|   | 
        
            
         | 
          | 
        
        
        
            | 
                
             | 
         
        
             | 
         
        
            
            
            
  
    
	  | 
   
  
    
        
          |   | 
          
              
                | 
                    Æä³×ÇǸ°ÄÚ¾à0.5%(¿°»êÆä´Ò¿¡ÇÁ¸°)  PHENEPHRINE NASAL SOL.[Phenylephrine HCl]  
                    
                 | 
               
              
                | 
                     ÀϹÝÀǾàǰ | »èÁ¦  
                        
                    	
                    
                 | 
               
              
                | 
					  
                  
				  
                 | 
               
              
              
              
              
              |   |  
              
                
                    
                        | 
                      ¾Ë¸²:  | 
                      µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. | 
                     
                    | 
               
            
              
                
                   
                   
                   
                   
		   
                 | 
               
              
                | 
                  
                  
                 | 
               
              | 
            | 
         
       
       | 
   
    |  
  
    | 
      
     | 
     
  |  
                              
                                  | 
                                   | 
                               
            
            
                
            
            
              
            
                            
              
                                                     
            
            
   |  
  
    | 
      
     | 
   
   
     | 
   
    
   
    | 
       
        À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
        ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
        À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
        ·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
       
     | 
   
  
     | 
   
   
  
    
      
	
	  
	     |  
	    
	      
	        
            
                | Çã°¡Á¤º¸ | 
                         
	         
	       | 
	     
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
   
    û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå  »óÇÑ±Ý¾× | 
    
      
      
        
        645903170[A01301981]  
	    
	    
          [º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸] 
          
        
        
        
          
          
            \0 ¿ø/1ml(2012.03.01)(ÇöÀç¾à°¡) 
            \14 ¿ø/1mL(2000.07.01)(º¯°æÀü¾à°¡)
        
          
            
	 
  	   
  	   
       
      
       
       
     
      
      
     
      
    
    
      
     [»óº´ÄÚµåÁ¶È¸]
      
     [Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
     [¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
     | 
   
   
    | ºü¸¥Á¶È¸ | 
    
      
     |   
   
  
  
   
    | Á¦Ç°¼º»ó | 
    
      ¹«»öÀÇ ¾×Á¦  
      
	    [Á¦ÇüÁ¤º¸ È®ÀÎ]
     |   
   
  
  
  
  
  
   
    | Æ÷À塤À¯Åë´ÜÀ§ | 
    5mg/mL¡¿500mL¡¿1EA | 
   
  
  
  
   
    | Æ÷À塤ÄÚµå´ÜÀ§ | 
    
        
        
            | ¾àǰ±Ô°Ý | 
            ´ÜÀ§ | 
            ´ëÇ¥ÄÚµå | 
            Ç¥ÁØÄÚµå | 
            ºñ°í | 
	     
        
        
            | 500¹Ð¸®¸®ÅÍ | 
            1 °³ | 
            8806459031709 | 
            8806459031716 | 
             | 
	     
        
         
     | 
   
      
  
  	
   
    | ÁÖ¼ººÐÄÚµå | 
    
      211904CLQ  
      
	  [µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
     | 
   
  
  
  
  
  	
   
    | ´ëÇ¥ÄÚµå | 
    8806459031709 | 
   
  
  
  
  
   
    | º¸°ü¹æ¹ý | 
    Â÷±¤±â¹Ð¿ë±â, 25¡ÉÀÌÇÏ º¸°ü | 
   
  
  
  
   
    | ¾à¸®ÀÛ¿ë | 
    
      
        [Á¶È¸]
     | 
      
  
  
  
  
   
    | È¿´ÉÈ¿°ú | 
    
    [ÀûÀÀÁõ º° °Ë»ö] 
      
    
     
	 
      °¨±â, °íÃÊ¿, ºÎºñ°¿°, »ó±âµµ ¾Ë·¹¸£±â¿¡ ÀÇÇÑ ºñÃæÇ÷ÀÇ ÀϽÃÀû °È 
[Drugbank ÀÇ ¼ººÐÁ¤º¸¿¶÷] [Phenylephrine]
      
      
      
      
     | 
   
  
  
  
  
  
  
  
  
    
  
  
   
    | ¿ë¹ý¿ë·® | 
    
      * Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù. 
    
