| |
|
|
|
|
|
 |
| |
|
ºÎ±¤´õ¸ðÇȽº°Ö(Áú»ê¼¼¸£Å¸ÄÚ³ªÁ¹) BUKWANG DERMOFIX GEL
|
|
ÀϹÝÀǾàǰ | »èÁ¦
|
|
¼öÀÔÀǾàǰ
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
642200610[W20950071]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1g(2012.11.01)(ÇöÀç¾à°¡)
\184 ¿ø/1g(2011.02.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
Æú¸®¿¡Ä¥·»º´¿¡ µé¾îÀÖ´Â, »óÄèÇÑ ÇâÀÌ ³ª´Â ¿¯Àº È£¹Ú»öÀÇ Åõ¸íÇÑ °Ö [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
100g/1Åë |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 100±×·¥ |
1 °³ |
º´ |
8806422006109 |
8806422006116 |
|
|
| ÁÖ¼ººÐÄÚµå |
226901CCM
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
È¿¸ð±Õ (pityrosporum)¿¡ ÀÇÇÑ ºñµë
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
µÎÇÇ¿Í ¸Ó¸®Ä«¶ô¿¡ º»Á¦¸¦ ±ÕÀÏÇÏ°Ô ¹Ù¸£°í, ÀÏ¹Ý ¼¤ÇªÃ³·³ 3-5ºÐ °£ Àû¿ëÇÑ ÈÄ¿¡ Çó±¸¾î ³½´Ù.
¸ÅÁÖ 2ȸ¾¿, 2-4ÁÖ°£ »ç¿ëÇÑ´Ù.
|
| ±Ý±â |
´ÙÀ½°ú °°Àº »ç¶÷Àº ÀÌ ¾àÀ» »ç¿ëÇÏÁö ¸» °Í
ÀÌ ¾àÀÇ ¼ººÐ¿¡ °ú¹ÎÁõÀÌ ÀÖ´Â »ç¶÷.
|
| ½ÅÁßÅõ¿© |
´ÙÀ½°ú °°Àº »ç¶÷Àº ÀÌ ¾àÀ» »ç¿ëÇϱâ Àü¿¡ ÀÇ»ç ¹× ¾à»ç¿Í »óÀÇÇÒ °Í
°¡. ÀӺΠ¹× ¼öÀ¯ºÎ : ¸¹Àº ¾çÀ» ±¹¼ÒºÎÀ§¿¡ »ç¿ëÇØµµ Ç÷Àå¿¡¼ °ËÃâµÇÁö ¾ÊÀ¸³ª, ¹«ÇؼºÀÌ °ËÁõµÇÁö ¾Ê¾ÒÀ¸¹Ç·Î, Ä¡·á »óÀÇ À¯ÀͼºÀÌ À§Ç輺À» »óȸÇÑ´Ù°í ÆÇ´ÜµÇ´Â °æ¿ì¿¡ ÀÇ»ç ¹× ¾à»çÀÇ ÆÇ´Ü ÇÏ¿¡ Åõ¿©ÇÑ´Ù.
³ª. À̴̹ÙÁ¹°è Ç×Áø±ÕÁ¦¿¡ °ú¹Î¼ºÀÌ ÀÖ´Â »ç¶÷.
±âŸ ÀÌ ¾àÀÇ »ç¿ë ½Ã ÁÖÀÇÇÒ »çÇ×
°¡. ÀÌ ¾àÀº ¼Ò¾Æ¿¡ ´ëÇÑ ¾ÈÀü¼º ¹× À¯È¿¼ºÀº È®¸³µÇ¾î ÀÖÁö ¾Ê´Ù.
³ª. ÀÌ ¾àÀ» ´«, ÄÚ, ÀÔ µî Á¡¸·¿¡ »ç¿ëÇÏÁö ¸» °Í.
´Ù. Ä¡·á ù³¯ ¾àÇÑ Àϰú¼ºÀÇ ¹ßÁøÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸³ª, Ä¡·á¸¦ Áß´ÜÇÒ ÇÊ¿ä´Â ¾ø´Ù.
¶ó. »óó ¶Ç´Â ¿°ÁõÀÌ ÀÖ´Â µÎÇÇ ¹× ½ÉÇÑ ¹Ì¶õ (Áþ¹«¸§) ºÎÀ§¿¡´Â »ç¿ëÇÏÁö ¾Ê´Â´Ù.
¸¶. ÀÌÀü¿¡ º¸°íµÈ ÀûÀÌ ¾ø´Â ´Ù¸¥ ÀÌ»ó¹ÝÀÀÀÌ ³ªÅ¸³ª¸é, Àǻ糪 ¾à»ç¿Í »ó´ãÇØ¾ß ÇÑ´Ù.
