| |
|
|
|
|
|
 |
| |
|
°ÇÀϰÕŸ¸¶À̽ÅÁÖ»ç
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
646800500[A03804841]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/2ml/¾ÚÇÃ(2010.11.01)(ÇöÀç¾à°¡)
\372 ¿ø/2ml/¾ÚÇÃ(2009.05.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹«»ö,¹«ÃëÀÇ Åõ¸íÇÑ ¾×ü
[Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
2¹Ð¸®¸®ÅÍx1, 5, 10, 20, 50¾ÚÇà |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 2¹Ð¸®¸®ÅÍ |
50 ¾ÚÇÃ |
¾ÚÇÃ |
8806468005005 |
8806468005029 |
|
| 2¹Ð¸®¸®ÅÍ |
1 ¾ÚÇÃ |
¾ÚÇÃ |
8806468005005 |
8806468005012 |
|
|
| ÁÖ¼ººÐÄÚµå |
165103BIJ
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
¡Û À¯È¿±ÕÁ¾
³ì³ó±Õ, ´ëÀå±Õ, ÇÁ·ÎÅ׿콺, Æ÷µµ±¸±Õ(Æä´Ï½Ç¸° ¹× ¸ÞÄ¡½Ç¸° ³»¼º±ÕÆ÷ÇÔ), Ŭ·¹ºê½Ã¿¤¶ó, ¿£Å׷ιÚÅÍ, ¼¼¶óƼ¾Æ, ½ÃÆ®·Î¹ÚÅÍ, »ì¸ð³Ú¶ó, ½Ã°Ö¶ó
¡Û ÀûÀÀÁõ
- ÆÐÇ÷Áõ(½Å»ý¾Æ ÆÐÇ÷Áõ Æ÷ÇÔ)
- ÁßÃ߽Űæ°è °¨¿°Áõ(¼ö¸·¿° Æ÷ÇÔ)
- ¿ä·Î°¨¿°Áõ
- È£Èí±â°¨¿°Áõ
- À§Àå°ü°¨¿°Áõ(º¹¸·¿° Æ÷ÇÔ)
- ÇǺÎ, °ñ ¹× ¿¬Á¶Á÷°¨¿°Áõ(È»ó ¹× â»ó Æ÷ÇÔ)
- ±×¶÷À½¼º±Õ °¨¿°ÁõÀÇ ÃʱâÄ¡·á
- ¿øÀÎ±Õ ¹Ì»ó½Ã ÃʱâÄ¡·á(Æä´Ï½Ç¸°°è ¶Ç´Â ¼¼ÆÈ·Î½ºÆ÷¸°°è ¾à¹°°ú º´¿ë)
- ³ì³ó±Õ¿¡ ÀÇÇÑ Ä¡¸íÀû °¨¿°Áõ(Ä«¸£º£´Ï½Ç¸°°ú º´¿ë)
- ½É³»¸·¿°(Æä´Ï½Ç¸°°è ¾à¹°°ú º´¿ë)
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
1. ½Å±â´ÉÁ¤»ó ȯÀÚ
º¸Åë Ä¡·á±â°£Àº 7¢¦10ÀÏÀ̸ç, ÁßÁõÀ̳ª ³Ä¡¼ºÀÎ °æ¿ì¿¡´Â ¿¬ÀåÇÒ ¼ö ÀÖ´Ù.
1) ¼ºÀÎ : °ÕŸ¸¶À̽ÅÀ¸·Î¼ 1ÀÏ Ã¼Áß Kg´ç 3mg(¿ª°¡)À» 8½Ã°£¸¶´Ù ºÐÇÒ Á¤¸Æ ¶Ç´Â ±ÙÀ°ÁÖ»çÇÏ¸ç »ý¸íÀÌ À§µ¶ÇÑ °æ¿ì¿¡´Â 1ÀÏ Ã¼Áß Kg´ç 5mg(¿ª°¡)À» 3¢¦4ȸ ºÐÇÒ ÁÖ»çÇÑ´Ù.
Áõ»óÀÇ °³¼±¿¡ µû¶ó °¨·®Çϸç À̶§ ÃÖ°íÇ÷Áß³óµµ´Â 12§¶/mL, ÃÖÀúÇ÷Áß³óµµ(Â÷±âÅõ¿©Á÷Àü)´Â 2§¶/mL°¡ ³ÑÁö ¾Ê´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù.
