| |
|
|
|
|
|
 |
| |
|
¸Æ»ìÆ®¸áÆ®±¸°Á¤10mg [Rizatriptan benzoate]
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
655500880[E09060401]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1Á¤(2007.03.01)(ÇöÀç¾à°¡)
\5,047 ¿ø/1Á¤(2003.09.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¸Å²öÇϰųª, ¾à°£ °ÅÄ£ ¸éÀÇ ¹é»ö ³»Áö °ÅÀÇ ¹é»öÀÇ ¿øÇü ±¸°Á¤
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| ´ëÇ¥ÄÚµå |
8806555008803 |
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
ÀüÁ¶Áõ»óÀ» µ¿¹ÝÇϰųª ¶Ç´Â µ¿¹ÝÇÏÁö ¾Ê´Â ÆíµÎÅëÀÇ ±Þ¼º Ä¡·á. ÀÌ ¾àÀº ÆíµÎÅëÀÇ ¿¹¹æ¸ñÀûÀ¸·Î Åõ¿©Çؼ´Â ¾ÈµÈ´Ù.
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
[ÁÖ¼ººÐÄÚµå:446601ATD ¿¡ µû¸¥ ½É»çÁöħ¿¶÷]
¹Ýµå½Ã À½·á¼ö¿Í ÇÔ²² ´Ü¹ø¿¡ º¹¿ëÇÏ¿©¾ß ÇÑ´Ù.
18¼¼ ÀÌ»óÀÇ ¼ºÀÎ
----------------
1)1ȸ 5§· ¶Ç´Â 10§·ÀÌ ¸ðµÎ À¯È¿Çϳª, 10§·ÀÇ È¿°ú°¡ ´õ¿í Å©¸ç, ȯÀÚ¿¡ µû¶ó ¿ë·®¿¡ µû¸¥ ¹ÝÀÀÀÌ ´Ù¸£°Ô ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ºÎÀÛ¿ëÀÇ À§Çè°ú 10§·Åõ¿©½ÃÀÇ À¯ÀͼºÀÇ °í·ÁÇÏ¿© ¿ë·®À» ¼³Á¤ÇØ¾ß ÇÑ´Ù.
2)ÀçÅõ¿© : ÀÌ ¾àÀ» ÀçÅõ¿©ÇÒ ¶§¿¡´Â Àû¾îµµ 2½Ã°£ ÀÌ»óÀÇ °£°ÝÀ» µÎ¾î¾ß Çϸç 24½Ã°£ À̳»¿¡ 30§·À»ÃʰúÇÏ¿© Åõ¿©ÇÏÁö ¾Ê´Â´Ù.
- 24½Ã°£À̳» µÎÅëÀÌ Àç¹ßÇÏ´Â °æ¿ì : 1Â÷ Åõ¿© ÈÄ µÎÅëÀÌ ¿ÏȵǾú´Ù°¡ ´Ù½Ã µÎÅëÀÌ Àç¹ßÇϸé ÀÌ ¾àÀ» 1ȸ ´õ º¹¿ëÇÑ´Ù.(À§¿¡¼ ¾ð±ÞÇÑ 1ÀÏ Åõ¿© Çѵµ·®Àº ¹Ýµå½Ã ÁöÄÑ¾ß ÇÑ´Ù.)
- 1Â÷ Åõ¿© ÈÄ µÎÅëÀÌ ¿ÏȵÇÁö ¾Ê´Â °æ¿ì : 1Â÷ Åõ¿© ½Ã µÎÅëÀÌ ¿ÏȵÇÁö ¾ÊÀº »óÅ¿¡¼ ÀÌ ¾àÀ» 2Â÷ Åõ¿©ÇÏ´Â °æ¿ì¿¡ ´ëÇØ¼´Â ´ëÁ¶ ÀÓ»ó½ÃÇè¿¡¼ ±× È¿°ú°¡ °ËÁõµÇÁö¾Ê¾Ò´Ù. µû¶ó¼ 1Â÷ Åõ¿©½Ã µÎÅëÀÌ ¿ÏȵÇÁö ¾ÊÀ¸¸é Ãß°¡ Åõ¿©ÇÏÁö ¾Ê´Â´Ù.
ÀÓ»ó ½ÃÇè °á°ú 1Â÷ Åõ¿© ÈÄ µÎÅëÀÌ ¿ÏȵÇÁö¾Ê´Â °æ¿ì Ãß°¡·Î Åõ¿©ÇÏ¿©µµ È¿°ú¸¦ ³ªÅ¸³»Áö¾Ê´Â °ÍÀ¸·Î ³ªÅ¸³µ´Ù.
3)´ÙÀ½ÀÇ È¯ÀÚ´Â 5§·À» Åõ¿©ÇÏ¿©¾ß ÇÑ´Ù.
