|   | 
        
            
         | 
          | 
        
        
        
            | 
                
             | 
         
        
             | 
         
        
            
            
            
  
    
	  | 
   
  
    
        
          |   | 
          
              
                | 
                    ¾ÆÅäÇÉÅ©¸²  [Doxepin HCl]  
                    
                 | 
               
              
                | 
                     Àü¹®ÀǾàǰ | »èÁ¦  
                        
                    	
                    
                 | 
               
              
                | 
					  
                  
				  
                 | 
               
              
              
              
              
              |   |  
              
                
                    
                        | 
                      ¾Ë¸²:  | 
                      µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. | 
                     
                    | 
               
            
              
                
                   
                   
                   
                   
		   
                 | 
               
              
                | 
                  
                  
                 | 
               
              | 
            | 
         
       
       | 
   
    |  
  
    | 
      
     | 
     
  |  
                              
                                  | 
                                   | 
                               
            
            
                
            
            
              
            
                            
              
                                                     
            
            
   |  
  
    | 
      
     | 
   
   
     | 
   
    
   
    | 
       
        À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
        ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
        À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
        ·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
       
     | 
   
  
     | 
   
   
  
    
      
	
	  
	     |  
	    
	      
	        
            
                | Çã°¡Á¤º¸ | 
                         
	         
	       | 
	     
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
   
    û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå  »óÇÑ±Ý¾× | 
    
      
      
        
        657305210[A11103841]  
	    
	    
          [º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸] 
          
        
        
        
           \0 ¿ø/1g(2006.06.01)(ÇöÀç¾à°¡)
            
           \382 ¿ø/1g(2005.02.01)(º¯°æÀü¾à°¡)
              
	 
	   
	   
       
      
       
       
     
      
      
     
      
    
    
      
     [»óº´ÄÚµåÁ¶È¸]
      
     [Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
     [¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
     | 
   
   
    | ºü¸¥Á¶È¸ | 
    
      
     |   
   
  
  
  
  
  
  
  
  
  
  
  
  
  
  	
   
    | ´ëÇ¥ÄÚµå | 
    8806573052109 | 
   
  
  
  
  
  
  
   
    | ¾à¸®ÀÛ¿ë | 
    
      
        [Á¶È¸]
     | 
      
  
  
  
  
   
    | È¿´ÉÈ¿°ú | 
    
    [ÀûÀÀÁõ º° °Ë»ö] 
      
    
     
	 
      È¿´É ¹× È¿°ú 
½ÀÁø¼º ÇǺÎÁúȯÀ» °¡Áø ¼ºÀÎȯÀÚµéÀÇ Áߵ ¼Ò¾çÁõÀÇ ´Ü±â Ä¡·á(ÃÖÀå 7ÀÏ À̳») : ¾ÆÅäÇÇ ÇǺο°, ¸¸¼º ´Ü¼ø¼º ż±
      
      
      
      
     | 
   
  
  
  
  
  
  
  
  
    
  
  
   
    | ¿ë¹ý¿ë·® | 
    
      * Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù. 
    
     
      
      
     [󹿾à¾î] 
      ¿ë¹ý ¹× ¿ë·® 
¹®Á¦ ºÎÀ§¿¡ ÃÖ¼ÒÇÑ 3~4½Ã°£ °£°ÝÀ¸·Î 1ÀÏ 4ȸ¾¿ ¾ã°Ô µµÆ÷ÇÑ´Ù. 7ÀÏ À̳»·Î ´Ü±â°£ »ç¿ëÇÑ´Ù.     
      	    
     | 
   
  
  
  
   
    | ÁÖ¿ä¾à¹° »óÈ£ÀÛ¿ë | 
    
        
	  [º¸±â]
     | 
   
  
  
  
  
  
  
