|   | 
        
            
         | 
          | 
        
        
        
            | 
                
             | 
         
        
             | 
         
        
            
            
            
  
    
	  | 
   
  
    
        
          |   | 
          
              
                | 
                    ½Ç·Î½ºÁúÁ¤(Áú»ê¿Á½ÃÄÚ³ªÁ¹)  SYLOS VAG.TABS.[Oxiconazole Nitrate]  
                    
                 | 
               
              
                
                     ÀϹÝÀǾàǰ | »èÁ¦  
                         |  
                    
                    	
                    
                 | 
               
              
                | 
					  
                  
				  
                 | 
               
              
              
              
              
              |   |  
              
                
                    
                        | 
                      ¾Ë¸²:  | 
                      µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. | 
                     
                    | 
               
            
              
                
                   
                   
                   
                   
		   
                 | 
               
              
                | 
                  
                  
                 | 
               
              | 
            | 
         
       
       | 
   
    |  
  
    | 
      
     | 
     
  |  
                              
                                  | 
                                   | 
                               
            
            
                
            
            
              
            
                            
              
                                                     
            
            
   |  
  
    | 
      
     | 
   
   
     | 
   
    
   
    | 
       
        À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
        ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
        À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
        ·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
       
     | 
   
  
     | 
   
   
  
    
      
	
	  
	     |  
	    
	      
	        
            
                | Çã°¡Á¤º¸ | 
                         
	         
	       | 
	     
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
   
    û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå  »óÇÑ±Ý¾× | 
    
      
      
        
        642000650[A30603181]  
	    
	    
          [º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸] 
          
        
        
        
          
          
            \0 ¿ø/1Á¤(2018.03.01)(ÇöÀç¾à°¡) 
            \2,516 ¿ø/1Á¤(2017.02.01)(º¯°æÀü¾à°¡)
        
          
            
	 
  	   
  	   
       
      
       
       
     
      
      
     
      
    
    
      
     [»óº´ÄÚµåÁ¶È¸]
      
     [Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
     [¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
     | 
   
   
    | ºü¸¥Á¶È¸ | 
    
      
     |   
   
  
  
   
    | Á¦Ç°¼º»ó | 
    
      ¾ç¸éÀÌ º¼·ÏÇÏ°í ³¿»õ°¡ ¾ø´Â ¹é»öÀÇ ÁúÁ¤  
      
	    [Á¦ÇüÁ¤º¸ È®ÀÎ]
     |   
   
  
  
  
  
  
   
    | Æ÷À塤À¯Åë´ÜÀ§ | 
    1,5,10,50T
 | 
   
  
  
  
   
    | Æ÷À塤ÄÚµå´ÜÀ§ | 
    
        
        
            | ¾àǰ±Ô°Ý | 
            ´ÜÀ§ | 
            ´ëÇ¥ÄÚµå | 
            Ç¥ÁØÄÚµå | 
            ºñ°í | 
	     
        
        
            | 600¹Ð¸®±×·¥ | 
            1 °³ | 
            8806420006507 | 
            8806420006514 | 
             | 
	     
        
         
     | 
   
      
  
  	
   
    | ÁÖ¼ººÐÄÚµå | 
    
      206402CTB  
      
	  [µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
     | 
   
  
  
  
  
  	
   
    | ´ëÇ¥ÄÚµå | 
    8806420006507 | 
   
  
  
  
  
   
    | º¸°ü¹æ¹ý | 
    ±â¹Ð¿ë±â, ½Ç¿Âº¸°ü | 
   
  
  
  
   
    | ¾à¸®ÀÛ¿ë | 
    
      
        [Á¶È¸]
     | 
      
  
  
  
  
   
    | È¿´ÉÈ¿°ú | 
    
    [ÀûÀÀÁõ º° °Ë»ö] 
      
    
     
	 
       | 
   
  
  
  
  
  
  
  
  
    
  
  
   
    | ¿ë¹ý¿ë·® | 
    
      * Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù. 
    
