|  
  
    | 
      
     | 
   
   
     | 
   
    
   
    | 
       
        À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
        ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
        À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
        ·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
       
     | 
   
  
     | 
   
   
  
    
      
	
	  
	     |  
	    
	      
	        
            
                | Çã°¡Á¤º¸ | 
                         
	         
	       | 
	     
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
   
    û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå  »óÇÑ±Ý¾× | 
    
      
      
        
        655200190[A05352921]  
	    
	    
          [º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸] 
          
        
        
        
           \0 ¿ø/1ml(2008.10.01)(ÇöÀç¾à°¡)
            
           \855 ¿ø/1ml(2007.10.01)(º¯°æÀü¾à°¡)
              
	 
	   
	   
       
      
       
       
     
      
      
     
      
    
    
      
     [»óº´ÄÚµåÁ¶È¸]
      
     [Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
     [¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
     | 
   
   
    | ºü¸¥Á¶È¸ | 
    
      
     |   
   
  
  
   
    | Á¦Ç°¼º»ó | 
    
      ÇÃ¶ó½ºÆ½¿ë±â¿¡ µç ¹ÌȲ»ö ³»Áö ´ãȲ»öÀÇ Åõ¸íÇÑ ¿ë¾×  
      
	    [Á¦ÇüÁ¤º¸ È®ÀÎ]
     |   
   
  
  
  
  
  
   
    | Æ÷À塤À¯Åë´ÜÀ§ | 
    1°³(5¹Ð¸®¸®ÅÍ) | 
   
  
  
  
   
    | Æ÷À塤ÄÚµå´ÜÀ§ | 
    
        
        
            | ¾àǰ±Ô°Ý | 
            ´ÜÀ§ | 
            ´ëÇ¥ÄÚµå | 
            Ç¥ÁØÄÚµå | 
            ºñ°í | 
	     
        
        
            | 5¹Ð¸®¸®ÅÍ | 
            1 °³ | 
            8806552001906 | 
            8806552001913 | 
             | 
	     
        
         
     | 
   
      
  
  
  
  
  
  	
   
    | ´ëÇ¥ÄÚµå | 
    8806552001906 | 
   
  
  
  
  
  
  
   
    | ¾à¸®ÀÛ¿ë | 
    
      
        [Á¶È¸]
     | 
      
  
  
  
  
   
    | È¿´ÉÈ¿°ú | 
    
    [ÀûÀÀÁõ º° °Ë»ö] 
      
    
     
	 
      <ÀûÀÀ±ÕÁ¾> 
ÀÌ ¾à¿¡ °¨¼ö¼ºÀÌ ÀÖ´Â Æ÷µµ±¸±Õ¼Ó, ¿¬¼â»ó±¸±Õ¼Ó, Æó·Å±¸±Õ, ¼Ò±¸±Õ¼Ó, À屸±Õ¼Ó, ÄÚ¸®³×¹ÚÅ׸®¿ò¼Ó, ½´µµ¸ð³ª½º¼Ó, ½ºÅ×³ëÆ®·ÎÆ÷¸ð³ª½º (»êÅä¸ð³ª½º) ¸»ÅäÇʸ®¾Æ , ³ì³ó±Õ, Ç÷È£±Õ¼Ó[ÀÎÇ÷翣ÀÚ±Õ, Haemophilus aegyptius (Koch-Weeks)], ¸ð¶ô¼¿¶ó¼Ó, ¼¼¶óƼ¾Æ¼Ó, Ŭ·¾½Ã¿¤¶ó¼Ó, ÇÁ·ÎÅ׿콺¼Ó, ¸ð¸£°¡³Ú¶ó-¸ð¸£°¡´Ï, ¾Æ½Ã³×Åä¹ÚÅͼÓ, ¿£Å׷ιÚÅͼÓ, ¾ÆÅ©³×±Õ
  
<ÀûÀÀÁõ> 
¾È°Ë¿°, ¸Æ¸³Á¾, ´©³¶¿°, °á¸·¿°, °ËÆÇ¼±¿°, °¢¸·¿°, °¢¸·±Ë¾ç, ¾È°ú ¼ö¼ú½ÃÀÇ ¹«±ÕÈ¿ä¹ý
  
      
      
      
      
     | 
   
  
  
  
  
  
  
  
  
    
  
  
   
    | ¿ë¹ý¿ë·® | 
    
      * Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù. 
    
