| |
|
|
|
|
|
 |
| |
|
ÄÝÇÇÆ®ÁúÁ¤100mg(Ŭ·ÎÆ®¸®¸¶Á¹) Colpit Vaginal Tab. 100mg
|
|
ÀϹÝÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
690302230
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1Á¤(2024.11.01)(ÇöÀç¾à°¡)
\245 ¿ø/1Á¤(2020.04.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
Èò»ö À广ÇüÀÇ ÁúÁ¤Á¦ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
6Á¤/Æ÷,100Á¤/º´ |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 100¹Ð¸®±×·¥ |
100 Á¤ |
º´ |
8806903022307 |
8806903022321 |
|
| 100¹Ð¸®±×·¥ |
6 Á¤ |
Æ÷ |
8806903022307 |
8806903022314 |
|
|
| ÁÖ¼ººÐÄÚµå |
137401CTB
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
ĵð´Ù¼º Áú¿°
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¼ºÀÎ : º¸Åë 1ÀÏ 1ȸ Ŭ·ÎÆ®¸®¸¶Á¹·Î¼ 100 mgÀ» ¿¬¼Ó 6Àϰ£ Ãëħ½Ã¿¡ Áú³» ±í¼÷ÀÌ »ðÀÔÇÑ´Ù. ´Ü±â¿ä¹ýÀ¸·Î º¸Åë ¼ºÀÎ 1ÀÏ 1ȸ Ŭ·ÎÆ®¸®¸¶Á¹·Î¼ 200 mgÀ» ¿¬¼Ó 3Àϰ£ Ãëħ½Ã Áú³» ±í¼÷ÀÌ »ðÀÔÇÑ´Ù.
|
| ÁÖ¿ä¾à¹° »óÈ£ÀÛ¿ë |
[Á¶È¸]
|
| ±Ý±â |
ÀÌ ¾àÀÇ ÁÖ¼ººÐ ¶Ç´Â ±¸¼º¼ººÐ¿¡ °ú¹Î¹ÝÀÀ ¹× ±× º´·ÂÀÌ Àִ ȯÀÚ |
| ½ÅÁßÅõ¿© |
1) ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ¿©¼º
(1) »ý½Ä´É·Â¿¡ ´ëÇÑ ÀÓ»ó½ÃÇèÀº ÀÌ·ç¾îÁöÁö ¾Ê¾ÒÀ¸³ª, µ¿¹°½ÇÇè °á°ú ÀÌ ¾à°ú °ü·ÃµÈ »ý½Ä´É·Â(Fertility)ÀÌ»óÀº ³ªÅ¸³ªÁö ¾Ê¾Ò½À´Ï´Ù.
(2) µ¿¹°½ÇÇè¿¡¼ ÀÌ ¾à°ú °ü·ÃµÈ ±âÇü¹ß»ýÀÛ¿ëÀÌ º¸°íµÇÁö ¾Ê¾Ò½À´Ï´Ù. ÀÌ ¾àÀ» ÀӽűⰣ µ¿¾È »ç¿ëÇÒ ¼ö ÀÖÀ¸³ª, ÀÇ»çÀÇ Áø´Ü ÇÏ¿¡¼¸¸ »ç¿ëÇÏ¿©¾ß ÇÕ´Ï´Ù.
(3) ÀӽŠ±â°£ µ¿¾È¿¡´Â Áú Á¤Á¦ÀÇ »ç¿ë ½Ã »ðÀԱⱸÀÇ »ç¿ëÀº ÇÇÇϵµ·Ï ÇÕ´Ï´Ù.
