| |
|
|
|
|
|
 |
| |
|
인펙토후람점안액 INFECTOFLAM EYE.[Fluorometholone , Gentamicin Sulfate]
|
|
전문의약품 | 삭제
|
|
수입의약품
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
653600920[E01630681]
[보험코드에 따른 약품기본정보 직접조회]
\0 원/1ml(2012.05.01)(현재약가)
\1,170 원/1ml(2007.12.01)(변경전약가)
[상병코드조회]
[질병코드집 다운로드]
[우리집건강주치의 바로가기]
|
| 빠른조회 |
|
| 제품성상 |
흔든 후 뿌옇고 거의 냄새가 없는 현탁액
[제형정보 확인]
|
| 포장·유통단위 |
5mL×1EA |
| 포장·코드단위 |
| 약품규격 |
단위 |
대표코드 |
표준코드 |
비고 |
| 5밀리리터 |
1 개 |
8806536009201 |
8806536009218 |
|
|
| 주성분코드 |
332200COS
[동일한 주성분코드를 가진 오리지날 또는 제네릭 의약품 조회]
|
| 대표코드 |
8806536009201 |
| 보관방법 |
기밀용기, 15-25℃보관. |
| 약리작용 |
[조회]
|
| 효능효과 |
[적응증 별 검색]
․겐타마이신에 감수성균에 의한 전안부 감염(예 : 세균성결막염)
․세균감염의 위험성이 있는 전안부 염증(예 : 눈 수술 후 치료시)
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
․세균성 감염(예 : 세균성 결막염) : 감염의 정도에 따라 조절한다. 감염된 눈에 1회 1방울 1일 5회 점안한다. 중증인 경우에는 1-2일간, 1시간마다 1방울씩 증량할 수 있다.
․눈 수술 후 치료시 : 수술한 눈에 1회 1방울 1일 4회 1주일간 점안한다. 그 후로는 적용 횟수를 줄이는 것이 바람직하다.
|
| 주요약물 상호작용 |
[보기]
|
| 금기 |
1) 겐타마이신, 플루오로메톨론, 염화벤잘코늄 또는 그 외 이 약 성분에 과민증의 병력이 있는 환자
2) 각막 손상 및 궤양 환자
3) 바이러스성 감염(예: 단순포진, 우두) 또는 진균감염 환자
4) 안결핵 환자
5) 녹내장 환자
|
| 이상반응 |
1) 점안시 일시적인 작열감이 소수의 환자에서 보고되었으며 드물게 가려움, 발적, 광과민증과 같은 과민 반응이 나타났다.
2) 첨가제 : 이 약은 인산염을 포함하고 있다.
상당한 각막 손상이 있는 일부 환자에서 인산염 함유 점안액의 사용과 연관되어 각막 석회화의 사례가 매우 드물게(0.01% 미만) 보고된 바 있다.
|
| 일반적 주의 |
1) 플루오로메톨론은 다른 스테로이드제에 비해 부작용 발생빈도가 훨씬 적지만, 스테로이드제의 연용은 안압의 병적인 상승을 유발할 수 있다. 특히 연용할 경우에는 반드시 정기적으로 안압검사를 한다.
2) 국소 스테로이드제를 집중적으로 연용하는 요법은 후낭하백내장을 일으키는 요인이 될 수 있다.
3) 스테로이드제를 내안수술 후 바로 적용할 경우 상처치유가 지연될 수 있다.
4) 스테로이드제 또는 항생물질의 장기투여는 이차적인 진균감염이나 비감수성세균 감염을 유발할 수 있으므로 이 복합제를 2주 이상 적용해서는 안된다. 또한 지속적으로 각막궤양이 있을 때에는 진균감염을 의심한다.
5) 스테로이드제의 장기연용으로 각막과 공막이 엷어지거나, 드물게 각막의 천공이 나타난 예가 보고되었다. 각막의 두께를 자주 재어보는 것이 바람직하다.
6) 겐타마이신이 각막상피의 치유를 지연시킬 수도 있으나, 단지 고농도 투여에서만 관찰되어진다.