  
   
    | ±Ý±â | 
    
      1) ÀÌ ¾à ¶Ç´Â Dibenzoxepin°è¿ÀÇ ¾à¹°¿¡ °ú¹ÎÁõ ȯÀÚ 
2) ³ì³»Àå, ¹è´¢°ï¶õÀ» ÀÏÀ¸Å³ ¼ö Àִ ȯÀÚ  
3) »ïȯ°è Ç׿ì¿ï¾à ¶Ç´Â MAOÀúÇØÁ¦¸¦ Åõ¿©ÁßÀΠȯÀÚ  
4) ÁßÁõÀÇ °£Áúȯ ȯÀÚ  
5) ÁßÃ߽Űæ¾ïÁ¦Á¦ ¶Ç´Â ¾ËÄÚ¿Ã ±Þ¼º Áßµ¶ ȯÀÚ  
6) ±Þ¼º ¼¶¸Á ȯÀÚ 
7) ¾î¸°ÀÌ 
 
     | 
   
  
  
  
  
   
    | ½ÅÁßÅõ¿© | 
    1) ÀÌ ¾à ¶Ç´Â Dibenzoxepin°è¿ÀÇ ¾à¹°¿¡ °ú¹ÎÁõ ȯÀÚ
  
2) ³ì³»Àå, ¹è´¢°ï¶õÀ» ÀÏÀ¸Å³ ¼ö Àִ ȯÀÚ 
  
3) »ïȯ°è Ç׿ì¿ï¾à ¶Ç´Â MAOÀúÇØÁ¦¸¦ Åõ¿©ÁßÀΠȯÀÚ 
  
4) ÁßÁõÀÇ °£Áúȯ ȯÀÚ 
  
5) ÁßÃ߽Űæ¾ïÁ¦Á¦ ¶Ç´Â ¾ËÄÚ¿Ã ±Þ¼º Áßµ¶ ȯÀÚ 
  
6) ±Þ¼º ¼¶¸Á ȯÀÚ
  
7) ¾î¸°ÀÌ
  
 <Ç×Äݸ°¾à¹°À» º´¿ëÇϰųª Ç×Äݸ°¾à¹°ÀÇ ¿µÇâÇÏ¿¡ Àִ ȯÀÚ> 
1) ÀÌ ¾à ¶Ç´Â Dibenzoxepin°è¿ÀÇ ¾à¹°¿¡ °ú¹ÎÁõ ȯÀÚ
 
  
2) ³ì³»Àå, ¹è´¢°ï¶õÀ» ÀÏÀ¸Å³ ¼ö Àִ ȯÀÚ 
 
  
3) »ïȯ°è Ç׿ì¿ï¾à ¶Ç´Â MAOÀúÇØÁ¦¸¦ Åõ¿©ÁßÀΠȯÀÚ 
 
  
4) ÁßÁõÀÇ °£Áúȯ ȯÀÚ 
 
  
5) ÁßÃ߽Űæ¾ïÁ¦Á¦ ¶Ç´Â ¾ËÄÚ¿Ã ±Þ¼º Áßµ¶ ȯÀÚ 
 
  
6) ±Þ¼º ¼¶¸Á ȯÀÚ
 
  
7) ¾î¸°ÀÌ
 
  
 <ÀÌ ¾àÀº ÇÁ·ÎÇÊ·»±Û¸®ÄÝÀ» ÇÔÀ¯Çϰí ÀÖÀ¸¹Ç·Î ÀÌ ¼ººÐ¿¡ °ú¹ÎÇϰųª ¾Ë·¹¸£±â º´·ÂÀÌ Àִ ȯÀÚ¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.> 
1) ÀÌ ¾à ¶Ç´Â Dibenzoxepin°è¿ÀÇ ¾à¹°¿¡ °ú¹ÎÁõ ȯÀÚ 
2) ³ì³»Àå, ¹è´¢°ï¶õÀ» ÀÏÀ¸Å³ ¼ö Àִ ȯÀÚ  
3) »ïȯ°è Ç׿ì¿ï¾à ¶Ç´Â MAOÀúÇØÁ¦¸¦ Åõ¿©ÁßÀΠȯÀÚ  
4) ÁßÁõÀÇ °£Áúȯ ȯÀÚ  
5) ÁßÃ߽Űæ¾ïÁ¦Á¦ ¶Ç´Â ¾ËÄÚ¿Ã ±Þ¼º Áßµ¶ ȯÀÚ  
6) ±Þ¼º ¼¶¸Á ȯÀÚ 
7) ¾î¸°ÀÌ 
 
  | 
   
  
  
