| |
|
|
|
|
|
 |
| |
|
À£ÇÇ¿ÂÁ¤(µð¿¡Æ¿ÇÁ·ÎÇǿ¿°»ê¿°) WELLPION TAB.
|
Àü¹®ÀǾàǰ | ºñ±Þ¿©
|
|
|
ÇâÁ¤ÀǾàǰ | °íÀ§Çè¾à¹°
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
 | º´¿ë±Ý±â |
|
|
|
|
|
|
 |
Á¦Ç°º° ¿¬·É±Ý±â °í½Ã |
|
|
| ¼ººÐ¸í |
¼ººÐÄÚµå |
ƯÁ¤¿¬·É |
°í½Ã¹øÈ£ |
°í½ÃÀÏÀÚ |
ºñ°í |
| diethylpropion hydrochloride |
551601ATB |
16 ¼¼ ÀÌÇÏ |
20090300 |
2009-12-03 |
¾ÈÀü¼º ¹× À¯È¿¼º ¹ÌÈ®¸³ |
|
|
 |
Á¦Ç°º° ÀӺαݱ⠰í½Ã |
|
|
|
1µî±Þ: ¿øÄ¢Àû »ç¿ë±Ý±â / 2µî±Þ: ¸íÈ®ÇÑ ÀÓ»óÀû ±Ù°Å ¶Ç´Â »çÀ¯°¡ ÀÖ´Â °æ¿ì ºÎµæÀÌÇÏ°Ô »ç¿ë / Mµî±Þ: ÀÓ»óÀû»óȲ¿¡ µû¶ó 1µî±Þ ¶Ç´Â 2µî±ÞÀ¸·Î ºÐ·ùµÇ´Â ¼ººÐ
| ¼ººÐ¸í |
¼ººÐÄÚµå |
±Ý±âµî±Þ |
°í½Ã¹øÈ£ |
°í½ÃÀÏÀÚ |
ºñ°í |
| diethylpropion hydrochloride |
551601ATB |
1 |
20190041 |
20190522 |
ÀӽŠÁß º¹¿ëÀ¸·Î ½Å»ý¾Æ¿¡°Ô ±Ý´ÜÁõ»óÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ½. ÀÌ ¾à°úÀÇ ¿¬°ü¼ºÀº È®¸³µÇ¾î ÀÖÁö ¾ÊÀ¸³ª, ¼±Ãµ¼º ±âÇü¿¡ ´ëÇÑ ÀÚ¹ßÀû º¸°í°¡ ÀÖ¾úÀ½. °í¿ë·® Åõ¿©´Â ¸ðü, ¹è¾Æ¿¡ µ¶¼ºÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ½ |
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
670601800
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
[ºñ±Þ¿©]
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
Èò»öÀÇ ¸¶¸§¸ðÇü Á¤Á¦ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
ÀÚ»çÆ÷Àå´ÜÀ§¿¡ µû¸§ |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 25¹Ð¸®±×·¥ |
30 Á¤ |
PTP |
8806706018002 |
8806706018033 |
|
| 25¹Ð¸®±×·¥ |
100 Á¤ |
º´ |
8806706018002 |
8806706018026 |
|
| 25¹Ð¸®±×·¥ |
30 Á¤ |
º´ |
8806706018002 |
8806706018019 |
|
|
| ÁÖ¼ººÐÄÚµå |
551601ATB
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
ÀûÀýÇÑ Ã¼Áß°¨·®¿ä¹ý(½ÄÀÌ¿ä¹ý ¹×/¶Ç´Â ¿îµ¿)¿¡ ¹ÝÀÀÇÏÁö ¾Ê´Â Ãʱâ üÁú·®Áö¼ö(Body Mass Index : BMI)°¡ 30 kg/m2 ÀÌ»ó ¶Ç´Â ´Ù¸¥ À§ÇèÀÎÀÚ(¿¹, °íÇ÷¾Ð, ´ç´¢, °íÁöÇ÷Áõ)°¡ ÀÖ´Â BMI 27 kg/m2 ÀÌ»óÀÎ ºñ¸¸È¯ÀÚ¿¡¼ Ä®·Î¸® Á¦ÇÑÀ» ±âº»À¸·Î Çϴ üÁß°¨·® ¿ä¹ýÀÇ ´Ü±â°£ º¸Á¶¿ä¹ý
ÀÌ ¾àÀº ´Ù¸¥ ½Ä¿å¾ïÁ¦Á¦¿Í º´¿ëÇÏÁö ¾Ê°í ´Üµ¶À¸·Î¸¸ »ç¿ëÇØ¾ß ÇÑ´Ù.