<Ç¥ 1>
| üÁß(Kg) |
ÁßÁõ°¨¿° ½Ã »ó¿ë·® (1mg/Kg¾¿ 8½Ã°£¸¶´Ù) |
»ý¸íÀ§±Þ½Ã ¿ë·® (1.7mg/Kg¾¿ 8½Ã°£¸¶´Ù) |
| 40 |
1.0mL(40mg) |
1.6mL(66mg) |
| 45 |
1.1mL(45mg) |
1.9mL(75mg) |
| 50 |
1.25mL(50mg) |
2.1mL(83mg) |
| 55 |
1.4mL(55mg) |
2.25mL(91mg) |
| 60 |
1.5mL(60mg) |
2.5mL(100mg) |
| 65 |
1.6mL(65mg) |
2.7mL(108mg) |
| 70 |
1.75mL(70mg) |
2.9mL(116mg) |
| 75 |
1.9mL(75mg) |
3.1mL(125mg) |
| 80 |
2.0mL(80mg) |
3.3mL(133mg) |
| 85 |
2.1mL(85mg) |
3.5mL(141mg) |
| 90 |
2.25mL(90mg) |
3.75mL(150mg) |
| 95 |
2.4mL(95mg) |
4.0mL(158mg) |
| 100 |
2.5mL(100mg) |
4.2mL(166mg) |
2) ¼Ò¾Æ : 1ÀÏ Ã¼Áß Kg´ç 6¢¦7.5mg(¿ª°¡)À» 8½Ã°£¸¶´Ù ºÐÇÒ Á¤¸Æ ¶Ç´Â ±ÙÀ°ÁÖ»ç ÇÑ´Ù.
3) À¯¾Æ : 1ÀÏ Ã¼Áß Kg´ç 7.5mg(¿ª°¡)À» 8½Ã°£¸¶´Ù ºÐÇÒ Á¤¸Æ ¶Ç´Â ±ÙÀ°ÁÖ»ç ÇÑ´Ù.
4) ¹Ì¼÷¾Æ ¹× »ýÈÄ 1ÁÖ ¹Ì¸¸ÀÇ ½Å»ý¾Æ : 1ÀÏ Ã¼Áß Kg´ç 5mg(¿ª°¡)À» 12½Ã°£¸¶´Ù ºÐÇÒ Á¤¸ÆÁÖ»ç ÇÑ´Ù.
5) Á¡Àû Á¤¸ÆÁÖ»çÀÇ °æ¿ì ¹Ì¼÷¾Æ, ½Å»ý¾Æ, ¿µ¾Æ, À¯¾Æ ¶Ç´Â ¼Ò¾Æ¿¡ ´ëÇÑ ¾ÈÀü¼ºÀÌ È®¸³µÇ¾î ÀÖÁö ¾Ê´Ù.
6) ±ÙÀ°ÁÖ»çÀÇ °æ¿ì ¹Ì¼÷¾Æ, ½Å»ý¾Æ¿¡ ´ëÇÑ ¾ÈÀü¼ºÀÌ È®¸³µÇ¾î ÀÖÁö ¾Ê´Ù.
¡Ø Á¤¸ÆÁÖ»ç
ÆÐÇ÷Áõ, ¼ï, ¿ïÇ÷¼º½ÉºÎÀü, Ç÷¾×ÇÐÀûÀå¾Ö, ÁßÁõÈ»ó ¹× ±ÙÀ°·®°¨¼Ò ȯÀÚ µî ±ÙÀ°Áֻ簡 ºÎÀû´çÇÑ È¯ÀÚ¿¡ Á¤¸ÆÁÖ»çÇÑ´Ù. Áֻ緮Àº ±ÙÀ°ÁÖ»ç¿Í µ¿ÀÏÇϳª ´ÙÀ½°ú °°ÀÌ Èñ¼®ÇÏ¿© ´Ù¸¥ ¾à¹°°ú È¥ÇÕÇÏÁö ¸»°í µû·Î Åõ¿©ÇÑ´Ù. °£ÇæÁ¤¸ÆÁÖ»ç ½Ã 1ȸ ¿ë·®À» 50¢¦200mLÀÇ »ý¸®½Ä¿°ÁÖ»ç¾× ¶Ç´Â 5% Æ÷µµ´ç ÁÖ»ç¾×¿¡ Èñ¼®ÇÏ¿© 30ºÐ¢¦2½Ã°£¿¡ °ÉÃÄ Á¡Àû Á¤¸ÆÁÖ»çÇÑ´Ù.
