| |
|
|
|
|
|
 |
| |
|
ÇÁ¸®Ä«ÀΰÖ5% PRICAIN GEL 5%
|
|
Àü¹®ÀǾàǰ | ºñ±Þ¿©
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
644100930[A21902311]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1g(2010.03.01)(ÇöÀç¾à°¡)
\0 ¿ø/1g(2006.03.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»öÀÇ ÀüÁú±ÕµîÇÑ °ÖÁ¦ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
6g, 15g |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 15±×·¥ |
1 °³ |
Æ©ºê |
8806441009303 |
8806441009327 |
ºñ¸Åǰ |
| 15±×·¥ |
1 °³ |
Æ©ºê |
8806441009303 |
8806441009310 |
|
|
| ÁÖ¼ººÐÄÚµå |
361100CCM
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
1. ÁÖ»ç¹Ù´Ã »ðÀԽà ¶Ç´Â Ç¥À缺 ¿Ü°úÀû óġ½Ã ÇǺÎÀÇ Ç¥¸é¸¶Ãë
2. »ý½Ä±â Á¡¸· Ç¥¸é¸¶Ãë(¿¹ : Äܵô·Ò Á¦°ÅÀü)
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¡Û ¼ºÀÎ
1. ÇǺΠ: ÀÌ ¾àÀ» Àû¿ëÇÑ ÈÄ ¹ÐºÀÅ×ÀÌÇÁ·Î µ¤´Â´Ù. Àû¿ë ºÎÀ§¿¡ ´ëÇÑ ¹ÐºÀÀº º¸Åë 1-3½Ã°£ À¯ÁöµÇ¾î¾ß ÇÏ¸ç ¹ÐºÀÅ×ÀÌÇÁ Á¦°ÅÈÄ ÃÖ¼Ò 1½Ã°£Àº È¿°ú°¡ Áö¼ÓµÈ´Ù.
1) ÁÖ»ç¹Ù´Ã »ðÀÔ½Ã(¿¹ : Á¤¸Æ»ð°ü, äÇ÷) ÀÌ ¾à ¾à 2gÀ» ÃÖ¼Ò 1½Ã°£, ÃÖ´ë 5½Ã°£ Àû¿ëÇÑ´Ù.
2) Ç¥À缺 ¿Ü°úÀû ¼Ò¼ö¼ú½Ã(¿¹ : ¿¬¼ÓÁ¾ÀÇ ÀûÃâ) ÀÌ ¾à 1.5-2g/10§²À» 1½Ã°£ Àû¿ëÇÑ´Ù.
3) Ç¥À缺 ¿Ü°úÀû ´ë¼ö¼ú½Ã(¿¹ : ÆÄ¿µÈ ÇǺÎÀ̽Ä) ÀÌ ¾à 1.5-2g/10§²À» ÃÖ¼Ò 2½Ã°£, ÃÖ´ë 5½Ã°£ Àû¿ëÇÑ´Ù.
2. »ý½Ä±â Á¡¸· : Äܵô·Ò Á¦°Å½Ã óġ ºÎÀ§¿¡ ÀÌ ¾à ¾à 10gÀ» 5-10ºÐ°£ Àû¿ëÇÑ ÈÄ ÀÌ ¾àÀ» Á¦°ÅÇϰí Áï½Ã ½Ã¼úÀ» °³½ÃÇÑ´Ù.
¡Û 3°³¿ù-12°³¿ù¿µ¾Æ : ÃÑ·® 2g, Àû¿ëºÎÀ§ 16§²¸¦ ÃʰúÇÏÁö ¾Ê´Â´Ù.