  
   
    | ÀÌ»ó¹ÝÀÀ | 
    
      1) Ç×Äݸ°ÀÛ¿ë : ±¸°¥, ½Ã¾ß¸ù·Õ, º¯ºñ, ´¢Àú·ù°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ÀÌ·¯ÇÑ Áõ»óÀÌ Áö¼ÓµÇ°í ½ÉÇÑ °æ¿ì¿¡´Â °¨·®ÇÑ´Ù.  
2) ÁßÃ߽Űæ°è : Á¹À½, ºÎÀ§°¨°¢»ó½Ç, Áö³²·Â»ó½Ç, ȯ°¢, È¥µ·, °¨°¢ÀÌ»ó, ¾îÁö·¯¿ò, ¿îµ¿ ½ÇÁ¶, Áö¹ß¼º ¿îµ¿Àå¾Ö, ¹ß¿, µÎÅë, ¹«·ÂÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.  
3) ¼øÈ¯±â°è : ÀúÇ÷¾Ð, °íÇ÷¾Ð, ºó¸ÆÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.  
4) Ç÷¾× : È£»ê±¸Áõ°¡, ¹«°ú¸³±¸Áõ, ¹éÇ÷±¸°¨¼Ò, Ç÷¼ÒÆÇ°¨¼Ò, ÀÚ¹Ý µîÀÇ °ñ¼ö±â´É¾ïÁ¦°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.  
5) °ú¹ÎÁõ : ÇǺιßÁø, ±¤°ú¹ÎÁõ, °¡·Á¿ò, ºÎÁ¾ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.  
6) ³»ºÐºñ°è : À¯ÁóºÐºñ°ú´Ù, À¯¹æ¿ïÇ÷, °í¤ýÀúÇ÷´ç, ¿©¼ºÇü À¯¹æ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ¶ÇÇÑ Ç×ÀÌ´¢È£¸£¸óºÐºñÀÌ»óÁõÈıº(Syndrome of Inappropriate ADH)ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.  
7) ¼Òȱâ°è : ±¸¿ª, ±¸Åä, ¼ÒȺҷ®, ¼³»ç, ½Ä¿åºÎÁø, ¹Ì°¢ÀÌ»ó, ¾ÆÇÁŸ¼º ±¸³»¿° µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.  
8) ±âŸ : À̸í, üÁßÁõ°¡, ¹ßÇÑ, Çѱâ, Çã¾à, È«Á¶, Ȳ´Þ, Å»¸ð, µÎÅë, ÇÇ·Î, õ½ÄÀÇ ¾ÇÈ, È»ó, ÀÚ»ó, ÀÚ±Ø, ŸÁøÅë, ±¹¼ÒÇÇÁø µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.  
 
          
     | 
   
  
  
    
   
    | ÀϹÝÀû ÁÖÀÇ | 
    1) Á¹À½ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ ¾àÀ» Åõ¿©ÁßÀΠȯÀÚ´Â ÀÚµ¿Â÷¿îÀü µî À§ÇèÀ» ¼ö¹ÝÇÏ´Â ±â°èÁ¶ÀÛÀ» ÇÏÁö ¾Êµµ·Ï ÁÖÀÇÇÑ´Ù.  
2) ÀÌ ¾àÀÇ »ç¿ëÀ¸·Î Á¹À½ÀÌ ½ÉÇÏ°Ô ³ªÅ¸³¯ ¶§¿¡´Â Àû¿ë Ƚ¼ö, Àû¿ë·®À» ÁÙÀ̰í, Åõ¿© üǥ¸éÀûÀ» ÁÙ¿©¾ß ÇÑ´Ù. 
3) ´«, Áú³»¿¡ »ç¿ëÇÏ¸é ¾ÈµÈ´Ù. 
  | 
   
  
  