À¯¤ý¼Ò¾ÆÀÇ °æ¿ì Èñ¼®¾×ÀÇ ¾àÀ» ÀûÀýÈ÷ °¨·® Á¶ÀýÇÑ´Ù.
2. ½Å±â´ÉºÎÀü ȯÀÚ
1) ½Å±â´ÉºÎÀü ȯÀÚ¿¡´Â ½ÅÀå±â´ÉºÎÀüÀÇ Á¤µµ¿¡ µû¶ó ¿ë·®À» Á¶ÀýÇÑ´Ù.
<Ç¥ 2> ½ÅÀå±â´ÉºÎÀü ȯÀÚÀÇ ¿ë·®Á¶Àý(ÃÊȸÅõ¿©ÈÄ 8½Ã°£°£°Ý ¿ë·®)
| Ç÷û Å©·¹¾ÆÆ¼´Ñ (mg %) |
Å©·¹¾ÆÆ¼´Ñû¼ÒÀ²ÀÇ °³·«Ä¡ (mL/min/1.73§³) |
Á¤»ó½ÅÀå±â´ÉȯÀÚÀÇ ¿ë·®¿¡ ´ëÇÑ ¹éºÐÀ² |
| ¡Â 1.0 |
> 100 |
100 |
| 1.1 ¢¦ 1.3 |
70 ¢¦ 100 |
80 |
| 1.4 ¢¦ 1.6 |
55 ¢¦ 70 |
65 |
| 1.7 ¢¦ 1.9 |
45 ¢¦ 55 |
55 |
| 2.0 ¢¦ 2.2 |
40 ¢¦ 45 |
50 |
| 2.3 ¢¦ 2.5 |
35 ¢¦ 40 |
40 |
| 2.6 ¢¦ 3.0 |
30 ¢¦ 35 |
35 |
| 3.1 ¢¦ 3.5 |
25 ¢¦ 30 |
30 |
| 3.6 ¢¦ 4.0 |
20 ¢¦ 25 |
25 |
| 4.1 ¢¦ 5.1 |
15 ¢¦ 20 |
20 |
| 5.2 ¢¦ 6.6 |
10 ¢¦ 15 |
15 |
| 6.7 ¢¦ 8.0 |
< 10 |
10 |
°ÕŸ¸¶À̽ÅÀÇ Ç÷û¹Ý°¨±â´Â Ç÷ûũ·¹¾ÆÆ¼´Ñ ³óµµ¿Í ¹ÐÁ¢ÇÑ °ü°è°¡ ÀÖÀ¸¹Ç·Î, Åõ¿© °£°ÝÀº Ç÷ûũ·¹¾ÆÆ¼´Ñ ³óµµ(mg/100mL)¸¦ 8¹èÇÏ¿© °³·« »êÃâÇÒ ¼ö ÀÖ´Ù.
2) ÁßÁõÀü½Å°¨¿°ÀÎ ½ÅÀå¾Ö ȯÀÚ : ¿ë·®À» °¨¼ÒÇϰí Åõ¿©È½¼ö¸¦ Áõ°¡½ÃŰ´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù. ÀÌ·¯ÇÑ È¯ÀÚ´Â °ÕŸ¸¶À̽ŠÇ÷û³óµµ¸¦ üũÇÏ¿© ¿ë·® Á¶ÀýÀ» ÇØ¾ß¸¸ ÇÑ´Ù. Ãʱâ¿ë·®À¸·Î´Â Á¤»óÀÎÀÇ Åë»ó »ç¿ë·®À» Åõ¿©Çϰí, ÀÌÈÄÀÇ ¿ë·®(8½Ã°£¸¶´Ù Åõ¿©)Àº Á¤»ó±ÇÀå¿ë·®À» Ç÷ûũ·¹¾ÆÆ¼´ÑÀ¸·Î ³ª´©¾î °³·«ÀûÀ¸·Î ±¸ÇÑ´Ù.
3) Ç÷¾×Åõ¼®ÁßÀΠȯÀÚ¿¡°Ô´Â ¸Å Åõ¼®¸»±â¿¡ ¼ºÀÎÀº üÁß Kg´ç 1¢¦1.7mg(¿ª°¡), ¼Ò¾Æ´Â üÁß Kg´ç 2mg(¿ª°¡)À» Åõ¿©ÇÑ´Ù.