     
      
      
     [󹿾à¾î] 
      [ÁÖ¼ººÐÄÚµå:206402CTB ¿¡ µû¸¥ ½É»çÁöħ¿¶÷] 
- ¿Á½ÃÄÚ³ªÁ¹·Î¼ 1ȸ 600mgÀ» Àú³áÃëħ½Ã °¡´ÉÇÑ ´©¿î ÀÚ¼¼¿¡¼ Áú³»¿¡ ¤¼÷ÀÌ »ðÀÔÇÑ´Ù. º¸ÅëÀÇ °æ¿ì 1ȸ Ä¡·á·Î ÃæºÐÇϳª, Çʿ信 µû¶ó ´ÙÀ½³¯ Ãëħ½Ã 1ȸ 600mgÀ» ´õ »ðÀÔÇÑ´Ù.
 - ¿¬·É, Áõ»ó¿¡ µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù.
 
[Á¦Çüº°º¹¾àÁöµµ]     
      	    
     
  | 
   
  
  
  
  
  
  
  
  
  
   
    | ±Ý±â | 
    
      - ÀÌ ¾à ¶Ç´Â ´Ù¸¥ Áú»ê¿Á½ÃÄÚ³ªÁ¹Á¦Á¦¿¡ °ú¹ÎÁõ ȯÀÚ
 - »ý¸®ÁßÀΠȯÀÚ
    
 
  | 
   
  
  
  
  
  
  
   
    | ÀÌ»ó¹ÝÀÀ | 
    
      ³»¾à¼ºÀº ¾ÆÁÖ ¾çÈ£Çϳª °£È¤ ÁúÁ¤Åõ¿©½Ã Áú¿¡ °¡º¿î ÀÚ±Ø ¶Ç´Â ÀÛ¿°¨, ¶§¶§·Î ¹ßÀû, µå¹°°Ô °¡·Á¿ò, µ¿ÅëÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¸ç, ¿Á½ÃÄÚ³ªÁ¹ Å©¸² µµÆ÷½Ã ¶§¶§·Î ±¹¼Ò¹ßÀû, Àڱذ¨, Á¢Ã˼º ÇǺο°, °¡·Á¿ò, µå¹°°Ô ±¹¼ÒÁ¾Ã¢ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
          
     | 
   
  
  
    
   
    | ÀϹÝÀû ÁÖÀÇ | 
    -  ¿ÜÀ½ºÎº´ÀÌ º´¹ßµÇ¾ú°Å³ª Áø±Õ¼º ±ÍµÎ¿° Á¸Àç½Ã, ¶ÇÇÑ ³²¼º¹è¿ìÀÚÀÇ ¿¹¹æÄ¡·á¸ñÀûÀ¸·Î´Â ¿Á½ÃÄÚ³ªÁ¹ Å©¸²À» Ãß°¡ÀûÀ¸·Î µµÆ÷ÇØ¾ß ÇÑ´Ù. Ưº°ÇÑ Áö½Ã°¡ ¾ø´Â ÇÑ ¿ÏÄ¡µÉ ¶§±îÁö(º¸Åë 1ÁÖÀÏ) °¨¿°µÈ ÇǺγª ±ÍµÎ ¹× Ç¥ÇÇ¿¡ ¿Á½ÃÄÚ³ªÁ¹ Å©¸²À» °¡´ÉÇϸé Àú³á¿¡ 1ÀÏ 1ȸ ¾ã°Ô µµÆ÷ÇÑ´Ù.
 - Àç°¨¿°À» ¸·±â À§Çؼ´Â °³ÀÎÀÌ »ç¿ëÇÏ´Â ¼ö°ÇÀ̳ª ³»ÀÇ µîÀ» ¸ÅÀÏ ¹Ù²Ù¾î ÀÔ°í ÀÔ¾ú´ø °ÍÀº »î¾Æ¼ ¼¼Å¹ÇÏ´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù.
 
