| |
|
|
|
|
|
 |
| |
|
¾Ëµå·ÎÁ¨°Ö(Å×½ºÅ佺Å×·Ð) ALDROGEN GEL.[Testosterone]
|
|
Àü¹®ÀǾàǰ | ºñ±Þ¿©
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
643201700[A06751331]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1g(2006.03.01)(ÇöÀç¾à°¡)
\359 ¿ø/1g(2004.08.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Æ÷À塤À¯Åë´ÜÀ§ |
14GEL |
| ´ëÇ¥ÄÚµå |
8806432017003 |
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
´ÙÀ½ÀÇ ³»ÀμºÅ×½ºÅ佺Å×·ÐÀÇ ºÎÁ· ¶Ç´Â °áÇ̰ú °ü·ÃÇÑ ³²¼ºÈ¦¸ó´ëü¿ä¹ý¿¡ »ç¿ë. 1. ¿ø¹ß¼º¼º¼±±â´ÉºÎÀü(Hypogonadism)-Àẹ°íȯÁõ, °íȯ¿°ÁÂ, ¹«°íȯÁõ(Vanishing testis syndro me)¿¡ ÀÇÇÑ °íȯºÎÀü, °íȯÀýÁ¦¼ú, Ŭ¶óÀÎÆçÅÍÁõÈıº(Klinefelter's syndrome), ÈÇпä¹ý, ¾ËÄÝ ¶Ç´Â Á߱ݼÓÀ¸·Î ÀÎÇÑ ¼Õ»ó 2. ¼Ó¹ß¼º, Áï Àú°í³ªµµÆ®·ÎÇɼº ¼º¼±±â´ÉºÎÀü(Hypogonadism) - Ư¹ß¼º°í³ªµµÆ®·ÎÇÉ ¶Ç´Â ȲüȦ ¸ó¹æÃâȦ¸ó(LHRH)°áÇÌÁõ, Á¾¾ç, ¿Ü»ó, ¹æ»ç¼±À¸·Î ÀÎÇÑ ³úÇϼöü-½Ã»óÇϺμջó
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
ÃʱâÅõ¿© ±ÇÀå·® : ±ú²ýÇÏ°í °ÇÁ¶ÇÑ ¾î±ú, ÆÈ ¶Ç´Â º¹ºÎÁ¤»ó ÇǺο¡ 1ÀÏ1ȸ µÉ ¼ö ÀÖÀ¸¸é ¿ÀÀü¿¡ Å×½ºÅä°Ö 1% 5g(1ÀÏ Å×½ºÅ佺Å×·Ð ÃÑÈí¼ö·® 5mg)À» Àû¿ëÇÑ´Ù. Æ÷Àå °³ºÀ ÈÄ ¸ðµç ³»¿ë¹°À» ¼Õ¹Ù´Ú¿¡ Â¥¼ Áï½Ã Àû¿ë ºÎÀ§¿¡ ¹Ù¸£°í, ¼öºÐ°£ °ÇÁ¶½ÃŲ´Ù. ÀÌ ¾àÀ» »ç¿ëÇÑ ÈÄ¿¡´Â ¼ÕÀ» ºñ´©·Î ¾Ä¾î¾ß ÇÑ´Ù. ÀÌ ¾àÀº ¼º±â¿¡ Àû¿ëÇÏÁö ¾Ê´Â´Ù. Ç÷Àå Å×½ºÅ佺Å×·Ð ³óµµ´Â ÀûÁ¤¿ë·®À» °áÁ¤Çϱâ À§ÇÏ¿© Åõ¿© ÈÄ ¾à 14Àϰ£ ÃøÁ¤ÇÑ´Ù. ¸¸ÀÏ Ç÷Àå Å×½ºÅ佺Å×·Ð ³óµµ°¡ Á¤»ó Ä¡º¸´Ù ³·°Å³ª ¿øÇÏ´Â ÀÓ»ó¹ÝÀÀÀÌ ³ªÅ¸³ªÁö ¾ÊÀ¸¸é ÀÇ»çÀÇ Áö½Ã¿¡ ÀÇÇÏ¿© 1ÀÏ ¿ë·®À» 7.5g, 10g À¸·Î Áõ·®ÇÑ´Ù
|
| ±Ý±â |
1) À¯¹æ¾ÏȯÀÚ ¶Ç´Â Àü¸³¼±¾ÏÀÌ Àְųª ÀǽɵǴ ³²¼ºÈ¯ÀÚ
2) ¿©¼º
3) ÀÌ ¾àÀÇ ¼ººÐ¿¡ °ú¹ÎÁõÀÌ Àִ ȯÀÚ
|
| ½ÅÁßÅõ¿© |
1) ³ëÀÎȯÀÚ¿¡¼ ³²¼ºÈ£¸£¸óÅõ¿©´Â Àü¸³¼±ºñ´ëÁõ°ú Àü¸³¼±¾Ï ¹ßÇöÀ» Áõ°¡½Ãų ¼ö ÀÖÀ¸¹Ç·Î ½ÅÁß È÷ Åõ¿©ÇÑ´Ù.