3. ¿ä·Î°¨¿°Áõ
Á¤»óÀûÀÎ ½Å±â´É ȯÀÚÀÇ ¿ä·Î°¨¿°Áõ¿¡´Â 1ÀÏ 1ȸ 160mg(¿ª°¡)À» Åõ¿©ÇÒ ¼ö ÀÖ´Ù.
¿¬·É, Áõ»ó¿¡ µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù.
|
| ÁÖ¿ä¾à¹° »óÈ£ÀÛ¿ë |
[Á¶È¸]
|
| ±Ý±â |
1) ÀÌ ¾à ¶Ç´Â ´Ù¸¥ ¾Æ¹Ì³ë±Û¸®ÄÚ»çÀ̵å°è Ç×»ý¹°Áú ¹× ¹Ù½ÃÆ®¶ó½Å¿¡ °ú¹Î¹ÝÀÀÀÇ º´·ÂÀÌ Àִ ȯÀÚ
2) ÀӺΠ¹× ¼öÀ¯ºÎ |
| ½ÅÁßÅõ¿© |
1) º»ÀÎ ¶Ç´Â ºÎ¸ð, ÇüÁ¦°¡ ¾Æ¹Ì³ë±Û¸®ÄÚ»çÀ̵å°è Ç×»ý¹°Áú¿¡ ÀÇÇÑ ³Ã»ÀÚ ¶Ç´Â ±× ¿Ü ´Ù¸¥ ³Ã»ÀÚÀÎ °æ¿ì¿¡´Â Åõ¿©ÇÏÁö ¾Ê´Â °ÍÀ» ¿øÄ¢À¸·Î Çϳª ºÎµæÀÌ Åõ¿©ÇÒ °æ¿ì¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
2) ½ÅÀå¾Ö ȯÀÚ(Ç÷Áß³óµµ°¡ ³ô°Ô Áö¼ÓµÇ¾î ½ÅÀå¾Ö°¡ ¾Ç鵃 ¼ö ÀÖÀ¸¸ç ¶ÇÇÑ Á¦8³ú½Å°æÀå¾Ö µîÀÇ ÀÌ»ó¹ÝÀÀÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.)
3) °£Àå¾Ö ȯÀÚ(°£Àå¾Ö°¡ ¾Ç鵃 ¼ö ÀÖ´Ù.)
4) ½Å»ý¾Æ, ¹Ì¼÷¾Æ
5) °æ±¸¼·Ãë°¡ ºÒ·®ÇÑ È¯ÀÚ ¶Ç´Â ºñ°æ±¸¿µ¾ç ȯÀÚ, °í·ÉÀÚ, Àü½Å»óŰ¡ ³ª»Û ȯÀÚ(ºñŸ¹Î K °áÇÌÁõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÃæºÐÈ÷ °üÂûÇÑ´Ù.)
6) ±ÙÀ°Àå¾Ö ȯÀÚ(¿¹ : ÁßÁõ ±Ù¹«·ÂÁõ)(½Å°æ±Ù Â÷´ÜÀÛ¿ëÀÌ ÀÖ¾î È£Èí¾ïÁ¦°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.)
7) ÀÌ ¾àÀº ¾ÆÈ²»ê¼ö¼Ò³ªÆ®·ýÀÌ ÇÔÀ¯µÇ¾î ÀÖ¾î ¾Æ³ªÇʶô½Ã¿Í °°Àº ¾Ë·¹¸£±â¸¦ ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¸ç ÀϺΠ°¨¼ö¼º ȯÀÚ¿¡¼´Â »ý¸íÀ» À§ÇùÇÒ Á¤µµ ¶Ç´Â À̺¸´Ù ¾àÇÑ Ãµ½Ä¹ßÀÛÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù. ÀÏ¹Ý »ç¶÷¿¡¼ÀÇ ¾ÆÈ²»ê°¨¼ö¼º¿¡ ´ëÇÑ ÃѰýÀûÀÎ ºóµµ´Â ¾Ë·ÁÁöÁö ¾Ê¾ÒÀ¸³ª ³·Àº °ÍÀ¸·Î º¸ÀÌ¸ç ¾ÆÈ²»ê°¨¼ö¼ºÀº ºñõ½ÄȯÀÚº¸´Ù õ½ÄȯÀÚ¿¡¼ ºó¹øÇÑ °ÍÀ¸·Î ³ªÅ¸³µ´Ù. |
| ÀÌ»ó¹ÝÀÀ |
1) ¼ï : ¼ïÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î ÃæºÐÈ÷ °üÂûÇϰí û»öÁõ, È£Èí°ï¶õ, ÈäºÎºÒÄè°¨, Ç÷¾ÐÀúÇÏ µîÀÇ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÏ´Â µî ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù.
