| |
|
|
|
|
|
 |
| |
|
µð°ÕŸÁ¡¾È¾× DIGENTA EYE.[Fluorometholone , Gentamicin Sulfate]
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
645300240[A37850811]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1ml(2016.10.01)(ÇöÀç¾à°¡)
\460 ¿ø/1ml(2014.02.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹«»öÅõ¸íÇÑ º´¿¡ µç ¹«»ö ¶Ç´Â ¹ÌȲ»öÀÇ Çöʼº Á¡¾È¾×
[Á¦ÇüÁ¤º¸ È®ÀÎ]
|
| Æ÷À塤À¯Åë´ÜÀ§ |
ÀÚ»çÆ÷Àå´ÜÀ§¿¡ µû¸§ |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 5¹Ð¸®¸®ÅÍ |
1 °³ |
8806453002408 |
8806453002439 |
ºñ¸Åǰ |
| 5¹Ð¸®¸®ÅÍ |
1 °³ |
8806453002408 |
8806453002422 |
¼öÃâ¿ë |
|
| ÁÖ¼ººÐÄÚµå |
332200COS
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| ´ëÇ¥ÄÚµå |
8806453002408 |
| º¸°ü¹æ¹ý |
±â¹Ð¿ë±â, »ó¿Â(15~25¡É)º¸°ü |
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
․°ÕŸ¸¶À̽ſ¡ °¨¼ö¼º±Õ¿¡ ÀÇÇÑ Àü¾ÈºÎ °¨¿°(¿¹ : ¼¼±Õ¼º°á¸·¿°)
․¼¼±Õ°¨¿°ÀÇ À§Ç輺ÀÌ ÀÖ´Â Àü¾ÈºÎ ¿°Áõ(¿¹ : ´« ¼ö¼ú ÈÄ Ä¡·á½Ã)
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
․¼¼±Õ¼º °¨¿°(¿¹ : ¼¼±Õ¼º °á¸·¿°) : °¨¿°ÀÇ Á¤µµ¿¡ µû¶ó Á¶ÀýÇÑ´Ù. °¨¿°µÈ ´«¿¡ 1ȸ 1¹æ¿ï 1ÀÏ 5ȸ Á¡¾ÈÇÑ´Ù. ÁßÁõÀÎ °æ¿ì¿¡´Â 1-2Àϰ£, 1½Ã°£¸¶´Ù 1¹æ¿ï¾¿ Áõ·®ÇÒ ¼ö ÀÖ´Ù.
․´« ¼ö¼ú ÈÄ Ä¡·á½Ã : ¼ö¼úÇÑ ´«¿¡ 1ȸ 1¹æ¿ï 1ÀÏ 4ȸ 1ÁÖÀϰ£ Á¡¾ÈÇÑ´Ù. ±× Èķδ Àû¿ë Ƚ¼ö¸¦ ÁÙÀÌ´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù.
|
| ÁÖ¿ä¾à¹° »óÈ£ÀÛ¿ë |
[º¸±â]
|
| ±Ý±â |
1) °ÕŸ¸¶À̽Å, Ç÷ç¿À·Î¸ÞÅç·Ð, ¿°Èº¥ÀßÄÚ´½ ¶Ç´Â ±× ¿Ü ÀÌ ¾à ¼ººÐ¿¡ °ú¹ÎÁõÀÇ º´·ÂÀÌ Àִ ȯÀÚ
2) °¢¸· ¼Õ»ó ¹× ±Ë¾ç ȯÀÚ
3) ¹ÙÀÌ·¯½º¼º °¨¿°(¿¹: ´Ü¼øÆ÷Áø, ¿ìµÎ) ¶Ç´Â Áø±Õ°¨¿° ȯÀÚ
4) ¾È°áÇ٠ȯÀÚ
5) ³ì³»Àå ȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
1) Á¡¾È½Ã ÀϽÃÀûÀÎ ÀÛ¿°¨ÀÌ ¼Ò¼öÀÇ È¯ÀÚ¿¡¼ º¸°íµÇ¾úÀ¸¸ç µå¹°°Ô °¡·Á¿ò, ¹ßÀû, ±¤°ú¹ÎÁõ°ú °°Àº °ú¹Î ¹ÝÀÀÀÌ ³ªÅ¸³µ´Ù.
