| |
|
|
|
|
|
 |
| |
|
µðÆä·»Å©¸²1%(µðŬ·ÎÆä³«µð¿¡Ä¥¾Ï¸ð´½)
|
|
ÀϹÝÀǾàǰ | ºñ±Þ¿©
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
657301163[657301160]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
[ºñ±Þ¿©]
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»öÀÇ Å©¸²Á¦
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
1°³(10±×·¥) |
| ÁÖ¼ººÐÄÚµå |
143331CCM
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| ´ëÇ¥ÄÚµå |
8806573011601 |
| º¸°ü¹æ¹ý |
±â¹Ð¿ë±â, ½Ç¿Â(1¢¦30¡É)º¸°ü, ¿À» ÇÇÇÏ¿© º¸È£
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
´ÙÀ½ Áúȯ ¹× Áõ»óÀÇ ÁøÅë¤ý¼Ò¿° :
1. °Ç, Àδë, ±ÙÀ° ¹× °üÀýÀÇ ¿Ü»ó¼º ¿°Áõ(»ã, Ÿ¹Ú»ó µî)
2. ¿¬Á¶Á÷ ·ù¸¶Æ¼½ºÀÇ ±¹¼ÒÇü(°ÇÃÊ¿°, ¾î±ú¼ÕÁõÈıº, Á¡¾×³¶¿°, °üÀýÁÖÀ§¿° µî)
3. ·ù¸¶Æ¼½º ÁúȯÀÇ ±¹¼ÒÇü(¸»ÃʰüÀý ¹× ôÃßÀÇ °ñ°üÀýÁõ µî)
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
ÅëÁõ ºÎÀ§ÀÇ ¸éÀû¿¡ µû¶ó 2 - 4gÀ» 1ÀÏ 3 - 4ȸ ȯºÎ¿¡ ¹Ù¸£°í Àß ½º¸çµéµµ·Ï °¡º±°Ô ¹®Áö¸¥´Ù.
|
| ±Ý±â |
1) ÀÌ ¾à ¹× ÀÌ ¾à ¼ººÐ¿¡ °ú¹ÎÁõ ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ
2) ¾Æ½ºÇǸ° ¶Ç´Â ±âŸÀÇ ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°ÁøÅëÁ¦¿¡ °ú¹ÎÁõ ȯÀÚ
3) ¾Æ½ºÇǸ° ¶Ç´Â ±âŸÀÇ ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°ÁøÅëÁ¦¿¡ ´ëÇÑ Ãµ½Ä(ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°ÁøÅëÁ¦ µî¿¡ ÀÇÇÑ Ãµ½Ä ¹ßÀÛÀ» À¯¹ß) ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ(õ½Ä ¹ßÀÛÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù)
4) 6¼¼ ÀÌÇÏÀÇ À¯¾Æ
5) ÀӽŠ3±â
|
| ½ÅÁßÅõ¿© |
±â°üÁö õ½Ä ȯÀÚ(ÁßÁõ õ½Ä¹ßÀÛÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù) |