|
| ±Ý±â |
1) ÀÌ ¾àÀÇ ¼ººÐ ¶Ç´Â ±âŸÀÇ ¾Æ¹Ìµå°è ±¹¼Ò¸¶ÃëÁ¦¿¡ °ú¹ÎÁõ ȯÀÚ
2) »óó°¡ ÀÖ´Â ºÎÀ§, Á¡¸·, Á¢Ã˼ºÇǺο° ¶Ç´Â ¾ÆÅäÇÇÇǺο° ȯÀÚ
3) 3°³¿ù ÀÌÇÏÀÇ ¿µ¾Æ
4) ¸ÞÆ®Çì¸ð±Û·ÎºóÇ÷ÁõÀ¯¹ß ¾à¹°(¼³Æù¾Æ¹Ìµå µî)À» Åõ¿©ÇÏ´Â 12°³¿ù ÀÌÇÏÀÇ ¿µ¾Æ
5) ÀӽŠ37ÁÖ ÀÌÀü¿¡ ÅÂ¾î³ Á¶»ê¾Æ
|
| ½ÅÁßÅõ¿© |
1) ºóÇ÷, ¸ÞÆ®Çì¸ð±Û·ÎºóÇ÷Áõ ¶Ç´Â ÀÌ·¯ÇÑ Áõ»óÀ» À¯¹ßÇÒ ¼ö ÀÖ´Â ¾à¹°Åõ¿© ȯÀÚ
2) ¼è¾àÀÚ, °í·ÉÀÚ, ±Þ¼º Áúȯ ȯÀÚ
3) ÁßÁõÀÇ °£Áúȯ ȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
1) ±¹¼Ò¹ÝÀÀ : ¶§¶§·Î ±¹¼Òâ¹é, ¹ßÀû, ºÎÁ¾, µå¹°°Ô °¡·Á¿ò, Ãʱâ ÀÛ¿°¨ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
2) ±âŸ : µÎµå·¯±â, Ç÷°ü¼º ºÎÁ¾, ±â°üÁö°æ·Ã, ¼ï µîÀÇ ¾Ë·¹¸£±â¼º ¹× ¾Æ³ªÇʶô½Ã¼º ¹ÝÀÀÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ¼Ò¾Æ¿¡¼ µå¹°°Ô ¸ÞÆ®Çì¸ð±Û·ÎºóÇ÷ÁõÀÌ ³ªÅ¸³µ´Ù. ƯÈ÷ ¾ÆÅäÇǼº ÇǺο°À̳ª ¿¬¼ÓÁõÀ» °¡Áø ¼Ò¾Æ¿¡ Àå±â°£ Àû¿ëÇßÀ» ¶§ ÀÚ¹ÝÀ̳ª Á¡»óÃâÇ÷°ú °°Àº ºÐ¸®¼º ¹ÝÀÀÀÌ µå¹°°Ô ³ªÅ¸³µ´Ù. ¿ì¹ßÀûÀ¸·Î ´«¿¡ ´ê´Â °æ¿ì, °¢¸· ÀÚ±ØÀ» À¯¹ßÇÒ ¼ö ÀÖ´Ù.
|
| »óÈ£ÀÛ¿ë |
1) ±¹¼Ò¸¶ÃëÁ¦ Åõ¿© ȯÀÚ´Â ´ÙÀ½ ¾à¹° º´¿ë Åõ¿© ½Ã ¸ÞÆ®Çì¸ð±Û·ÎºóÇ÷Áõ ¹ß»ý À§ÇèÀÌ Áõ°¡ÇÑ´Ù.
Ç¥ 1. ¸ÞÆ®Çì¸ð±Û·ÎºóÇ÷Áõ°ú °ü·ÃµÈ ¾à¹°ÀÇ ¿¹
|
ºÐ·ù
|
¿¹½Ã
|
|
Áú»ê¿°/¾ÆÁú»ê¿°
|
»êÈÁú¼Ò, ´ÏÆ®·Î±Û¸®¼¼¸°, ´ÏÆ®·ÎǪ·ç½Ãµå, ¾Æ»êÈÁú¼Ò
|
|
±¹¼Ò¸¶ÃëÁ¦
|
¾ÆÆ¼Ä«ÀÎ, º¥Á¶Ä«ÀÎ, ºÎÇǹÙÄ«ÀÎ, ¸®µµÄ«ÀÎ, ¸ÞÇǹÙÄ«ÀÎ, ÇÁ¸±·ÎÄ«ÀÎ, ÇÁ·ÎÄ«ÀÎ, ·ÎÇǹÙÄ«ÀÎ,
Åׯ®¶óÄ«ÀÎ, ·¹º¸ºÎÇǹÙÄ«ÀÎ
|
|
Ç×¾ÏÁ¦
|
½ÃŬ·ÎÆ÷½ºÆÄ¹Ìµå, Ç÷矹̵å, È÷µå·Ï½Ã¿ì·¹¾Æ, ÀÌÆ÷½ºÆÄ¸¶À̵å, ¶ó½ººÎ¸®Ä«Á¦
|
|
Ç×»ýÁ¦
|
´ä¼Õ, ´ÏÆ®·ÎǪ¶õÅäÀÎ, ÆÄ¶ó¾Æ¹Ì³ë»ì¸®½Ç»ê, ¼³Æù¾Æ¹Ìµå
|
|
Ç׸»¶ó¸®¾Æ¾à
|
Ŭ·Î·ÎÄý, ÇÁ¸®¸¶Äý
|
|
Ç×°æ·ÃÁ¦
|
Æä³ë¹ÙºñÅ», Æä´ÏÅäÀÎ, ¹ßÇÁ·Î»ê³ªÆ®·ý
|
|
±âŸ
|
¾Æ¼¼Æ®¾Æ¹Ì³ëÆæ, ¸ÞÅäŬ·ÎÇÁ¶ó¹Ìµå, Äû´Ñ, ¼³ÆÄ»ì¶óÁø
|
2) ´Ù¸¥ ±¹¼Ò¸¶ÃëÁ¦´Â ¶Ç´Â ºÎÁ¤¸Æ¿ëÁ¦(ÅäÄ«À̴ϵå,¸Æ½Ç·¹Æ¾µî)°ú º´¿ëÅõ¿©½Ã µ¶¼ºÀÌ Áõ°µÉ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù.