¾Æ·¡´Â ´Ù¾çÇÑ Å°¿Í üÁß¿¡ ±Ù°ÅÇÑ Ã¼Áú·®Áö¼öÇ¥ÀÌ´Ù. üÁú·®Áö¼ö´Â ȯÀÚÀÇ Ã¼Áß(kg)À» ȯÀÚÀÇ Å°(m)ÀÇ Á¦°öÀ¸·Î ³ª´©¾î °è»êµÈ´Ù.
Ç¥ 1. üÁú·®Áö¼ö(BMI, kg/m2)
| üÁß (kg) |
Ű (cm) |
| 150 |
160 |
170 |
175 |
180 |
185 |
190 |
| 60 |
26.7 |
23.4 |
20.8 |
19.6 |
18.5 |
17.5 |
16.6 |
| 65 |
28.9 |
25.4 |
22.5 |
21.2 |
20.1 |
19.0 |
18.0 |
| 70 |
31.1 |
27.3 |
24.2 |
22.9 |
21.6 |
20.5 |
19.4 |
| 75 |
33.3 |
29.3 |
26.0 |
24.5 |
23.1 |
21.9 |
20.8 |
| 80 |
35.6 |
31.3 |
27.7 |
26.1 |
24.7 |
23.4 |
22.2 |
| 85 |
37.8 |
33.2 |
29.4 |
27.8 |
26.2 |
24.8 |
23.5 |
| 90 |
40.0 |
35.2 |
31.1 |
29.4 |
27.8 |
26.3 |
24.9 |
| 95 |
42.2 |
37.1 |
32.9 |
31.0 |
29.3 |
27.8 |
26.3 |
| 100 |
44.4 |
39.1 |
34.6 |
32.7 |
30.9 |
29.2 |
27.7 |
| 105 |
46.7 |
41.0 |
36.3 |
34.3 |
32.4 |
30.7 |
29.1 |
| 110 |
48.9 |
43.0 |
38.1 |
35.9 |
34.0 |
32.1 |
30.5 |
| 120 |
53.3 |
46.9 |
41.5 |
39.2 |
37.0 |
35.1 |
33.2 |
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¼ºÀÎ : µð¿¡Æ¿ÇÁ·ÎÇǿ¿°»ê¿°À¸·Î¼ 1ȸ 25 mgÀ» 1ÀÏ 3ȸ, ½Ä»ç 1½Ã°£ Àü¿¡ °æ±¸Åõ¿©ÇÑ´Ù.
1ÀÏ ÃÖ´ë¿ë·®Àº 75 mgÀ̸ç, ´Ê¾îµµ ÀáÀÚ±â 4½Ã°£ ÀÌÀü¿¡´Â º¹¿ëÇØ¾ß ÇÑ´Ù.
³²¿ë °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© Ãʱâ(2ÁÖ À̳») Åõ¿©·®Àº °¡´ÉÇÑ ÃÖ¼Ò·®À» ó¹æÇϰųª Á¶Á¦Ç쵂 ÀûÀýÇÑ ¹ÝÀÀÀ» ¾òÀ» ¼ö ÀÖµµ·Ï °³Àκ°·Î Á¶Á¤ÇÏ¿©¾ß ÇÑ´Ù.
ÀÌ ¾àÀº ´Ü±â°£(4ÁÖ À̳») µ¿¾È Åõ¿©ÇÑ´Ù. ´Ü, ÀÌ ¾àÀÇ ºÎÀûÀýÇÑ »ç¿ë°ú À§ÇèÀ» ÁÙÀ̱â À§Çؼ ȯÀÚ°¡ ù 4ÁÖ À̳»¿¡ ¸¸Á·ÇÒ ¸¸ÇÑ Ã¼Áß°¨·®À» ¾ò¾úÀ» °æ¿ì(ÃÖ¼Ò 1.8 kg ÀÌ»ó üÁß °¨·®ÀÌ Àְųª ÀÇ»ç¿Í ȯÀÚ ¸ðµÎ ¸¸Á·ÇÒ¸¸ÇÑ Ã¼Áß°¨·®ÀÌ ÀÖ´Ù°í ÆÇ´ÜÇÏ¿´À» ¶§)¿¡´Â ÀÌ ¾àÀ¸·Î Ä¡·á¸¦ Áö¼ÓÇÒ ¼ö ÀÖ´Ù.
