| |
|
|
|
|
|
 |
| |
|
Ƽ´Ï¾îÅ©¸²(¿°»êºÎÅ׳ªÇÉ)
|
|
ÀϹÝÀǾàǰ | ºñ±Þ¿©
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
ºñ±Þ¿©
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
ƯÀÌÇÑ ³¿»õ°¡ ÀÖ´Â Èò»öÀÇ Å©¸² [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
ÀÚ»çÆ÷Àå´ÜÀ§¿¡ µû¸§ |
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
´ÙÀ½ÀÇ ÇǺÎÁø±ÕÁõ
1) ¹é¼± : Á·ºÎ¹é¼±(¹ß¹é¼±Áõ,¹«Á»), °íºÎ¹é¼±(´ëÅðºÎ¹é¼±)(¿Ï¼±(»çŸ±¸´Ï¹é¼±(Áõ))), üºÎ¹é¼±
2) ¾î·ç·¯±â
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
1ÀÏ 1ȸ ȯºÎ(ÁúȯºÎÀ§)¿¡ ¹Ù¸¥´Ù.
Ä¡·á±â°£ ÀÌÈÄ¿¡µµ ÀÓ»óÀûÀÎ Áõ»óÀÌ °³¼±µÇÁö ¾ÊÀ¸¸é Áø´ÜÀ» ´Ù½Ã ÇØ¾ß ÇÑ´Ù.
|
| ÷°¡Á¦ ÁÖÀÇ»çÇ× |
* ÷°¡Á¦ ÁÖÀÇ»çÇ×Á¤º¸´Â ÇöÀç ¾÷µ¥ÀÌÆ®ÁßÀÌ¸ç ¹Ì¾÷µ¥ÀÌÆ®µÈ ÀǾàǰÀÇ Ã·°¡Á¦
ÁÖÀÇ»çÇ×Àº Ç¥½ÃµÇÁö ¾ÊÀ»¼ö ÀÖ½À´Ï´Ù.
÷°¡Á¦1 º¥Áú¾ËÄÚ¿Ã (ÁÖ»çÁ¦¿¡ ÇÑÇÔ.) ¡Û °æ°í
º¥Áú¾ËÄÚ¿ÃÀº ¹Ì¼÷¾Æ¿¡¼ Ä¡¸íÀûÀÎ °¡»Û È£ÈíÁõ»ó°ú ¿¬°üÀÌ ÀÖ´Â °ÍÀ¸·Î º¸°íµÇ¾ú´Ù.
¡Û ´ÙÀ½ ȯÀÚ¿¡´Â Åõ¿©ÇÏÁö ¸» °Í.
½Å»ý¾Æ, ¹Ì¼÷¾Æ(º¥Áú¾ËÄÚ¿ÃÀ» ÇÔÀ¯Çϰí ÀÖ´Ù.)
|
| ±Ý±â |
ÀÌ ¾à ¼ººÐ¿¡ °ú¹ÎÁõÀÇ º´·ÂÀÌ Àִ ȯÀÚ
|
| ½ÅÁßÅõ¿© |
¾Ë¸±¾Æ¹Î°è Ç×Áø±ÕÁ¦¿¡ ¹Î°¨ÇÑ È¯ÀÚ(±³Â÷¹ÝÀÀÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù)
|
| ÀÌ»ó¹ÝÀÀ |
ÇǺΠ: ¶§¶§·Î ±¹¼ÒÀڱذ¨, ¹ßÀû (ÃæÇ÷µÇ¾î ºÓ¾îÁü), È«¹Ý(ºÓÀº ¹ÝÁ¡), °¡·Á¿ò, Á¢ÃËÇǺο°, ¼öÆ÷(¹°Áý), µå¹°°Ô ¹Ì¶õ(Áþ¹«¸§), Àμ³(ºñ´Ã²®Áú), ±Õ¿(Æ´»õ,¿Ã¢)ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| Related FDA Approved Drug |
±âÁØ ¼ººÐ: BUTENAFINE HYDROCHLORIDELOTRIMIN ULTRA (BUTENAFINE HYDROCHLORIDE)
MENTAX (BUTENAFINE HYDROCHLORIDE)
MENTAX-TC (BUTENAFINE HYDROCHLORIDE)
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
ºñ±Þ¿©
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
|
| Á¦Ç°¼º»ó |
ƯÀÌÇÑ ³¿»õ°¡ ÀÖ´Â Èò»öÀÇ Å©¸²
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
ÀÚ»çÆ÷Àå´ÜÀ§¿¡ µû¸§ |
| º¸°ü¹æ¹ý |
Â÷±¤±â¹Ð¿ë±â, ½Ç¿Â(1¢¦30¡É)º¸°ü |
| ÷°¡Á¦ ÁÖÀÇ»çÇ× |
* ÷°¡Á¦ ÁÖÀÇ»çÇ×Á¤º¸´Â ÇöÀç ¾÷µ¥ÀÌÆ®ÁßÀÌ¸ç ¹Ì¾÷µ¥ÀÌÆ®µÈ ÀǾàǰÀÇ Ã·°¡Á¦
ÁÖÀÇ»çÇ×Àº Ç¥½ÃµÇÁö ¾ÊÀ»¼ö ÀÖ½À´Ï´Ù.