¹Ù. Ä¡·á 4ÁÖÈÄ¿¡µµ ÀÓ»óÀûÀÎ °³¼±ÀÌ ³ªÅ¸³ªÁö ¾ÊÀ¸¸é, ´Ù¸¥ ±ÕÀÇ °¨¿°À» Àç°íÇØºÁ¾ß ÇÑ´Ù.
|
| ÀÌ»ó¹ÝÀÀ |
´ÙÀ½°ú °°Àº °æ¿ì ÀÌ ¾àÀÇ »ç¿ëÀ» Áï°¢ ÁßÁöÇϰí ÀÇ»ç ¹× ¾à»ç¿Í »óÀÇÇÒ °Í
°¡. ¹ßÀû, ÀÛ¿°¨, ¼Ò¾çÁõ, ¹ÚÇÇ °°Àº ÇǺΠÀÚ±ØÀÌ ³ªÅ¸³ °æ¿ì.
³ª. ÁÖ¼ººÐÀÇ ³óµµ¿Í Åõ¿©¹æ¹ý(°æ·Î)À» °í·ÁÇÒ ¶§ ¾à¹°Áßµ¶ÀÌ ÀϾ´Â °ÍÀº ºÒ°¡´ÉÇϳª, ¿ì¹ßÀûÀ¸·Î º¹¿ëÇÑ °æ¿ì¿¡´Â Áõ»ó¿¡ µû¶ó ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÏ¿©¾ß ÇÑ´Ù.
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
(sertaconazole; )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Sertaconazole¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Sertaconazole interacts with 14-¥á demethylase, a cytochrome P-450 enzyme necessary to convert lanosterol to ergosterol. As ergosterol is an essential component of the fungal cell membrane, inhibition of its synthesis results in increased cellular permeability causing leakage of cellular contents. Sertaconazole may also inhibit endogenous respiration, interact with membrane phospholipids, inhibit the transformation of yeasts to mycelial forms, inhibit purine uptake, and impair triglyceride and/or phospholipid biosynthesis.
|
| Pharmacology |
Sertaconazole¿¡ ´ëÇÑ Pharmacology Á¤º¸ Sertaconazole is an imidazole/triazole type antifungal agent. Sertaconazole is a highly selective inhibitor of fungal cytochrome P-450 sterol C-14 ¥á-demethylation via the inhibition of the enzyme cytochrome P450 14¥á-demethylase. This enzyme converts lanosterol to ergosterol, and is required in fungal cell wall synthesis. The subsequent loss of normal sterols correlates with the accumulation of 14 ¥á-methyl sterols in fungi and may be partly responsible for the fungistatic activity of fluconazole. Mammalian cell demethylation is much less sensitive to fluconazole inhibition. Sertaconazole exhibits in vitro activity against Cryptococcus neoformans and Candida spp. Fungistatic activity has also been demonstrated in normal and immunocompromised animal models for systemic and intracranial fungal infections due to Cryptococcus neoformans and for systemic infections due to Candida albicans.
|
| Protein Binding |
Sertaconazole¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ >99% to plasma
|
| Absorption |
Sertaconazole¿¡ ´ëÇÑ Absorption Á¤º¸ Bioavailability is negligible.
|
| Description |
Sertaconazole¿¡ ´ëÇÑ Description Á¤º¸ Sertaconazole nitrate is an antifungal medication of the imidazole class. It is available as a cream to treat skin infections such as athlete's foot. [Wikipedia]
|
| Drug Category |
Sertaconazole¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antifungal Agents
|
| Smiles String Canonical |
Sertaconazole¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ ClC1=CC(Cl)=C(C=C1)C(CN1C=CN=C1)OCC1=CSC2=C1C=CC=C2Cl
|
| Smiles String Isomeric |
Sertaconazole¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ ClC1=CC(Cl)=C(C=C1)[C@@H](CN1C=CN=C1)OCC1=CSC2=C1C=CC=C2Cl
|
| InChI Identifier |
Sertaconazole¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C20H15Cl3N2OS/c21-14-4-5-16(18(23)8-14)19(9-25-7-6-24-12-25)26-10-13-11-27-20-15(13)2-1-3-17(20)22/h1-8,11-12,19H,9-10H2
|
| Chemical IUPAC Name |
Sertaconazole¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 1-[2-[(7-chloro-1-benzothiophen-3-yl)methoxy]-2-(2,4-dichlorophenyl)ethyl]imidazole
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2020-05-11
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|