| ÀÌ»ó¹ÝÀÀ |
1) ÀÌ ¾àÀº Å»¶ô¼º ÇǺο°, ½ºÆ¼ºì½º-Á¸½¼ ÁõÈıº ¹× µ¶¼º Ç¥ÇDZ«»ç °°Àº Áß´ëÇÑ ÇǺΠÀÌ»ó¹ÝÀÀÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¸ç, ÀÌ´Â Ä¡¸íÀûÀÏ ¼ö ÀÖ´Ù. ÀÌ·¯ÇÑ Áß´ëÇÑ ÀÌ»ó¹ÝÀÀÀº °æ°í Áõ»ó ¾øÀÌ ¹ß»ýÇÒ ¼ö ÀÖ´Ù. ´ëºÎºÐÀÇ °æ¿ì ÀÌ·¯ÇÑ ÀÌ»ó¹ÝÀÀÀº Åõ¿© Ãʱâ 1°³¿ù À̳»¿¡ ¹ß»ýÇÑ´Ù. ȯÀÚ´Â Áß´ëÇÑ ÇǺΠ¹ßÇö Áõ»ó ¹× ÁõÈÄ¿¡ ´ëÇØ ¾Ë°í ÀÖ¾î¾ß ÇÏ¸ç ¶§¶§·Î °¡·Á¿ò, ¹ßÀû, ¾²¶ó¸², ÇǺο°(¹ßÁø, ½ÀÁø, ÇÇÁø, ±¸Áø, Á¢ÃËÇǺο°, ºÎÁ¾), ÇǺιÚÅ» ¹× °ÅÄ¥¾îÁü, Àڱذ¨ ¹× ¼öÆ÷Çü¼º, µå¹°°Ô »ö¼ÒÄ§ÂøÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
2) ³ÐÀº ºÎÀ§¿¡ ¶Ç´Â Àå±â°£ »ç¿ëÇÒ °æ¿ì ¹ü¹ß¼º ÇǺιßÁø, ±¤°ú¹ÎÁõ, È£Èí°ï¶õ, õ½Ä, ¸Æ°üºÎÁ¾ µîÀÇ Àü½Å ºÎÀÛ¿ëÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| ÀϹÝÀû ÁÖÀÇ |
1) ¼Ò¿°ÁøÅëÁ¦¿¡ ÀÇÇÑ Ä¡·á´Â ¿øÀοä¹ýÀÌ ¾Æ´Ñ ´ëÁõ¿ä¹ýÀÓ¿¡ À¯ÀÇÇÑ´Ù.
2) ÇǺÎÀÇ °¨¿°ÁõÀ» ºÒÇö¼ºÈÇÒ ¿ì·Á°¡ ÀÖÀ¸¹Ç·Î °¨¿°À» ¼ö¹ÝÇÏ´Â ¿°Áõ¿¡ ´ëÇØ ÀÌ ¾àÀ» »ç¿ëÇÏ´Â °æ¿ì¿¡´Â Àû´çÇÑ Ç×±ÕÁ¦ ¶Ç´Â Ç×Áø±ÕÁ¦¸¦ º´¿ëÇϰí ÃæºÐÈ÷ °üÂûÇÏ¿© ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
3) ¸¸¼ºÁúȯ(ÅðÇ༺°üÀý¿°(°ñ°üÀý¿°) µî)¿¡ ÀÌ ¾àÀ» »ç¿ëÇÏ´Â °æ¿ì¿¡´Â ¾à¹°¿ä¹ý ÀÌ¿ÜÀÇ ¿ä¹ýµµ °í·ÁÇÑ´Ù. ¶Ç ȯÀÚ »óŸ¦ ÃæºÐÈ÷ °üÂûÇÏ°í ºÎÀÛ¿ë ¹ßÇö¿¡ À¯ÀÇÇÑ´Ù.
4) ÀÌ ¾àÀÇ ÀÓ»ó½ÃÇè ¹× ½ÃÆÇÈÄ Á¶»ç °á°ú ½ÅÀå¿¡¼ÀÇ ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°ÁøÅëÁ¦(NSAIDs)°¡ ÀϺΠȯÀÚ¿¡¼ ·çÇÁ ÀÌ´¢Á¦(¿¹: Ǫ·Î¼¼¹Ìµå) ¹× Ä¡¾ÆÁþ°è ÀÌ´¢Á¦ÀÇ ³ªÆ®·ý´¢¹è¼³ È¿°ú¸¦ °¨¼Ò½Ãų ¼ö ÀÖÀ½ÀÌ È®ÀεǾú´Ù. ÀÌ ¾à¹°µé°ú NSAIDs¸¦ º´¿ëÅõ¿©ÇÏ´Â µ¿¾È Ç×°íÇ÷¾Ð È¿°ú¸¦ Æ÷ÇÔÇÑ ÀÌ´¢ È¿°ú¸¦ È®ÀÎÇØ¾ß Çϸç, ½Å±â´É ¾ÇÈÀÇ Â¡Èĸ¦ ¸é¹ÐÈ÷ °üÂûÇØ¾ß ÇÑ´Ù.