     
      
      
     [󹿾à¾î] 
      1ȸ 1¹æ¿ï, 1ÀÏ 3ȸ Á¡¾È
  
     
      	    
     | 
   
  
  
  
  
  
  
  
  
  
   
    | ±Ý±â | 
    
      ÀÌ ¾à ¹× Äû³î·Ð°è Ç×»ý¹°Áú¿¡ °ú¹ÎÁõ º´·ÂÀÌ Àִ ȯÀÚ
  
     | 
   
  
  
  
  
  
  
   
    | ÀÌ»ó¹ÝÀÀ | 
    
      1) ¼ï : µå¹°°Ô ¼ï¾ç Áõ»ó(±¸¿ª, »çÁö³Ã°¨, È£Èí°ï¶õ µî)ÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ»óÀÌ ÀÎÁ¤µÇ´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù.
  
2) °ú¹ÎÁõ : µå¹°°Ô ½ÉÇ÷°ü°è ÇãÅ», ÀǽļҽÇ, Ç÷°üºÎÁ¾(ÀεÎ, ÈĵÎ, ¾ó±¼), ±âµµÆó¼â, È£Èí°ï¶õ, ¹ßÁø, µÎµå·¯±â, °¡·Á¿òÁõ, ¾È°Ë¹ßÀû¡¤ºÎÁ¾, ÇǺιßÀû, °á¸·ÃæÇ÷ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³ª´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
  
3) ´« : ¶§¶§·Î ÀϽÃÀûÀÎ ÀÛ¿°¨µî Àڱذ¨, ºÒÄè°¨ÀÌ, ¶§¶§·Î ÀÚÅë, ¹ßÀû, ¼Ò¾ç°¨, ÈÇÐÀû °á¸·¿° ¹× °¢¸·¿°, ¾È±¸ÁÖÀ§ ¹× ¾È¸éºÎÁ¾, À̹°°¨, ´«ºÎ½É, ½Ã·ÂºÒ¼±¸í, ´«¹°, °ÇÁ¶°¨, ¾ÈÅë, µå¹°°Ô ¾îÁö·¯¿ò, ºñ¸¸¼º Ç¥Ãþ°¢¸·¿°µîÀÇ °¢¸·Àå¾Ö ¹× µ¶¼ºÇ¥ÇDZ«»ç·Î±îÁö ¾ÇȵǴ ½ºÆ¼ºì½º-Á¸½¼ ÁõÈıºÀÌ ÀϾ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ·± Áõ»óÀÌ ³ªÅ¸³ª´Â °æ¿ì Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
  
4) ±âŸ : û°¢Àå¾Ö, ¶§¶§·Î ÀÚ±ØÁõ»óÀÌ ÀϾ´Â °æ¿ì°¡ ÀÖ´Ù.
  
5) ±¹³» ½ÃÆÇÈÄ Á¶»ç°á°ú 
 ±¹³»¿¡¼ Àç½É»ç¸¦ À§ÇÏ¿© 6³â µ¿¾È 908¸íÀÇ È¯ÀÚ¸¦ ´ë»óÀ¸·Î ½Ç½ÃÇÑ ½ÃÆÇÈÄ Á¶»ç°á°ú ÀÌ»ó¹ÝÀÀÀÇ ¹ßÇöÁõ·ÊÀ²Àº Àΰú°ü°è¿Í »ó°ü¾øÀÌ 1.98%(18¸í/908¸í, ÃÑ 19°Ç)·Î ³ªÅ¸³µÀ¸¸ç, ¾à¹° ÀÌ»ó¹ÝÀÀÀ¸·Î´Â ÀÛ¿°¨ (1.1%, 10·Ê), ¼Ò¾ç°¨(0.11%, 1·Ê)ÀÌ º¸°íµÇ¾ú´Ù.
  