2) ¼öÀ¯ºÎ
Ŭ·ÎÆ®¸®¸¶Á¹ÀÇ »ç¶÷ ¸ðÀ¯·Î ÀÌÇà¿¡ °üÇÑ ÀÚ·á´Â ¾ø½À´Ï´Ù. ±×·¯³ª, ±¹¼Ò Åõ¿© ÈÄ Àü½Å Èí¼ö°¡ °ÅÀÇ Àû°í Àü½Å È¿°ú¸¦ À¯¹ßÇÒ °¡´É¼ºÀÌ ³·½À´Ï´Ù. Ŭ·ÎÆ®¸®¸¶Á¹Àº ¼öÀ¯ Áß¿¡ »ç¿ëÇÒ ¼ö ÀÖÀ¸³ª, ÀÇ»ç¿Í »óÀÇÇϽñ⠹ٶø´Ï´Ù. |
| ÀÌ»ó¹ÝÀÀ |
´ÙÀ½°ú °°Àº °æ¿ì ÀÌ ¾àÀÇ »ç¿ëÀ» Áï°¢ ÁßÁöÇϰí ÀÇ»ç, Ä¡°úÀÇ»ç, ¾à»ç¿Í »óÀÇÇϽʽÿÀ. »ó´ã½Ã °¡´ÉÇÑ ÇÑ ÀÌ Ã·ºÎ¹®¼¸¦ ¼ÒÁöÇϽʽÿÀ.
1) ¸é¿ª°è Àå¾Ö: ¾Æ³ªÇʶô½Ã½º ¹ÝÀÀ, ¸Æ°ü(Ç÷°ü) ºÎÁ¾, °ú¹Î(Áõ)
2) Ç÷°ü¼º Àå¾Ö: ½Ç½Å, ÀúÇ÷¾Ð
3) È£Èí±â, ÈäºÎ ¹× Á¾°Ý(¼¼·ÎÄ) Àå¾Ö: È£Èí °ï¶õ
4) À§Àå Àå¾Ö: º¹Åë, ¿À½É(±¸¿ª)
5) ÇǺΠ¹× ÇÇÇÏ(ÇǺιØ) Á¶Á÷ Àå¾Ö: ¹ßÁø, ´ã¸¶Áø(µÎµå·¯±â), ¼Ò¾çÁõ
6) »ý½Ä°è ¹× À¯¹æ Àå¾Ö: Áú ¹Ú¸®(¹þ°ÜÁü), Áú ºÐºñ¹°, Áú ÃâÇ÷, ¿ÜÀ½Áú ºÒÆí°¨, ¿ÜÀ½Áú È«¹Ý(ºÓÀº ¹ÝÁ¡), ¿ÜÀ½Áú ÀÛ¿°¨(Ȳö°¨), ¿ÜÀ½Áú ¼Ò¾çÁõ, ¿ÜÀ½Áú ÅëÁõ
7) ÀϹÝÀû Àå¾Ö ¹× Åõ¿© ºÎÀ§ »óÅÂ: Àû¿ë ºÎÀ§ ÀÚ±Ø, ºÎÁ¾(ºÎ±â), ÅëÁõ
|
| »óÈ£ÀÛ¿ë |
ÀÌ ¾àÀ» »ç¿ëÇÏ´Â µ¿¾È ´ÙÀ½ÀÇ ¾àÀ» »ç¿ëÇÏÁö ¸¶½Ê½Ã¿À.
ÀÌ ¾à°ú °æ±¸¿ë Ÿũ·Î¸®¹«½º(FK-506; ¸é¿ª¾ïÁ¦Á¦)¸¦ º´¿ë Åõ¿© ½Ã, Ç÷Àå ³» Ÿũ·Î¸®¹«½º ¶Ç´Â ½Ã·Ñ¸®¹«½ºÀÇ ³óµµ°¡ »ó½ÂÇÒ ¼ö ÀÖ½À´Ï´Ù. µû¶ó¼ ȯÀڵ鿡°Ô¼ Ÿũ·Î¸®¹«½º ȤÀº ½Ã·Ñ¸®¹«½º °ú·®Åõ¿© Áõ»óÀÌ ³ªÅ¸³ª´ÂÁö öÀúÈ÷ ¸ð´ÏÅ͸µ Çϵµ·Ï Çϰí, ÇÊ¿äÇÏ¸é °¢°¢ÀÇ Ç÷Àå ¼öÄ¡¸¦ ÃøÁ¤ÇÏ¿© ¸ð´ÏÅ͸µ Çϵµ·Ï ÇÕ´Ï´Ù. |
| Off-label Usage |
[Á¶È¸]
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Bµî±Þ
(clotrimazole vaginal use )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Á¦Çüº° º¹¾àÁöµµ |
[ÁúÁ¤] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Clotrimazole¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Clotrimazole interacts with yeast 14-¥á demethylase, a cytochrome P-450 enzyme that converts lanosterol to ergosterol, an essential component of the membrane. In this way, clotrimazole inhibits ergosterol synthesis, resulting in increased cellular permeability. Clotrimazole may also inhibit endogenous respiration, interact with membrane phospholipids, inhibit the transformation of yeasts to mycelial forms and the uptake of purine, impair triglyceride and/or phospholipid biosynthesis, and inhibit the movement of calcium and potassium ions across the cell membrane by blocking the ion transport pathway known as the Gardos channel.