2) ¼º¼±±â´ÉºÎÀüÁõ Ä¡·áȯÀÚ¿¡¼ ÀÚÁÖ ¿©¼ºÇü À¯¹æÀÌ ¹ßÇöÇÏ¿© °£È¤ Áö¼ÓµÉ ¼ö ÀÖÀ¸¹Ç·Î ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
|
| ÀϹÝÀû ÁÖÀÇ |
1) Àå±â°£ ³²¼ºÈ£¸£¸óÀ» Åõ¿© ¹Þ´Â ȯÀÚ´Â Çì¸ð±Û·Îºó°ú Ç츶ÅäÅ©¸®Æ® ³óµµ¸¦ Á¤±âÀûÀ¸·Î °Ë»ç ÇØ¾ß ÇÑ´Ù. ¶ÇÇÑ Á¤±âÀûÀ¸·Î °£±â´É, Àü¸³¼±Æ¯ÀÌÇ׿ø, ÃÑÄÝ·¹½ºÅ×·Ñ, HDLÄÝ·¹½ºÅ×·ÑÀ» °Ë»çÇØ¾ß ÇÑ´Ù.
2) ½ÉÀå, ½ÅÀå, °£ÀåÁúȯ ±â¿Õ·Â ȯÀÚ¿¡ ´ëÇÑ ³²¼ºÈ£¸£¸ó¿ä¹ý½Ã ÁßÁõÀÇ ÇÕº´ÁõÀº(¿ïÇ÷¼º ½ÉºÎÀü À» µ¿¹ÝÇϰųª µ¿¹ÝÇÏÁö ¾ÊÀº)ºÎÁ¾ÀÌ´Ù. ÀÌ·¯ÇÑ °æ¿ì Åõ¾àÁßÁö¿Í ´õºÒ¾î ÀÌ´¢Á¦ Åõ¿©°¡ ÇÊ¿äÇÒ ¼öµµ ÀÖ´Ù.
|
| »óÈ£ÀÛ¿ë |
1) ¸ÞÆ®¾Èµå·Î½ºÅ׳î·Ð°ú °°Àº Å×½ºÅ佺Å×·Ð C-17ġȯÁ¦´Â °æ±¸¿ë Ç×ÀÀ°íÁ¦ÀÇ ¿ä±¸·®À» °¨¼Ò½Ã ´Â °ÍÀ¸·Î º¸°íµÇ¾ú´Ù. °æ±¸¿ë Ç×ÀÀ°íÁ¦ Åõ¿©È¯ÀÚ´Â ³²¼ºÈ£¸£¸ó¹ý ½ÃÀÛ°ú Áߴܽà ¸ð´ÏÅÍ ÇØ¾ß ÇÑ´Ù.
2) ¿Á½ÃÆæÅ¸Á¸°ú ³²¼ºÈ£¸£¸óÀÇ º´¿ëÅõ¿©´Â Ç÷Áß ¿Á½ÃÆæÅ¸Á¸³óµµ¸¦ Áõ°¡½Ãų ¼ö ÀÖ´Ù.