2) °ú¹Î¹ÝÀÀ : °¡·Á¿ò, µå¹°°Ô ¹ßÁø, ¹ß¿ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³ª´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
3) ½Å°æ°è : µå¹°°Ô ¾îÁö·¯¿ò, À̸í, ³Ã», û·Â»ó½Ç, ¿îµ¿½ÇÁ¶ µîÀÇ Á¦8³ú½Å°æÀå¾Ö°¡ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÃæºÐÈ÷ °üÂûÇÏ¿© ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³ª´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÏ´Â °ÍÀÌ ¹Ù¶÷Á÷Çϳª ºÎµæÀÌ Åõ¿©¸¦ °è¼ÓÇÒ °æ¿ì¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù. »çÁöÀÇ ¸¶ºñ°¨, ȯ°¢, ¸Á»ó, °æ·Ã, ÀǽÄÀå¾Ö, µå¹°°Ô µÎÅë, Á¹À½, ¿ì¿ï, ½Ã·ÂÀå¾Ö, ÇǺÎÀú¸², ±ÙÀ°¿¬Ãà µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
4) ¼Òȱâ°è : ±¸Åä, ½Ä¿åºÎÁø, µå¹°°Ô Ÿ¾×ºÐºñ°ú´Ù, ±¸³»¿°, ±¸¿ª µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
5) È£Èí±â°è : È£Èí°ï¶õ, ÈĵκÎÁ¾, Æó¼¶À¯Á¾ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
6) Ç÷¾×°è : ¶§¶§·Î È£»ê±¸ Áõ°¡, µå¹°°Ô ¹éÇ÷±¸ °¨¼Ò, ÀϽÃÀûÀÎ ¹«°ú¸³±¸Áõ, ¸Á»óÀûÇ÷±¸¼öÀÇ º¯È, Ç÷¼ÒÆÇ °¨¼Ò, ºóÇ÷, °ú¸³±¸ °¨¼Ò µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
7) °£Àå : ¶§¶§·Î °£Àå¾Ö°¡ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÃæºÐÈ÷ °üÂûÇÏ¿© ALT, AST, ALP, Ç÷û LDH, ºô¸®·çºó »ó½Â µîÀÇ ÀÌ»óÀÌ ÀÎÁ¤µÇ´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
8) ½ÅÀå : µå¹°°Ô ±Þ¼º ½ÅºÎÀü µîÀÇ ÁßÁõÀÇ ½ÅÀå¾Ö°¡ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î Á¤±âÀûÀ¸·Î °Ë»ç¸¦ ½Ç½ÃÇÏ´Â µî ÃæºÐÈ÷ °üÂûÇÏ¿© ÀÌ»óÀÌ ÀÎÁ¤µÇ´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù. ¶ÇÇÑ ºÎÁ¾, ¶§¶§·Î ÇÌ´¢, BUN »ó½Â, Å©·¹¾ÆÆ¼´Ñû¼ÒÀ² °¨¼Ò, ´Ü¹é´¢, ¿ä¼Ò°ß ÀÌ»ó, µå¹°°Ô Ç÷´¢, ÀüÇØÁúÀÌ»ó(Ç÷ûĮ½·, ¸¶±×³×½·, ³ªÆ®·ý, Ä®·ýÀÇ °¨¼Ò)ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
9) ºñŸ¹Î °áÇÌÁõ : ºñŸ¹Î K °áÇÌÁõ»ó(ÀúÇÁ·ÎÆ®·ÒºóÇ÷Áõ, ÃâÇ÷°æÇâ µî), ºñŸ¹Î B±º °áÇÌÁõ»ó(¼³¿°, ±¸³»¿°, ½Ä¿åºÎÁø, ½Å°æ¿° µî)ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
10) ÁÖ»çºÎÀ§ : ÁÖ»çºÎÀ§ÀÇ µ¿Åë, °æ°áÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù(±ÙÀ°Áֻ翡 ÇÑÇÔ.).
