| |
|
|
|
|
|
 |
| |
|
¹Ìµå·ÐÁ¤(¹Ìµµµå¸°¿°»ê¿°) Midron Tab.
|
Àü¹®ÀǾàǰ | ±Þ¿©
|
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
 |
Á¦Ç°º° ÀӺαݱ⠰í½Ã |
|
|
|
1µî±Þ: ¿øÄ¢Àû »ç¿ë±Ý±â / 2µî±Þ: ¸íÈ®ÇÑ ÀÓ»óÀû ±Ù°Å ¶Ç´Â »çÀ¯°¡ ÀÖ´Â °æ¿ì ºÎµæÀÌÇÏ°Ô »ç¿ë / Mµî±Þ: ÀÓ»óÀû»óȲ¿¡ µû¶ó 1µî±Þ ¶Ç´Â 2µî±ÞÀ¸·Î ºÐ·ùµÇ´Â ¼ººÐ
| ¼ººÐ¸í |
¼ººÐÄÚµå |
±Ý±âµî±Þ |
°í½Ã¹øÈ£ |
°í½ÃÀÏÀÚ |
ºñ°í |
| midodrine |
195601ATB |
2 |
20200061 |
20200710 |
ÀӺο¡ ´ëÇÑ ¾ÈÀü¼º ¹ÌÈ®¸³. |
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
649801760[A31803351]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\105 ¿ø/1Á¤(2024.12.01)(ÇöÀç¾à°¡)
\105 ¿ø/1Á¤(2024.07.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»öÀÇ ¿øÇüÁ¤Á¦
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
30Á¤/º´, 100Á¤/º´ |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 2.5¹Ð¸®±×·¥ |
100 Á¤ |
8806498017603 |
8806498017634 |
|
| 2.5¹Ð¸®±×·¥ |
100 Á¤ |
8806498017603 |
8806498017627 |
|
| 2.5¹Ð¸®±×·¥ |
30 Á¤ |
8806498017603 |
8806498017610 |
|
|
| ÁÖ¼ººÐÄÚµå |
195601ATB
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| ´ëÇ¥ÄÚµå |
8806498017603 |
| º¸°ü¹æ¹ý |
±â¹Ð¿ë±â, ½Ç¿Âº¸°ü |
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
ÀúÇ÷¾Ð(±â¸³¼º, º»Å¼º, ÁõÈļº)
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¼ºÀÎ : ¿°»ê¹Ìµµµå¸°À¸·Î¼ 1ȸ 2.5§· 1ÀÏ 2-3ȸ °æ±¸Åõ¿©ÇÑ´Ù.
Àå±âÄ¡·áÇÏ´Â °æ¿ì¿¡´Â ÃÖ¼Ò À¯È¿·®À» Åõ¿©ÇÑ´Ù.
¿¬·É, Áõ»ó¿¡ µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù.
´©¿îÀÚ¼¼ °íÇ÷¾Ð À§ÇèÀ» ÁÙÀ̱â À§ÇØ ´Ê¾îµµ Ãëħ 4½Ã°£ Àü¿¡ º¹¿ëÇØ¾ßÇÑ´Ù.