  | 
   
  
  
  
    
   
    | »óÈ£ÀÛ¿ë | 
     ÀÌ ¾àÀº Äܵ¼, Áú³» ÇÇÀÓ¿ë°Ý¸·°ú °°Àº ¶óÅØ½º ¶Ç´Â °í¹«Á¦Ç°À» ¾àȽÃų ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù. | 
   
  
  
  
   
    | ÀӺο¡ ´ëÇÑ Åõ¿© | 
    
      
	[ÀӺαݱ⠼ººÐ Á¶È¸]       
      ÀӽŠ12Á̸ֹ¸ÀÇ ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀÎÀÇ °æ¿ì ¾ÈÀü¼ºÀÌ È®¸³µÇ¾îÀÖÁö ¾ÊÀ¸¹Ç·Î Ä¡·á»óÀÇ À¯ÀͼºÀÌ À§Ç輺À» »óȸÇÑ´Ù°í ÆÇ´ÜµÇ´Â °æ¿ì¿¡¸¸ ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù. ÀÓ½ÅÁß Áø±Õ ¿¹¹æÀ» ¸ñÀûÀ¸·Î ó¹æÇØ¾ß ÇÏ´Â °æ¿ì¿¡´Â ÀӽЏ¶Áö¸· ´Þ¿¡ ÇÑ´Ù.
     | 
   
  
  
  
  
   
    | ¼öÀ¯ºÎ¿¡ ´ëÇÑ Åõ¿© | 
    ¸ðÀ¯·ÎÀÇ ÀÌÇà¿©ºÎ´Â ¾Ë·ÁÁ® ÀÖÁö ¾ÊÀ¸³ª ¼öÀ¯Áß¿¡´Â Åõ¿©ÇÏÁö ¾Ê´Â´Ù. | 
   
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  		
  
  
   
    | º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ | 
    -  ¾î¸°ÀÌÀÇ ¼ÕÀÌ ´êÁö ¾Ê´Â °÷¿¡ º¸°üÇÑ´Ù.
 - ½Ç¿Â¿¡¼ Â÷±¤ÇÏ¿© º¸°üÇÑ´Ù.
 
  | 
   
  	
  
  
  
  
  
  
   
    | Related FDA Approved Drug | 
    
      
      ±âÁØ ¼ººÐ: OXICONAZOLE NITRATEOXISTAT (OXICONAZOLE NITRATE) 
        
     | 
      
  
  
      							
 
 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | Á¤º¸¿ä¾à | 
                 
	         
	       | 
	           	    
	     |  
	    | 
  
    µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
    
  
  
    
  
   |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | ÄÚµå ¹× ºÐ·ùÁ¤º¸ | 
                 
	         
	       | 
	           	    
	     |  
	    | 	 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | Á¦Ç°Á¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	     |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | º¹¾àÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
   
    | LACTmed ¹Ù·Î°¡±â | 
    
      
        [¹Ù·Î°¡±â]
     | 
     
  
  
   
    | ¾à¸®ÀÛ¿ë | 
    
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
       
     | 
     
  
  
       
  
  
   
    | º¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
                                                          															
  
   
  
  
   
    | ÀӺο¡´ëÇÑÅõ¿© | 
    
      
      
        
	      
	      
	        | *  | 
	        
	          ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù. 
	         | 
	         
	       
	       | 
	   
	  
	    |   | 
	   
	  
	    
	      FDA : Bµî±Þ 
				        
				         (oxiconazole; )
				        
	   | 
	  
	  
	  
	     
	     
	     
	     
	     
	     
	   | 
	 
	
	  
	      
	      
	        | *  | 
	        
	          »ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
	         | 
	         
	      
	        | *  | 
	        
	          ¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
	         | 
	         
	       
	   | 
	 
       
     | 
   
  
  
  	   
  
  	   
  
  	   
  
  
     
      | Pharmacokinetics | 
      
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
      
       |   
     
  
  