|
| Pharmacology |
Clotrimazole¿¡ ´ëÇÑ Pharmacology Á¤º¸ Clotrimazole, an imidazole derivative with a broad spectrum of antimycotic activity, inhibits biosynthesis of the sterol ergostol, an important component of fungal cell membranes. Its action leads to increased membrane permeability and apparent disruption of enzyme systems bound to the membrane. Betamethasone and clotrimazole are used together to treat cutaneous tinea infections. In studies in fungal cultures, the minimum fungicidal concentration of clotrimazole caused leakage of intracellular phosphorous compounds into the ambient medium with concomitant breakdown of cellular nucleic acids, and accelerated potassium etflux. Both of these events began rapidly and extensively after addition of the drug to the cultures. The primary action of clotrimazole is against dividing and growing organisms.
|
| Metabolism |
Clotrimazole¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 11A1 (CYP11A1)Cytochrome P450 1A2 (CYP1A2)Cytochrome P450 2D6 (CYP2D6)
|
| Protein Binding |
Clotrimazole¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 90%
|
| Half-life |
Clotrimazole¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 2 hours
|
| Absorption |
Clotrimazole¿¡ ´ëÇÑ Absorption Á¤º¸ Poorly and erratically absorbed orally, minimal vaginal or topical absorption.
|
| Pharmacokinetics |
ClotrimazoleÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : ¿Ü¿ë : Á¤»ó ÇǺθ¦ ÅëÇØ¼´Â °ÅÀÇ Èí¼öµÇÁö ¾Ê´Â´Ù.
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ :
- Troches : Ÿ¾× ³óµµ : 3½Ã°£ À̳»
- Áú Å©¸² : Áú³» ³óµµ : 8-24 ½Ã°£ À̳»
- ÁúÁ¤ : Áú³» ³óµµ : 1-2 ÀÏ À̳»
- ¼Ò½Ç : ´ë»çü·Î ´ãÁó¹è¼³
|
| Biotransformation |
Clotrimazole¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic (metabolized to inactive metabolites)
|
| Toxicity |
Clotrimazole¿¡ ´ëÇÑ Toxicity Á¤º¸ Symptoms of overdose include erythema, stinging, blistering, peeling, edema, pruritus, urticaria, burning, and general irritation of the skin, and cramps.
|
| Drug Interactions |
Clotrimazole¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Clotrimazole¿¡ ´ëÇÑ Food Interaction Á¤º¸ Not Available
|
| Drug Target |
[Drug Target]
|
| Description |
Clotrimazole¿¡ ´ëÇÑ Description Á¤º¸ An imidazole derivative with a broad spectrum of antimycotic activity. It inhibits biosynthesis of the sterol ergostol, an important component of fungal cell membranes. Its action leads to increased membrane permeability and apparent disruption of enzyme systems bound to the membrane. [PubChem]
|
| Dosage Form |
Clotrimazole¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Cream IntravaginalCream Topical
|
| Drug Category |
Clotrimazole¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Infective Agents, LocalAntifungal AgentsGrowth Inhibitors
|
| Smiles String Canonical |
Clotrimazole¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ ClC1=CC=CC=C1C(N1C=CN=C1)(C1=CC=CC=C1)C1=CC=CC=C1
|
| Smiles String Isomeric |
Clotrimazole¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ ClC1=CC=CC=C1C(N1C=CN=C1)(C1=CC=CC=C1)C1=CC=CC=C1
|
| InChI Identifier |
Clotrimazole¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C22H17ClN2/c23-21-14-8-7-13-20(21)22(25-16-15-24-17-25,18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-17H
|
| Chemical IUPAC Name |
Clotrimazole¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 1-[(2-chlorophenyl)-di(phenyl)methyl]imidazole
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2026-03-06
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|