     
      
      
     [󹿾à¾î] 
      [ÁÖ¼ººÐÄÚµå:211904CLQ ¿¡ µû¸¥ ½É»çÁöħ¿¶÷] 
¼ºÀÎ ¹× 12¼¼ ÀÌ»ó ¾î¸°ÀÌ : ¸Å 4½Ã°£ ÀÌ»óÀÇ °£°ÝÀ¸·Î °¢ ºñ°ø(Ä౸¸Û) ³»¿¡ 2-3¹æ¿ï¾¿ Á¡ÀûÇÑ´Ù.     
      	    
     | 
   
  
  
  
   
    | ÁÖ¿ä¾à¹° »óÈ£ÀÛ¿ë | 
    
        
	  [º¸±â]
     | 
   
  
  
  
  
  
  
  
   
    | ±Ý±â | 
    
      ÀÌ ¾à¿¡ °ú¹ÎÁõÀÇ º´·ÂÀÌ Àִ ȯÀÚ
     | 
   
  
  
  
  
   
    | ½ÅÁßÅõ¿© | 
    - °íÇ÷¾Ð, ½ÉÀ庴, ´ç´¢º´, °©»ó¼±±â´É Ç×ÁøÁõ, ³ì³»Àå ȯÀÚ 
 -  Áö±Ý±îÁö ºñ¿°¿ë ºÐ¹«Á¦¿¡ ÀÇÇØ ¾Ë·¹¸£±âÁõ»ó(¿¹¸¦µé¸é, ¹ßÁø, Á¾Ã¢, Àڱذ¨ µî) À» ÀÏÀ¸Å² ÀÏÀÌ Àִ ȯÀÚ 
 - ÀÇ»çÀÇ Ä¡·á¸¦ ¹Þ°í Àִ ȯÀÚ
 
  | 
   
  
  
  
   
    | ÀÌ»ó¹ÝÀÀ | 
    
      - °ú¹ÎÁõ:
   °ú¹ÎÁõ»óÀÌ ÀϾ´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÒ°Í 
 Á¤½Å½Å°æ°è: µå¹°°Ô ÁøÀü, ºÒ¸éÁõÀÌ ³ªÅ¸³¯¼ö ÀÖ´Ù 
¼øÈ¯±â°è: µå¹°°Ô ½É°èÇ×ÁøÀÌ ³ªÅ¸³¯¼ö ÀÖ´Ù 
ÄÚ :¶§¶§·Î ÀÚ±ØÅë, µå¹°°Ô ºñ·çÁõ»óÀÌ ³ªÅ¸³¯¼ö ÀÖ´Ù 
 ÀÌ ¾àÀÇ Åõ¿©¿¡ ÀÇÇØ ¹ßÁø, ¹ßÀû, Á¾Ã¢, Àڱذ¨µîÀÇ Áõ»óÀÌ ³ªÅ¸³¯¼ö °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇÑ´Ù
          
     | 
   
  
  
    
   
    | ÀϹÝÀû ÁÖÀÇ | 
    - ÀÌ ¾àÀº °úµµÇÏ°Ô »ç¿ëÇÏ¸é ¿ÀÈ÷·Á ÄÚ¸·ÈûÀ» ÀÏÀ¸Å³¼ö ÀÖÀ¸¹Ç·Î »ç¿ëÀÌ °úÇÏÁö ¾Êµµ·Ï ÇÑ´Ù 
 - Á¤ÇØÁø ¿ë¹ý.¿ë·®À» ÀßÁöŲ´Ù 
 - 3Àϰ£ º¹¿ëÇØµµ Áõ»óÀÇ °³¼±ÀÌ º¸ÀÌÁö ¾ÊÀ» °æ¿ì¿¡´Â ÀϽà Åõ¿©¸¦ ÁßÁöÇϰí ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇÑ´Ù 
 -  Àå±â°£ °è¼ÓÇÏ¿© Åõ¿©ÇÏÁö ¾Ê´Â´Ù
 
  | 
   
  
  