  
  
  
  
  
   
    | º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ | 
    
      [º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
     | 
   
  	
  
  
  	
  
  
   
    | Á¦Çüº° º¹¾àÁöµµ | 
    [ÁúÁ¤] | 
   
  
  
   
    | º¸°ü»ó ÁÖÀÇ | 
    
      
    	
     | 
   
  
  
   
    | Á¶Á¦½Ã ÁÖÀÇ | 
    
      
    	
     | 
      
 
 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | ½É»çÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	     |  
	   
	   
	
	  
       |  
	    
	      
	        
            
                | ÇмúÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
    | DUR (ÀǾàǰ»ç¿ëÆò°¡) | 
    º´¿ë±Ý±â :
     
	 °í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
	 
	  [»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]										
	  ¿¬·É´ë±Ý±â :
      °í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
      
       [¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
       
       
        
        
     | 
   
  
   
    | Mechanism of Action | 
    
       Oxiconazole¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Oxiconazole inhibits ergosterol biosynthesis, which is required for cytoplasmic membrane integrity of fungi. 
     | 
   
  
   
    | Pharmacology | 
     
       Oxiconazole¿¡ ´ëÇÑ Pharmacology Á¤º¸ Oxiconazole is a broad-spectrum imidazole derivative whose antifungal activity is derived primarily from the inhibition of ergosterol biosynthesis, which is critical for cellular membrane integrity. It has fungicidal or fungistatic activity in vitro against a number of pathogenic fungi including the following dermatophytes, and yeasts: T. rubrum, T. mentagrophytes, T. tonsurans, T. violaceum, E. floccosum, M. canis, M. audouini, M. gypseum, C. albicans, and M. furfur. 
     | 
   
  
   
    | Metabolism | 
    
       Oxiconazole¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Not Available 
     | 
   
  
   
    | Protein Binding | 
    
       Oxiconazole¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Not Available 
     | 
   
  
   
    | Half-life | 
    
       Oxiconazole¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ Not Available 
     | 
   
  
   
    | Absorption | 
    
       Oxiconazole¿¡ ´ëÇÑ Absorption Á¤º¸ Systemic absorption of oxiconazole is low. 
     | 
   
  
   
    | Pharmacokinetics | 
    
       Oxiconazole NitrateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á 
	- Èí¼ö : ¿Ü¿ë : Àü½ÅÀ¸·Î Èí¼öµÇ´Â ¾çÀº ¹Ì¹ÌÇÏ´Ù.
 
	 - ºÐÆ÷ : À¯Áó ºÐºñ
 
	 - ¼Ò½Ç : 0.3% ¹Ì¸¸ÀÌ ½Å¹è¼³
 
  
     | 
   
  
   
    | Biotransformation | 
    
       Oxiconazole¿¡ ´ëÇÑ Biotransformation Á¤º¸ Not Available 
     | 
   
  
   
    | Toxicity | 
    
       Oxiconazole¿¡ ´ëÇÑ Toxicity Á¤º¸ Side effects incliude pruritus, burning, irritation, erythema, stinging and allergic contact dermatitis and folliculitis, fissuring, maceration rash and nodules. 
     | 
   
  
   
    | Drug Interactions | 
    
       Oxiconazole¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available 
     | 
   
  
   
    CYP450  Drug Interaction | 
    
      [CYP450 TableÁ÷Á¢Á¶È¸] 
     | 
   
  
   
    | Food Interaction | 
    
       Oxiconazole¿¡ ´ëÇÑ Food Interaction Á¤º¸ Not Available 
     | 
   
  
   
    | Drug Target | 
    
      
      [Drug Target]
     | 
   
  
   
    | Description | 
    
       Oxiconazole¿¡ ´ëÇÑ Description Á¤º¸ Oxiconazole nitrate (U.S.: Oxistat, Canada: Oxizole) is an antifungal medication typically administered in a cream or lotion to treat skin infections such as athlete's foot, jock itch and ringworm. [Wikipedia] 
     | 
   
