| |
|
|
|
|
|
 |
| |
|
°ÇÀÏÆ¼°£ÁÖ2g(¿°»êÆ®¸®¸ÞÅ亥ÀÚ¸¶À̵å) [Trimethobenzamide Hydrochloride]
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
(ÀÓ»ó ¿¬±¸¿¡¼ ³·Àº À§Ç輺ÀÌ º¸°íµÊ. -Briggs G, et al. Drugs in Pregnancy and Lactation 7th edit. )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Trimethobenzamide¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ The mechanism of action of trimethobenzamide as determined in animals is obscure, but may involve the chemoreceptor trigger zone (CTZ), an area in the medulla oblongata through which emetic impulses are conveyed to the vomiting center; direct impulses to the vomiting center apparently are not similarly inhibited.
|
| Pharmacology |
Trimethobenzamide¿¡ ´ëÇÑ Pharmacology Á¤º¸ Trimethobenzamide is a novel antiemetic which prevents nausea and vomiting in humans. Its actions are unclear but most likely involves the chemoreceptor trigger zone (CTZ). In dogs pretreated with trimethobenzamide HCl, the emetic response to apomorphine is inhibited, while little or no protection is afforded against emesis induced by intragastric copper sulfate.
|
| Absorption |
Trimethobenzamide¿¡ ´ëÇÑ Absorption Á¤º¸ The relative bioavailability of the capsule formulation compared to the solution is 100%.
|
| Pharmacokinetics |
Trimethobenzamide HClÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ÀÛ¿ë¹ßÇö½Ã°£ :
- °æ±¸ : 10-40ºÐ À̳»
- ±ÙÀ°ÁÖ»ç : 15-35ºÐ À̳»
- ÀÛ¿ëÁö¼Ó½Ã°£ : 3-4 ½Ã°£
- Èí¼ö : Á÷Àå ÁÂÁ¦ : ¾à 60%
|
| Toxicity |
Trimethobenzamide¿¡ ´ëÇÑ Toxicity Á¤º¸ Oral LD50 in mice is 1600 mg/kg.
|
| Drug Interactions |
Trimethobenzamide¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Description |
Trimethobenzamide¿¡ ´ëÇÑ Description Á¤º¸ Trimethobenzamide is a novel antiemetic which prevents nausea and vomiting in humans. Its actions are unclear but most likely involves the chemoreceptor trigger zone (CTZ). In dogs pretreated with trimethobenzamide HCl, the emetic response to apomorphine is inhibited, while little or no protection is afforded against emesis induced by intragastric copper sulfate.
|
| Dosage Form |
Trimethobenzamide¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Capsule OralInjection, solution IntramuscularSuppository Rectal
|
| Drug Category |
Trimethobenzamide¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antiemetics
|
| Smiles String Canonical |
Trimethobenzamide¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ COC1=CC(=CC(OC)=C1OC)C(=O)NCC1=CC=C(OCCN(C)C)C=C1
|
| Smiles String Isomeric |
Trimethobenzamide¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ COC1=CC(=CC(OC)=C1OC)C(=O)NCC1=CC=C(OCCN(C)C)C=C1
|
| InChI Identifier |
Trimethobenzamide¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C21H28N2O5/c1-23(2)10-11-28-17-8-6-15(7-9-17)14-22-21(24)16-12-18(25-3)20(27-5)19(13-16)26-4/h6-9,12-13H,10-11,14H2,1-5H3,(H,22,24)/f/h22H
|
| Chemical IUPAC Name |
Trimethobenzamide¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ N-[[4-(2-dimethylaminoethoxy)phenyl]methyl]-3,4,5-trimethoxybenzamide
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2021-12-09
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|