  
    
   
    | »óÈ£ÀÛ¿ë | 
    1) ½Ã¸ÞƼµòÀº »ïȯ°è Ç׿ì¿ï¾àÀÇ Ç÷Á߳󵵿¡ ÀÓ»óÀûÀ¸·Î À¯ÀÇÇÑ ¿µÇâÀ» ¹ÌÄ¥ ¼ö ÀÖ´Ù.  
2) ¹Ù¸£ºñÅ»°è ¾à¹°Àº ÀÌ ¾àÀÇ ´ë»ç¼Óµµ¸¦ Áõ°¡½Ãų ¼ö ÀÖ´Ù.  
3) ÀÌ ¾à°ú º´¿ëÅõ¿©½Ã °©»ó¼±È£¸£¸ó Á¦Á¦ÀÇ Åõ¿©·®À» °¨·®ÇÑ´Ù.  
4) ¿¡Æäµå¸°, À̼ÒÇÁ·ÎÅ×·¹³î, ³ë¸£¿¡Çdz×ÇÁ¸°, Æä´Ò¿¡ÇÁ¸°, Æä´ÒÇÁ·ÎÆÇ¿Ã¾Æ¹Î µîÀÇ ±³°¨½Å°æÈïºÐ¾à°ú º´¿ëÅõ¿©ÇÏÁö ¾Ê´Â´Ù.  
5) ¾ËÄÚ¿ÃÀÌ ÀÌ ¾àÀÇ °·ÂÇÑ ÁøÁ¤È¿°ú¸¦ Áõ°¡½Ãų ¼ö ÀÖ´Ù.  
6) MAOÀúÇØÁ¦¿Í º´¿ëÅõ¿©ÇÏÁö ¾ÊÀ¸¸ç Åõ¿©ÁßÁöÈÄ¿¡µµ ÃÖ¼ÒÇÑ 2ÁÖ ÀÌ»óÀÇ °£°ÝÀ» µÎ°í ÀÌ ¾àÀ» Åõ¿©ÇÑ´Ù.  
7) ¹Ù¸£ºñÅ»°è ¾à¹°°ú °°Àº CNS¿¡ ÀÛ¿ëÇÏ´Â ¾à¹°, CNSÀúÇØÁ¦¸¦ Åõ¿©¹Þ´Â ȯÀÚ´Â ÀÌ ¾àÀÇ »ç¿ëÀ¸·Î ÁßÃ߽Űæ°è È¿°ú°¡ °ÈµÉ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÏ¿©¾ß ÇÑ´Ù. 
  | 
   
  
  
  
   
    | ÀӺο¡ ´ëÇÑ Åõ¿© | 
    
      
	[ÀӺαݱ⠼ººÐ Á¶È¸]       
       ÀӺΠº¹¾àÁöµµ ÀÓ½ÅÁßÀÇ Åõ¿©¿¡ ´ëÇÑ ¾ÈÀü¼ºÀÌ È®¸³µÇ¾î ÀÖÁö ¾ÊÀ¸¹Ç·Î ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀο¡´Â Ä¡·á»óÀÇ À¯ÀͼºÀÌ À§Ç輺À» »óȸÇÑ´Ù°í ÆÇ´ÜµÇ´Â °æ¿ì¿¡¸¸ Åõ¿©ÇÑ´Ù.  
     | 
   
  
  
  
  
   
    | ¼öÀ¯ºÎ¿¡ ´ëÇÑ Åõ¿© | 
    ¼öÀ¯ºÎ º¹¾àÁöµµ ÀÌ ¾à ¹× ±× Ȱ¼º´ë»ç¹°ÀÎ µ¥½º¸ÞÄ¥µ¶¼¼ÇÉÀÌ ¸ðÀ¯ ÁßÀ¸·Î ÀÌÇàµÇ¹Ç·Î ÀÌ ¾àÀÇ Åõ¿© Áß¿¡´Â ¼öÀ¯¸¦ Áß´ÜÇÑ´Ù. ¶ÇÇÑ ÀÌ ¾à Åõ¿© Áß¿¡ ¼öÀ¯¹ÞÀº À¯¾Æ¿¡¼ Á¹À½, ¹«È£ÈíÀÌ ³ªÅ¸³µ´Ù´Â º¸°í°¡ ÀÖ´Ù. 
 
  | 
   
  
  
  
  
   
    | ¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿© | 
    
      
       
        <¼Ò¾Æ> 
12¼¼ ÀÌÇÏÀÇ ¼Ò¾Æ¿¡ ´ëÇÑ ¾ÈÀü¼ºÀÌ È®¸³µÇ¾î ÀÖÁö ¾Ê´Ù.  
<°í·ÉÀÚ/³ë¾àÀÚ> 
°í·ÉÀÚ¿¡¼´Â °Ý¾Ó, È¥¶õ, ±â¸³¼º ÀúÇ÷¾Ð µîÀÇ ºÎÀÛ¿ëÀÌ ³ªÅ¸³ª±â ½¬¿ì¹Ç·Î ȯÀÚÀÇ »óÅ¿¡ µû¶ó Åõ¿©·®¿¡ ÁÖÀÇÇÏ¸é¼ ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.  
  | 
   