3) ±¹¼Ò¸¶ÃëÁ¦ ¹× Class¥² ºÎÁ¤¸Æ¿ëÁ¦(¿¹:¾Æ¹Ì¿À´Ù·Ð)¿ÍÀÇ »óÈ£ÀÛ¿ë¿¡ °üÇÑ ¿¬±¸´Â ±¸Ã¼ÀûÀ¸·Î ÀÌ·ç¾îÁöÁö ¾Ê¾ÒÀ¸³ª, ÁÖÀÇÇϵµ·Ï ÇÑ´Ù.
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Bµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Lidocaine¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Lidocaine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Lidocaine stabilizes the neuronal membrane by inhibiting the ionic fluxes required for the initiation and conduction of impulses thereby effecting local anesthetic action.
Prilocaine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Prilocaine acts on sodium channels on the neuronal cell membrane, limiting the spread of seizure activity and reducing seizure propagation. The antiarrhythmic actions are mediated through effects on sodium channels in Purkinje fibers.
|
| Pharmacology |
Lidocaine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Lidocaine is an anesthetic agent indicated for production of local or regional anesthesia and in the treatment of ventricular tachycardia occurring during cardiac manipulation, such as surgery or catheterization, or which may occur during acute myocardial infarction, digitalis toxicity, or other cardiac diseases. The mode of action of the antiarrhythmic effect of Lidocaine appears to be similar to that of procaine, procainamide and quinidine. Ventricular excitability is depressed and the stimulation threshold of the ventricle is increased during diastole. The sinoatrial node is, however, unaffected. In contrast to the latter 3 drugs, Lidocaine in therapeutic doses does not produce a significant decrease in arterial pressure or in cardiac contractile force. In larger doses, lidocaine may produce circulatory depression, but the magnitude of the change is less than that found with comparable doses of procainamide.
Prilocaine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Prilocaine, a hydantoin anticonvulsant, is used alone or with phenobarbital or other anticonvulsants to manage tonic-clonic seizures, psychomotor seizures, neuropathic pain syndromes including diabetic neuropathy, digitalis-induced cardiac arrhythmias, and cardiac arrhythmias associated with QT-interval prolongation.
|
| Absorption |
Lidocaine¿¡ ´ëÇÑ Absorption Á¤º¸ Information derived from diverse formulations, concentrations and usages reveals that lidocaine is completely absorbed following parenteral administration, its rate of absorption depending, for example, upon various factors such as the site of administration and the presence or absence of a vasoconstrictor agent.
Prilocaine¿¡ ´ëÇÑ Absorption Á¤º¸ Not Available
|
| Pharmacokinetics |
LidocaineÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- È¿°ú¹ßÇö½Ã°£ (1ȸ bolus ¿ë·®À¸·Î¼) : 45-90ÃÊ
- ÀÛ¿ëÁö¼Ó½Ã°£ : 10-25ºÐ
- ºÐÆ÷ (Vd) : ¸¹Àº ¿äÀο¡ µû¶ó º¯ÈµÇ¸ç, ¿ïÇ÷¼º ½ÉºÎÀü°ú °£Áúȯ¿¡¼´Â ºÐÆ÷¿ëÀûÀÌ °¨¼ÒµÊ
- ´Ü¹é°áÇÕ : 60-80%, ¥á1-acid glycoprotein°ú °áÇÕ
- ´ë»ç : °£¿¡¼ 90% ´ë»ç
- Ȱ¼ºÇü ´ë»çüÀÎ monoethylglycinexylidide(MEGX)¿Í glycinexylidide(GX)°¡ ÃàÀûµÇ¾î ÁßÃ߽Űæ°è µ¶¼ºÀ» À¯¹ßÇÒ ¼ö ÀÖ´Ù.