|
| ÁÖ¿ä¾à¹° »óÈ£ÀÛ¿ë |
[º¸±â]
|
| ±Ý±â |
1) °íÇ÷¾Ð ȯÀÚ
2) ½ÉÇÑ ½ÉÁúȯ ȯÀÚ
3) ±Þ¼º ½ÅÀå¿° ȯÀÚ
4) °©»ó¼±±â´ÉÇ×ÁøÁõ ȯÀÚ
5) Å©·Òģȼ¼Æ÷Á¾ ȯÀÚ
6) Æó¼â¿ì°¢Çü ³ì³»Àå ȯÀÚ
7) Ç÷°ü°æ·Ã, Ç÷°üÆó»ö ȯÀÚ
8) ¹è´¢Àå¾Ö ȯÀÚ(ƯÈ÷ Àü¸³¼±Á¾ ȯÀÚ)
9) ºó¸Æ¼º ºÎÁ¤¸Æ ȯÀÚ
|
| ½ÅÁßÅõ¿© |
1) ½ÉÇÑ ½ÅÀå¾Ö ȯÀÚ
2) ºÎÁ¤¸Æ ȯÀÚ |
| ÀÌ»ó¹ÝÀÀ |
1) °ú¹ÎÁõ : ¶§¶§·Î ¹ßÁø¡¤µÎµå·¯±â, °¡·Á¿ò, ¹ßÀû, ÀԸ𰨠µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇÑ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
2) ¼Òȱâ°è : ¶§¶§·Î ±¸¿ª¡¤±¸Åä, º¹Åë, º¹ºÎÆØ¸¸°¨, ±¸³»¿°, º¯ºñ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
3) °£Àå : ¶§¶§·Î °£±â´ÉÀå¾Ö(AST, ALT, ALP »ó½Â) µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
4) ¼øÈ¯±â°è : ¶§¶§·Î ½É½Ç¼º ±â¿Ü¼öÃà, ½É°èÇ×Áø, ½É½Ç¼º ºÎÁ¤¸Æ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
5) Á¤½Å½Å°æ°è : ¶§¶§·Î µÎÅë, µå¹°°Ô Á¹À½, ÃÊÁ¶°¨, ¾îÁö·¯¿ò µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
6) ºñ´¢±â°è : ºó´¢, Àü¸³¼± ȯÀÚ¿¡¼´Â ¹è´¢°ï¶õ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
7) ±âŸ : µå¹°°Ô ¹ßÇÑ, ¿°¨, ¾î±ú°á¸², ¿ÀÇÑ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| ÀϹÝÀû ÁÖÀÇ |
1) ´ç´¢º´ ȯÀÚ´Â Ç÷´çÄ¡¸¦ Á¶ÀýÇÑ ÈÄ Åõ¿©ÇÏ´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù.
2) Àå±âÄ¡·á½Ã¿¡´Â ½Å±â´É¿¡ À¯ÀÇÇÏ¿© Åõ¿©ÇÏ´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù.
|
| »óÈ£ÀÛ¿ë |
1) ±¸¾Æ³×Ƽµò, MAOÀúÇØÁ¦ µî°ú º´¿ëÅõ¿©½Ã ±³°¨½Å°æÈïºÐÀÛ¿ëÀÌ Áõ°µÉ ¼ö ÀÖ´Ù.
2) µð±âÅ»¸®½ºÁ¦Á¦¿Í º´¿ëÅõ¿©½Ã ¹Ý»ç¼º ¼¸ÆÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
|
| ÀӺο¡ ´ëÇÑ Åõ¿© |
[ÀӺαݱ⠼ººÐ Á¶È¸]
ÀÓ½ÅÁßÀÇ Åõ¿©¿¡ ´ëÇÑ ¾ÈÀü¼ºÀº È®¸³µÇ¾î ÀÖÁö ¾ÊÀ¸¹Ç·Î ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀο¡´Â Åõ¿©ÇÏÁö ¾Ê´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù.
|
| ¼öÀ¯ºÎ¿¡ ´ëÇÑ Åõ¿© |
¼öÀ¯ÁßÀÇ Åõ¿©¿¡ ´ëÇÑ ¾ÈÀü¼ºÀÌ È®¸³µÇ¾î ÀÖÁö ¾ÊÀ¸¹Ç·Î ¼öÀ¯ºÎ¿¡´Â Åõ¿©ÇÏÁö ¾Ê´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù. |
| °í·ÉÀÚ¿¡ ´ëÇÑ Åõ¿© |
ÀϹÝÀûÀ¸·Î °í·ÉÀÚ´Â »ý¸®±â´ÉÀÌ ÀúÇϵǾî ÀÖÀ¸¹Ç·Î °¨·®ÇÏ´Â µî ÁÖÀÇÇÑ´Ù. |
| °ú·®Åõ¿© ¹× óġ |
°ú·®Åõ¿©¿¡ ÀÇÇØ ÀÔ¸ð°¨, ³Ã°¨, ¿äÀÇ ±Þ¹Ú, °íÇ÷¾Ð, ¼¸Æ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. °¨·®¿¡ ÀÇÇØ Áõ»óÀÌ ¼Ò½ÇµÇ³ª ÇÊ¿äÇÑ °æ¿ì À§¼¼Ã´À» Çϰí ÁøÁ¤Á¦, ½Å°æ¾ÈÁ¤Á¦ µîÀ» Åõ¿©Çϸç ÁßÁõÀÎ °æ¿ì ¥á,¥â-Â÷´ÜÁ¦¸¦ Åõ¿©ÇÑ´Ù. ¼¸ÆÀÌ ³ªÅ¸³ª´Â °æ¿ì ¾ÆÆ®·ÎÇÉÀ» Åõ¿©ÇÏ¸é ºü¸£°Ô °³¼±µÈ´Ù.