5) ÀÌ ¾àÀ» Æ÷ÇÔÇÑ NSAIDs´Â À§ ¶Ç´Â Àå°üÀÇ ÃâÇ÷, ±Ë¾ç ¹× õ°øÀ» Æ÷ÇÔÇÑ Áß´ëÇÑ À§Àå°ü°è ÀÌ»ó¹ÝÀÀÀÇ À§ÇèÀ» Áõ°¡½Ãų ¼ö ÀÖÀ¸¸ç, ÀÌ´Â Ä¡¸íÀûÀÏ ¼ö ÀÖ´Ù. À§Àå°ü°è ÃâÇ÷¿¡ ´ëÇÏ¿© ¿ÍÆÄ¸°°ú NSAIDs´Â »ó½ÂÀÛ¿ëÀ» ³ªÅ¸³¾ ¼ö ÀÖ´Ù. µÎ ¾à¹°À» ÇÔ²² »ç¿ëÇϴ ȯÀÚ´Â ´Üµ¶À¸·Î Åõ¿©ÇÏ´Â °æ¿ì¿¡ ºñÇØ ÃâÇ÷ÀÇ À§ÇèÀÌ ³ô¾ÆÁú ¼ö ÀÖÀ¸¹Ç·Î Äí¸¶¸°°è Ç×ÀÀÇ÷Á¦¿Í º´¿ëÅõ¿©½Ã Ç÷¾× ÀÀ°í´É °Ë»ç µî °üÂûÀ» ÃæºÐÈ÷ ÇÑ´Ù.
ÁöÇ÷À» ¹æÇØÇÏ´Â ¾à¹°(¿¹: ¿ÍÆÄ¸°), Ç×Ç÷¼ÒÆÇÁ¦(¿¹: ¾Æ½ºÇǸ°), ¼±ÅÃÀû ¼¼·ÎÅä´Ñ ÀçÈí¼ö ¾ïÁ¦Á¦(SSRI) ¹× ¼¼·ÎÅä´Ñ ³ë¸£¿¡Çdz×ÇÁ¸° ÀçÈí¼ö ¾ïÁ¦Á¦(SNRI)¿Í ÀÌ ¾àÀ» ÇÔ²² º´¿ëÇϴ ȯÀÚ¿¡¼ ÃâÇ÷ ¡Èİ¡ ÀÖ´ÂÁö °üÂûÇØ¾ß ÇÑ´Ù. ÀÌ·¯ÇÑ ÀÌ»ó¹ÝÀÀÀº °æ°í Áõ»ó ¾øÀÌ ¹ß»ýÇÒ ¼ö ÀÖ´Ù. ¶ÇÇÑ, °í·ÉÀÚ´Â Áß´ëÇÑ À§Àå°ü°è ÀÌ»ó¹ÝÀÀÀÇ À§ÇèÀÌ ´õ Ŭ ¼ö ÀÖ´Ù.
6) ÀÌ ¾à Åõ¿© 2ÁÖ ÈÄ¿¡´Â ÀÌ ¾à¿¡ ´ëÇÑ Àç°ËÅä°¡ ÀÌ·ç¾îÁ®¾ß ÇÑ´Ù. |
| ÀӺο¡ ´ëÇÑ Åõ¿© |
[ÀӺαݱ⠼ººÐ Á¶È¸]
1) ÀӽŠ3±â : ÇÁ·Î½ºÅ¸±Û¶õµò ÇÕ¼ºÀúÇØ·Î ÀÎÇØ Ãâ»êÀÌ Áö¿¬µÉ ¼ö ÀÖÀ¸¸ç Ãâ»ê½Ã ½ÇÇ÷, ½Å»ý¾Æ ÃâÇ÷, žÆÀÇ ½ÉÆóµ¶¼º(µ¿¸Æ°ü Á¶±âÆó¼â¸¦ ¼ö¹ÝÇÏ´Â Æó°íÇ÷¾Ð), ½Å±â´ÉÀúÇÏ·Î ¾ç¼ö°ú¼ÒÁõÀ» ¼ö¹ÝÇÏ´Â ½ÅºÎÀü µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ ½Ã±âÀÇ ÀӺο¡´Â »ç¿ëÇÏÁö ¾Ê´Â´Ù.