|
| ±Ý±â |
1) MAO¾ïÁ¦Á¦¸¦ º¹¿ëÁßÀ̰ųª ¶Ç´Â º¹¿ëÈÄ 14ÀÏÀÌ °æ°úÇÏÁö ¾ÊÀº ȯÀÚ(Ç÷¾Ð»ó½Â À§Çè À¯¹ß)
2) Æóµ¿¸Æ °íÇ÷¾Ð ȯÀÚ¸¦ Æ÷ÇÔÇÏ´Â ÁßÁõÀÇ °íÇ÷¾Ð ȯÀÚ
3) ³ì³»Àå ȯÀÚ
4) °©»ó»ùÇ×Áø ȯÀÚ
5) ÁøÀüµÈ µ¿¸Æ°æÈÁõ ȯÀÚ
6) µ¿¸ÆÆó»ö ȯÀÚ
7) ±âÁöÀÇ ½ÉÀåÀâÀ½ ¶Ç´Â ÆÇ¸·½ÉÀ庴 ȯÀÚ
8) ³»Àμº ¿ì¿ïÁõ ȯÀÚ
9) Á¤½ÅÀûÀ¸·Î ¸Å¿ì ºÒ¾ÈÇϰųª ÈïºÐ»óÅ¿¡ Àִ ȯÀÚ
10) ±³°¨½Å°æ ÈïºÐ¼º ¾Æ¹Î·ù¿¡ °ú¹ÎÇϰųª ƯÀÌüÁúÀΠȯÀÚ
11) ¾à¹°‧¾ËÄÚ¿Ã ³²¿ëÀÇ º´·ÂÀÌ Àְųª ±×·² °¡´É¼ºÀÌ Àִ ȯÀÚ
12) ³úÁ¹Áß ÀÌÈÄ »óÅÂÀΠȯÀÚ
13) ´Ù¸¥ ½Ä¿å¾ïÁ¦Á¦¸¦ º¹¿ëÇϰí Àִ ȯÀÚ(½É°¢ÇÑ ½ÉÀå°ü·Ã ¹®Á¦°¡ ¹ß»ýÇÒ ¼ö ÀÖ´Ù.)
14) ºÎÁ¤¸ÆÀ̳ª °íÇ÷¾ÐÀ» Æ÷ÇÔÇÏ´Â ÁßÁõÀÇ ½ÉÁúȯ ȯÀÚ
15) Å©·Òģȼ¼Æ÷Á¾ ȯÀÚ
16) 16¼¼ ÀÌÇÏÀÇ ¼Ò¾Æ
|
| ½ÅÁßÅõ¿© |
1) °æÁõÀÇ ½ÉÇ÷°ü ÁúȯÀ̳ª °æÁõ ¢¦ ÁߵÀÇ °íÇ÷¾Ð ȯÀÚ(ÀÌ ¾àÀ» Åõ¿©ÇÒ ¶§ ȯÀÚÀÇ ½ÉÇ÷°ü ±â´É°ú Ç÷¾ÐÀ» Á¤±âÀûÀ¸·Î °üÂûÇÏ¿©¾ß ÇÑ´Ù.)
2) °£Áú ȯÀÚ(°æ·Ã ¹ß»ýºóµµ¸¦ Áõ°¡½Ãų ¼ö ÀÖÀ¸¹Ç·Î ÀÌ ¾àÀ» Åõ¿©ÇÏ´Â µ¿¾È °£ÁúÀ» ÁÖÀÇ ±í°Ô °üÂûÇÏ¿©¾ß ÇÑ´Ù. ÇÊ¿äÇÑ °æ¿ì ¿ë·®À» ÀûÁ¤Çϰųª ¾à¹°À» Áß´ÜÇÒ ¼ö ÀÖ´Ù.)