  
    
   
    | »óÈ£ÀÛ¿ë | 
    MAO¾ïÁ¦Á¦ÀÇ Åõ¿©Áß¿¡ Àִ ȯÀÚ¿¡´Â ±Þ°ÝÇÑ Ç÷¾Ð»ó½ÂµîÀ» ÀÏÀ¸Å³¼ö ÀÖÀ¸¹Ç·Î »ç¿ëÀ» ÇÇÇÑ´Ù. | 
   
  
  
  
   
    | ÀӺο¡ ´ëÇÑ Åõ¿© | 
    
      
	[ÀӺαݱ⠼ººÐ Á¶È¸]       
      ÀÓ½ÅÁßÀÇ Åõ¿©¿¡ ´ëÇÑ ¾ÈÀü¼ºÀÌ È®¸³µÇ¾î ÀÖÁö ¾ÊÀ¸¹Ç·Î ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀο¡´Â Ä¡·á»óÀÇ À¯ÀͼºÀÌ À§Ç輺À» »óȸÇÑ´Ù°í ÆÇ´ÜµÇ´Â °æ¿ì¿¡¸¸ Åõ¿©ÇÑ´Ù.
     | 
   
  
  
  
  
  
  
  
   
    | ¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿© | 
    
      
       
      - ¼Ò¾Æ¿¡ÀÇ »ç¿ë
- °ú·®Åõ¿©¿¡ ÀÇÇÏ¿© ¹ßÇÑ, ¼¸Æ, È¥¼öµîÀÇ Áõ»óÀÌ ³ªÅ¸³ª±â ½¬¿ì¹Ç·Î »ç¿ëÇÏÁö ¾Ê´Â °ÍÀÌ ÁÁ´Ù.
 - ºÎµæÀÌ »ç¿ëÇÏ´Â °æ¿ì¿¡´Â »ç¿ë¹æ¹ýÀ» Á¤È®È÷ ÁöµµÇÏ°í °æ°ú¸¦ ÃæºÐÈ÷ °üÂûÇÒ °Í.
 
  
  | 
   
  
  
  
  
  
  
  
  
  
  
  
    
   
    | Àû¿ë»óÀÇ ÁÖÀÇ | 
    - ÀÌ ¾àÀº ´«°ú ±Í¿¡´Â »ç¿ëÇÏÁö ¾Ê´Â´Ù 
 - ¿À¿°À» ¹æÁöÇϱâ À§ÇØ µÉ¼ö ÀÖ´Â ÇÑ °øµ¿À¸·Î »ç¿ëÇÏÁö ¾Ê´Â´Ù 
 - º¯»öµÈ °ÍÀº »ç¿ëÇÏÁö ¸»°Í
 
  | 
   
  
  
  
  
  
  		
  
  
   
    | º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ | 
    - ¼Ò¾ÆÀÇ ¼ÕÀÌ ´êÁö ¾Ê´Â °÷¿¡ º¸°üÇÒ °Í.
 - Á÷»çÀϱ¤À» ÇÇÇÏ¿© µÇµµ·Ï ½À±â°¡ ÀûÀº  ½Ã¿øÇÑ °÷¿¡ ¹ÐÀüÇÏ¿© º¸°üÇÒ °Í.
 - ¿À¿ëÀ» ÇÇÇϰí ǰÁúÀÇ º¸Á¸À» À§ÇÏ¿© ´Ù¸¥ ¿ë±â¿¡ ¹Ù²Ù¾î ³ÖÁö ¸» °Í.
 
  | 
   
  	
  
  
  
  
  
  
   
    | Related FDA Approved Drug | 
    
       
     | 
      
  
  
      							
 
 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | Á¤º¸¿ä¾à | 
                 
	         
	       | 
	           	    
	     |  
	    | 
  
    µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
    
  
  
    
  
   |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | ÄÚµå ¹× ºÐ·ùÁ¤º¸ | 
                 
	         
	       | 
	           	    
	     |  
	    | 	 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | Á¦Ç°Á¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
  
   
    û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× | 
    
      
      
        
        645903170[A01301981]  
	    
	    
          [º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸] 
          
        
        
        
          
          
            \0 ¿ø/1ml(2012.03.01)(Ãֽžడ)
            \14 ¿ø/1mL(2000.07.01)(º¯°æÀü¾à°¡)
        
          
            
	 
  	   
  	   
       
      
       
       
     
      
      
     
      
    
    
      
     [»óº´ÄÚµåÁ¶È¸]
      