÷°¡Á¦1 º¥Áú¾ËÄÚ¿Ã (ÁÖ»çÁ¦¿¡ ÇÑÇÔ.) ¡Û °æ°í
º¥Áú¾ËÄÚ¿ÃÀº ¹Ì¼÷¾Æ¿¡¼ Ä¡¸íÀûÀÎ °¡»Û È£ÈíÁõ»ó°ú ¿¬°üÀÌ ÀÖ´Â °ÍÀ¸·Î º¸°íµÇ¾ú´Ù.
¡Û ´ÙÀ½ ȯÀÚ¿¡´Â Åõ¿©ÇÏÁö ¸» °Í.
½Å»ý¾Æ, ¹Ì¼÷¾Æ(º¥Áú¾ËÄÚ¿ÃÀ» ÇÔÀ¯Çϰí ÀÖ´Ù.)
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Bµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Á¦Çüº° º¹¾àÁöµµ |
[Å©¸²] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Butenafine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Like allylamines, butenafine inhibits ergosterol biosynthesis by blocking squalene epoxidation. As ergosterol is an essential component of the fungal cell membrane, inhibition of its synthesis results in increased cellular permeability causing leakage of cellular contents.
|
| Pharmacology |
Butenafine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Butenafine is an antifungal agent that acts by inhibiting squalene epoxidase, thus blocking the biosynthesis of ergosterol, an essential component of fungal cell membranes. It is mainly active against dermatophytes and has superior fungicidal activity against this group of fungi when compared to that of terbinafine, naftifine, tolnaftate, clotrimazole, and bifonazole. It is active also against Candida albicans and this activity is superior to that of terbinafine and naftifine. Butenafine also generates low MICs for Cryptococcus neoformans and Aspergillus spp. as well.
|
| Half-life |
Butenafine¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ Following topical application, a biphasic decline of plasma butenafine concentrations was observed with the half-lives estimated to be 35 hours initial and over 150 hours terminal.
|
| Absorption |
Butenafine¿¡ ´ëÇÑ Absorption Á¤º¸ The total amount absorbed through the skin into the systemic circulation has not been quantified.
|
| Pharmacokinetics |
Butenafine HClÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : ¿Ü¿ë : °ÅÀÇ Èí¼öµÇÁö ¾Ê´Â´Ù.
- ºÐÆ÷ : ÇǺο¡ ºÐÆ÷ÇÑ´Ù.
- ´ë»ç : °£´ë»çµÈ´Ù.
- ¹Ý°¨±â : 35½Ã°£
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : ¿Ü¿ë : 6-15 ½Ã°£
- ¼Ò½Ç : ¿Ü¿ë : ¼Ò·®ÀÌ ½Å¹è¼³µÈ´Ù.
|
| Biotransformation |
Butenafine¿¡ ´ëÇÑ Biotransformation Á¤º¸ The primary metabolite in urine was formed through hydroxylation at the terminal t-butyl side-chain.
|
| Toxicity |
Butenafine¿¡ ´ëÇÑ Toxicity Á¤º¸ Not Available
|
| Drug Interactions |
Butenafine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Butenafine¿¡ ´ëÇÑ Description Á¤º¸ Butenafine hydrochloride is a synthetic benzylamine antifungal agent. Butenafine works by inhibiting the synthesis of ergosterol by inhibiting squalene epoxidase, an enzyme responsible for the creation of sterols needed in fungal cell membranes.
|
| Drug Category |
Butenafine¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antifungal Agents
|
| Smiles String Canonical |
Butenafine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CN(CC1=CC=C(C=C1)C(C)(C)C)CC1=CC=CC2=CC=CC=C12
|
| Smiles String Isomeric |
Butenafine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CN(CC1=CC=C(C=C1)C(C)(C)C)CC1=CC=CC2=CC=CC=C12
|
| InChI Identifier |
Butenafine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C23H27N/c1-23(2,3)21-14-12-18(13-15-21)16-24(4)17-20-10-7-9-19-8-5-6-11-22(19)20/h5-15H,16-17H2,1-4H3
|
| Chemical IUPAC Name |
Butenafine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 1-(4-tert-butylphenyl)-N-methyl-N-(naphthalen-1-ylmethyl)methanamine
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2026-03-04
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|