3) ´ç´¢º´ ȯÀÚ¿¡¼ ³²¼ºÈ£¸£¸óÀÇ ´ë»çÈ¿°ú·Î Ç÷´çÀ» °¨¼Ò½ÃÄÑ Àν¶¸° ¿ä±¸·®À» °¨¼Ò½Ãų ¼öÀÖ ´Ù. |
| ¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿© |
¼Ò¾Æ¿¡ ´ëÇÑ Åõ¿©
º»Á¦´Â 18¼¼ ÀÌÇÏÀÇ ³²¼º¿¡ ´ëÇÑ ÀÓ»óÆò°¡°¡ ÀÌ·ç¾îÁöÁö ¾Ê¾Ò´Ù.
|
| Àû¿ë»óÀÇ ÁÖÀÇ |
1) ÀÌ ¾àÀº À½³¶¿¡ µµÆ÷ÇØ¼´Â ¾È µÈ´Ù.
2) 1ÀÏ 1ȸ ±ú²ýÇÏ°í °ÇÁ¶µÈ ÇǺο¡ µµÆ÷ ÇØ¾ßÇÑ´Ù.
3) ÇöÀç±îÁö´Â »þ¿ö³ª ¼ö¿µÀÌ ¾à È¿·Â¿¡ ¾ó¸¶³ª ¿µÇâÀ» ÁÖ´ÂÁö Á¤È®È÷ ¾Ë·ÁÁ® ÀÖÁö´Â ¾ÊÁö¸¸,
Å×½ºÅ佺Å×·ÐÀÇ Èí¼ö·®ÀÇ ÃÖ´ëȸ¦ À§Çؼ´Â Àû¾îµµ 5~6½Ã°£ Àü¿¡ µµÆ÷ ÇÏ´Â °ÍÀÌ ÁÁ´Ù.
±×·¯³ª ³Ê¹« ÀæÀº »þ¿ö³ª ¼ö¿µÀ» ÇÏÁö ¾Ê´Â ÇÑ Å×½ºÅ佺Å×·ÐÀÇ Èí¼ö¿¡ ¹ÌÄ¡´Â ¿µÇâÀº °ÅÀÇ ¾ø ´Ù.
|
| °ú·®Åõ¿© ¹× óġ |
Å×½ºÅ佺Å×·Ð ¿¡³Å×ÀÌÆ® ÁÖ»çÀÇ ±Þ¼º °ú·®Åõ¿©¿¡ ´ëÇØ ´ÙÀ½°ú °°Àº ÇÑ °ÇÀÇ º¸°í°¡ ÀÖ´Ù.
11,400§·/DL Å×½ºÅ佺Å×·Ð ³óµµ´Â ³úÇ÷°üÇÕº´ÁõÀ» ¾ß±âÇÒ ¼ö ÀÖ´Ù.
|
ÀÓ»ó°Ë»çÄ¡¿¡ÀÇÇÑ ¿µÇâ |
³²¼ºÈ£¸£¸óÀº Ƽ·Ï½Å°áÇÕ-±Û·ÎºÒ¸°Ä¡¸¦ °¨¼Ò½ÃÄÑ Ç÷Áß ÃÑ T4Ä¡¸¦ °¨¼Ò½Ã۰í T3¿Í T4ÀÇ ¼öÁö À¯ÀÔÀ» Áõ°¡ ½Ãų ¼ö ÀÖ´Ù. ±×·¯³ª À¯¸® °©»ó¼±È£¸£¸ó ³óµµ´Â º¯ÈÇÏÁö ¾ÊÀ¸¸ç °©»ó¼± ±â´ÉºÎÀü ÀÇ ÀÓ»óÀû Áõ°Å´Â ¾ø´Ù.
|
| ±âŸ |
1) ÀÌ ¾à ¶Ç´Â ÀÌ ¾àÀÇ ¿¬°í¼ººÐÀ» °æ±¸ ¼·ÃëÇØµµ, Ç¥Àû±â°ü¿¡¼ °úµµÇÑ ÃÊȸÅë°ú È¿°ú¿¡ ±âÀÎÇÑ ½É°¢ÇÑ Ç÷Áß Å×½ºÅ佺Å×·Ð Ä¡¸¦ ¾ß±âÇÏÁö ¾Ê´Â´Ù.
