| |
|
|
|
|
|
 |
| |
|
¼¼Æ®¶ô»ìÇ÷¯½ºÁ¡ÀÌ¾× CETRAXAL PLUS OTIC SOLUTION
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
¼öÀÔÀǾàǰ
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
679700100[E26130031]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1ml(2016.10.01)(ÇöÀç¾à°¡)
\1,099 ¿ø/1ml(2016.03.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»öÀÇ ºÒÅõ¸íÇÑ ÇÃ¶ó½ºÆ½ ¿ë±â¿¡ µç ¹«»ö ³»Áö ¹ÌȲ»öÀÇ Åõ¸íÇÑ ¾×Á¦
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
10ml/1ÅëÆ÷Àå |
| ÁÖ¼ººÐÄÚµå |
475900CLQ
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| ´ëÇ¥ÄÚµå |
8806797001006 |
| º¸°ü¹æ¹ý |
±â¹Ð¿ë±â, 25¡ÉÀÌÇÏ¿¡¼ º¸°ü |
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
Á¤»ó °í¸·À» °¡Áø ȯÀÚÀÇ Staphylococcus aureus, Proteus mirabilis, Pseudomonas aeruginosa ¿¡ ÀÇÇÑ ±Þ¼º ¿ÜÀÌ¿°ÀÇ Ä¡·á
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
7¼¼ ÀÌ»óÀÇ ¼Ò¾Æ ¹× ¼ºÀÎ;
ÀÌ ¾à 4¢¦6¹æ¿ïÀ» 8½Ã°£¸¶´Ù °¨¿°µÈ ¿ÜÀ̵µ¿¡ Á¡ÀûÇÑ´Ù. Ä¡·á±â°£Àº 7¢¦8ÀÏÀÌ´Ù.
»ç¿ë ½Ã ¾à¾×ÀÇ ¿Âµµ°¡ ³·À¸¸é ¾îÁö·¯¿òÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î À̸¦ ÇÇÇϱâ À§ÇÏ¿© ¿ë±â¸¦ 1¢¦2ºÐ Á¤µµ ¼ÕÀ¸·Î Àâ¾Æ µû¶æÇÏ°Ô ÇÑ ÈÄ Åõ¿©ÇÑ´Ù. ¸Ó¸®´Â ¿·À¸·Î ±â¿ï¿©¼ °¨¿°µÈ ±Í°¡ À§ÂÊÀ¸·Î ÇâÇÏ°Ô ÇÑ ÀÚ¼¼¿¡¼ ÀÌ ¾àÀ» Á¡ÀûÇÏ¸ç ¾à¹°¹æ¿ïÀÌ ¿ÜÀ̵µ¿¡ µé¾î°¡µµ·Ï ¾à 30Ãʰ£ À¯ÁöÇÑ´Ù. ÇÊ¿äÇÑ °æ¿ì ¹Ý´ëÂÊ ±Í¿¡µµ µ¿ÀÏÇÑ ¹æ¹ýÀ¸·Î Åõ¿©ÇÑ´Ù.
|
| ±Ý±â |
´ÙÀ½ ȯÀÚ¿¡´Â Åõ¿©ÇÏÁö ¸» °Í
1) Ç÷ç¿À½Ã³î·Ð, ½ÃÇÁ·ÎÇ÷ϻç½Å ¶Ç´Â ´Ù¸¥ Äû³î·Ð°è ¾à¹° ¹× ÀÌ ¾àÀÇ ´Ù¸¥ ¼ººÐ¿¡ °ú¹ÎÁõÀÌ Àִ ȯÀÚ
2) ¼öµÎ ¹× ´Ü¼øÆ÷Áø °¨¿°À» Æ÷ÇÔÇÑ ¿ÜÀ̵µÀÇ ¹ÙÀÌ·¯½º¼º °¨¿°È¯ÀÚ
|
| ½ÅÁßÅõ¿© |
´ÙÀ½ ȯÀÚ¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÒ °Í
°í¸·Ãµ°øÀÌ ÀÖ´Â ±Þ¼º ¿ÜÀÌ¿° ȯÀÚ¿¡ ´ëÇÑ ¾ÈÀü¼º¡¤À¯È¿¼ºÀº È®¸³µÇÁö ¾Ê¾Ò´Ù. °í¸·Ãµ°øÀÌ ÀÖ´Ù°í ¾Ë·ÁÁ® Àְųª ÀǽɵǴ ȯÀÚ´Â ÁÖÀÇÇÏ¿© Åõ¿©ÇÑ´Ù.