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  		
  
  
   
    | º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ | 
    1) ¾î¸°ÀÌÀÇ ¼ÕÀÌ ´êÁö ¾Ê´Â °÷¿¡ º¸°üÇÑ´Ù. 
2) º» Á¦Ç°À» ´Ù¸¥¿ë±â¿¡ ¹Ù²Ù¾î ³ÖÁö ¾Ê´Â´Ù. 
  
  | 
   
  	
  
  
  
  
  
  
   
    | Related FDA Approved Drug | 
    
       
     | 
      
  
  
      							
 
 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | Á¤º¸¿ä¾à | 
                 
	         
	       | 
	           	    
	     |  
	    | 
  
    µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
    
  
  
    
  
   |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | ÄÚµå ¹× ºÐ·ùÁ¤º¸ | 
                 
	         
	       | 
	           	    
	     |  
	    | 	 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | Á¦Ç°Á¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	     |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | º¹¾àÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
   
    | LACTmed ¹Ù·Î°¡±â | 
    
      
        [¹Ù·Î°¡±â]
     | 
     
  
  
   
    | ¾à¸®ÀÛ¿ë | 
    
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
       
     | 
     
  
  
       
  
  
   
    | º¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
                                                          															
  
   
  
  
   
    | ÀӺο¡´ëÇÑÅõ¿© | 
    
      
      
        
	      
	      
	        | *  | 
	        
	          ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù. 
	         | 
	         
	       
	       | 
	   
	  
	    |   | 
	   
	  
	    
	      FDA : Bµî±Þ 
				        
				         (doxepin HCl topical )
				        
	   | 
	  
	  
	  
	     
	     
	     
	     
	     
	     
	   | 
	 
	
	  
	      
	      
	        | *  | 
	        
	          »ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
	         | 
	         
	      
	        | *  | 
	        
	          ¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
	         | 
	         
	       
	   | 
	 
       
     | 
   
  
  
  
   
    ½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
  	   
  
  	   
  
  	   
  
  
     
      | Pharmacokinetics | 
      
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
      
       |   
     
  
  
  
  
  
  
  
   
    | º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ | 
    
      [º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
     | 
   
  	
  
  
  
   
    | º¹¾à¶óº§ | 
    
    
    
      | À̹ÌÁö | 
      º¹¾à¼³¸í | 
     
    
    
        | 
      º¯ºñ°¡ »ý±æ¼ö ÀÖ½À´Ï´Ù. | 
     
    
       | 
     
    
    
        | 
      ¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. | 
     
    
       | 
     
    
     |  
    
      
	
	  
            | *  | 
	    º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. | 
	   
	  
            | *  | 
	    º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. | 
	   
	  
            | *  | 
	    ±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. | 
	   
	   
     |   
     | 
   
  	
  
  
   
    | Á¦Çüº° º¹¾àÁöµµ | 
    [Å©¸²] | 
   
  
  
   
    | º¸°ü»ó ÁÖÀÇ | 
    
      
    	
     | 
   
  
  
   
    | Á¶Á¦½Ã ÁÖÀÇ | 
    
      
    	
     | 
      
 
 |  
	   
	 
	
	  
       |  
	    
	      
	        
            
                | ½É»çÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	     |  
	   
	   
	
	  
       |  
	    
	      
	        
            
                | ÇмúÁ¤º¸ | 
                             
	         
	       | 
	           	  
	     |  
	    
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
    | DUR (ÀǾàǰ»ç¿ëÆò°¡) | 
    º´¿ë±Ý±â :
     
	 °í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
	 
	  [»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]										
	  ¿¬·É´ë±Ý±â :
      °í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
      
       [¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
       
       
        
        
     | 
   
  
   
    | Mechanism of Action | 
    
       Doxepin¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ The mechanism of action of doxepin is not completely understood. It is thought that Like amitriptyline, doxepin enhances the actions of norepinephrine and serotonin by blocking their reuptake at the neuronal membrane. Doxepin may also act on histamine H1-receptors, resulting in sedative effects, and beta-adrenergic receptors. 
     | 
   