2) µ¿¹°¿¡ ´ëÇÑ ½ÇÇè : ¸¶¿ì½º¿Í ·§Æ®¸¦ »ç¿ëÇÏ¿© Å×½ºÅ佺Å×·ÐÀÇ ÇÇÇÏÁÖ»ç ¹× ÀÌ½Ä ½ÇÇèÀ» ÇÏ ¿´´Ù. ¸¶¿ì½º¿¡ ´ëÇÑ À̽Ŀ¡¼ ¸î¸îÀº ÀüÀÌµÈ ÀڱðæºÎÁ¾¾çÀ» À¯¹ßÇÏ¿´´Ù. ¸î Á¾ÀÇ ¾ÏÄÆ ¸¶¿ì½º ¿¡ Å×½ºÅ佺Å×·Ð ÁÖ»ç·Î Ç÷Á¾¿¡ ´ëÇÑ °¨¼ö¼ºÀÌ Áõ°¡ÇÔÀ» ½Ã»çÇÏ´Â Áõ°Å°¡ ÀÖ´Ù.
¶ÇÇÑ Å×½ºÅ佺Å×·ÐÀº ·§Æ®¿¡¼ Á¾¾çÀÇ ¼ö¸¦ Áõ°¡½Ã۰í ÈÇÐÀûÀ¸·Î À¯µµµÈ °£¾ÏÀÇ ºÐÈÁ¤µµ¸¦ °¨¼Ò½ÃŰ´Â °ÍÀ¸·Î ¾Ë·ÁÁ® ÀÖ´Ù.
3) Àå±â°£ÀÇ °í¿ë·® ³²¼ºÈ£¸£¸ó¿ä¹ý ȯÀÚ¿¡¼ µå¹°°Ô °£¼¼Æ÷Á¾¾çÀÌ ¹ß»ýÇÑ º¸°í°¡ ÀÖ´Ù. Åõ¾à Áß ´Ü ÀÌ Ç×»ó Á¾¾çÀÇ Åðȸ¦ À¯µµÇÏÁö´Â ¾Ê´Â´Ù
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Xµî±Þ
(ÀӺο¡ »ç¿ë ±Ý±â. )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Testosterone¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Testosterone¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ The effects of testosterone in humans and other vertebrates occur by way of two main mechanisms: by activation of the androgen receptor (directly or as DHT), and by conversion to estradiol and activation of certain estrogen receptors. Free testosterone (T) is transported into the cytoplasm of target tissue cells, where it can bind to the androgen receptor, or can be reduced to 5¥á-dihydrotestosterone (DHT) by the cytoplasmic enzyme 5¥á-reductase. DHT binds to the same androgen receptor even more strongly than T, so that its androgenic potency is about 2.5 times that of T. The T-receptor or DHT-receptor complex undergoes a structural change that allows it to move into the cell nucleus and bind directly to specific nucleotide sequences of the chromosomal DNA. The areas of binding are called hormone response elements (HREs), and influence transcriptional activity of certain genes, producing the androgen effects.
|
| Pharmacology |
Testosterone¿¡ ´ëÇÑ Pharmacology Á¤º¸ Testosterone is a steroid hormone from the androgen group. Testosterone is primarily secreted in the testes of males and the ovaries of females although small amounts are secreted by the adrenal glands. It is the principal male sex hormone and an anabolic steroid. In both males and females, it plays key roles in health and well-being. Examples include enhanced libido, energy, immune function, and protection against osteoporosis. On average, the adult male body produces about twenty times the amount of testosterone than an adult female's body does.
|
| Protein Binding |
Testosterone¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 40% of testosterone in plasma is bound to sex hormone-binding globulin and 2% remains unbound and the rest is bound to albumin and other proteins.
|
| Half-life |
Testosterone¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 10-100 minutes
|
| Absorption |
Testosterone¿¡ ´ëÇÑ Absorption Á¤º¸ Approximately 10% of the testosterone dose applied on the skin surface is absorbed into systemic circulation
|
| Pharmacokinetics |
TestosteroneÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ÃÖ´ëÈ¿°ú ¹ßÇö½Ã°£ :
- ÀÛ¿ëÁö¼Ó½Ã°£ : Åõ¿© °æ·Î ¹× ¿° Á¾·ù¿¡ µû¶ó ´Ù¸£´Ù.
