|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
646000460[A10052271]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1g(2007.11.15)(ÇöÀç¾à°¡)
\144 ¿ø/1g(2004.07.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
Èò»öÀÇ Å©¸²Á¦ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
ÀÚ»çÆ÷Àå´ÜÀ§¿¡ µû¸§ |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 10±×·¥ |
1 °³ |
Æ©ºê |
8806460004600 |
8806460004617 |
|
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
½ÀÁø¤ýÇǺο°±º(¸¸¼º´Ü¼øÅ¼±, Áö·çÇǺο°, ÁøÇ༺ ÁöÀå°¢ÇÇÁõ), °Ç¼±, ¾çÁø±º(±¸ÁøµÎµå·¯±â)
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
1ÀÏ 1-3ȸ ¼Ò·®À» ȯºÎ¿¡ ¹Ù¸¥´Ù.
|
| ±Ý±â |
1) ¼¼±Õ(ÇǺΰáÇÙ, ¸Åµ¶ µî)¤ýÁø±Õ(ĵð´ÙÁõ, ¹é¼± µî)¤ý¹ÙÀÌ·¯½º(´ë»óÆ÷Áø, ´Ü¼øÆ÷Áø, ¼öµÎ, Á¾µÎÁõ µî)¤ýµ¿¹°(¿È, »ç¸é¹ßÀÌ µî)¼º ÇǺΰ¨¿°Áõ ȯÀÚ(Áõ»óÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù)
2) ÀÌ ¾à ¶Ç´Â ÀÌ ¾à ¼ººÐ¿¡ °ú¹ÎÁõ ¹× ±× º´·ÂÀÌ Àִ ȯÀÚ
3) °í¸· õ°øÀÌ ÀÖ´Â ½ÀÁø¼º ¿ÜÀ̵µ¿° ȯÀÚ(õ°øºÎÀ§ÀÇ Ä¡À¯Áö¿¬ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù)
4) ±Ë¾ç(º£Ã¼Æ®º´ Á¦¿Ü), Á¦2µµ ½ÉÀ缺 ÀÌ»óÀÇ È»ó¤ýµ¿»ó ȯÀÚ(ÇǺÎÀç»ýÀÌ ¾ïÁ¦µÇ¾î Ä¡À¯°¡ Áö¿¬µÉ ¼ö ÀÖ´Ù)
5) ÀÔÁÖÀ§ÇǺο°, º¸Åë¿©µå¸§, ÁÖ»ç ȯÀÚ
6) ¾ÆÅäÇÇÇǺο° ȯÀÚ
7) ¿µ¤ýÀ¯¾Æ |
| ½ÅÁßÅõ¿© |
1) ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀÎ ¹× ¼öÀ¯ºÎ
2) ¼Ò¾Æ
3) °í·ÉÀÚ
4) ÀÌ ¾àÀº ÇÁ·ÎÇÊ·»±Û¸®ÄÝÀ» ÇÔÀ¯Çϰí ÀÖÀ¸¹Ç·Î ÀÌ ¼ººÐ¿¡ °ú¹ÎÇϰųª ¾Ë·¹¸£±â º´·ÂÀÌ Àִ ȯÀÚ¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù. |
| ÀÌ»ó¹ÝÀÀ |
1) ÇǺÎ
¨ç °¨¿°Áõ : ÇǺÎÀÇ ¼¼±Õ¼º(Àü¿°¼º ³ó°¡Áø, ¸ð³¶¿° µî) ¹× Áø±Õ¼º(ĵð´ÙÁõ, ¹é¼± µî) °¨¿°ÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù[¹ÐºÀºØ´ë¹ý(ODT)ÀÇ °æ¿ì ³ªÅ¸³ª±â ½±´Ù]. ÀÌ¿Í °°Àº Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â ÀûÀýÇÑ Ç×±ÕÁ¦³ª Ç×Áø±ÕÁ¦ µîÀ» º´¿ëÇϰí Áõ»óÀÌ ½Å¼ÓÈ÷ °³¼±µÇÁö ¾ÊÀ» °æ¿ì¿¡´Â »ç¿ëÀ» ÁßÁöÇÑ´Ù.
¨è ÀϹÝÀû ÇǺÎÁõ»ó : ¸ð³¶¿°, ºÎ½º·³, ÇǺÎÀÚ±Ø, ÀÚÅë, ¹ß¿, ÀÛ¿°¨, ¹ßÁø, ¹ßÀû, È«Á¶, °¡·Á¿ò, ÇǺΰÇÁ¶, ³óÆ÷¼ºÇǺο°, ¾Ë·¹¸£±â¼º Á¢ÃËÇǺο°, ¶¡¶ì, ÇÑÁø, »óó¾ÇÈ, ¿åâ, ³óÆ÷Áõ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¸ç, ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â »ç¿ëÀ» ÁßÁöÇÑ´Ù.