2) ÀӽŠ1±â ¹× 2±â : µ¿¹°ÀÇ »ý½Ä½ÇÇè °á°ú ÅÂÀÚµ¶¼ºÀº ¹ß»ýÇÏÁö ¾Ê¾ÒÀ¸³ª ÀӺο¡ ´ëÇÑ ¿¬±¸´Â ¾ÆÁ÷ ¹àÇôÁø ¹Ù ¾ø´Ù.
3) NSAIDs´Â ÇÁ·Î½ºÅ¸±Û¶õµò ¸Å°³ ÀÛ¿ë±âÀüÀ¸·Î ÀÎÇØ ³Æ÷ÆÄ¿À» ¹æÇØÇϰųª Áö¿¬½Ãų ¼ö ÀÖÀ¸¸ç, ÀÌ´Â ÀϺΠ¿©¼º¿¡°Ô °¡¿ªÀû ºÒÀÓÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù. µû¶ó¼ ÀÓ½ÅÀÌ ¾î·Æ°Å³ª ºÒÀӰ˻縦 ¹Þ°í ÀÖ´Â ¿©¼ºÀÇ °æ¿ì ÀÌ ¾àÀ» Æ÷ÇÔÇÑ NSAIDs °è¿ ¾à¹°ÀÇ »ç¿ëÁß´ÜÀ» °í·ÁÇØ¾ß ÇÑ´Ù.
|
| ¼öÀ¯ºÎ¿¡ ´ëÇÑ Åõ¿© |
¿µ¾Æ¿¡ ´ëÇÑ À§ÇØ¿©ºÎ´Â ¾ÆÁ÷ ¹àÇôÁø ¹Ù ¾øÀ¸³ª ÀÌ ¾àÀÌ ¸ðÀ¯·Î ÀÌÇàÇϹǷΠ¼öÀ¯ºÎ¿¡´Â »ç¿ëÇÏÁö ¾Ê´Â´Ù. |
| ¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿© |
¼Ò¾Æ¿¡ ´ëÇØ¼´Â ¾ÈÀü¼ºÀÌ È®¸³µÇ¾î ÀÖÁö ¾Ê´Ù(»ç¿ë°æÇèÀÌ Àû´Ù). |
| °í·ÉÀÚ¿¡ ´ëÇÑ Åõ¿© |
°í·É ȯÀÚÀÇ °æ¿ì ¿¬·ÉÀÌ ³·Àº ȯÀÚº¸´Ù NSAIDs °ü·Ã ÁßÁõ ½ÉÇ÷°ü°è, À§Àå°ü, ¹×/¶Ç´Â ½ÅÀå ÀÌ»ó ¹ÝÀÀÀÇ À§Ç輺ÀÌ ´õ ³ô´Ù. °í·ÉÀÚ¿¡ ÀÖ¾î¼ ÇÊ¿äÇÑ ÃÖ¼Ò·®À¸·Î ½ÅÁßÈ÷ Åõ¿©Çϰí ÀÌ»ó¹ÝÀÀ ¹ßÇö¿¡ ƯÈ÷ À¯ÀÇÇÑ´Ù. |
| Àû¿ë»óÀÇ ÁÖÀÇ |
1) º´º¯ÀÌ ÀÖ´Â ÇǺÎ(ÃâÇ÷¼º ÇǺÎÁúȯ, ½ÀÁø, °¨¿°µÈ º´º¯, È»ó, »óó), ´« ¹× Á¡¸·ºÎÀ§¿¡´Â »ç¿ëÇÏÁö ¾Ê´Â´Ù.
2) ¹ÐºÀºØ´ë¹ýÀ¸·Î »ç¿ëÇÏÁö ¾Ê´Â´Ù.