3) ÀÜ´¢ Çü¼ºÀ» ¼ö¹ÝÇÏ´Â Àü¸³»ù ¼±Á¾ ȯÀÚ
4) ´ç´¢º´À» Æ÷ÇÔÇÑ ½ÅÁø´ë»ç Áúȯ ȯÀÚ
5) Àü½Å¸¶Ã븦 ÇÏ´Â °æ¿ì
|
| ÀÌ»ó¹ÝÀÀ |
°¡Àå ºó¹øÇÑ ÀÌ ¾àÀÇ ÀÌ»ó¹ÝÀÀÀ¸·Î´Â ºÒ¸é, ½Å°æÁú, ¾îÁö·³, ºÒ¾È, ÃÊÁ¶ ¹× ±¸°¥ µîÀÌ ÀÖ´Ù. ¿ªÇÐÁ¶»ç¿¡¼ 3°³¿ù ÀÌ»ó ½Ä¿å¾ïÁ¦Á¦¸¦ »ç¿ë ÇßÀ» ¶§ ¿ø¹ß¼º Æóµ¿¸Æ °íÇ÷¾ÐÀÌ ¹ß»ýÇÒ À§ÇèÀÌ Áõ°¡µÈ´Ù°í ³ªÅ¸³µ´Ù.
1) ½ÉÇ÷°ü°è : ºó¸Æ, ¸íÄ¡µ¿Åë, ºÎÁ¤¸Æ(½É½ÇºÎÁ¤¸Æ Æ÷ÇÔ), ½É°èÇ×Áø, Ç÷¾Ð»ó½Â, ½ÉÀüµµ º¯È, ÀÌ ¾àÀ» º¹¿ëÇÑ °Ç°ÇÑ ÀþÀº ³²ÀÚÀÇ ECG(½ÉÀüµµ)¿¡¼ T-ÆÄÀÇ º¯È°¡ º¸°íµÇ¾ú´Ù. ÀÌ ¾àÀÇ º¹¿ë°ú °ü·ÃÀÌ ÀÖ´Â ¿ø¹ß¼º Æóµ¿¸Æ °íÇ÷¾Ð¿¡ ´ëÇÑ º¸°í°¡ ÀÖ´Ù. µå¹°°Ô ÆÇ¸·½ÉÀ庴ÀÌ º¸°íµÇ¾úÀ¸³ª ÀÌ ¾à°úÀÇ Àΰú °ü°è´Â È®½ÇÇÏÁö ¾Ê´Ù.
2) ÁßÃ߽Űæ°è : ¿îµ¿ÀÌ»óÁõ, Èå·Áº¸ÀÓ, °úÀÚ±Ø, ½Å°æÁú, ¾ÈÀýºÎÀý, ¾îÁö·³, ÃÊÁ¶, ºÒ¸é, ºÒ¾È, ÀÌ»óȲȦ°¨, ºÒÄè°¨, ¶§·Î ¿ì¿ïÁõ, ÁøÀü, µ¿°øÈ®´ë, Á¹À½, ±Çۨ, µÎÅë, ³úÇ÷°ü»ç°í, Á¤½Åº´Àû ¿¡ÇǼҵå, °æ·Ã¼º Àå¾Ö Áõ°¡
3) ¼Òȱâ°è : ¼³»ç, º¯ºñ, ±¸¿ª, ±¸Åä, º¹ºÎºÒÄè°¨, º¹Åë, ºÒÄèÇÑ ¸À, ±¸°¥, ±¸°°ÇÁ¶Áõ, ±¸³»¿°, ±âŸ À§ÀåÀå¾Ö
4) ¾Ë·¹¸£±â : µÎµå·¯±â, ¹ßÁø, ¹Ý»óÃâÇ÷, È«¹Ý
5) ³»ºÐºñ°è : ¹ß±âºÎÀü, ¿ù°æÅë, ¼º¿åº¯È, ¿ù°æ°ï¶õ, ¿©¼ºÇüÀ¯¹æ
6) Ç÷¾×°è : °ñ¼ö±â´É¾ïÁ¦, ¹éÇ÷±¸°¨¼ÒÁõ, ¹«°ú¸³±¸Áõ, ÀúÇ÷¼ÒÆÇÁõ
7) ±âŸ : È£Èí°ï¶õ, ¸ð¹ß°¨¼Ò, ±ÙÀ°Åë, ¹è´¢Àå¾Ö, ´Ù´¢Áõ, ¹ßÇÑ, Ç÷°üºÎÁ¾
|
| »óÈ£ÀÛ¿ë |
1) ºÎÁ¤¸ÆÀº Àü½Å¸¶ÃëÁ¦¿Í µ¿½Ã¿¡ Åõ¿©µÇ´Â ¸î¸î ±³°¨½Å°æÀÛ¿ë ¾à¹°°ú °ü·ÃÀÌ ÀÖÀ¸¹Ç·Î ÀÌ ¾àÀ» º¹¿ëÇϰí Àִ ȯÀÚ°¡ Àü½Å¸¶Ã븦 ÇÏ´Â °æ¿ì¿¡ ÁÖÀÇÇÏ¿©¾ß ÇÑ´Ù.