6) ·¹º¸Ç÷ϻç½Å µîÀÇ Äû³î·Ð°è Ç×±ÕÁ¦¸¦ Åõ¿©¹ÞÀº ȯÀÚ Áß¿¡¼ ¿Ü°úÀû ¼ö¼úÀÌ ÇÊ¿äÇϰųª ¶Ç´Â Àå¾Ö±â°£ÀÇ ¿¬ÀåÀ» À¯¹ßÇÏ´Â ¾î±ú¤ý¼Õ¤ý¾ÆÅ³·¹½º°Ç µîÀÇ °ÇÆÄ¿ÀÌ º¸°íµÇ¾ú´Ù. Àü½Å Äû³î·Ð ¿¬±¸/½ÃÆÇ ÈÄ °æÇè¿¡ µû¸£¸é ƯÈ÷ °í·ÉȯÀÚ/¾ÆÅ³·¹½º ÈûÁÙ µîÀÇ ÈûÁÙÀÌ °íºÎÇÏ(high stress) »óÅÂÀÎ °æ¿ì¸¦ Æ÷ÇÔÇÏ¿© ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀÌµå º´¿ë½Ã µ¿ ÆÄ¿ À§ÇèÀÌ Áõ°¡ÇÑ´Ù.
  
          
     | 
   
  
  
    
   
    | ÀϹÝÀû ÁÖÀÇ | 
    1) À̾àÀÇ »ç¿ë¿¡ ÀÖ¾î¼ ³»¼º±ÕÀÇ ¹ßÇöµîÀ» ¹æÁöÇϱâ À§ÇÏ¿© ¿øÄ¢ÀûÀ¸·Î °¨¼ö¼ºÀ» È®ÀÎÇϰí Ä¡·á»ó ÇÊ¿äÇÑ ÃÖ¼Ò ±â°£¸¸ Åõ¿©ÇÑ´Ù.
  
2) À̾àÀÇ Àå±â »ç¿ëÀº Áø±ÕÀ» ºñ·ÔÇÑ ºñ°¨¼ö¼º±ÕÀÇ °úÀ× ¼ºÀåÀ» ÃÊ·¡ÇÒ ¼ö ÀÖÀ¸¹Ç·Î Àå±â »ç¿ëÇÏÁö ¾Ê´Â´Ù. Áߺ¹ °¨¿°½Ã Åõ¿©¸¦ ÁßÁöÇÏ°í ´Ù¸¥ ¿ä¹ýÀ¸·Î ´ëÄ¡ÇÑ´Ù.
  
3) ÀÌ ¾àÀÇ ¸ÞƼ½Ç¸°³»¼º Æ÷µµ»ó±¸±Õ(MRSA)¿¡ ´ëÇÑ À¯È¿¼ºÀº Áõ¸íµÇ¾îÀÖÁö ¾Ê±â ¶§¹®¿¡ MRSA¿¡ ÀÇÇÑ °¨¿°ÁõÀÌ ºÐ¸íÇϰí ÀÓ»óÁõ»óÀÇ °³¼±ÀÌ ³ªÅ¸³ªÁö ¾ÊÀº °æ¿ì ½Å¼ÓÈ÷ Ç×MRSAÀÛ¿ëÀÌ °ÇÑ ¾àÁ¦¸¦ Åõ¿©ÇÑ´Ù. 
  
4) ·¹º¸Ç÷ϻç½Å µîÀÇ Äû³î·Ð°è Ç×±ÕÁ¦¸¦ Åõ¿©¹ÞÀº ȯÀÚ Áß¿¡¼ ÈûÁÙ ¿°Áõ/ÆÄ¿ÀÌ º¸°íµÇ¾ú´Ù. ÇØ´ç Áõ»óÀº ƯÈ÷ °í·ÉÀÚÀ̰ųª ½ºÅ×·ÎÀ̵å¿Í º´¿ë ½Ã ´õ Áõ°¡ÇÑ´Ù. ȯÀÚ°¡ ÅëÁõ, ¿°Áõ, °ÇÆÄ¿À» °æÇèÇϸé ÀÌ ¾àÀÇ Åõ¿©¸¦ ÁßÁöÇØ¾ß ÇÑ´Ù. 
 | 
   