2) ÷°¡Á¦ : ÀÌ ¾àÀº Àλ꿰À» Æ÷ÇÔÇϰí ÀÖ´Ù.
»ó´çÇÑ °¢¸· ¼Õ»óÀÌ ÀÖ´Â ÀϺΠȯÀÚ¿¡¼ Àλ꿰 ÇÔÀ¯ Á¡¾È¾×ÀÇ »ç¿ë°ú ¿¬°üµÇ¾î °¢¸· ¼®È¸ÈÀÇ »ç·Ê°¡ ¸Å¿ì µå¹°°Ô(0.01% ¹Ì¸¸) º¸°íµÈ ¹Ù ÀÖ´Ù.
|
| ÀϹÝÀû ÁÖÀÇ |
1) Ç÷ç¿À·Î¸ÞÅç·ÐÀº ´Ù¸¥ ½ºÅ×·ÎÀ̵åÁ¦¿¡ ºñÇØ ºÎÀÛ¿ë ¹ß»ýºóµµ°¡ ÈξÀ ÀûÁö¸¸, ½ºÅ×·ÎÀ̵åÁ¦ÀÇ ¿¬¿ëÀº ¾È¾ÐÀÇ º´ÀûÀÎ »ó½ÂÀ» À¯¹ßÇÒ ¼ö ÀÖ´Ù. ƯÈ÷ ¿¬¿ëÇÒ °æ¿ì¿¡´Â ¹Ýµå½Ã Á¤±âÀûÀ¸·Î ¾È¾Ð°Ë»ç¸¦ ÇÑ´Ù.
2) ±¹¼Ò ½ºÅ×·ÎÀ̵åÁ¦¸¦ ÁýÁßÀûÀ¸·Î ¿¬¿ëÇÏ´Â ¿ä¹ýÀº Èij¶ÇϹ鳻ÀåÀ» ÀÏÀ¸Å°´Â ¿äÀÎÀÌ µÉ ¼ö ÀÖ´Ù.
3) ½ºÅ×·ÎÀ̵åÁ¦¸¦ ³»¾È¼ö¼ú ÈÄ ¹Ù·Î Àû¿ëÇÒ °æ¿ì »óóġÀ¯°¡ Áö¿¬µÉ ¼ö ÀÖ´Ù.
4) ½ºÅ×·ÎÀ̵åÁ¦ ¶Ç´Â Ç×»ý¹°ÁúÀÇ Àå±âÅõ¿©´Â ÀÌÂ÷ÀûÀÎ Áø±Õ°¨¿°À̳ª ºñ°¨¼ö¼º¼¼±Õ °¨¿°À» À¯¹ßÇÒ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ º¹ÇÕÁ¦¸¦ 2ÁÖ ÀÌ»ó Àû¿ëÇØ¼´Â ¾ÈµÈ´Ù. ¶ÇÇÑ Áö¼ÓÀûÀ¸·Î °¢¸·±Ë¾çÀÌ ÀÖÀ» ¶§¿¡´Â Áø±Õ°¨¿°À» ÀǽÉÇÑ´Ù.
5) ½ºÅ×·ÎÀ̵åÁ¦ÀÇ Àå±â¿¬¿ëÀ¸·Î °¢¸·°ú °ø¸·ÀÌ ¿¯¾îÁö°Å³ª, µå¹°°Ô °¢¸·ÀÇ Ãµ°øÀÌ ³ªÅ¸³ ¿¹°¡ º¸°íµÇ¾ú´Ù. °¢¸·ÀÇ µÎ²²¸¦ ÀÚÁÖ Àç¾îº¸´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù.
6) °ÕŸ¸¶À̽ÅÀÌ °¢¸·»óÇÇÀÇ Ä¡À¯¸¦ Áö¿¬½Ãų ¼öµµ ÀÖÀ¸³ª, ´ÜÁö °í³óµµ Åõ¿©¿¡¼¸¸ °üÂûµÇ¾îÁø´Ù.