     [Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
    
     | 
   
  
  
   
    | Á¦Ç°¼º»ó | 
    
      ¹«»öÀÇ ¾×Á¦  
      
	  [Á¦ÇüÁ¤º¸ È®ÀÎ]
     |   
   
  
  
  
  
  
  
  
  
  
  
  
  
  
   
    | Æ÷À塤À¯Åë´ÜÀ§ | 
    5mg/mL¡¿500mL¡¿1EA | 
   
  
  
  
   
    | º¸°ü¹æ¹ý | 
    Â÷±¤±â¹Ð¿ë±â, 25¡ÉÀÌÇÏ º¸°ü | 
   
  
  
  
   
    µ¿ÀÏÁÖ¼ººÐÄÚµå  °Ë»ö¼øÀ§ | 
    
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
      
     | 
   
                                                          															
  
  
  
  
  
       
  
    
   
    | ÷°¡Á¦ ÁÖÀÇ»çÇ× | 
    
      
        * ÷°¡Á¦ ÁÖÀÇ»çÇ×Á¤º¸´Â ÇöÀç ¾÷µ¥ÀÌÆ®ÁßÀÌ¸ç ¹Ì¾÷µ¥ÀÌÆ®µÈ ÀǾàǰÀÇ Ã·°¡Á¦
	ÁÖÀÇ»çÇ×Àº Ç¥½ÃµÇÁö ¾ÊÀ»¼ö ÀÖ½À´Ï´Ù.
      
      
  	
      ¡à ¾È½ÄÇâ»ê³ªÆ®·ý(º¯°æÁö½Ã Àǰü 65623-601È£, 2001.3.12)À» ´ÙÀ½°ú °°ÀÌ 
º¯°æÇÑ´Ù. 
¡à ¡°¾È½ÄÇâ»ê, ¾È½ÄÇâ»ê³ªÆ®·ý(¿Ü¿ëÁ¦ ¹× ÁÖ»çÁ¦¿¡ ÇÑÇÔ)¡± ÇÔÀ¯Á¦Á¦ 
¡Û »ç¿ë»óÀÇ ÁÖÀÇ»çÇ× 
 - ÀϹÝÀû ÁÖÀÇ 
   (¿Ü¿ëÁ¦) ÀÌ ¾àÀº ¾È½ÄÇâ»ê(³ªÆ®·ý)À» Æ÷ÇÔÇϰí ÀÖ¾î ÇǺÎ, ´«, Á¡¸·¿¡ 
°æ¹ÌÇÑ ÀÚ±ØÀÌ µÉ ¼ö ÀÖ´Ù. 
   (ÁÖ»çÁ¦) ÀÌ ¾àÀº ¾È½ÄÇâ»ê(³ªÆ®·ý)À» Æ÷ÇÔÇϰí ÀÖ¾î ½Å»ý¾Æ¿¡°Ô Ȳ´ÞÀÇ 
À§ÇèÀ» Áõ°¡½Ãų ¼ö ÀÖ´Ù. 
     | 
   
  
  
   
  |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | º¹¾àÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
   
    | LACTmed ¹Ù·Î°¡±â | 
    
      
        [¹Ù·Î°¡±â]
     | 
     
  
  
   
    | ¾à¸®ÀÛ¿ë | 
    
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
       
     | 
     
  
  
       
  
  
   
    | º¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
                                                          															
  
   
  
  
   
    | ÀӺο¡´ëÇÑÅõ¿© | 
    
      
      
        
	      
	      
	        | *  | 
	        
	          ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù. 
	         | 
	         
	       
	       | 
	   
	  
	    |   | 
	   
	  
	    
	      FDA : Cµî±Þ 
				        
				         (ÀÓ»ó ½ÃÇè¿¡¼ À§Ç輺 º¸°íµÊ. -Briggs G, et al. Drugs in Pregnancy and Lactation 7th edit. )
				        
	   | 
	  
	  
	  
	     
	     
	     
	     
	     
	     
	   | 
	 
	
	  
	      
	      
	        | *  | 
	        
	          »ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
	         | 
	         
	      
	        | *  | 
	        
	          ¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
	         | 
	         
	       
	   | 
	 
       
     | 
   
  
  
  	   
  
  	   
  
  	   
  