  
  
  
  
  
  
   
    | ÀӺο¡ ´ëÇÑ Åõ¿© | 
    
      
	[ÀӺαݱ⠼ººÐ Á¶È¸]       
      ÀÓ½ÅÁßÀÇ Åõ¿©¿¡ °üÇÑ ¾ÈÀü¼ºÀÌ È®¸³µÇ¾î ÀÖÁö ¾ÊÀ¸¹Ç·Î, ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀο¡´Â Ä¡·á»óÀÇ À¯ÀͼºÀÌ À§Ç輺À» »óȸÇÑ´Ù°í ÆÇ´ÜµÇ´Â °æ¿ì¿¡¸¸ Åõ¿©ÇÑ´Ù.
  
     | 
   
  
  
  
  
   
    | ¼öÀ¯ºÎ¿¡ ´ëÇÑ Åõ¿© | 
    ¼öÀ¯ºÎ¿¡ Åõ¿©ÇÒ °æ¿ì¿¡´Â ¼öÀ¯¸¦ Áß´ÜÇϰųª ÀÌ ¾àÀÇ Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
  
 | 
   
  
  
  
  
   
    | ¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿© | 
    
      
       
      ¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿© 
1¼¼ ¹Ì¸¸ÀÇ ¿µ¾Æ¿¡ ´ëÇÑ ¾ÈÀü¼º ¹× À¯È¿¼ºÀÌ È®¸³µÇ¾î ÀÖÁö ¾Ê´Ù.
 
  | 
   
  
  
  
  
  
  
  
  
  
  
  
    
   
    | Àû¿ë»óÀÇ ÁÖÀÇ | 
    1) Á¡¾È¿ëÀ¸·Î¸¸ »ç¿ëÇÑ´Ù. 
2) Á¡¾È½Ã ¿ë±âÀÇ ÀÔ±¸°¡ Á÷Á¢ ´«¿¡ ´êÁö ¾Êµµ·Ï ÁÖÀÇÇÑ´Ù. 
3) ¿À¿°À» ¹æÁöÇϱâ À§ÇØ µÉ ¼ö ÀÖ´Â ÇÑ °øµ¿À¸·Î »ç¿ëÇÏÁö ¾Ê´Â´Ù.
  
 | 
   
  
  
  
  
  
  		
  
  
   
    | º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ | 
    1) ¼Ò¾ÆÀÇ ¼ÕÀÌ ´êÁö ¾Ê´Â °÷¿¡ º¸°üÇÑ´Ù. 
2) Á÷»çÀϱ¤À» ÇÇÇÏ°í µÇµµ·Ï ¼´ÃÇÑ °÷¿¡ º¸°üÇÑ´Ù. 
3) ¿À¿ëÀ» ¸·°í ǰÁúÀÇ º¸Á¸À» À§ÇÏ¿© ´Ù¸¥ ¿ë±â¿¡ ¹Ù²Ù¾î ³ÖÁö ¾Ê´Â´Ù. 
  
 | 
   
  	
  
  
  
  
  
  
  
      							
 
 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | Á¤º¸¿ä¾à | 
                 
	         
	       | 
	           	    
	     |  
	    | 
  
    µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
    
  
  
    
  
   |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | ÄÚµå ¹× ºÐ·ùÁ¤º¸ | 
                 
	         
	       | 
	           	    
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
  
  
  
  
  
  
  
  
  	
   
    | ´ëÇ¥ÄÚµå | 
    8806552001906 | 
   
  
  
  
  
   
    | BIT ¾àÈ¿ºÐ·ù | 
    
      ¾È°ú¿ë Ç×°¨¿°Á¦(Eye anti-infectives)
     | 
   
  
  
  
   
    | ATC ÄÚµå | 
    levofloxacin  / S01AE05
     
      [ÄÚµåºÐ·ù»ó¼¼¼³¸í]
      
        [ATCÄÚµå¿¹Ãø]
      
     | 
   
  
  