2) ÀÌ ¾àÀº ÁßÃ߽Űæ°è¿¡ ÀÛ¿ëÇÏ´Â ´Ù¸¥ ¾à¹°µéÀÇ È¿°ú¸¦ º¯È½Ãų ¼ö ÀÖ´Ù.
3) ½ÄÀÌ¿ä¹ý°ú ÇÔ²² º´¿ë Åõ¿©ÇÏ´Â °æ¿ì¿¡´Â ´ç´¢º´¾à(¿¹, Àν¶¸°)ÀÇ Åõ¿©·®À» Á¶ÀýÇÏ¿©¾ß ÇÑ´Ù.
4) ÀÌ ¾àÀº ±¸¾Æ³×ƼµòÀÇ Ç÷¾Ð°ÇÏ È¿°ú¸¦ ÀúÇϽÃų ¼ö ÀÖ°í, ±¸¾Æ³×Ƽµò°ú ¾Æ¸¸Å¸µòÀÇ Ãʱ⠱³°¨½Å°æ ÈïºÐ ÀÛ¿ëÀ» °È½Ãų ¼ö ÀÖ´Ù.
5) ÀÌ ¾à°ú ´Ù¸¥ ½Ä¿å¾ïÁ¦Á¦µéÀº ¿ÜÀμº Ä«Å×ÄݾƹηùÀÇ Ç÷¾Ð»ó½Â È¿°ú¸¦ °ÈÇÑ´Ù.
6) Æä³ëƼ¾ÆÁø°úÀÇ º´¿ëÀº ÀÌ ¾àÀÇ ½Ä¿å¾ïÁ¦È¿°ú¸¦ Â÷´ÜÇÒ ¼ö ÀÖ´Ù.
7) ÀÌ ¾àÀº Äí¸¶¸° °è¿ÀÇ Ç×ÀÀ°íÁ¦, Ç×°æ·ÃÁ¦(¿¹, Æä³ë¹Ù¸£ºñÅ», µðÆä´ÒÇÏÀÌ´ÜÅäÀÎ, ÇÁ¸®¹Ìµ·), ½Å°æÀÌ¿ÏÁ¦, ½Éȯ°èÇ׿ì¿ïÁ¦(ƯÈ÷ À̹ÌÇÁ¶ó¹Î ¹× µ¥½ÃÇÁ¶ó¹Î), Æä´ÒºÎŸÁ¸ µî°ú ÇÔ²² Åõ¿©Çϸé ÁÖ¾îÁø ¼ººÐµéÀÇ ½ÅÁø´ë»ç°¡ ÀúÇ쵃 ¼ö ÀÖÀ¸¹Ç·Î °æ¿ì¿¡ µû¶ó¼´Â ÀÌ ¾àÀÇ ¿ë·®À» ÁÙÀÌ´Â °ÍÀÌ ÇÊ¿äÇÏ´Ù.
8) °ú·®ÀÇ Ä«ÆäÀÎÀ¸·Î ÀÎÇÑ ³²¿ë °¡´É¼ºÀÇ Áõ°¡ ¹× È¿´É °È¸¦ È®½ÇÇÏ°Ô ¹èÁ¦ÇÒ ¼ö ¾ø´Ù.
9) ÁßÃ߽Űæ°è Ȱ¼º¾à¹°À» Åõ¿©ÇÒ ¶§¿¡´Â ¾ËÄڿðúÀÇ À¯ÇØ »óÈ£ÀÛ¿ëÀÇ °¡´É¼ºÀÌ ÀÖÀ¸¹Ç·Î Ç×»ó ÁÖÀÇÇØ¾ß ÇÑ´Ù.