- ÇÁ·ÎÇÁ¶ó³î·êÀ» Åõ¿©ÁßÀΠȯÀÚ
ÀÌ ¾à°ú ÇÁ·ÎÇÁ¶ó³î³îÀÇ Åõ¿© °£°ÝÀº Àû¾îµµ 2½Ã°£ÀÌ»óÀ¸·Î ÇÑ´Ù. (»ç¿ë»óÀÇ ÁÖÀÇ»çÇ× 6.»óÈ£ÀÛ¿ëÇ× ÂüÁ¶)
- °æÁõ ³»Áö ÁߵÀÇ ½ÅºÎÀü ȯÀÚ
- °æÁõ ³»Áö ÁߵÀÇ °£ºÎÀü ȯÀÚ
ÀÌ ¾àÀ» ÀçÅõ¿©ÇÒ ¶§¿¡´Â Àû¾îµµ 2½Ã°£ ÀÌ»óÀÇ °£°ÝÀ» µÎ¾î¾ß Çϸç 24½Ã°£ À̳»¿¡ 2ȸ¸¦ ÃʰúÇÏ¿© Åõ¿©ÇÏÁö ¾Ê´Â´Ù.
|
| ¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿© |
¼Ò¾Æ¿¡ ´ëÇÑ ÀÌ ¾àÀÇ ¾ÈÀü¼º ¹× À¯È¿¼ºÀº È®¸³µÇÁö ¾Ê¾ÒÀ¸¹Ç·Î 18¼¼ ÀÌÇÏÀÇ ¼Ò¾Æ¿¡ ´ëÇØ¼´Â ÀÌ ¾àÀÇ Åõ¿©´Â ±ÇÀåµÇÁö ¾Ê´Â´Ù. 65¼¼ ÀÌ»óÀÇ °í·ÉȯÀÚ¿¡ ´ëÇÑ À̾àÀÇ ¾ÈÀü¼º ¹× À¯È¿¼ºÀº ü°èÀûÀ¸·Î Æò°¡µÇÁö¾Ê¾Ò´Ù.
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Rizatriptan¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Rizatriptan binds with high affinity to human 5-HT1B and 5-HT1D receptors leading to cranial blood vessel constriction.
|
| Pharmacology |
Rizatriptan¿¡ ´ëÇÑ Pharmacology Á¤º¸ Rizatriptan is a selective 5-hydroxytryptamine receptor subtype agonist indicated for the acute treatment of migraine attacks with or without aura in adults. Rizatriptan is not intended for the prophylactic therapy of migraine or for use in the management of hemiplegic or basilar migraine. Rizatriptan is an agonist for a vascular 5-hydroxytryptamine receptor subtype (probably a member of the 5-HT1D family) having only a weak affinity for 5-HT1A, 5-HT5A, and 5-HT7 receptors and no significant affinity or pharmacological activity at 5-HT2, 5-HT3 or 5-HT4 receptor subtypes or at alpha1-, alpha2-, or beta-adrenergic, dopamine1,; dopamine2; muscarinic, or benzodiazepine receptors. This action in humans correlates with the relief of migraine headache. In addition to causing vasoconstriction, experimental data from animal studies show that Rizatriptan also activates 5-HT1 receptors on peripheral terminals of the trigeminal nerve innervating cranial blood vessels, which may also contribute to the antimigrainous effect of Rizatriptan in humans.
|
| Absorption |
Rizatriptan¿¡ ´ëÇÑ Absorption Á¤º¸ Rapid following oral administration. Bioavailability is 45%. Food has no effect on the bioavailability of rizatriptan. However, administering rizatriptan with food will delay by 1 hour the time to reach peak plasma concentration. The rate of absorption is not affected by the presence of a migraine attack.
|
| Toxicity |
Rizatriptan¿¡ ´ëÇÑ Toxicity Á¤º¸ Symptoms of overdose include dizziness, fainting, heart and blood vessel problems, high blood pressure, loss of bowel and bladder control, slow heartbeat, and vomiting.
|
| Drug Interactions |
Rizatriptan¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| SNP Á¤º¸ |
Name:Rizatriptan (DB00953)
Interacting Gene/Enzyme:G protein beta3 subunit (Gene symbol = GNB3) Swissprot P16520
SNP(s):rs5443 (T Allele)
Effect:Better response to drug treatment
Reference(s):Schurks M, Kurth T, Stude P, Rimmbach C, de Jesus J, Jonjic M, Diener HC, Rosskopf D: G protein beta3 polymorphism and triptan response in cluster headache. Clin Pharmacol Ther. 2007 Oct;82(4):396-401. Epub 2007 Mar 14. [PubMed]
|
| Description |
Rizatriptan¿¡ ´ëÇÑ Description Á¤º¸ Rizatriptan is a triptan drug used for the treatment of migraine headaches. It is a selective 5-hydroxytryptamine1 receptor subtype agonist.
|
| Dosage Form |
Rizatriptan¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Tablet OralWafer Oral
|
| Drug Category |
Rizatriptan¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-inflammatory AgentsAnti-migraine AgentsSelective Serotonin AgonistsSerotonin AgonistsVasoconstrictor Agents
|
| Smiles String Canonical |
Rizatriptan¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CN(C)CCC1=CNC2=C1C=C(CN1C=NC=N1)C=C2
|
| Smiles String Isomeric |
Rizatriptan¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CN(C)CCC1=CNC2=C1C=C(CN1C=NC=N1)C=C2
|
| InChI Identifier |
Rizatriptan¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C15H19N5/c1-19(2)6-5-13-8-17-15-4-3-12(7-14(13)15)9-20-11-16-10-18-20/h3-4,7-8,10-11,17H,5-6,9H2,1-2H3
|
| Chemical IUPAC Name |
Rizatriptan¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ N,N-dimethyl-2-[5-(1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl]ethanamine
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2022-03-26
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|