  
  
  
  
  
 
  
  
   
    | º¹ÁöºÎºÐ·ùÄÚµå | 
    
    131  (¾È°ú¿ëÁ¦                                                        )
      
     | 
   
  
  
  
   
    | ÀǾàǰ ¹ÙÄÚµåÁ¤º¸ | 
    
      
          
        ³»¿ëº¸±â
       	 
      
	·¹º¸Å·Á¡¾È¾×(·¹º¸Ç÷ϻç½Å)/ A05352921 
Á¦Ç°±Ô°Ý: 5¹Ð¸®¸®ÅÍ/Á¦Ç°¼ö·®: 1/Á¦Çü: °³
Æû¸ñ±âÁØÄÚµå: 200705652 /´ëÇ¥ÄÚµå: 8806552001906/Ç¥ÁØÄÚµå: 8806552001913
±¸¹ÙÄÚµå: -/ºñ°í:-
        																								
     | 
   
  
  
  
  
   
  
     
  
  
  
  
   
    | Drugs By Indication | 
    
      [Àüüº¸±â]
     | 
   
  
   
    | Drugs By Classification | 
    
      [Àüüº¸±â]
     | 
     
 	 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | Á¦Ç°Á¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	     |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | º¹¾àÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
   
    | LACTmed ¹Ù·Î°¡±â | 
    
      
        [¹Ù·Î°¡±â]
     | 
     
  
  
   
    | ¾à¸®ÀÛ¿ë | 
    
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
       
     | 
     
  
  
  
   
    | Ãà¾àº¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
       
  
  
   
    | º¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
                                                          															
  
   
  
  
   
    | ÀӺο¡´ëÇÑÅõ¿© | 
    
      
      
        
	      
	      
	        | *  | 
	        
	          ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù. 
	         | 
	         
	       
	       | 
	   
	  
	    |   | 
	   
	  
	    
	      FDA : Cµî±Þ 
				        	
					  
					
	   | 
	  
	  
	  
	     
	     
	     
	     
	     
	     
	   | 
	 
	
	  
	      
	      
	        | *  | 
	        
	          »ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
	         | 
	         
	      
	        | *  | 
	        
	          ¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
	         | 
	         
	       
	   | 
	 
       
     | 
   
  
  
  
   
    ½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
  	   
  
  	   
  
  	   
  
  
     
      | Pharmacokinetics | 
      
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
      
       |   
     
  
  
  
  
  
  
  
   
    | º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ | 
    
      [º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
     | 
   
  	
  
  
  	
  
  
   
    | Á¦Çüº° º¹¾àÁöµµ | 
    [Á¡¾È¾×] | 
   
  
  
   
    | º¸°ü»ó ÁÖÀÇ | 
    
      
    	
     | 
   
  
  
   
    | Á¶Á¦½Ã ÁÖÀÇ | 
    
      
    	
     | 
      
 
 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | ½É»çÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	     |  
	   
	   
	
	  
       |  
	    
	      
	        
            
                | ÇмúÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
    | DUR (ÀǾàǰ»ç¿ëÆò°¡) | 
    º´¿ë±Ý±â :
     
	 °í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
	 
	  [»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]										
	  ¿¬·É´ë±Ý±â :
      °í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
      
       [¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
       
       
        
        
     | 
   
  
   
    | Mechanism of Action | 
    
       Levofloxacin¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Levofloxacin inhibits bacterial type II topoisomerases, topoisomerase IV and DNA gyrase. Levofloxacin, like other fluoroquinolones, inhibits the A subunits of DNA gyrase, two subunits encoded by the gyrA gene. This results in strand breakage on a bacterial chromosome, supercoiling, and resealing; DNA replication and transcription is inhibited. 
     | 
   
  
   
    | Pharmacology | 
     
       Levofloxacin¿¡ ´ëÇÑ Pharmacology Á¤º¸ Levofloxacin, a fluoroquinolone antiinfective, is the optically active L-isomer of ofloxacin. Levofloxacin is used to treat bacterial conjunctivitis, sinusitis, chronic bronchitis, community-acquired pneumonia and pneumonia caused by penicillin-resistant strains of Streptococcus pneumoniae, skin and skin structure infections, complicated urinary tract infections and acute pyelonephritis. 
     | 
   
