H,22,23)/f/h22H
|
| Chemical IUPAC Name |
Norfloxacin¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2026-03-04
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|