  
   
    | Pharmacology | 
     
       Doxepin¿¡ ´ëÇÑ Pharmacology Á¤º¸ Doxepin, a tricyclic antidepressant of the dibenzoxepin type, is used to treat depression and anxiety and, topically, pruritus associated with eczema. Doxepin has substantial anticholinergic and sedative effects. 
     | 
   
  
   
    | Protein Binding | 
    
       Doxepin¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ highly protein-bound 
     | 
   
  
   
    | Half-life | 
    
       Doxepin¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 6 - 8 hours 
     | 
   
  
   
    | Absorption | 
    
       Doxepin¿¡ ´ëÇÑ Absorption Á¤º¸ well absorbed from the gut 
     | 
   
  
   
    | Pharmacokinetics | 
    
       Doxepin HClÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á 
-  ÃÖ´ë Ç׿ì¿ïÈ¿°ú ¹ßÇö½Ã°£ : ´ë°³ 2ÁÖ ÀÌÈÄ¿¡ ³ªÅ¸³´Ù.  Ç׺ҾÈÈ¿°ú´Â À̺¸´Ù »¡¸® ³ªÅ¸³´Ù.
 
 -  ºÐÆ÷ : ÅÂ¹Ý Åë°ú, À¯Áó ºÐºñ
 
 -  ´Ü¹é°áÇÕ : 80-85%
 
 -  ´ë»ç : °£´ë»ç.  ´ë»çü¿¡´Â desmethyldoxepin(Ȱ¼ºÇü)ÀÌ Æ÷ÇԵȴÙ.
 
 -  ¹Ý°¨±â : ¼ºÀÎ : 6-8 ½Ã°£ 
 
 -  ¼Ò½Ç : ½Å¹è¼³
   
 
	 
	
     | 
   
  
   
    | Biotransformation | 
    
       Doxepin¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic 
     | 
   
  
   
    | Toxicity | 
    
       Doxepin¿¡ ´ëÇÑ Toxicity Á¤º¸ LD50=26 (mg/kg) (in mice, iv); LD50=16 (mg/kg) (in rats, iv); Cardiac dysrhythmias, severe hypotension, convulsions, and CNS depression, including coma. Changes in the electrocardiogram, particularly in QRS axis or width, are clinically significant indicators of tricyclic antidepressant toxicity. 
     | 
   
  
   
    | Drug Interactions | 
    
       Doxepin¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Altretamine	Risk of severe hypotensionAtazanavir	Atazanavir increases the effect and toxicity of tricyclicsCarbamazepine	The tricyclic increases the effect of carbamazepineCimetidine	Cimetidine increases the effect of tricyclic agentCisapride	Increased risk of cardiotoxicity and arrhythmiasClonidine	The tricyclic decreases the effect of clonidineDihydroquinidine barbiturate	Quinidine increases the effect of tricyclic agentDobutamine	The tricyclic increases the sympathomimetic effectDonepezil	Possible antagonism of actionDopamine	The tricyclic increases the sympathomimetic effectEphedra	The tricyclic increases the sympathomimetic effectEphedrine	The tricyclic increases the sympathomimetic effectFenoterol	The tricyclic increases the sympathomimetic effectFluoxetine	Fluoxetine increases the effect and toxicity of tricyclicsFluvoxamine	Fluvoxamine increases the effect and toxicity of tricyclicsGalantamine	Possible antagonism of actionGrepafloxacin	Increased risk of cardiotoxicity and arrhythmiasGuanethidine	The tricyclics decreases the effect of guanethidineIsocarboxazid	Possibility of severe adverse effectsIsoproterenol	The tricyclic increases the sympathomimetic effectMephentermine	The tricyclic increases the sympathomimetic effectMesoridazine	Increased risk of cardiotoxicity and arrhythmiasMetaraminol	The tricyclic increases the sympathomimetic effectMethoxamine	The tricyclic increases the sympathomimetic effectMoclobemide	Possible severe adverse reaction with this combinationNorepinephrine	The tricyclic increases the sympathomimetic effectOrciprenaline	The tricyclic increases the sympathomimetic effectPhenelzine	Possibility of severe adverse effectsPhenylephrine	The tricyclic increases the sympathomimetic effectPhenylpropanolamine	The tricyclic increases the sympathomimetic effectPirbuterol	The tricyclic increases the sympathomimetic effectProcaterol	The tricyclic increases the sympathomimetic effectPseudoephedrine	The tricyclic increases the sympathomimetic effectQuinidine	Quinidine increases the effect of tricyclic agentQuinidine barbiturate	Quinidine increases the effect of tricyclic agentRasagiline	Possibility of severe adverse effectsRifabutin	The rifamycin decreases the effect of tricyclicsRifampin	The rifamycin decreases the effect of tricyclicsRitonavir	Ritonavir increases the effect and toxicity of tricyclicsRivastigmine	Possible antagonism of actionSalbutamol	The tricyclic increases the sympathomimetic effectSibutramine	Increased risk of CNS adverse effectsSparfloxacin	Increased risk of cardiotoxicity and arrhythmiasTerbutaline	The tricyclic increases the sympathomimetic effectTerfenadine	Increased risk of cardiotoxicity and arrhythmiasThioridazine	Increased risk of cardiotoxicity and arrhythmiasTranylcypromine	Possibility of severe adverse effects 
     | 
   