11) ±âŸ : ÀÌ ¾à Åõ¿©·Î ºñ°¨¼ö¼º±ÕÀÇ °úµµ¼ºÀåÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ¶Ç °íÇ÷¾Ð, ÀúÇ÷¾Ð, ¿øÇüÅ»¸ðÁõ, üÁß°¨¼Ò µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
12) ÀǾàǰ ½ÃÆÇ ÈÄ ÀÌ»ó»ç·Ê º¸°íÀÚ·á(1989-2017³â6¿ù)¸¦ Åä´ë·Î ½Ç¸¶¸®Á¤º¸ ºÐ¼®¡¤Æò°¡ °á°ú »õ·Î È®ÀÎµÈ ÀÌ»ó»ç·Ê´Â ´ÙÀ½°ú °°´Ù. ´Ù¸¸, ÀÌ·Î½á °ð ÇØ´ç¼ººÐ°ú ´ÙÀ½ÀÇ ÀÌ»ó»ç·Ê °£¿¡ Àΰú°ü°è°¡ ÀÔÁõµÈ °ÍÀ» ÀǹÌÇÏ´Â °ÍÀº ¾Æ´Ï´Ù.
• ¸é¿ª°è-¾Æ³ªÇʶô½Ã½º¹ÝÀÀ
|
| »óÈ£ÀÛ¿ë |
1) µ¦½ºÆ®¶õ, ¾Æ¸£±ä»ê³ªÆ®·ý µî ½ÅÀå¾Ö¸¦ ÀÏÀ¸Å³ ¼ö ÀÖ´Â Ç÷¾× ´ë¿ëÁ¦ÀÇ ½Åµ¶¼ºÀ» Áõ°½Ãų ¼ö ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇÑ Ç÷¾× ´ë¿ëÁ¦¿Í´Â º´¿ëÅõ¿©ÇÏÁö ¾Ê´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù. ¶ÇÇÑ º´¿ëÅõ¿©¿¡ ÀÇÇØ ¾Æ¹Ì³ë±Û¸®ÄÚ»çÀ̵å°è ¾à¹°ÀÌ Ç÷Áß¿¡ ÃàÀûµÇ°í ±ÙÀ§¼¼´¢°ü »óÇǼ¼Æ÷ÀÇ °øÆ÷º¯¼ºÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ½ÅÀå¾Ö°¡ ¹ß»ýÇßÀ» °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí Åõ¼®¿ä¹ý µî ÀûÀýÇÑ Ã³Ä¡¸¦ ½Ç½ÃÇÑ´Ù.
2) Äí¶ó·¹À¯»çÀÛ¿ë(½Å°æ±Ù Á¢ÇպΠÂ÷´ÜÀÛ¿ë)¿¡ ÀÇÇÑ È£Èí¾ïÁ¦°¡ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ¸¶ÃëÁ¦, ±ÙÀÌ¿ÏÁ¦(Åõº¸Äí¶ó¸°, ºê·ÒÈÆÇÅ©·Î´½, ºê·ÒȺ£Å©·Î´½, ÅçÆä¸®¼Õ, AÇü º¸Åø¸®´©½º µ¶¼Ò, ¼®½Ã´ÒÄݸ°, ¿¡Å׸£, ÇÒ·Îź, µ¥Ä«¸ÞÅä´½)¿Í º´¿ëÇÒ °æ¿ì¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù. È£Èí¾ïÁ¦°¡ ³ªÅ¸³µÀ» °æ¿ì¿¡´Â Ä®½·Á¦Á¦ÀÇ Á¤¸ÆÁÖ»ç, Äݸ°¿¡½ºÅ×¶óÁ¦ ÀúÇØÁ¦ µîÀ» Åõ¿©ÇÑ´Ù.
3) ·çÇÁÀÌ´¢Á¦(¿¡Å¸Å©¸°»ê, Ǫ·Î¼¼¹Ìµå, ¾ÆÁ¶¼¼¹Ìµå, ÇÇ·¹Å¸´Ïµå, ºÎ¸ÞŸ´Ïµå µî)¿ÍÀÇ º´¿ë¿¡ ÀÇÇØ ½Åµ¶¼º ¹× û°¢±âµ¶¼ºÀÌ Áõ°µÉ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇÑ ÀÌ´¢Á¦¿Í´Â º´¿ëÅõ¿©ÇÏÁö ¾Ê´Â´Ù.