7) 7-8Àϰ£ÀÇ Åõ¿©·Î ¾Æ¹«·± °³¼±ÀÌ ¾øÀ¸¸é ´Ù¸¥ Ä¡·á¹æ¹ýÀ» °í·ÁÇÑ´Ù.
8)ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀ̵åÀÇ Àü½ÅÀû ÀÌ»ó¹ÝÀÀÀº ¾î¸°ÀÌ ¹× CYP3A4 ÀúÇØÁ¦(¸®Å䳪ºñ¸£ ¶Ç´Â ÄÚºñ½Ã½ºÅ¸Æ® Æ÷ÇÔ)Ä¡·á¸¦ ¹ÞÀº ȯÀÚ¿Í °°ÀÌ Ãë¾àÇÑ È¯ÀÚ°¡ ¾È°ú¿ë ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀ̵带 ÁýÁßÄ¡·á ¶Ç´Â Àå±âÄ¡·á¸¦ ¹ÞÀº ÈÄ¿¡ ¹ß»ýÇÒ ¼ö ÀÖ´Ù. |
| »óÈ£ÀÛ¿ë |
1)´Ù¸¥ ¾È°ú¿ë¾à°ú °°ÀÌ Àû¿ëÇØ¾ß ÇÒ ¶§¿¡´Â °¢°¢ÀÇ ÁÖ¼ººÐÀÌ ¾Ä°Ü³ª°¡Áö ¾Êµµ·Ï Çϱâ À§ÇØ Àû¾îµµ 5ºÐÀÇ °£°ÝÀ» µÎ°í Àû¿ëÇØ¾ß ÇÑ´Ù. °ÕŸ¸¶À̽ÅÀ» ¾ÏÆ÷Å׸®½ÅB, ÇìÆÄ¸°, ¼³ÆÄµð¾ÆÁø, ¼¼ÆÈ·ÎÄ£, Ŭ·Ï»ç½Ç¸°°ú º´¿ëÅõ¿©ÇÏ¸é ´«¿¡ º¸ÀÏ Á¤µµÀÇ Ä§ÀüÀÌ »ý±æ ¼ö ÀÖ´Ù.
2)CYP3A4 ÀúÇØÁ¦ (¸®Å䳪ºñ¸£ ¶Ç´Â ÄÚºñ½Ã½ºÅ¸Æ® Æ÷ÇÔ)¿Í º´¿ë Åõ¿©½Ã Àü½Å ³ëÃâÀÌ Áõ°¡µÇ¾î, Àü½ÅÀû ÀÌ»ó ¹ÝÀÀ ¹ß»ý À§ÇèÀÌ Áõ°¡ÇÒ ¼ö ÀÖ´Ù. Ä¡·á»óÀÇ À¯ÀͼºÀÌ Àü½Å ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀ̵å ÀÌ»ó¹ÝÀÀ ¹ß»ýÀÇ À§Ç輺À» »óȸÇÑ´Ù°í ÆÇ´ÜµÇ´Â °æ¿ì¿¡¸¸ º´¿ë Åõ¿©Çϸç, ȯÀÚÀÇ Àü½Å ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀÌµå ¿µÇâÀ» »ìÆì¾ß ÇÑ´Ù.
|
| ÀӺο¡ ´ëÇÑ Åõ¿© |
[ÀӺαݱ⠼ººÐ Á¶È¸]
µ¿¹°½ÇÇè °á°ú ÅÂÀÚ¿¡ ¹Ù¶÷Á÷ÇÏÁö ¸øÇÑ È¿°ú¸¦ ³ªÅ¸³»¾ú´Ù. Ç÷ç¿À·Î¸ÞÅç·ÐÀº ´ë·®Åõ¿©½Ã ±âÇü¹ß»ý°ú ¹èÀÚµ¶¼ºÀ» ³ªÅ¸³»´Â ¹°Áú·Î ¾Ë·ÁÁ® ÀÖÀ¸¸ç »ç¶÷¿¡ ´ëÇÑ ¿¬±¸°á°ú´Â ¾ø´Ù. ÀӺΠ¹× ¼öÀ¯ºÎ¿¡´Â Ä¡·á»óÀÇ À¯ÀͼºÀÌ À§Ç輺À» »óȸÇÑ´Ù°í ÆÇ´ÜµÇ´Â °æ¿ì¿¡¸¸ Åõ¿©ÇÑ´Ù.