¨é Àå±â ¿¬¿ë : ½ºÅ×·ÎÀ̵强 ¿©µå¸§, ½ºÅ×·ÎÀ̵强 ÇǺÎ(ÇǺÎÀ§Ãà, ¸ð¼¼Ç÷°üÈ®Àå, ÀÚ¹Ý), ½ºÅ×·ÎÀ̵强 ÁÖ»ç, ÀÔÁÖÀ§ÇǺο°(ÀÔÁÖÀ§¤ý¾È¸éÀüü¿¡ È«¹Ý, ±¸Áø, ¸ð¼¼Ç÷°üÈ®Àå, µüÁö, Àμ³), ¾î¸°¼±(åÛ×÷àÈ)¾ç ÇǺκ¯È, ´Ù¸ð, »ö¼ÒÅ»½Ç, ¼±Á¶, ¼öÆ÷¼ºÇǺο°, ¾ÆÅäÇÇÇǺο°, ÇǺÎÃâÇ÷ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â õõÈ÷ »ç¿ë·®À» ÁÙ¿© ÄÚ¸£Æ¼ÄÚÀ̵带 ÇÔÀ¯ÇÏÁö ¾ÊÀº ¾àÀ¸·Î ¹Ù²Ù¾î »ç¿ëÇÑ´Ù.
2) ³»ºÐºñ°è : ´ë·® ¶Ç´Â Àå±â°£¿¡ °ÉÄ£ ±¤¹üÀ§ÇÑ »ç¿ë, ¹ÐºÀºØ´ë¹ý¿¡ ÀÇÇØ ÄÚ¸£Æ¼ÄÚÀ̵å Àü½Å Åõ¿©¿Í °°Àº ³úÇϼöü¤ýºÎ½ÅÇÇÁú°è ±â´ÉÀÇ ¾ïÁ¦¸¦ °¡Á®¿Ã ¼ö ÀÖÀ¸¹Ç·Î Ưº°ÇÑ °æ¿ì¸¦ Á¦¿ÜÇϰí´Â ¹ÐºÀºØ´ë¹ýÀ̳ª Àå±â°£ ¶Ç´Â ´ë·® »ç¿ëÀ» ÇÏÁö ¾Ê´Â´Ù.
3) ´« : ¾È°ËÇǺο¡ »ç¿ë½Ã ¾È¾Ð »ó½Â, ³ì³»ÀåÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù. ´ë·® ¶Ç´Â Àå±â°£¿¡ °ÉÄ£ ±¤¹üÀ§ÇÑ »ç¿ë, ƯÈ÷ ¹ÐºÀºØ´ë¹ýÀ» »ç¿ëÇÒ °æ¿ì Èij¶ÇϹ鳻Àå, ³ì³»Àå µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| ¼ººÐÄÚµå |
M085738/ÃÊ»êµðÇÁ·Î¶ó¼Õ 0.5¹Ð¸®±×·¥ /
|
| ´ëÇ¥ÄÚµå |
8806460004600 |
| BIT ¾àÈ¿ºÐ·ù |
¿Ü¿ë ½ºÅ×·ÎÀ̵å (Steroids : Skin & Mucous Membrane)
|
| ATC ÄÚµå |
Diflorasone / D07AC10
[ÄÚµåºÐ·ù»ó¼¼¼³¸í]
[ATCÄÚµå¿¹Ãø]
|
| º¹ÁöºÎºÐ·ùÄÚµå |
264 (ÁøÅ롤Áø¾ç¡¤¼ö·Å¡¤¼Ò¿°Á¦ )
|
| ÀǾàǰ ¹ÙÄÚµåÁ¤º¸ |
³»¿ëº¸±â
·Î¾Æ¼ÖÅ©¸²(ÃÊ»êµðÇÁ·Î¶ó¼Õ)/ A10052271
Á¦Ç°±Ô°Ý: 10±×·¥/Á¦Ç°¼ö·®: 1/Á¦Çü: °³
Æû¸ñ±âÁØÄÚµå: 200401343 /´ëÇ¥ÄÚµå: 8806460004600/Ç¥ÁØÄÚµå: 8806460004617
±¸¹ÙÄÚµå: -/ºñ°í:-
|
ÁÖ¼ººÐÄÚµå ºÐ¼® ¹× Áߺ¹Ã³¹æ °ËÅä |
[ÁÖ¼ººÐÄÚµå ºÐ¼® ¹× Áߺ¹Ã³¹æ °ËÅä]
|
| Drugs By Indication |
[Àüüº¸±â]
|
| Drugs By Classification |
[Àüüº¸±â]
|
|
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
(diflorasone diacetate topical )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Á¦Çüº° º¹¾àÁöµµ |
[Å©¸²] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Diflorasone¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ The precise mechanism of the antiinflammatory activity of topical steroids in the treatment of steroid-responsive dermatoses, in general, is uncertain. However, corticosteroids are thought to act by the induction of phospholipase A2 inhibitory proteins, collectively called lipocortins. It is postulated that these proteins control the biosynthesis of potent mediators of inflammation such as prostaglandins and leukotrienes by inhibiting the release of their common precursor arachidonic acid. Arachidonic acid is released from membrane phospholipids by phospholipase A2.