7) 7-8일간의 투여로 아무런 개선이 없으면 다른 치료방법을 고려한다.
8)코르티코스테로이드의 전신적 이상반응은 어린이 및 CYP3A4 저해제(리토나비르 또는 코비시스타트 포함)치료를 받은 환자와 같이 취약한 환자가 안과용 코르티코스테로이드를 집중치료 또는 장기치료를 받은 후에 발생할 수 있다. |
| 상호작용 |
1)다른 안과용약과 같이 적용해야 할 때에는 각각의 주성분이 씻겨나가지 않도록 하기 위해 적어도 5분의 간격을 두고 적용해야 한다. 겐타마이신을 암포테리신B, 헤파린, 설파디아진, 세팔로친, 클록사실린과 병용투여하면 눈에 보일 정도의 침전이 생길 수 있다.
2)CYP3A4 저해제 (리토나비르 또는 코비시스타트 포함)와 병용 투여시 전신 노출이 증가되어, 전신적 이상 반응 발생 위험이 증가할 수 있다. 치료상의 유익성이 전신 코르티코스테로이드 이상반응 발생의 위험성을 상회한다고 판단되는 경우에만 병용 투여하며, 환자의 전신 코르티코스테로이드 영향을 살펴야 한다.
|
| 임부에 대한 투여 |
[임부금기 성분 조회]
동물실험 결과 태자에 바람직하지 못한 효과를 나타내었다. 플루오로메톨론은 대량투여시 기형발생과 배자독성을 나타내는 물질로 알려져 있으며 사람에 대한 연구결과는 없다. 임부 및 수유부에는 치료상의 유익성이 위험성을 상회한다고 판단되는 경우에만 투여한다.
|
| 적용상의 주의 |
1) 투여전과 투여후 5분정도는 콘택트렌즈의 착용을 피해야 한다. 눈 감염시에는 감염이 확대될 위험성이 있기 때문에 수일간 콘택트렌즈를 착용하지 않아야 한다.
2) 흔들어서 사용한다.
3) 점안용으로만 사용한다.
4) 점안시 용기의 입구가 직접 눈에 닿지 않도록 주의한다.
5) 오염을 방지하기 위해 될 수 있는 한 공동으로 사용하지 않는다.
|
| 과량투여 및 처치 |
국소적 과량투여시 생리식염수 또는 물로 씻어낸다.
|
| 보관 및 취급상의 주의 |
1) 소아의 손이 닿지 않는 곳에 보관한다.
2) 15-25℃에서 보관하고 사용 후 즉시 병이나 튜브를 잠궈야 한다.
3) 직사일광을 피하고 되도록(습기가 적은)서늘한 곳에(밀전하여) 보관한다[괄호내는 필요시에 기재한다.].
4) 개봉 후 한달이상 사용하지 않는다.
5) 오용을 막고 품질의 보존을 위하여 다른 용기에 바꾸어 넣지 않는다.
|
| Related FDA Approved Drug |
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| |
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 축약복약지도 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : C등급
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
신장애, 간장애시
용량조절 |
유료정보입니다.
|
| Pharmacokinetics |
유료정보입니다.
|
| 병용금기 및 연령대금기 근거조회 |
[병용금기 및 연령대금기 근거조회]
|
| 제형별 복약지도 |
[점안액] |
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| Mechanism of Action |
Fluorometholone에 대한 Mechanism_Of_Action 정보
There is no generally accepted explanation for the mechanism of action of ocular corticosteroids. However, corticosteroids are thought to act by the induction of phospholipase A2 inhibitory proteins, collectively called lipocortins. It is postulated that these proteins control the biosynthesis of potent mediators of inflammation such as prostaglandins and leukotrienes by inhibiting the release of their common precursor, arachidonic acid. Arachidonic acid is released from membrane phospholipids by phospholipase A2.