|
| ÀÌ»ó¹ÝÀÀ |
ÀÓ»ó½ÃÇè °á°ú ÀÌ»ó¹ÝÀÀÀº ¾à¹° Åõ¿© ½Ã¿¡ ±¹¼Ò ¼Ò¾çÁõ°ú Áö°¢°ú¹Î µîÀÌ 0.3% ¹ß»ýÇÏ¿´´Ù.
|
| ÀϹÝÀû ÁÖÀÇ |
1) ÀÌ ¾àÀº ÁßÀÌ¿° ȯÀÚ¿¡ ´ëÇÑ ¾ÈÀü¼º¡¤À¯È¿¼ºÀº È®¸³µÇÁö ¾Ê¾Ò´Ù.
2) µÎµå·¯±â³ª ±¹¼Ò ¶Ç´Â Àü½ÅÀû °ú¹ÎÁõÀÇ Áõ»óÀÌ ÀÖ´Ù¸é Ä¡·á¸¦ Áß´ÜÇÒ °Í
3) ÀÌ ¾àÀ» »ïŰ°Å³ª ÁÖ»çÇÏÁö ¸» °Í
4) ¿À¿°À» ¿¹¹æÇϱâ À§ÇØ ÀÌ ¾àÀ» Á¡ÀûÇÒ ¶§ Á¡Àû±â¿Í ±Í ¹× ¼Õ°¡¶ô°úÀÇ Á¢ÃËÀ» ÇÇÇϵµ·Ï ÁÖÀÇÇÒ °Í
5) ÀÌ ¾àÀº ´Ù¸¥ Á¡À̾à°ú º´¿ëÇÏ¿© »ç¿ëÇÏÁö ¸» °Í
6) ´Ù¸¥ Ç×±ÕÁ¦¿Í ¸¶Âù°¡Áö·Î ÀÌ ¾àÀÇ »ç¿ëÀ¸·Î Áø±ÕÀ̳ª À̽ºÆ®¿Í °°Àº ºñ°¨¼ö¼º ±ÕÀÌ °úµµÇÏ°Ô ¼ºÀåÇÒ ¼ö ÀÖ´Ù. ¸¸¾à 1ÁÖÀÏÀ» Ä¡·áÇÏ¿©µµ °¨¿°ÁõÀÇ °³¼±ÀÌ ¾øÀ» °æ¿ì¿¡´Â ±ÕÀ» ¹è¾çÇÏ¿© ´õ ³ªÀº Ä¡·á¸¦ ÇÒ ¼ö ÀÖµµ·Ï ÇÑ´Ù. Ä¡·á°¡ ³¡³ ÈÄ¿¡µµ ÀÌ·ç°¡ Áö¼ÓµÇ°Å³ª, 6°³¿ù ¾È¿¡ 2¹ø ÀÌ»óÀÇ ÀÌ·ç°¡ ³ªÅ¸³ª¸é ÄÝ·¹½ºÅ׸°Á¾, À̹°, Á¾¾ç µî¿¡ °üÇÑ Á¤¹ÐÇÑ °Ë»ç°¡ ±ÇÀåµÈ´Ù.