|
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
±â¹Ð¿ë±â, ½Ç¿Âº¸°ü |
| ±âŸ |
°³ÀÎÀÇ °¨¼ö¼º°ú ÀÚÀ²½Å°æ°è ¹ÝÀÀ¼ºÀÇ Â÷ÀÌ·Î ÀÌ ¾àÀÇ È¿°ú´Â °³ÀÎÂ÷°¡ Å©´Ù. µû¶ó¼ Ä¡·áÃʱ⿡´Â ¿ë¹ý¡¤¿ë·®¿¡ ¸í½ÃÇÑ ¾çÀ» Åõ¿©ÇÏ´Ù°¡ ȯÀÚÀÇ ³»¼º¿¡ µû¶ó ¾çÀ» Á¶ÀýÇØ¾ß ÇÑ´Ù. |
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
(midodrine; )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
º¯ºñ°¡ »ý±æ¼ö ÀÖ½À´Ï´Ù. |
|
 |
¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Midodrine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Midodrine forms an active metabolite, desglymidodrine, that is an alpha1-agonist, and exerts its actions via activation of the alpha-adrenergic receptors of the arteriolar and venous vasculature, producing an increase in vascular tone and elevation of blood pressure. Desglymidodrine does not stimulate cardiac beta-adrenergic receptors.
|
| Pharmacology |
Midodrine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Midodrine is a prodrug, i.e., the therapeutic effect of orally administered midodrine is due to the major metabolite desglymidodrine formed by deglycination of midodrine. Desglymidodrine diffuses poorly across the blood-brain barrier, and is therefore not associated with effects on the central nervous system. Administration of midodrine results in a rise in standing, sitting, and supine systolic and diastolic blood pressure in patients with orthostatic hypotension of various etiologies. Standing systolic blood pressure is elevated by approximately 15 to 30 mmHg at 1 hour after a 10-mg dose of midodrine, with some effect persisting for 2 to 3 hours. Midodrine has no clinically significant effect on standing or supine pulse rates in patients with autonomic failure.
|
| Half-life |
Midodrine¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ The plasma levels of the prodrug peak after about half an hour, and decline with a half-life of approximately 25 minutes, while the metabolite reaches peak blood concentrations about 1 to 2 hours after a dose of midodrine and has a half-life of about 3 to 4 hours.
|
| Absorption |
Midodrine¿¡ ´ëÇÑ Absorption Á¤º¸ Rapidly absorbed following oral administration. The absolute bioavailability of midodrine (measured as desglymidodrine) is 93% and is not affected by food.
|
| Biotransformation |
Midodrine¿¡ ´ëÇÑ Biotransformation Á¤º¸ Thorough metabolic studies have not been conducted, but it appears that deglycination of midodrine to desglymidodrine takes place in many tissues, and both compounds are metabolized in part by the liver.
|
| Toxicity |
Midodrine¿¡ ´ëÇÑ Toxicity Á¤º¸ Symptoms of overdose could include hypertension, piloerection (goosebumps), a sensation of coldness and urinary retention. The single doses that would be associated with symptoms of overdosage or would be potentially life- threatening are unknown. The oral LD50 is approximately 30 to 50 mg/kg in rats, 675 mg/kg in mice, and 125 to 160 mg/kg in dogs. Desglymidodrine is dialyzable.