- Testosterone cypionate, Testosterone enanthate : ±ÙÀ°ÁÖ»ç : 2-4ÁÖ
- Èí¼ö :
- °æ±¸ : À§Àå°ü, ±¸° Á¡¸·À¸·ÎºÎÅÍ Èí¼öµÇ³ª ÃÊȸÅë°úÈ¿°ú°¡ ¸Å¿ì Å©´Ù.
- ±ÙÀ°ÁÖ»ç : ¼¼È÷ Èí¼öµÈ´Ù.
- ºÐÆ÷ : ÅÂ¹Ý Åë°ú, À¯Áó ºÐºñ
- ´Ü¹é°áÇÕ : 98% (transcortin ¹× albumin¿¡ °áÇÕÇÑ´Ù.)
- ´ë»ç :
- °æ±¸ Åõ¿©½Ã °ÅÀÇ ´ëºÎºÐÀÌ ÃÊȸÅë°ú ´ë»ç¸¦ ¹Þ´Â´Ù.
- °£¿¡¼ ´Ù¾çÇÑ 17-ketosteroids ¹× Æ÷ÇÕü·Î ´ë»çµÈ´Ù.
- ¹Ý°¨±â : 10-100ºÐ
- À¯¸®Çü testosteroneÀÇ ¾ç¿¡ µû¶ó ¹Ý°¨±â°¡ º¯ÇϹǷΠÅõ¿© °æ·Î ¹× ¿° Á¾·ù¿¡ µû¶ó ´Ù¸£´Ù.
- Testosterone cypionate : ±ÙÀ°ÁÖ»ç : ¹Ý°¨±â°¡ ¾à 8ÀÏÀ̶ó°í º¸°íµÇ¾ú´Ù.
- ¼Ò½Ç : 90%´Â ÁÖ·Î ´ë»çü·Î¼ ´¢¸¦ ÅëÇØ, ¾à 10%´Â ´ãÁóÀ» °ÅÃÄ ´ëº¯À» ÅëÇØ ¹è¼³µÈ´Ù.
|
| Biotransformation |
Testosterone¿¡ ´ëÇÑ Biotransformation Á¤º¸ Testosterone is metabolized to 17-keto steroids through two different pathways. The major active metabolites are estradiol and dihydrotestosterone (DHT).
|
| Toxicity |
Testosterone¿¡ ´ëÇÑ Toxicity Á¤º¸ Side effects include amnesia, anxiety, discolored hair, dizziness, dry skin, hirsutism, hostility, impaired urination, paresthesia, penis disorder, peripheral edema, sweating, and vasodilation.
|
| Drug Interactions |
Testosterone¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Testosterone¿¡ ´ëÇÑ Description Á¤º¸ A potent androgenic steroid and major product secreted by the leydig cells of the testis. Its production is stimulated by luteinizing hormone from the pituitary gland. In turn, testosterone exerts feedback control of the pituitary LH and FSH secretion. Depending on the tissues, testosterone can be further converted to dihydrotestosterone or estradiol. [PubChem]
|
| Dosage Form |
Testosterone¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Capsule OralGel TopicalLiquid IntramuscularPatch TransdermalSolution Intramuscular
|
| Drug Category |
Testosterone¿¡ ´ëÇÑ Drug_Category Á¤º¸ Androgens
|
| Smiles String Canonical |
Testosterone¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC12CCC3C(CCC4=CC(=O)CCC34C)C1CCC2O
|
| Smiles String Isomeric |
Testosterone¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@]34C)[C@@H]1CC[C@@H]2O
|
| InChI Identifier |
Testosterone¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-17,21H,3-10H2,1-2H3/t14-,15-,16-,17-,18-,19-/m0/s1
|
| Chemical IUPAC Name |
Testosterone¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2018-02-27
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|