4) ¼¼ÆÈ·Î½ºÆ÷¸°°è¿Í ´Ù¸¥ ¾Æ¹Ì³ë±Û¸®ÄÚ»çÀ̵å°è Ç×»ý¹°Áú°úÀÇ º´¿ë¿¡ ÀÇÇØ ½Åµ¶¼ºÀÌ Áõ°¡Çß´Ù´Â º¸°í°¡ ÀÖ´Ù.
5) ½ÅÀå¾Ö ¶Ç´Â Á¦8³ú½Å°æÀå¾Ö¸¦ ÀÏÀ¸Å³ ¼ö ÀÖ´Â ¾à¹°°ú´Â º´¿ëÅõ¿©ÇÏÁö ¾Ê´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù. : ´Ù¸¥ ¾Æ¹Ì³ë±Û¸®ÄÚ»çÀ̵å°è Ç×»ý¹°Áú, ¼¼ÆÈ·Î½ºÆ÷¸°°è, ºñ¿À¸¶À̽Å, Æú¸®¹Í½Å B, Äݸ®½ºÆ¾, ¹é±ÝÇÔÀ¯ Ç׾ǼºÁ¾¾çÁ¦(½Ã½ºÇöóƾ, Ä«¸£º¸Çöóƾ, ³×´ÙÇÃ¶óÆ¾ µî), ¹ÝÄÚ¸¶À̽Å, ¿£ºñ¿À¸¶À̽Å, ½ÃŬ·Î½ºÆ÷¸°, ¾ÏÆ÷Å׸®½Å B, Ÿũ·Î¸®¹«½º µî |
| Off-label Usage |
[Á¶È¸]
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Dµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
ÀÓ»êºÎ ¶Ç´Â ÀӽŰèȹÁß º¹¿ë±ÝÁö |
|
 |
¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Gentamicin¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Aminoglycosides like gentamicin "irreversibly" bind to specific 30S-subunit proteins and 16S rRNA. Specifically gentamicin binds to four nucleotides of 16S rRNA and a single amino acid of protein S12. This interferes with decoding site in the vicinity of nucleotide 1400 in 16S rRNA of 30S subunit. This region interacts with the wobble base in the anticodon of tRNA. This leads to interference with the initiation complex, misreading of mRNA so incorrect amino acids are inserted into the polypeptide leading to nonfunctional or toxic peptides and the breakup of polysomes into nonfunctional monosomes.
|
| Pharmacology |
Gentamicin¿¡ ´ëÇÑ Pharmacology Á¤º¸ Gentamicin is a broad spectrum aminoglycoside antibiotic. Aminoglycosides work by binding to the bacterial 30S ribosomal subunit, causing misreading of t-RNA, leaving the bacterium unable to synthesize proteins vital to its growth. Aminoglycosides are useful primarily in infections involving aerobic, Gram-negative bacteria, such as Pseudomonas, Acinetobacter, and Enterobacter. In addition, some mycobacteria, including the bacteria that cause tuberculosis, are susceptible to aminoglycosides. Infections caused by Gram-positive bacteria can also be treated with aminoglycosides, but other types of antibiotics are more potent and less damaging to the host. In the past the aminoglycosides have been used in conjunction with penicillin-related antibiotics in streptococcal infections for their synergistic effects, particularly in endocarditis. Aminoglycosides are mostly ineffective against anaerobic bacteria, fungi and viruses.
|
| Protein Binding |
Gentamicin¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Low (between 0 and 30%)
|
| Half-life |
Gentamicin¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 3-3¨ö hours in infants one week to six months of age; this increases to 5¨ö hours in full-term and large premature infants less than one week old.
|
| Absorption |
Gentamicin¿¡ ´ëÇÑ Absorption Á¤º¸ Injections lead to peak serum concentrations in 30-60 minutes. Topical gentamicin is readily absorbed from large burned, denuded, or granulating areas but not through intact skin. Absorption of gentamicin is faster and greater with the cream compared to the ointment. Gentamicin is absorbed in small quantities following topical application to the eye. Gentamicin is also absorbed in small amounts following topical application to the ear (especially if the eardrum is perforated or if tissue damage is present).