Gentamicin에 대한 Mechanism_Of_Action 정보
Aminoglycosides like gentamicin "irreversibly" bind to specific 30S-subunit proteins and 16S rRNA. Specifically gentamicin binds to four nucleotides of 16S rRNA and a single amino acid of protein S12. This interferes with decoding site in the vicinity of nucleotide 1400 in 16S rRNA of 30S subunit. This region interacts with the wobble base in the anticodon of tRNA. This leads to interference with the initiation complex, misreading of mRNA so incorrect amino acids are inserted into the polypeptide leading to nonfunctional or toxic peptides and the breakup of polysomes into nonfunctional monosomes.
|
| Pharmacology |
Fluorometholone에 대한 Pharmacology 정보
Corticosteroids such as fluorometholone inhibit the inflammatory response to a variety of inciting agents and probably delay or slow healing. They inhibit the edema, fibrin deposition, capillary dilation, leukocyte migration, capillary proliferation, fibroblast proliferation, deposition of collagen, and scar formation associated with inflammation.
Gentamicin에 대한 Pharmacology 정보
Gentamicin is a broad spectrum aminoglycoside antibiotic. Aminoglycosides work by binding to the bacterial 30S ribosomal subunit, causing misreading of t-RNA, leaving the bacterium unable to synthesize proteins vital to its growth. Aminoglycosides are useful primarily in infections involving aerobic, Gram-negative bacteria, such as Pseudomonas, Acinetobacter, and Enterobacter. In addition, some mycobacteria, including the bacteria that cause tuberculosis, are susceptible to aminoglycosides. Infections caused by Gram-positive bacteria can also be treated with aminoglycosides, but other types of antibiotics are more potent and less damaging to the host. In the past the aminoglycosides have been used in conjunction with penicillin-related antibiotics in streptococcal infections for their synergistic effects, particularly in endocarditis. Aminoglycosides are mostly ineffective against anaerobic bacteria, fungi and viruses.
|
| Metabolism |
Fluorometholone에 대한 Metabolism 정보
# Phase_1_Metabolizing_Enzyme:Cytochrome P450 3A4 (CYP3A4)
|
| Protein Binding |
Fluorometholone에 대한 단백결합 정보
Not Available
Gentamicin에 대한 단백결합 정보
Low (between 0 and 30%)
|
| Half-life |
Fluorometholone에 대한 반감기 정보
Not Available
Gentamicin에 대한 반감기 정보
3-3½ hours in infants one week to six months of age; this increases to 5½ hours in full-term and large premature infants less than one week old.
|
| Absorption |
Fluorometholone에 대한 Absorption 정보
Not Available
Gentamicin에 대한 Absorption 정보
Injections lead to peak serum concentrations in 30-60 minutes. Topical gentamicin is readily absorbed from large burned, denuded, or granulating areas but not through intact skin. Absorption of gentamicin is faster and greater with the cream compared to the ointment. Gentamicin is absorbed in small quantities following topical application to the eye. Gentamicin is also absorbed in small amounts following topical application to the ear (especially if the eardrum is perforated or if tissue damage is present).
|
| Pharmacokinetics |
Gentamicin Sulfate의 약물동력학자료
- 흡수 : 경구 : 흡수되지 않는다.
- 분포 : 태반 통과
- 분포용적 : 부종이나 복수가 있거나 수액을 과다 투여했을 때 증가되고, 탈수시에 감소된다.
- 신생아 : 0.4-0.6 L/kg
- 소아 : 0.3-0.35 L/kg
- 성인 : 0.2-0.3 L/kg
표 1. 다양한 조직으로 분포된 정도 (혈액과의 비율 (%))
|
위치 |
분포 정도 |
|
눈 |
미미하다. |
|
중추신경계 |
미미하다.(25% 이하) |
|
흉막 |
우수하다 |
|
기관지 분비물 |
미미하다. |
|
타액 |
어느정도 분포된다.(10-50%) |
|
폐조직 |
우수하다. |
|
복수 |
다양하다.(43-132%) |
|
복막액 |
미미하다. |
|
담즙 |
다양하다.(25-90%) |
|
담도 패색시 답즙 |
미미하다. |
|
활액 |
우수하다. |
|
뼈 |
미미하다. |
|
전립선 |
미미하다. |
|
요 |
우수하다. |
|
신장조직 |
우수하다. |
- 뇌척수액으로의 분포는 뇌막에 염증이 있을 때도 미미하다.