  
   
    CYP450  Drug Interaction | 
    
      [CYP450 TableÁ÷Á¢Á¶È¸] 
     | 
   
  
   
    | Description | 
    
       Doxepin¿¡ ´ëÇÑ Description Á¤º¸ A dibenzoxepin tricyclic compound. It displays a range of pharmacological actions including maintaining adrenergic innervation. Its mechanism of action is not fully understood, but it appears to block reuptake of monoaminergic neurotransmitters into presynaptic terminals. It also possesses anticholinergic activity and modulates antagonism of histamine H(1)- and H(2)-receptors. [PubChem] 
     | 
   
  
   
    | Drug Category | 
    
       Doxepin¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-anxiety AgentsAntidepressantsAntidepressive Agents, TricyclicAntipruriticsHistamine AntagonistsNorepinephrine-Reuptake Inhibitors 
     | 
   
  
   
    | Smiles String Canonical | 
    
       Doxepin¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CN(C)CCC=C1C2=CC=CC=C2COC2=CC=CC=C12 
     | 
   
  
   
    | Smiles String Isomeric | 
    
       Doxepin¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CN(C)CC\C=C1/C2=CC=CC=C2COC2=CC=CC=C12 
     | 
   
  
   
    | InChI Identifier | 
    
       Doxepin¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C19H21NO/c1-20(2)13-7-11-17-16-9-4-3-8-15(16)14-21-19-12-6-5-10-18(17)19/h3-6,8-12H,7,13-14H2,1-2H3/b17-11+ 
     | 
   
  
   
    | Chemical IUPAC Name | 
    
       Doxepin¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (3E)-3-(6H-benzo[c][1]benzoxepin-11-ylidene)-N,N-dimethylpropan-1-amine 
     | 
   
  
   
    | Drug-Induced Toxicity Related Proteins | 
    
      DOXEPIN ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:CYP2D6 Drug:Doxepin  Toxicity:Toxicity and inefficacy.  [¹Ù·Î°¡±â] 
     | 
   
    
  |  
	   
	   
	
	  
       |  
	    
	      
	        
            
                | »ç¿ëÀÚÄÁÅÙÃ÷ | 
                             
	         
	       | 
	           	  
       |  
	     |  
	   
	     	
 
  | 
   
   
     | 
   
  
    
      
        
          
            
              - 
                ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2021-12-09
              
 
              - 
                
                º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
                
              
     
             
         |                 
       
     |       
          
                
                    
                       ¾Ë¸² | 
                       
                      »ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù.  | 
                    
                    | 
               
      
      
                
                    
                       °æ°í | 
                     
                      µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù. 
                          Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â 
                          Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
                            ¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
                          ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
 | 
                    
                    | 
               
  
 
  
    ¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é 
    ¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
   
  
 
  º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
 
  [ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â]       Á¦¸ñ ¾øÀ½ 
 
    
    2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
    
    1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ  º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
    ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
          
    
    
    
    2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
    ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
 
 
 
   
  |  
             
             | 
         
         
         | 
         |