7) ½ÃÇÁ·ÎÇ÷ϻç½ÅÀ» Æ÷ÇÔÇÑ Äû³î·Ð°è ¾à¹°ÀÌ ±Í·Î Èí¼öµÇ°Å³ª Åõ¿©µÇ´Â °Íº¸´Ù °í¿ë·®À¸·Î Àü½ÅÅõ¿©µÉ °æ¿ì ´Ù¾çÇÑ Á¾ÀÇ ¹Ì¼º¼÷ µ¿¹°ÀÇ Ã¼ÁßÀ» ÁöÁöÇÏ´Â °üÀý ¿¬°ñÀÇ ¼Õ»óÀ̳ª ħ½Ä, ȤÀº ´Ù¸¥ °üÀýÁúȯÀÇ ÁõÈİ¡ ³ªÅ¸³µ´Ù.
8) ±¹¼Ò ÄÚ¸£Æ¼ÄÚÀ̵åÀÇ Àü½ÅÀû Èí¼ö´Â ¸î¸î ȯÀÚ¿¡¼ °¡¿ªÀûÀÎ ½Ã»óÇϺÎ-³úÇϼöü-ºÎ½Å(HPA)ÃàÀÇ ¾ïÁ¦, Äí½ÌÁõÈıº, °úÇ÷´çÁõ, ´ç´¢ µîÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÏ¿© Åõ¿©ÇÑ´Ù.
|
| »óÈ£ÀÛ¿ë |
´Ù¸¥ ¾à¹°°úÀÇ »óÈ£ÀÛ¿ë¿¡ ´ëÇÏ¿© ¿¬±¸µÈ ¹Ù´Â ¾ø´Ù.
|
| ÀӺο¡ ´ëÇÑ Åõ¿© |
[ÀӺαݱ⠼ººÐ Á¶È¸]
µ¿¹°½ÃÇè¿¡¼ Ç÷ç¿À½Ã³î·ÐÀÇ ±¹¼ÒµµÆ÷·Î ÀÎÇØ ±âÇü¹ß»ýÀÌ ³ªÅ¸³µ´Ù´Â º¸°í°¡ ÀÖÀ¸¸ç ÀÌ ¾àÀ» ÀӺθ¦ ´ë»óÀ¸·Î ÇÑ ¿¬±¸´Â ¼öÇàµÇÁö ¾Ê¾ÒÀ¸¹Ç·Î ÀӺο¡ ´ëÇÑ ¾ÈÀü¼º¤ýÀ¯È¿¼ºÀº È®¸³µÇ¾îÀÖÁö ¾Ê´Ù. ÀÓ½ÅÇÑ ¿©¼º¿¡°Ô »ç¿ëÇÒ °æ¿ì¿¡´Â Ä¡·á»óÀÇ À¯ÀͼºÀÌ À§Ç輺À» »óȸÇÑ´Ù°í ÆÇ´ÜµÉ ¶§¿¡ ÇÑÇÏ¿© ÁÖÀÇÇÏ¿© Åõ¿©ÇÑ´Ù.
|
| ¼öÀ¯ºÎ¿¡ ´ëÇÑ Åõ¿© |
ÀÌ ¾àÀÌ ±Í¸¦ ÅëÇØ ¸ðÀ¯·Î ºÐºñµÈ´Ù´Â Á¦ÇÑÀû Á¤º¸°¡ ÀÖ´Ù. ¼öÀ¯¸¦ ¹Þ´Â À¯¾Æ¿¡°Ô ÁßÁõÀÇ ºÎÀÛ¿ëÀÌ »ý±æ ¼öµµ Àֱ⠶§¹®¿¡ ÀÌ ¾àÀÇ Çʿ伺À» °í·ÁÇÏ¿© ¼öÀ¯ºÎ¿¡°Ô Åõ¿©ÇÒ ¶§ ¼öÀ¯¸¦ Áß´ÜÇÒ °ÍÀÎÁö Åõ¾àÀ» Áß´ÜÇÒ °ÍÀÎÁö °áÁ¤ÇÑ´Ù. |
| ¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿© |
¸¸ 7¼¼ ¹Ì¸¸ÀÇ ¼Ò¾Æ¿¡ ´ëÇÑ ¾ÈÀü¼º¤ýÀ¯È¿¼ºÀº È®¸³µÇÁö ¾Ê¾Ò´Ù. |
| Àû¿ë»óÀÇ ÁÖÀÇ |
1) ¾È°ú¿ëÀ̳ª ÁÖ»ç¿ëÀ¸·Î »ç¿ëÇÏÁö ¾Ê´Â´Ù.