|
| Drug Interactions |
Midodrine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Betamethasone Increased arterial pressureCortisone acetate Increased arterial pressureDexamethasone Increased arterial pressureDobutamine Increased arterial pressureDopamine Increased arterial pressureEphedra Increased arterial pressureEphedrine Increased arterial pressureEpinephrine Increased arterial pressureFenoterol Increased arterial pressureFludrocortisone Increased arterial pressureHydrocortisone Increased arterial pressureIsoproterenol Increased arterial pressureMephentermine Increased arterial pressureMethoxamine Increased arterial pressureMetaraminol Increased arterial pressureMethylprednisolone Increased arterial pressurePrednisolone Increased arterial pressurePrednisone Increased arterial pressureNorepinephrine Increased arterial pressureOrciprenaline Increased arterial pressureParamethasone Increased arterial pressurePhenylephrine Increased arterial pressurePseudoephedrine Increased arterial pressurePirbuterol Increased arterial pressurePhenylpropanolamine Increased arterial pressureProcaterol Increased arterial pressureSalbutamol Increased arterial pressureTerbutaline Increased arterial pressureTriamcinolone Increased arterial pressureTranylcypromine Possible hypertensive crisis with this combinationRasagiline Possible hypertensive crisis with this combinationPhenelzine Possible hypertensive crisis with this combinationIsocarboxazid Possible hypertensive crisis with this combination
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Midodrine¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take without regard to meals.
|
| Drug Target |
[Drug Target]
|
| Description |
Midodrine¿¡ ´ëÇÑ Description Á¤º¸ An ethanolamine derivative that is an adrenergic alpha agonist. It is used as a vasoconstrictor agent in the treatment of hypotension. [PubChem]
|
| Drug Category |
Midodrine¿¡ ´ëÇÑ Drug_Category Á¤º¸ Adrenergic alpha-AgonistsSympathomimeticsVasoconstrictor Agents
|
| Smiles String Canonical |
Midodrine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ COC1=CC(C(O)CNC(=O)CN)=C(OC)C=C1
|
| Smiles String Isomeric |
Midodrine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ COC1=CC([C@@H](O)CNC(=O)CN)=C(OC)C=C1
|
| InChI Identifier |
Midodrine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C12H18N2O4/c1-17-8-3-4-11(18-2)9(5-8)10(15)7-14-12(16)6-13/h3-5,10,15H,6-7,13H2,1-2H3,(H,14,16)/f/h14H
|
| Chemical IUPAC Name |
Midodrine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 2-amino-N-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]acetamide
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-11-03
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
The database contains the following fields: The generic name of each chemical For module A10 (liver enzyme composite module): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the number of active and marginally active scores for each compound at the five individual endpoints (see research article for full description of method) Number of endpoints at which each compound is marginally active (M) Number of endpoints at which each compound is active (A) For modules A11 to A15 (alkaline phosphatase increased, SGOT increased, SGPT increased, LDH increased, and GGT increased, respectively): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the RI and ADR values (see the research article for full description of method) Number of ADR reports for each compound, given as <4 or ¡Ã4 Reporting Index value for each compound, except where no shipping units were available (NSU) Group 1 comprises of compounds for which ADR data were available for the first five years of marketing, so when no ADR reports were listed during this period the compounds were evaluated as inactive. Group 2 comprises of compounds for which a 'steady state' period of ADR data were available (1992-1996). In cases where no ADR reports were filed during this period, the compounds were scored as 'NA' (data not available) since they may have had one or more ADR reports during their first five years of marketing which should not be negated by a lack of ADR reports during the steady-state period. MIDODRINE[GGT Increase][Composite Activity](Score) I(Marginal) 0(Active) 0[Alkaline Phosphatase Increase](Activity Score) I(Number of Rpts) <4(Index value) 0[SGOT Increase](Activity Score) I(Number of Rpts) <4(Index value) 0[SGPT Increase](Activity Score) I(Number of Rpts) <4(Index value) 0[LDH Increase](Activity Score) I(Number of Rpts) <4(Index value) 0[GGT Increase](Activity Score) I(Number of Rpts) <4(Index value) 0
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|