- 뇌척수액 대 혈액의 농도비 (%)
- 단백결합 : 30% 이하
- 반감기 :
- 신생아
- 1주 이하 : 3-11.5 시간
- 1주-6개월 : 3-3.5 시간
- 성인 :
- 1.5-3 시간
- 말기 신질환 : 36-70 시간
- 혈중최고농도 도달시간 :
- 근육주사 : 30-90 분 이내
- 정맥주사 : 30분 주입 후 30분 이내
- 소실 : 클리러런스는 환자의 신기능에 의존한다. 대부분이 사구체 여과를 통해 미변화체로 신배설
Fluorometholone의 약물동력학자료
- 흡수 : 대부분은 방수(aqueous humor)로 흡수되고 소량이 전신흡수 된다.
|
| Biotransformation |
Fluorometholone에 대한 Biotransformation 정보
Not Available
|
| Toxicity |
Fluorometholone에 대한 Toxicity 정보
Side effects may include acute anterior uveitis and perforation of the globe. Keratitis, conjunctivitis, corneal ulcers, mydriasis, conjunctival hyperemia, loss of accommodation and ptosis have occasionally been reported following local use of corticosteroids. LD50 = 234 mg/kg (rats)
Gentamicin에 대한 Toxicity 정보
Mouse, intravenous LD50: 52 mg/kg; rat, intravenous LD50: 96 mg/kg.
|
| Drug Interactions |
Fluorometholone에 대한 Drug_Interactions 정보
Not Available
Gentamicin에 대한 Drug_Interactions 정보
Atracurium The agent increases the effect of muscle relaxantDoxacurium The agent increases the effect of muscle relaxantGallamine Triethiodide The agent increases the effect of muscle relaxantMetocurine The agent increases the effect of muscle relaxantMivacurium The agent increases the effect of muscle relaxantPancuronium The agent increases the effect of muscle relaxantPipecuronium The agent increases the effect of muscle relaxantRocuronium The agent increases the effect of muscle relaxantSuccinylcholine The agent increases the effect of muscle relaxantTubocurarine The agent increases the effect of muscle relaxantVecuronium The agent increases the effect of muscle relaxantBumetanide Increased ototoxicityEthacrynic acid Increased ototoxicityFurosemide Increased ototoxicityTorasemide Increased ototoxicityThalidomide Thalidomide increases the renal toxicity of the aminoglycosideCisplatin Increased risk of nephrotoxicityCefradine Increased risk of nephrotoxicityCephapirin Increased risk of nephrotoxicityCefamandole Increased risk of nephrotoxicityCefazolin Increased risk of nephrotoxicityCefonicid Increased risk of nephrotoxicityCefoperazone Increased risk of nephrotoxicityCeforanide Increased risk of nephrotoxicityCefotaxime Increased risk of nephrotoxicityCefotetan Increased risk of nephrotoxicityCefoxitin Increased risk of nephrotoxicityCeftazidime Increased risk of nephrotoxicityCeftizoxime Increased risk of nephrotoxicityCeftriaxone Increased risk of nephrotoxicityCefuroxime Increased risk of nephrotoxicityCephalothin Group Increased risk of nephrotoxicity
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Drug Target |
[Drug Target]
|
| Description |
Fluorometholone에 대한 Description 정보
A glucocorticoid employed, usually as eye drops, in the treatment of allergic and inflammatory conditions of the eye. It has also been used topically in the treatment of various skin disorders. (From Martindale, The Extra Pharmacopoeia, 30th ed, p732)