2) »ç¿ë ½Ã ¾à¾×ÀÇ ¿Âµµ°¡ ³·À¸¸é ¾îÁö·¯¿òÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î À̸¦ ÇÇÇϱâ À§ÇÏ¿© ¿ë±â¸¦ 1¢¦2ºÐ Á¤µµ ¼ÕÀ¸·Î Àâ¾Æ µû¶æÇÏ°Ô ÇÑ ÈÄ Åõ¿©ÇÏ¸ç »ç¿ë Àü Àß Èçµé¾î¼ »ç¿ëÇÑ´Ù.
3) ÀÌ ¾àÀº Á÷»ç±¤¼±À» ÇÇÇÏ¿© ¾óÁö ¾Ê°Ô º¸°üÇÏ°í °³ºÀ ÈÄ 30ÀÏÀÌ Áö³ª¸é »ç¿ëÇÏÁö ¾Ê´Â´Ù.
|
| °ú·®Åõ¿© ¹× óġ |
°ú·®Åõ¿©¿¡ ´ëÇÑ ÀÚ·á´Â ¾ø´Ù. ¸¸¾à ¿ì¹ßÀûÀ¸·Î ÀÌ ¾àÀ» »ïÄ×À» °æ¿ì ±¸Å䳪 À§¼¼Ã´, Ȱ¼ºÅº°ú ¸¶±×³×½· ¶Ç´Â Ä®½· µîÀ» Æ÷ÇÔÇÑ Á¦»êÁ¦¸¦ Åõ¿©ÇÏ´Â µî óġÇÑ´Ù. |
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
±â¹Ð¿ë±â, 25¡ÉÀÌÇÏ¿¡¼ º¸°ü |
| ±âŸ |
¿îÀüÀ̳ª ±â°èÁ¶ÀÛ¿¡ ´ëÇÑ ÀÓ»ó½ÃÇèÀÇ Á¤º¸´Â ¾ø´Ù. ±×·¯³ª ÀÌ ¾àÀÇ Åõ¿©°æ·Î³ª »ç¿ë Á¶°ÇÀ» °í·ÁÇÒ ¶§ ÀÌ ¾àÀº ¿îÀüÀ̳ª ±â°èÁ¶ÀÛÀÇ ´É·Â¿¡ ¿µÇâÀ» ¹ÌÄ¡Áö ¾Ê´Â´Ù. |
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| Á¦Çüº° º¹¾àÁöµµ |
[Á¡ÀÌ] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Ciprofloxacin¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ The bactericidal action of ciprofloxacin results from inhibition of the enzymes topoisomerase II (DNA gyrase) and topoisomerase IV, which are required for bacterial DNA replication, transcription, repair, and recombination.
|
| Pharmacology |
Ciprofloxacin¿¡ ´ëÇÑ Pharmacology Á¤º¸ Ciprofloxacin is a broad-spectrum antiinfective agent of the fluoroquinolone class. Ciprofloxacin has in vitro activity against a wide range of gram-negative and gram-positive microorganisms. The mechanism of action of quinolones, including ciprofloxacin, is different from that of other antimicrobial agents such as beta-lactams, macrolides, tetracyclines, or aminoglycosides; therefore, organisms resistant to these drugs may be susceptible to ciprofloxacin. There is no known cross-resistance between ciprofloxacin and other classes of antimicrobials. Notably the drug has 100 times higher affinity for bacterial DNA gyrase than for mammalian.
|
| Absorption |
Ciprofloxacin¿¡ ´ëÇÑ Absorption Á¤º¸ Rapidly and well absorbed from the gastrointestinal tract after oral administration. The absolute bioavailability is approximately 70% with no substantial loss by first pass metabolism.
|
| Pharmacokinetics |
Ciprofloxacin HClÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : °æ±¸ : À§Àå°ü¿¡¼ ºü¸£°Ô Èí¼öµÈ´Ù.