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Bµî±Þ
(diethylpropion; )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
[bupropion hydrochloride+naltrexone hydrochloride]
[phendimetrazine tartrate]
[phendimetrazine tartrate]
[phentermine HCl]
[phentermine hydrochloride]
[phentermine hydrochloride (as phentermine)]
[phentermine hydrochloride (as phentermine)+topiramate]
[selegiline hydrochloride]
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Diethylpropion¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Diethylpropion is an amphetamine that stimulates neurons to release or maintain high levels of a particular group of neurotransmitters known as catecholamines; these include dopamine and norepinephrine. High levels of these catecholamines tend to suppress hunger signals and appetite. Diethylpropion (through catecholamine elevation) may also indirectly affect leptin levels in the brain. It is theorized that diethylpropion can raise levels of leptin which signal satiety. It is also theorized that increased levels of the catecholamines are partially responsible for halting another chemical messenger known as neuropeptide Y. This peptide initiates eating, decreases energy expenditure, and increases fat storage.
|
| Pharmacology |
Diethylpropion¿¡ ´ëÇÑ Pharmacology Á¤º¸ Diethylpropion is a sympathomimetic stimulant drug marketed as an appetite suppressant. Chemically, it is the N,N-diethyl analog of cathinone. Its mechanism of action is similar to other appetite suppressants such as sibutramine, phentermine and dextroamphetamine.
|
| Absorption |
Diethylpropion¿¡ ´ëÇÑ Absorption Á¤º¸ Diethylpropion is rapidly absorbed from the GI tract after oral administration.
|
| Pharmacokinetics |
Diethylpropion HydrochlorideÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
ºÐÆ÷ : ¹Ìº¯Èü ¹× Ȱ¼ºÇü ´ë»çü´Â ³úÇ÷°üÀ庮, ŹÝÀ» Åë°úÇÑ´Ù.
|
| Toxicity |
Diethylpropion¿¡ ´ëÇÑ Toxicity Á¤º¸ The reported oral LD50 for mice is 600 mg/kg, for rats is 250 mg/kg and for dogs is 225 mg/kg. Manifestation of acute overdosage include restlessness, tremor, hyperreflexia, rapid respiration, confusion, assaultiveness, hallucinations, and panic states.
|
| Drug Interactions |
Diethylpropion¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Acetophenazine Decreased anorexic effect, may increase psychotic symptomsChlorpromazine Decreased anorexic effect, may increase psychotic symptomsEthopropazine Decreased anorexic effect, may increase psychotic symptomsFluoxetine Risk of serotoninergic syndromeFluphenazine Decreased anorexic effect, may increase psychotic symptomsFluvoxamine Risk of serotoninergic syndromeGuanethidine The agent decreases the effect of guanethidineIsocarboxazid Possible hypertensive crisisMesoridazine Decreased anorexic effect, may increase psychotic symptomsMethdilazine Decreased anorexic effect, may increase psychotic symptomsParoxetine Risk of serotoninergic syndromePerphenazine Decreased anorexic effect, may increase psychotic symptomsPhenelzine Possible hypertensive crisisProchlorperazine Decreased anorexic effect, may increase psychotic symptomsPromazine Decreased anorexic effect, may increase psychotic symptomsPromethazine Decreased anorexic effect, may increase psychotic symptomsPropiomazine Decreased anorexic effect, may increase psychotic symptomsRasagiline Possible hypertensive crisisThiethylperazine Decreased anorexic effect, may increase psychotic symptomsThioridazine Decreased anorexic effect, may increase psychotic symptomsTranylcypromine Possible hypertensive crisisTrifluoperazine Decreased anorexic effect, may increase psychotic symptomsTriflupromazine Decreased anorexic effect, may increase psychotic symptomsTrimeprazine Decreased anorexic effect, may increase psychotic symptomsVenlafaxine Risk of serotoninergic syndromeMethotrimeprazine Decreased anorexic effect, may increase psychotic symptomsPropericiazine Decreased anorexic effect, may increase psychotic symptoms
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Diethylpropion¿¡ ´ëÇÑ Description Á¤º¸ A appetite depressant considered to produce less central nervous system disturbance than most drugs in this therapeutic category. It is also considered to be among the safest for patients with hypertension. (From AMA Drug Evaluations Annual, 1994, p2290)
|
| Drug Category |
Diethylpropion¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anorexigenic AgentsAppetite DepressantsStimulants
|
| Smiles String Canonical |
Diethylpropion¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CCN(CC)C(C)C(=O)C1=CC=CC=C1
|
| Smiles String Isomeric |
Diethylpropion¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CCN(CC)[C@H](C)C(=O)C1=CC=CC=C1
|
| InChI Identifier |
Diethylpropion¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C13H19NO/c1-4-14(5-2)11(3)13(15)12-9-7-6-8-10-12/h6-11H,4-5H2,1-3H3
|
| Chemical IUPAC Name |
Diethylpropion¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 2-diethylamino-1-phenylpropan-1-one
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2026-02-02
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|