|
| Àû¿ë»óÀÇ ÁÖÀÇ |
1) Åõ¿©Àü°ú Åõ¿©ÈÄ 5ºÐÁ¤µµ´Â ÄÜÅÃÆ®·»ÁîÀÇ Âø¿ëÀ» ÇÇÇØ¾ß ÇÑ´Ù. ´« °¨¿°½Ã¿¡´Â °¨¿°ÀÌ È®´ëµÉ À§Ç輺ÀÌ Àֱ⠶§¹®¿¡ ¼öÀϰ£ ÄÜÅÃÆ®·»Á Âø¿ëÇÏÁö ¾Ê¾Æ¾ß ÇÑ´Ù.
2) Èçµé¾î¼ »ç¿ëÇÑ´Ù.
3) Á¡¾È¿ëÀ¸·Î¸¸ »ç¿ëÇÑ´Ù.
4) Á¡¾È½Ã ¿ë±âÀÇ ÀÔ±¸°¡ Á÷Á¢ ´«¿¡ ´êÁö ¾Êµµ·Ï ÁÖÀÇÇÑ´Ù.
5) ¿À¿°À» ¹æÁöÇϱâ À§ÇØ µÉ ¼ö ÀÖ´Â ÇÑ °øµ¿À¸·Î »ç¿ëÇÏÁö ¾Ê´Â´Ù.
|
| °ú·®Åõ¿© ¹× óġ |
±¹¼ÒÀû °ú·®Åõ¿©½Ã »ý¸®½Ä¿°¼ö ¶Ç´Â ¹°·Î ¾Ä¾î³½´Ù.
|
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
1) ¼Ò¾ÆÀÇ ¼ÕÀÌ ´êÁö ¾Ê´Â °÷¿¡ º¸°üÇÑ´Ù.
2) 15-25¡É¿¡¼ º¸°üÇÏ°í »ç¿ë ÈÄ Áï½Ã º´À̳ª Æ©ºê¸¦ Àá±Å¾ß ÇÑ´Ù.
3) Á÷»çÀϱ¤À» ÇÇÇÏ°í µÇµµ·Ï(½À±â°¡ ÀûÀº)¼´ÃÇÑ °÷¿¡(¹ÐÀüÇÏ¿©) º¸°üÇÑ´Ù[°ýÈ£³»´Â ÇÊ¿ä½Ã¿¡ ±âÀçÇÑ´Ù.].
4) °³ºÀ ÈÄ ÇÑ´ÞÀÌ»ó »ç¿ëÇÏÁö ¾Ê´Â´Ù.
5) ¿À¿ëÀ» ¸·°í ǰÁúÀÇ º¸Á¸À» À§ÇÏ¿© ´Ù¸¥ ¿ë±â¿¡ ¹Ù²Ù¾î ³ÖÁö ¾Ê´Â´Ù.
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Á¦Çüº° º¹¾àÁöµµ |
[Á¡¾È¾×] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Fluorometholone¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ There is no generally accepted explanation for the mechanism of action of ocular corticosteroids. However, corticosteroids are thought to act by the induction of phospholipase A2 inhibitory proteins, collectively called lipocortins. It is postulated that these proteins control the biosynthesis of potent mediators of inflammation such as prostaglandins and leukotrienes by inhibiting the release of their common precursor, arachidonic acid. Arachidonic acid is released from membrane phospholipids by phospholipase A2.