  
     
      | Pharmacokinetics | 
      
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
      
       |   
     
  
  
  
  
  
  
  
   
    | º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ | 
    
      [º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
     | 
   
  	
  
  
  	
  
  
  
   
    | º¸°ü»ó ÁÖÀÇ | 
    
      
    	
     | 
   
  
  
   
    | Á¶Á¦½Ã ÁÖÀÇ | 
    
      
    	
     | 
      
 
 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | ½É»çÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	     |  
	   
	   
	
	  
       |  
	    
	      
	        
            
                | ÇмúÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
    | DUR (ÀǾàǰ»ç¿ëÆò°¡) | 
    º´¿ë±Ý±â :
     
	 °í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
	 
	  [»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]										
	  ¿¬·É´ë±Ý±â :
      °í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
      
       [¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
       
       
        
        
     | 
   
  
   
    | Mechanism of Action | 
    
       Phenylephrine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Phenylephrine produces its ophthalmic and systemic actions by acting on alpha 1 adrenergic receptors in the pupillary dilator muscle and the vascular smooth musle, resulting in contraction of the dilator muscle and contraction of the smooth muscle in the arterioles of the conjunctiva and peripheral vasoconstriction. Phenylephrine decreases nasal congestion by acting on alpha 1 adrenergic receptors in the arterioles of the nasal mucosa to produce constriction. 
     | 
   
  
   
    | Pharmacology | 
     
       Phenylephrine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Phenylephrine is a powerful vasoconstrictor. It is used as a mydriatic, nasal decongestant, and cardiotonic agent. Phenylephrine is a postsynaptic alpha-receptor stimulant with little effect on the beta receptors of the heart. Parenteral administration of Phenylephrine causes a rise in systolic and diastolic pressures, cardiac output is slightly decreased and peripheral resistance is considerably increased, most vascular beds are constricted; renal, splanchnic, cutaneous, and limb blood flows are reduced but coronary blood flow is increased. Pulmonary vessels are constricted, and pulmonary arterial pressure is raised. This alpha receptor sympathetic agonist is also used locally because its vasoconstrictor and mydriatic action. 
     | 
   
  
   
    | Metabolism | 
    
       Phenylephrine¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Monoamine oxidase type A (MAO-A) 
     | 
   
  
   
    | Protein Binding | 
    
       Phenylephrine¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 95% binding-plasma proteins 
     | 
   
  
   
    | Half-life | 
    
       Phenylephrine¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 2.1 to 3.4 hours 
     | 
   
  
   
    | Absorption | 
    
       Phenylephrine¿¡ ´ëÇÑ Absorption Á¤º¸ Reduced bioavailability (compared to pseudoephedrine) following oral administration due to significant first-pass metabolism. 
     | 
   
  
   
    | Pharmacokinetics | 
    
       Phenylephrine HClÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á 
	- È¿°ú¹ßÇö½Ã°£
	
		- ±ÙÀ°ÁÖ»ç, ÇÇÇÏÁÖ»ç : 10~15ºÐ À̳»
		
 - Á¤¸ÆÁÖ»ç : Áï½Ã
	
  
	 - È¿°úÁö¼Ó½Ã°£
	
		- ±ÙÀ°ÁÖ»ç : 30ºÐ ~ 2½Ã°£
		
 - Á¤¸ÆÁÖ»ç : 15~30ºÐ
		
 - ÇÇÇÏÁÖ»ç : 1½Ã°£
	
  
	 - ´ë»ç : Phenolic Æ÷ÇÕü·Î ´ë»çµÊ. Monoamine oxidase¿¡ ÀÇÇØ °£°ú Àå¿¡¼ ´ë»çµÊ.
	