|
| Pharmacology |
Diflorasone¿¡ ´ëÇÑ Pharmacology Á¤º¸ Like other topical corticosteroids, diflorasone has anti-inflammatory, antipruritic, and vasoconstrictive properties. Once absorbed through the skin, topical corticosteroids are handled through pharmacokinetic pathways similar to systemically administered corticosteroids. Diflorasone is a potent topical corticosteroid that should not be used with occlusive dressings. It is recommended that treatment should be limited to 2 consecutive weeks and therapy should be discontinued when adequate results have been achieved.
|
| Metabolism |
Diflorasone¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Not Available
|
| Protein Binding |
Diflorasone¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Bound to plasma proteins in varying degrees.
|
| Half-life |
Diflorasone¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ Not Available
|
| Absorption |
Diflorasone¿¡ ´ëÇÑ Absorption Á¤º¸ Topical corticosteroids can be absorbed from intact healthy skin. The extent of percutaneous absorption of topical corticosteroids is determined by many factors, including the vehicle and the integrity of the epidermal barrier. Occlusion, inflammation and/or other disease processes in the skin may also increase percutaneous absorption.
|
| Pharmacokinetics |
Diflorasone DiacetateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : ±¹¼Ò Àû¿ë½Ã Èí¼ö´Â °ÅÀÇ µÇÁö ¾ÊÀ¸¸ç ¾à 1% Á¤µµ°¡ Àü½Å ¼øÈ¯À¸·Î Èí¼öµÇ°í, ¹ÐºÀÇÏ´Â °æ¿ì °æÇÇÈí¼ö°¡ Áõ°¡µÈ´Ù.
- ´ë»ç : ÁÖ·Î °£¿¡¼ ´ë»ç
|
| Biotransformation |
Diflorasone¿¡ ´ëÇÑ Biotransformation Á¤º¸ Metabolized, primarily in the liver, and then excreted by the kidneys.
|
| Toxicity |
Diflorasone¿¡ ´ëÇÑ Toxicity Á¤º¸ Topically applied diflorasone can be absorbed in sufficient amounts to produce systemic effects. Symptoms of overdose include thinning of skin and suppression of adrenal cortex (decreased ability to respond to stress).
|
| Drug Interactions |
Diflorasone¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Diflorasone¿¡ ´ëÇÑ Food Interaction Á¤º¸ Not Available
|
| Drug Target |
[Drug Target]
|
| Description |
Diflorasone¿¡ ´ëÇÑ Description Á¤º¸ Diflorasone is a corticosteroid.
|
| Drug Category |
Diflorasone¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-inflammatory AgentsGlucocorticoids
|
| Smiles String Canonical |
Diflorasone¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC1CC2C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1(OC(C)=O)C(=O)COC(C)=O
|
| Smiles String Isomeric |
Diflorasone¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@H]1C[C@H]2[C@@H]3C[C@H](F)C4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)[C@@]1(OC(C)=O)C(=O)COC(C)=O
|
| InChI Identifier |
Diflorasone¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C26H32F2O7/c1-13-8-17-18-10-20(27)19-9-16(31)6-7-23(19,4)25(18,28)21(32)11-24(17,5)26(13,35-15(3)30)22(33)12-34-14(2)29/h6-7,9,13,17-18,20-21,32H,8,10-12H2,1-5H3/t13-,17-,18-,20-,21-,23-,24-,25-,26-/m0/s1
|
| Chemical IUPAC Name |
Diflorasone¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ [(6S,8S,9R,10S,11S,13S,14S,16S,17R)-17-(2-acetyloxyacetyl)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] acetate
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2026-03-04
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|