- ¹Ý°¨±â (biphasic) : ¿ïÇ÷¼º ½ÉºÎÀü, °£Áúȯ, ¼îÅ©, ÁßÁõÀÇ ½ÅÁúȯ¿¡¼ Áõ°¡
- Ãʱâ : 7-30ºÐ
- ¸»±â : ¿µ¾Æ, ¹Ì¼÷¾Æ : 3.2½Ã°£, ¼ºÀÎ : 1.5-2½Ã°£
PrilocaineÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ÀÛ¿ë¹ßÇö½Ã°£ : Lidocaine°ú À¯»ç (¾à 45-90ÃÊ)
- ÀÛ¿ëÁö¼Ó½Ã°£ : ¾à 2½Ã°£
- ´ë»ç : °£´ë»ç
|
| Toxicity |
Lidocaine¿¡ ´ëÇÑ Toxicity Á¤º¸ The oral LD 50 of lidocaine HCl in non-fasted female rats is 459 (346-773) mg/kg (as the salt) and 214 (159-324) mg/kg (as the salt) in fasted female rats. Symptoms of overdose include convulsions, hypoxia, acidosis, bradycardia, arrhythmias and cardiac arrest.
Prilocaine¿¡ ´ëÇÑ Toxicity Á¤º¸ Not Available
|
| Drug Interactions |
Lidocaine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
Prilocaine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Alendronate Increased risk of gastric toxicityMethotrexate The NSAID increases the effect and toxicity of methotrexateAnisindione The NSAID increases the anticoagulant effectDicumarol The NSAID increases the anticoagulant effectAcenocoumarol The NSAID increases the anticoagulant effectWarfarin The NSAID increases the anticoagulant effectCyclosporine Monitor for nephrotoxicity
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Lidocaine¿¡ ´ëÇÑ Description Á¤º¸ A local anesthetic and cardiac depressant used as an antiarrhythmia agent. Its actions are more intense and its effects more prolonged than those of procaine but its duration of action is shorter than that of bupivacaine or prilocaine. [PubChem]
Prilocaine¿¡ ´ëÇÑ Description Á¤º¸ A local anesthetic that is similar pharmacologically to lidocaine. Currently, it is used most often for infiltration anesthesia in dentistry. (From AMA Drug Evaluations Annual, 1992, p165)
|
| Drug Category |
Lidocaine¿¡ ´ëÇÑ Drug_Category Á¤º¸ AnestheticsAnesthetics, LocalAnti-Arrhythmia AgentsAntiarrhythmic Agents
Prilocaine¿¡ ´ëÇÑ Drug_Category Á¤º¸ AnestheticsAnesthetics, LocalLocal Anesthetics
|
| Smiles String Canonical |
Lidocaine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CCN(CC)CC(=O)NC1=C(C)C=CC=C1C
Prilocaine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CCCNC(C)C(=O)NC1=CC=CC=C1C
|
| Smiles String Isomeric |
Lidocaine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CCN(CC)CC(=O)NC1=C(C)C=CC=C1C
Prilocaine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CCCN[C@@H](C)C(=O)NC1=CC=CC=C1C
|
| InChI Identifier |
Lidocaine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C14H22N2O/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4/h7-9H,5-6,10H2,1-4H3,(H,15,17)/f/h15H
Prilocaine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C13H20N2O/c1-4-9-14-11(3)13(16)15-12-8-6-5-7-10(12)2/h5-8,11,14H,4,9H2,1-3H3,(H,15,16)/f/h15H
|
| Chemical IUPAC Name |
Lidocaine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 2-diethylamino-N-(2,6-dimethylphenyl)acetamide
Prilocaine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ N-(2-methylphenyl)-2-propylaminopropanamide
|
| Drug-Induced Toxicity Related Proteins |
DOCA ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Aquaporin-2 Drug:DOCA Toxicity:hypertension. [¹Ù·Î°¡±â] LIDOCAINE ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:glucose-regulated protein Drug:lidocaine Toxicity:intestinal disorder. [¹Ù·Î°¡±â] Replated Protein:Alkaline phosphatase Drug:lidocaine Toxicity:lidocaine induced hepatitis. [¹Ù·Î°¡±â] Replated Protein:C-reactive protein Drug:lidocaine Toxicity:fever. [¹Ù·Î°¡±â] Replated Protein:C-reactive protein Drug:lidocaine Toxicity:lidocaine induced hepatitis. [¹Ù·Î°¡±â] Replated Protein:Alpha-1-acid glycoprotein Drug:lidocaine Toxicity:lidocaine tolerance. [¹Ù·Î°¡±â] Replated Protein:Gamma-glutamyltranspeptidase Drug:lidocaine Toxicity:fever. [¹Ù·Î°¡±â] Replated Protein:Alkaline phosphatase Drug:lidocaine Toxicity:fever. [¹Ù·Î°¡±â] Replated Protein:Gamma-glutamyltranspeptidase Drug:lidocaine Toxicity:lidocaine induced hepatitis. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2026-02-02
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|