3) ÇǺο¡ ¼Õ»óÀÌ ÀÖÀ» °æ¿ì »ç¿ëÇϸé ÀϽÃÀûÀÎ ÀÚ±Ø ¹× Àú¸°°¨À» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î »ç¿ë½Ã ÁÖÀÇÇÑ´Ù. |
| °ú·®Åõ¿© ¹× óġ |
1) Áõ»ó : ¿Ã¹Ù¸£°Ô »ç¿ëÇÏÁö ¾Ê°Å³ª °©Àڱ⠰ú¿ë·®À» »ç¿ëÇÏ¿© ÀúÇ÷¾Ð, ½ÅºÎÀü, °æ·Ã, À§Àå°ü ºÒÄè°¨ ¹× È£Èí±â´É ¾ïÁ¦ µîÀÇ Àü½Å ºÎÀÛ¿ëÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
2) óġ : ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°Á¦ÀÇ ÀÏ¹Ý ÇØµ¶¹ýÀ» »ç¿ëÇÑ´Ù. ÀÌ Ã³Ä¡¹ýÀº ´ëÁõÀû º¸Á¶¿ä¹ýÀÌ´Ù. |
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
±â¹Ð¿ë±â, ½Ç¿Â(1¢¦30¡É)º¸°ü, ¿À» ÇÇÇÏ¿© º¸È£
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Diclofenac¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ The antiinflammatory effects of diclofenac are believed to be due to inhibition of both leukocyte migration and the enzyme cylooxygenase (COX-1 and COX-2), leading to the peripheral inhibition of prostaglandin synthesis. As prostaglandins sensitize pain receptors, inhibition of their synthesis is responsible for the analgesic effects of ketoprofen. Antipyretic effects may be due to action on the hypothalamus, resulting in peripheral dilation, increased cutaneous blood flow, and subsequent heat dissipation.
|
| Pharmacology |
Diclofenac¿¡ ´ëÇÑ Pharmacology Á¤º¸ Diclofenac is an acetic acid nonsteroidal antiinflammatory drug (NSAID) with analgesic and antipyretic properties. Diclofenac is used to treat pain, dysmenorrhea, ocular inflammation, osteoarthritis, rheumatoid arthritis, ankylosing spondylitis, and actinic keratosis
|
| Metabolism |
Diclofenac¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 2C9 (CYP2C9)Cytochrome P450 2C19 (CYP2C19)Cytochrome P450 1A2 (CYP1A2)Cytochrome P450 2C8 (CYP2C8)Cytochrome P450 2D6 (CYP2D6)Glucuronosyltransferase
|
| Protein Binding |
Diclofenac¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ More than 99%
|
| Half-life |
Diclofenac¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 2 hours
|
| Absorption |
Diclofenac¿¡ ´ëÇÑ Absorption Á¤º¸ Completely absorbed from the gastrointestinal tract.
|
| Pharmacokinetics |
Diclofenac diethylammoniumÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ´Ü¹é°áÇÕ : 99%
- ´ë»ç : °£¿¡¼ ºñȰ¼ºÇü ´ë»çü·Î ´ë»çµÊ
- ¹Ý°¨±â : 2½Ã°£
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : 1-2 ½Ã°£ À̳»
- ¼Ò½Ç : ÁÖ·Î ½Å¹è¼³
|
| Biotransformation |
Diclofenac¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic
|
| Toxicity |
Diclofenac¿¡ ´ëÇÑ Toxicity Á¤º¸ Symptoms of overdose include loss of consciousness, increased intracranial pressure, and aspiration pneumonitis. LD50=390mg/kg (orally in mice)
|
| Drug Interactions |
Diclofenac¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Alendronate Increased risk of gastric toxicityAnisindione The NSAID increases the anticoagulant effectCyclosporine Monitor for nephrotoxicityDicumarol The NSAID increases the anticoagulant effectWarfarin The NSAID increases the anticoagulant effectRifampin Decreased levels/effect of the NSAID
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸] Diclofenac¿¡ ´ëÇÑ P450 table
SUBSTRATES
CYP 2C9
NSAIDs:
**diclofenac**
ibuprofen
piroxicam
Oral Hypoglycemic Agents:
tolbutamide
glipizide
Angiotensin II Blockers:
NOT candesartan
irbesartan
losartan
NOT valsartan
celecoxib
fluvastatin naproxen
phenytoin
sulfamethoxazole
tamoxifen
tolbutamide
torsemide
warfarin
INHIBITORS
CYP 2C9
amiodarone
fluconazole
isoniazid
INDUCERS
CYP 2C9
rifampin
secobarbital
|
| Food Interaction |
Diclofenac¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take with food to reduce irritation.Avoid alcohol.