  
   
    | Dosage Form | 
    
       Oxiconazole¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Cream	TopicalLotion	Topical 
     | 
   
  
   
    | Drug Category | 
    
       Oxiconazole¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antifungal Agents 
     | 
   
  
   
    | Smiles String Canonical | 
    
       Oxiconazole¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ ClC1=CC(Cl)=C(CON=C(CN2C=CN=C2)C2=C(Cl)C=C(Cl)C=C2)C=C1 
     | 
   
  
   
    | Smiles String Isomeric | 
    
       Oxiconazole¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ ClC1=CC(Cl)=C(CO\N=C(\CN2C=CN=C2)C2=C(Cl)C=C(Cl)C=C2)C=C1 
     | 
   
  
   
    | InChI Identifier | 
    
       Oxiconazole¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C18H13Cl4N3O/c19-13-2-1-12(16(21)7-13)10-26-24-18(9-25-6-5-23-11-25)15-4-3-14(20)8-17(15)22/h1-8,11H,9-10H2/b24-18- 
     | 
   
  
   
    | Chemical IUPAC Name | 
    
       Oxiconazole¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 1-(2,4-dichlorophenyl)-N-[(2,4-dichlorophenyl)methoxy]-2-imidazol-1-ylethanimine 
     | 
   
    
  |  
	   
	   
	
	  
       |  
	    
	      
	        
            
                | »ç¿ëÀÚÄÁÅÙÃ÷ | 
                             
	         
	       | 
	           	  
       |  
	     |  
	   
	     	
 
  | 
   
   
     | 
   
  
    
      
        
          
            
              - 
                ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2024-03-03
              
 
              - 
                
                º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
                
              
     
             
         |                 
       
     |       
          
                
                    
                       ¾Ë¸² | 
                       
                      »ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù.  | 
                    
                    | 
               
      
      
                
                    
                       °æ°í | 
                     
                      µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù. 
                          Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â 
                          Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
                            ¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
                          ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
 | 
                    
                    | 
               
  
 
  
    ¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é 
    ¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
   
  The database contains the following fields: The generic name of each chemical For module A10 (liver enzyme composite module): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the number of active and marginally active scores for each compound at the five individual endpoints (see research article for full description of method) Number of endpoints at which each compound is marginally active (M) Number of endpoints at which each compound is active (A) For modules A11 to A15 (alkaline phosphatase increased, SGOT increased, SGPT increased, LDH increased, and GGT increased, respectively): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the RI and ADR values (see the research article for full description of method) Number of ADR reports for each compound, given as <4 or ¡Ã4 Reporting Index value for each compound, except where no shipping units were available (NSU) Group 1 comprises of compounds for which ADR data were available for the first five years of marketing, so when no ADR reports were listed during this period the compounds were evaluated as inactive. Group 2 comprises of compounds for which a 'steady state' period of ADR data were available (1992-1996). In cases where no ADR reports were filed during this period, the compounds were scored as 'NA' (data not available) since they may have had one or more ADR reports during their first five years of marketing which should not be negated by a lack of ADR reports during the steady-state period. OXICONAZOLE[GGT Increase][Composite Activity](Score)  I(Marginal)  0(Active)  0[Alkaline Phosphatase Increase](Activity Score)  I(Number of Rpts)  <4(Index value)  0[SGOT Increase](Activity Score)  I(Number of Rpts)  <4(Index value)  0[SGPT Increase](Activity Score)  I(Number of Rpts)  <4(Index value)  0[LDH Increase](Activity Score)  I(Number of Rpts)  <4(Index value)  0[GGT Increase](Activity Score)  I(Number of Rpts)  <4(Index value)  0
 
  º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
 
  [ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â]       Á¦¸ñ ¾øÀ½ 
 
    
    2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
    
    1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ  º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
    ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
          
    
    
    
    2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
    ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
 
 
 
   
  |  
             
             | 
         
         
         | 
         |