 - ¹Ý°¨±â : 2.5 ½Ã°£
	
 - ¼Ò½Ç : ½Å¹è¼³ (90%)
  
     | 
   
  
   
    | Biotransformation | 
    
       Phenylephrine¿¡ ´ëÇÑ Biotransformation Á¤º¸ Oral phenylephrine is extensively metabolised by monoamine oxidase, an enzyme which is present in the stomach and liver. 
     | 
   
  
   
    | Toxicity | 
    
       Phenylephrine¿¡ ´ëÇÑ Toxicity Á¤º¸ Not Available 
     | 
   
  
   
    | Drug Interactions | 
    
       Phenylephrine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Alseroxylon	Increased arterial pressureIsocarboxazid	Increased arterial pressureDeserpidine	Increased arterial pressureGuanethidine	The agent decreases the effect of guanethidineRasagiline	Increased arterial pressureMethyldopa	Increased arterial pressureMidodrine	Increased arterial pressurePargyline	Increased arterial pressurePhenelzine	Increased arterial pressureReserpine	Increased arterial pressureTranylcypromine	Increased arterial pressureOxytocin	Possible marked increase of arterial pressureMethylergonovine	Possible marked increase of arterial pressureLinezolid	Possible increase of arterial pressureErgonovine	Possible marked increase of arterial pressureTrimipramine	The tricyclic increases the sympathomimetic effectProtriptyline	The tricyclic increases the sympathomimetic effectNortriptyline	The tricyclic increases the sympathomimetic effectClomipramine	The tricyclic increases the sympathomimetic effectAmitriptyline	The tricyclic increases the sympathomimetic effectAmoxapine	The tricyclic increases the sympathomimetic effectDesipramine	The tricyclic increases the sympathomimetic effectDoxepin	The tricyclic increases the sympathomimetic effectImipramine	The tricyclic increases the sympathomimetic effectMoclobemide	Moclobemide increases the sympathomimetic effect 
     | 
   
  
   
    CYP450  Drug Interaction | 
    
      [CYP450 TableÁ÷Á¢Á¶È¸] 
     | 
   
  
   
    | Food Interaction | 
    
       Phenylephrine¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take without regard to meals. 
     | 
   
  
   
    | Drug Target | 
    
      
      [Drug Target]
     | 
   
  
   
    | Description | 
    
       Phenylephrine¿¡ ´ëÇÑ Description Á¤º¸ An alpha-adrenergic agonist used as a mydriatic, nasal decongestant, and cardiotonic agent. [PubChem] 
     | 
   
  
   
    | Dosage Form | 
    
       Phenylephrine¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Liquid	IntramuscularLiquid	IntravenousLiquid	OphthalmicOintment	TopicalSolution	IntravenousSolution / drops	OphthalmicStrip	OralTablet	Oral 
     | 
   
  
   
    | Drug Category | 
    
       Phenylephrine¿¡ ´ëÇÑ Drug_Category Á¤º¸ Adrenergic alpha-AgonistsCardiotonic AgentsMydriaticsNasal DecongestantsSympathomimeticsVasoconstrictor Agents 
     | 
   
  
   
    | Smiles String Canonical | 
    
       Phenylephrine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CNCC(O)C1=CC(O)=CC=C1 
     | 
   
  
   
    | Smiles String Isomeric | 
    
       Phenylephrine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CNC[C@H](O)C1=CC(O)=CC=C1 
     | 
   
  
   
    | InChI Identifier | 
    
       Phenylephrine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C9H13NO2/c1-10-6-9(12)7-3-2-4-8(11)5-7/h2-5,9-12H,6H2,1H3/t9-/m0/s1 
     | 
   
  
   
    | Chemical IUPAC Name | 
    
       Phenylephrine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 3-[(1R)-1-hydroxy-2-methylaminoethyl]phenol 
     | 
   
    
  |  
	   
	   
	
	  
       |  
	    
	      
	        
            
                | »ç¿ëÀÚÄÁÅÙÃ÷ | 
                             
	         
	       | 
	           	  
       |  
	     |  
	   
	     	
 
  | 
   
   
     | 
   
  
    
      
        
          
            
              - 
                ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2021-12-09
              
 
              - 
                
                º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
                
              
     
             
         |                 
       
     |       
          
                
                    
                       ¾Ë¸² | 
                       
                      »ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù.  | 
                    
                    | 
               
      
      
                
                    
                       °æ°í | 
                     
                      µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù. 
                          Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â 
                          Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
                            ¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
                          ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
 | 
                    
                    | 
               
  
 
  
    ¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é 
    ¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
   
  
 
  º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
 
  [ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â]       Á¦¸ñ ¾øÀ½ 
 
    
    2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
    
    1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ  º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
    ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
          
    
    
    
    2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
    ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
 
 
 
   
  |  
             
             | 
         
         
         | 
         |