Gentamicin¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Aminoglycosides like gentamicin "irreversibly" bind to specific 30S-subunit proteins and 16S rRNA. Specifically gentamicin binds to four nucleotides of 16S rRNA and a single amino acid of protein S12. This interferes with decoding site in the vicinity of nucleotide 1400 in 16S rRNA of 30S subunit. This region interacts with the wobble base in the anticodon of tRNA. This leads to interference with the initiation complex, misreading of mRNA so incorrect amino acids are inserted into the polypeptide leading to nonfunctional or toxic peptides and the breakup of polysomes into nonfunctional monosomes.
|
| Pharmacology |
Fluorometholone¿¡ ´ëÇÑ Pharmacology Á¤º¸ Corticosteroids such as fluorometholone inhibit the inflammatory response to a variety of inciting agents and probably delay or slow healing. They inhibit the edema, fibrin deposition, capillary dilation, leukocyte migration, capillary proliferation, fibroblast proliferation, deposition of collagen, and scar formation associated with inflammation.
Gentamicin¿¡ ´ëÇÑ Pharmacology Á¤º¸ Gentamicin is a broad spectrum aminoglycoside antibiotic. Aminoglycosides work by binding to the bacterial 30S ribosomal subunit, causing misreading of t-RNA, leaving the bacterium unable to synthesize proteins vital to its growth. Aminoglycosides are useful primarily in infections involving aerobic, Gram-negative bacteria, such as Pseudomonas, Acinetobacter, and Enterobacter. In addition, some mycobacteria, including the bacteria that cause tuberculosis, are susceptible to aminoglycosides. Infections caused by Gram-positive bacteria can also be treated with aminoglycosides, but other types of antibiotics are more potent and less damaging to the host. In the past the aminoglycosides have been used in conjunction with penicillin-related antibiotics in streptococcal infections for their synergistic effects, particularly in endocarditis. Aminoglycosides are mostly ineffective against anaerobic bacteria, fungi and viruses.
|
| Metabolism |
Fluorometholone¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 3A4 (CYP3A4)
|
| Protein Binding |
Fluorometholone¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Not Available
Gentamicin¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Low (between 0 and 30%)
|
| Half-life |
Fluorometholone¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ Not Available
Gentamicin¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 3-3¨ö hours in infants one week to six months of age; this increases to 5¨ö hours in full-term and large premature infants less than one week old.
|
| Absorption |
Fluorometholone¿¡ ´ëÇÑ Absorption Á¤º¸ Not Available
Gentamicin¿¡ ´ëÇÑ Absorption Á¤º¸ Injections lead to peak serum concentrations in 30-60 minutes. Topical gentamicin is readily absorbed from large burned, denuded, or granulating areas but not through intact skin. Absorption of gentamicin is faster and greater with the cream compared to the ointment. Gentamicin is absorbed in small quantities following topical application to the eye. Gentamicin is also absorbed in small amounts following topical application to the ear (especially if the eardrum is perforated or if tissue damage is present).
|
| Pharmacokinetics |
Gentamicin SulfateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : °æ±¸ : Èí¼öµÇÁö ¾Ê´Â´Ù.
- ºÐÆ÷ : ÅÂ¹Ý Åë°ú
- ºÐÆ÷¿ëÀû : ºÎÁ¾À̳ª º¹¼ö°¡ Àְųª ¼ö¾×À» °ú´Ù Åõ¿©ÇßÀ» ¶§ Áõ°¡µÇ°í, Å»¼ö½Ã¿¡ °¨¼ÒµÈ´Ù.