- »ýü³»ÀÌ¿ë·ü : 50-80%
- ºÐÆ÷ : ÅÂ¹Ý Åë°ú, À¯Áó ºÐºñ, ü³»¿¡ ³Î¸® ºÐÆ÷
- ÈçÈ÷ Á¶Á÷³óµµ°¡ Ç÷Á߳󵵺¸´Ù ³ô´Ù.
- ½ÅÀå, ¹æ±¤, °£, Æó, ºÎÀΰúÀû Á¶Á÷, Àü¸³¼±¿¡ ³ôÀº ³óµµ·Î ºÐÆ÷ÇÑ´Ù.
- ³úô¼ö¾× ´ë Ç÷¾×ÀÇ ³óµµºñ (%)
- Á¤»ó ³ú¸· : 10
- ¿°Áõ¼º ³ú¸· : 14-37
- ´Ü¹é°áÇÕ : 16-43%
- ´ë»ç : ºÎºÐÀûÀ¸·Î °£´ë»ç
- ¹Ý°¨±â :
- ¼Ò¾Æ : 2.5½Ã°£
- Á¤»ó ½Å±â´ÉÀÇ ¼ºÀÎ : 3-5 ½Ã°£
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : °æ±¸ : 0.5-2 ½Ã°£
- ¼Ò½Ç : 30-50%°¡ ¹Ìº¯Èü·Î ½Å¹è¼³, 20-40%°¡ ´ãÁóÀ» ÅëÇØ º¯¹è¼³
Fluocinolone AcetonideÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : Á¦Á¦ÀÇ ³óµµ(strength)¿Í Àû¿ëµÈ ¾ç, Àû¿ë ºÎÀ§ÀÇ ÇǺΠ»óÅ¿¡ µû¶ó ´Ù¸£´Ù.
- Èí¼öµÇ´Â ¹üÀ§´Â Èí¼öµÇ´Â ÃþÀÌ µÎ²¨¿î °æ¿ì´Â (¼Õ¹Ù´Ú, ¹ß¹Ù´Ú, ÆÈ²ÞÄ¡ µî) 1%¿¡¼ ºÎÅÍ Èí¼öµÇ´Â ÃþÀÌ ¾ãÀº °æ¿ì´Â (¾ó±¼, ¾È°Ë µî) 36% Á¤µµ±îÁö ´Ù¾çÇÏ´Ù.
- ÇǺο¡ ¼Õ»óÀ̳ª ¿°ÁõÀÌ Àְųª ±× ºÎÀ§¸¦ ¹ÐºÀ(occlude)½ÃÄÑ ÁÖ¸é Èí¼öµÇ´Â Á¤µµ°¡ Áõ°¡ÇÑ´Ù.
- ºÐÆ÷ : ÁÖ·Î Àû¿ëµÈ ÇǺο¡ ºÐÆ÷ÇÑ´Ù. Àü½Å ¼øÈ¯°è·Î Èí¼öµÈ ¾à¹°Àº ±ÙÀ°, °£, ÇǺÎ, Àå°ü, ½ÅÀåÀ¸·Î ºü¸£°Ô ºÐÆ÷µÈ´Ù.
- ´ë»ç : ÀÏÂ÷ÀûÀ¸·Î ÇǺο¡¼ ´ë»çµÈ´Ù. Àü½Å ¼øÈ¯°è·Î Èí¼öµÈ ¼Ò·®ÀÇ ¾à¹°Àº ÀÏÂ÷ÀûÀ¸·Î °£¿¡¼ Ȱ¼ºÀÌ ¾ø´Â ´ë»çü·Î ´ë»çµÈ´Ù.