  
   
    | Metabolism | 
    
       Levofloxacin¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 1A2 (CYP1A2) 
     | 
   
  
   
    | Protein Binding | 
    
       Levofloxacin¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 24-38% (to plasma proteins) 
     | 
   
  
   
    | Half-life | 
    
       Levofloxacin¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 6-8 hours 
     | 
   
  
   
    | Absorption | 
    
       Levofloxacin¿¡ ´ëÇÑ Absorption Á¤º¸ Absorption of ofloxacin after single or multiple doses of 200 to 400 mg is predictable, and the amount of drug absorbed increases proportionately with the dose. 
     | 
   
  
   
    | Pharmacokinetics | 
    
       LevofloxacinÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á 
- 
Èí¼ö : Àß Èí¼öµÈ´Ù. À½½Ä¹°¿¡ ÀÇÇÑ ¿µÇâÀº ¹Ì¹ÌÇÏ´Ù.
  -  
»ýü³»ÀÌ¿ë·ü : 99%
  -  
ºÐÆ÷ : ºÐÆ÷¿ëÀû : 1.25 L/kg
  -  
´ë»ç : ÀÔüÈÇÐÀûÀ¸·Î Ç÷Àå°ú ¼Òº¯Áß¿¡¼ ¾ÈÁ¤Çϸç, À̰ÍÀÇ enantiomer·Î´Â ´ë»çÀûÀ¸·Î º¯È¯µÇÁö ¾Ê´Â´Ù. 
  - 
´Ü¹é°áÇÕ : 24-38%
  -  
¹Ý°¨±â : 6-8 ½Ã°£ 
  -  ¼Ò½Ç : ÁÖ·Î ¹Ìº¯Èü·Î ½Å¹è¼³, 4% ¹Ì¸¸ÀÌ º¯¹è¼³
   
     | 
   
  
   
    | Biotransformation | 
    
       Levofloxacin¿¡ ´ëÇÑ Biotransformation Á¤º¸ Not Available 
     | 
   
  
   
    | Toxicity | 
    
       Levofloxacin¿¡ ´ëÇÑ Toxicity Á¤º¸ Side effects include disorientation, dizziness, drowsiness, hot and cold flashes, nausea, slurring of speech, swelling and numbness in the face 
     | 
   
  
   
    | Drug Interactions | 
    
       Levofloxacin¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Aluminium	Formation of non-absorbable complexesBismuth	Formation of non-absorbable complexesCalcium	Formation of non-absorbable complexesIron	Formation of non-absorbable complexesMagnesium oxide	Formation of non-absorbable complexesMagnesium	Formation of non-absorbable complexesSucralfate	Formation of non-absorbable complexesZinc	Formation of non-absorbable complexesAmiodarone	Increased risk of cardiotoxicity and arrhythmiasBepridil	Increased risk of cardiotoxicity and arrhythmiasBretylium	Increased risk of cardiotoxicity and arrhythmiasChlorpromazine	Increased risk of cardiotoxicity and arrhythmiasDihydroquinidine barbiturate	Increased risk of cardiotoxicity and arrhythmiasDisopyramide	Increased risk of cardiotoxicity and arrhythmiasErythromycin	Increased risk of cardiotoxicity and arrhythmiasFluphenazine	Increased risk of cardiotoxicity and arrhythmiasJosamycin	Increased risk of cardiotoxicity and arrhythmiasMesoridazine	Increased risk of cardiotoxicity and arrhythmiasMethotrimeprazine	Increased risk of cardiotoxicity and arrhythmiasPerphenazine	Increased risk of cardiotoxicity and arrhythmiasProchlorperazine	Increased risk of cardiotoxicity and arrhythmiasQuinidine	Increased risk of cardiotoxicity and arrhythmiasPropiomazine	Increased risk of cardiotoxicity and arrhythmiasPromazine	Increased risk of cardiotoxicity and arrhythmiasPromethazine	Increased risk of cardiotoxicity and arrhythmiasProcainamide	The quinolone increases the effect of procainamideQuinidine barbiturate	Increased risk of cardiotoxicity and arrhythmiasQuinupristin	This combination presents an increased risk of toxicitySotalol	Increased risk of cardiotoxicity and arrhythmiasThiethylperazine	Increased risk of cardiotoxicity and arrhythmiasThioridazine	Increased risk of cardiotoxicity and arrhythmiasTrifluoperazine	Increased risk of cardiotoxicity and arrhythmiasTriflupromazine	Increased risk of cardiotoxicity and arrhythmiasWarfarin	The quinolone increases the anticoagulant effectAcenocoumarol	The quinolone increases the anticoagulant effectDicumarol	The quinolone increases the anticoagulant effectAnisindione	The quinolone increases the anticoagulant effect 
     | 
   