|
| Toxicity |
Gentamicin¿¡ ´ëÇÑ Toxicity Á¤º¸ Mouse, intravenous LD50: 52 mg/kg; rat, intravenous LD50: 96 mg/kg.
|
| Drug Interactions |
Gentamicin¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Atracurium The agent increases the effect of muscle relaxantDoxacurium The agent increases the effect of muscle relaxantGallamine Triethiodide The agent increases the effect of muscle relaxantMetocurine The agent increases the effect of muscle relaxantMivacurium The agent increases the effect of muscle relaxantPancuronium The agent increases the effect of muscle relaxantPipecuronium The agent increases the effect of muscle relaxantRocuronium The agent increases the effect of muscle relaxantSuccinylcholine The agent increases the effect of muscle relaxantTubocurarine The agent increases the effect of muscle relaxantVecuronium The agent increases the effect of muscle relaxantBumetanide Increased ototoxicityEthacrynic acid Increased ototoxicityFurosemide Increased ototoxicityTorasemide Increased ototoxicityThalidomide Thalidomide increases the renal toxicity of the aminoglycosideCisplatin Increased risk of nephrotoxicityCefradine Increased risk of nephrotoxicityCephapirin Increased risk of nephrotoxicityCefamandole Increased risk of nephrotoxicityCefazolin Increased risk of nephrotoxicityCefonicid Increased risk of nephrotoxicityCefoperazone Increased risk of nephrotoxicityCeforanide Increased risk of nephrotoxicityCefotaxime Increased risk of nephrotoxicityCefotetan Increased risk of nephrotoxicityCefoxitin Increased risk of nephrotoxicityCeftazidime Increased risk of nephrotoxicityCeftizoxime Increased risk of nephrotoxicityCeftriaxone Increased risk of nephrotoxicityCefuroxime Increased risk of nephrotoxicityCephalothin Group Increased risk of nephrotoxicity
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Gentamicin¿¡ ´ëÇÑ Description Á¤º¸ A complex of three different closely related aminoglycoside sulfates, Gentamicins C1, C2, and C1(subA), obtained from Micromonospora purpurea and related species. They are broad-spectrum antibiotics, but may cause ear and kidney damage. They act to inhibit protein synthesis (genetic translation). [PubChem]
|
| Drug Category |
Gentamicin¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Bacterial AgentsProtein Synthesis Inhibitors
|
| Smiles String Canonical |
Gentamicin¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CNC(C)C1CCC(N)C(O1)OC1C(N)CC(N)C(OC2OCC(C)(O)C(NC)C2O)C1O
|
| Smiles String Isomeric |
Gentamicin¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CN[C@H](C)[C@@H]1CC[C@@H](N)[C@@H](O1)O[C@H]1[C@H](N)C[C@H](N)[C@@H](O[C@@H]2OC[C@@](C)(O)[C@H](NC)[C@H]2O)[C@@H]1O
|
| InChI Identifier |
Gentamicin¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C21H43N5O7/c1-9(25-3)13-6-5-10(22)19(31-13)32-16-11(23)7-12(24)17(14(16)27)33-20-15(28)18(26-4)21(2,29)8-30-20/h9-20,25-29H,5-8,22-24H2,1-4H3
|
| Chemical IUPAC Name |
Gentamicin¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 2-[4,6-diamino-3-[3-amino-6-(1-methylaminoethyl)oxan-2-yl]oxy-2-hydroxycyclohexyl]oxy-5-methyl-4-methylaminooxane-3,5-diol
|
| Drug-Induced Toxicity Related Proteins |
GENTAMICIN ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Phospholipase A Drug:gentamicin Toxicity:aminoglycoside toxicity. [¹Ù·Î°¡±â] Replated Protein:phospholipases C Drug:gentamicin Toxicity:aminoglycoside toxicity. [¹Ù·Î°¡±â] Replated Protein:Angiotensinase A Drug:gentamicin Toxicity:important consequences upon renal function and metabolism. [¹Ù·Î°¡±â] Replated Protein:Dipeptidylpeptidase IV Drug:gentamicin Toxicity:important consequences upon renal function and metabolism. [¹Ù·Î°¡±â] Replated Protein:Sodium/potassium-transporting ATPase Drug:Gentamicin Toxicity:necrosis. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2026-03-04
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|