Gentamicin에 대한 Description 정보
A complex of three different closely related aminoglycoside sulfates, Gentamicins C1, C2, and C1(subA), obtained from Micromonospora purpurea and related species. They are broad-spectrum antibiotics, but may cause ear and kidney damage. They act to inhibit protein synthesis (genetic translation). [PubChem]
|
| Drug Category |
Fluorometholone에 대한 Drug_Category 정보
Anti-Allergic AgentsAnti-inflammatory AgentsGlucocorticoids
Gentamicin에 대한 Drug_Category 정보
Anti-Bacterial AgentsProtein Synthesis Inhibitors
|
| Smiles String Canonical |
Fluorometholone에 대한 Smiles_String_canonical 정보
CC1CC2C3CCC(O)(C(C)=O)C3(C)CC(O)C2(F)C2(C)C=CC(=O)C=C12
Gentamicin에 대한 Smiles_String_canonical 정보
CNC(C)C1CCC(N)C(O1)OC1C(N)CC(N)C(OC2OCC(C)(O)C(NC)C2O)C1O
|
| Smiles String Isomeric |
Fluorometholone에 대한 Smiles_String_isomeric 정보
C[C@H]1C[C@H]2[C@@H]3CC[C@](O)(C(C)=O)[C@@]3(C)C[C@H](O)[C@]2(F)[C@@]2(C)C=CC(=O)C=C12
Gentamicin에 대한 Smiles_String_isomeric 정보
CN[C@H](C)[C@@H]1CC[C@@H](N)[C@@H](O1)O[C@H]1[C@H](N)C[C@H](N)[C@@H](O[C@@H]2OC[C@@](C)(O)[C@H](NC)[C@H]2O)[C@@H]1O
|
| InChI Identifier |
Fluorometholone에 대한 InChI_Identifier 정보
InChI=1/C22H29FO4/c1-12-9-17-15-6-8-21(27,13(2)24)20(15,4)11-18(26)22(17,23)19(3)7-5-14(25)10-16(12)19/h5,7,10,12,15,17-18,26-27H,6,8-9,11H2,1-4H3/t12-,15-,17-,18-,19-,20-,21-,22-/m0/s1
Gentamicin에 대한 InChI_Identifier 정보
InChI=1/C21H43N5O7/c1-9(25-3)13-6-5-10(22)19(31-13)32-16-11(23)7-12(24)17(14(16)27)33-20-15(28)18(26-4)21(2,29)8-30-20/h9-20,25-29H,5-8,22-24H2,1-4H3
|
| Chemical IUPAC Name |
Fluorometholone에 대한 Chemical_IUPAC_Name 정보
(6S,8S,9R,10S,11S,13S,14S,17R)-17-acetyl-9-fluoro-11,17-dihydroxy-6,10,13-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one
Gentamicin에 대한 Chemical_IUPAC_Name 정보
2-[4,6-diamino-3-[3-amino-6-(1-methylaminoethyl)oxan-2-yl]oxy-2-hydroxycyclohexyl]oxy-5-methyl-4-methylaminooxane-3,5-diol
|
| Drug-Induced Toxicity Related Proteins |
GENTAMICIN 의 Drug-Induced Toxicity Related Protein정보
Replated Protein:Phospholipase A
Drug:gentamicin
Toxicity:aminoglycoside toxicity.
[바로가기]
Replated Protein:phospholipases C
Drug:gentamicin
Toxicity:aminoglycoside toxicity.
[바로가기]
Replated Protein:Angiotensinase A
Drug:gentamicin
Toxicity:important consequences upon renal function and metabolism.
[바로가기]
Replated Protein:Dipeptidylpeptidase IV
Drug:gentamicin
Toxicity:important consequences upon renal function and metabolism.
[바로가기]
Replated Protein:Sodium/potassium-transporting ATPase
Drug:Gentamicin
Toxicity:necrosis.
[바로가기]
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2021-12-09
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
[의약품병용/연령대금기 고시근거로 바로가기] 제목 없음
2008년 8월 1일 약가화일상 8월달 신규등재 및 삭제되는 품목 포함한 병용연령 금기 품목리스트 기준
1. 현재 검색한 제품에 대한 병용금기 제품 존재여부 및 검색
현재 이제품에 대한 병용금기에 해당하는 청구코드별 제품내역 공지내용이 없습니다
2. 연령대금기 존재여부
현재 이제품에 대한 연령금기에 해당하는 청구코드별 공지내용이 없습니다
|
|
|
|
전문/일반
내용보기