- ¼Ò½Ç : ÀÏÂ÷ÀûÀ¸·Î glucuronides, sulfates Æ÷ÇÕü³ª ºñÆ÷ÇÕ ´ë»çü·Î ½Å¹è¼³ µÈ´Ù. ¼Ò·®ÀÇ ´ë»çü´Â º¯À¸·Î ¹è¼³µÈ´Ù.
|
| Toxicity |
Ciprofloxacin¿¡ ´ëÇÑ Toxicity Á¤º¸ The major adverse effect seen with use of is gastrointestinal irritation, common with many antibiotics.
|
| Drug Interactions |
Ciprofloxacin¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Aluminium Formation of non-absorbable complexesMethotrexate Increases methotrexate toxicity Aminophylline The quinolone increases the effect of theophyllineAnisindione The quinolone increases the anticoagulant effectBismuth Formation of non-absorbable complexesCaffeine The quinolone increases the effect and toxicity of caffeineCalcium Formation of non-absorbable complexesClozapine Ciprofloxacin may increase clozapine serum levelsCyclosporine The quinolone increases the effect and toxicity of cyclosporineDicumarol The quinolone increases the anticoagulant effectDihydroxyaluminium Formation of non-absorbable complexesDyphylline The quinolone increases the effect of theophyllineDuloxetine Increases the effect/toxicity of duloxetineDyphylline The quinolone increases the effect of theophyllineEthotoin Decreases the hydantoin effectFoscarnet Increased risk of convulsionsFosphenytoin Decreases the hydantoin effectMagnesium oxide Formation of non-absorbable complexesMagnesium Formation of non-absorbable complexesMephenytoin Decreases the hydantoin effectAcenocoumarol The quinolone increases the anticoagulant effectOxtriphylline The quinolone increases the effect of theophyllinePhenytoin Decreases the hydantoin effectProcainamide The quinolone increases the effect of procainamideRasagiline Increases effect/toxicity of rasagilineRopinirole The quinolone increases the effect and toxicity of ropiniroleSevelamer Sevelamer decreases ciprofloxacin bioavailabilitySildenafil The quinolone increases sildenafil levelsSucralfate Formation of non-absorbable complexesTheophylline The quinolone increases the effect of theophyllineTizanidine Increases the effect/toxicity of tizanidineWarfarin The quinolone increases the anticoagulant effectIron Formation of non-absorbable complexesZinc Formation of non-absorbable complexes
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Ciprofloxacin¿¡ ´ëÇÑ Description Á¤º¸ A broad-spectrum antimicrobial carboxyfluoroquinoline. [PubChem]
|
| Dosage Form |
Ciprofloxacin¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Ointment OphthalmicSolution IntravenousSolution OphthalmicSuspension OralTablet OralTablet, extended release Oral
|
| Drug Category |
Ciprofloxacin¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Infective AgentsAnti-InfectivesNucleic Acid Synthesis InhibitorsQuinolones
|
| Smiles String Canonical |
Ciprofloxacin¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ OC(=O)C1=CN(C2CC2)C2=CC(N3CCNCC3)=C(F)C=C2C1=O
|
| Smiles String Isomeric |
Ciprofloxacin¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ OC(=O)C1=CN(C2CC2)C2=CC(N3CCNCC3)=C(F)C=C2C1=O
|
| InChI Identifier |
Ciprofloxacin¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C17H18FN3O3/c18-13-7-11-14(8-15(13)20-5-3-19-4-6-20)21(10-1-2-10)9-12(16(11)22)17(23)24/h7-10,19H,1-6H2,(H,23,24)/f/h23H
|
| Chemical IUPAC Name |
Ciprofloxacin¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid
|
| Drug-Induced Toxicity Related Proteins |
CIPROFLOXACIN ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Alanine aminotransferase Drug:ciprofloxacin Toxicity:Fulminant hepatic failure. [¹Ù·Î°¡±â] Replated Protein:Alanine aminotransferase Drug:ciprofloxacin Toxicity:significant haematological or biochemical toxicity. [¹Ù·Î°¡±â] Replated Protein:Aspartate aminotransferase Drug:ciprofloxacin Toxicity:Fulminant hepatic failure. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-08-01
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|