|
| Drug Target |
[Drug Target]
|
| Description |
Diclofenac¿¡ ´ëÇÑ Description Á¤º¸ A non-steroidal anti-inflammatory agent (NSAID) with antipyretic and analgesic actions. It is primarily available as the sodium salt. [PubChem]
|
| Dosage Form |
÷°¡Á¦1 º¥Áú¾ËÄÚ¿Ã (ÁÖ»çÁ¦¿¡ ÇÑÇÔ.) ¡Û °æ°í
º¥Áú¾ËÄÚ¿ÃÀº ¹Ì¼÷¾Æ¿¡¼ Ä¡¸íÀûÀÎ °¡»Û È£ÈíÁõ»ó°ú ¿¬°üÀÌ ÀÖ´Â °ÍÀ¸·Î º¸°íµÇ¾ú´Ù.
¡Û ´ÙÀ½ ȯÀÚ¿¡´Â Åõ¿©ÇÏÁö ¸» °Í.
½Å»ý¾Æ, ¹Ì¼÷¾Æ(º¥Áú¾ËÄÚ¿ÃÀ» ÇÔÀ¯Çϰí ÀÖ´Ù.)
|
| Drug Category |
Diclofenac¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Inflammatory Agents, Non-SteroidalCyclooxygenase InhibitorsNonsteroidal Antiinflammatory Agents (NSAIDs)
|
| Smiles String Canonical |
Diclofenac¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ OC(=O)CC1=CC=CC=C1NC1=C(Cl)C=CC=C1Cl
|
| Smiles String Isomeric |
Diclofenac¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ OC(=O)CC1=CC=CC=C1NC1=C(Cl)C=CC=C1Cl
|
| InChI Identifier |
Diclofenac¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C14H11Cl2NO2/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19/h1-7,17H,8H2,(H,18,19)/f/h18H
|
| Chemical IUPAC Name |
Diclofenac¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 2-[2-[(2,6-dichlorophenyl)amino]phenyl]acetic acid
|
| Drug-Induced Toxicity Related Proteins |
DICLOFENAC ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:CYP3A4 Drug:Diclofenac Toxicity:idiosyncratic hepatotoxicity. [¹Ù·Î°¡±â] Replated Protein:CYP2C9 Drug:Diclofenac Toxicity:idiosyncratic hepatotoxicity. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2024-12-13
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
The database contains the following fields: The generic name of each chemical For module A10 (liver enzyme composite module): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the number of active and marginally active scores for each compound at the five individual endpoints (see research article for full description of method) Number of endpoints at which each compound is marginally active (M) Number of endpoints at which each compound is active (A) For modules A11 to A15 (alkaline phosphatase increased, SGOT increased, SGPT increased, LDH increased, and GGT increased, respectively): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the RI and ADR values (see the research article for full description of method) Number of ADR reports for each compound, given as <4 or ¡Ã4 Reporting Index value for each compound, except where no shipping units were available (NSU) Group 1 comprises of compounds for which ADR data were available for the first five years of marketing, so when no ADR reports were listed during this period the compounds were evaluated as inactive. Group 2 comprises of compounds for which a 'steady state' period of ADR data were available (1992-1996). In cases where no ADR reports were filed during this period, the compounds were scored as 'NA' (data not available) since they may have had one or more ADR reports during their first five years of marketing which should not be negated by a lack of ADR reports during the steady-state period. DICLOFENAC[GGT Increase][Composite Activity](Score) A(Marginal) 1(Active) 3[Alkaline Phosphatase Increase](Activity Score) A(Number of Rpts) ¡Ã4(Index value) 9.2[SGOT Increase](Activity Score) A(Number of Rpts) ¡Ã4(Index value) 11.4[SGPT Increase](Activity Score) A(Number of Rpts) ¡Ã4(Index value) 11.1[LDH Increase](Activity Score) I(Number of Rpts) ¡Ã4(Index value) 2[GGT Increase](Activity Score) M(Number of Rpts) ¡Ã4(Index value) 3.8
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|