  
   
    CYP450  Drug Interaction | 
    
      [CYP450 TableÁ÷Á¢Á¶È¸] 
     | 
   
  
   
    | Food Interaction | 
    
       Levofloxacin¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take without regard to meals. Take with water, drink lliberally. Taking this product with orange juice can result in reduced quinolone plasma levels. 
     | 
   
  
   
    | Drug Target | 
    
      
      [Drug Target]
     | 
   
  
   
    | Description | 
    
       Levofloxacin¿¡ ´ëÇÑ Description Á¤º¸ A synthetic fluoroquinolone (fluoroquinolones) antibacterial agent that inhibits the supercoiling activity of bacterial DNA gyrase, halting DNA replication. [PubChem] 
     | 
   
  
   
    | Dosage Form | 
    
       Levofloxacin¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Solution	IntravenousTablet	Oral 
     | 
   
  
   
    | Drug Category | 
    
       Levofloxacin¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Bacterial AgentsAnti-Infective Agents, UrinaryNucleic Acid Synthesis InhibitorsQuinolones 
     | 
   
  
   
    | Smiles String Canonical | 
    
       Levofloxacin¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC1COC2=C3N1C=C(C(O)=O)C(=O)C3=CC(F)=C2N1CCN(C)CC1 
     | 
   
  
   
    | Smiles String Isomeric | 
    
       Levofloxacin¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@H]1COC2=C3N1C=C(C(O)=O)C(=O)C3=CC(F)=C2N1CCN(C)CC1 
     | 
   
  
   
    | InChI Identifier | 
    
       Levofloxacin¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C18H20FN3O4/c1-10-9-26-17-14-11(16(23)12(18(24)25)8-22(10)14)7-13(19)15(17)21-5-3-20(2)4-6-21/h7-8,10H,3-6,9H2,1-2H3,(H,24,25)/t10-/m0/s1/f/h24H 
     | 
   
  
   
    | Chemical IUPAC Name | 
    
       Levofloxacin¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (-)-(S)-9-fluoro-2,3-dihydro-3-methyl-10-(4-methyl-1-piperazinyl)-7-oxo-7Hpyrido[1,2,3-de]-1,4 benzoxazine-6-carboxylic acid hemihydrate 
     | 
   
    
  |  
	   
	   
	
	  
       |  
	    
	      
	        
            
                | »ç¿ëÀÚÄÁÅÙÃ÷ | 
                             
	         
	       | 
	           	  
       |  
	     |  
	   
	     	
 
  | 
   
   
     | 
   
  
    
      
        
          
            
              - 
                ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2021-12-09
              
 
              - 
                
                º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
                
              
     
             
         |                 
       
     |       
          
                
                    
                       ¾Ë¸² | 
                       
                      »ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù.  | 
                    
                    | 
               
      
      
                
                    
                       °æ°í | 
                     
                      µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù. 
                          Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â 
                          Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
                            ¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
                          ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
 | 
                    
                    | 
               
  
 
  
    ¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é 
    ¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
   
  
 
  º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
 
  [ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â]       Á¦¸ñ ¾øÀ½ 
 
    
    2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
    
    1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ  º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
    ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
          
    
    
    
    2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
    ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
 
 
 
   
  |