- ½Å»ý¾Æ : 0.4-0.6 L/kg
- ¼Ò¾Æ : 0.3-0.35 L/kg
- ¼ºÀÎ : 0.2-0.3 L/kg
Ç¥ 1. ´Ù¾çÇÑ Á¶Á÷À¸·Î ºÐÆ÷µÈ Á¤µµ (Ç÷¾×°úÀÇ ºñÀ² (%))
|
À§Ä¡ |
ºÐÆ÷ Á¤µµ |
|
´« |
¹Ì¹ÌÇÏ´Ù. |
|
ÁßÃ߽Űæ°è |
¹Ì¹ÌÇÏ´Ù.(25% ÀÌÇÏ) |
|
È丷 |
¿ì¼öÇÏ´Ù |
|
±â°üÁö ºÐºñ¹° |
¹Ì¹ÌÇÏ´Ù. |
|
Ÿ¾× |
¾î´ÀÁ¤µµ ºÐÆ÷µÈ´Ù.(10-50%) |
|
ÆóÁ¶Á÷ |
¿ì¼öÇÏ´Ù. |
|
º¹¼ö |
´Ù¾çÇÏ´Ù.(43-132%) |
|
º¹¸·¾× |
¹Ì¹ÌÇÏ´Ù. |
|
´ãÁó |
´Ù¾çÇÏ´Ù.(25-90%) |
|
´ãµµ ÆÐ»ö½Ã ´äÁó |
¹Ì¹ÌÇÏ´Ù. |
|
Ȱ¾× |
¿ì¼öÇÏ´Ù. |
|
»À |
¹Ì¹ÌÇÏ´Ù. |
|
Àü¸³¼± |
¹Ì¹ÌÇÏ´Ù. |
|
¿ä |
¿ì¼öÇÏ´Ù. |
|
½ÅÀåÁ¶Á÷ |
¿ì¼öÇÏ´Ù. |
- ³úô¼ö¾×À¸·ÎÀÇ ºÐÆ÷´Â ³ú¸·¿¡ ¿°ÁõÀÌ ÀÖÀ» ¶§µµ ¹Ì¹ÌÇÏ´Ù.
- ³úô¼ö¾× ´ë Ç÷¾×ÀÇ ³óµµºñ (%)
- Á¤»ó ³ú¸· : 0
- ¿°Áõ¼º ³ú¸· : 10-30
- ´Ü¹é°áÇÕ : 30% ÀÌÇÏ
- ¹Ý°¨±â :
- ½Å»ý¾Æ
- 1ÁÖ ÀÌÇÏ : 3-11.5 ½Ã°£
- 1ÁÖ-6°³¿ù : 3-3.5 ½Ã°£
- ¼ºÀÎ :
- 1.5-3 ½Ã°£
- ¸»±â ½ÅÁúȯ : 36-70 ½Ã°£
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ :
- ±ÙÀ°ÁÖ»ç : 30-90 ºÐ À̳»
- Á¤¸ÆÁÖ»ç : 30ºÐ ÁÖÀÔ ÈÄ 30ºÐ À̳»
- ¼Ò½Ç : Ŭ¸®·¯·±½º´Â ȯÀÚÀÇ ½Å±â´É¿¡ ÀÇÁ¸ÇÑ´Ù. ´ëºÎºÐÀÌ »ç±¸Ã¼ ¿©°ú¸¦ ÅëÇØ ¹Ìº¯Èü·Î ½Å¹è¼³
FluorometholoneÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : ´ëºÎºÐÀº ¹æ¼ö(aqueous humor)·Î Èí¼öµÇ°í ¼Ò·®ÀÌ Àü½ÅÈí¼ö µÈ´Ù.
|
| Biotransformation |
Fluorometholone¿¡ ´ëÇÑ Biotransformation Á¤º¸ Not Available
|
| Toxicity |
Fluorometholone¿¡ ´ëÇÑ Toxicity Á¤º¸ Side effects may include acute anterior uveitis and perforation of the globe. Keratitis, conjunctivitis, corneal ulcers, mydriasis, conjunctival hyperemia, loss of accommodation and ptosis have occasionally been reported following local use of corticosteroids. LD50 = 234 mg/kg (rats)
Gentamicin¿¡ ´ëÇÑ Toxicity Á¤º¸ Mouse, intravenous LD50: 52 mg/kg; rat, intravenous LD50: 96 mg/kg.
|
| Drug Interactions |
Fluorometholone¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
Gentamicin¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Atracurium The agent increases the effect of muscle relaxantDoxacurium The agent increases the effect of muscle relaxantGallamine Triethiodide The agent increases the effect of muscle relaxantMetocurine The agent increases the effect of muscle relaxantMivacurium The agent increases the effect of muscle relaxantPancuronium The agent increases the effect of muscle relaxantPipecuronium The agent increases the effect of muscle relaxantRocuronium The agent increases the effect of muscle relaxantSuccinylcholine The agent increases the effect of muscle relaxantTubocurarine The agent increases the effect of muscle relaxantVecuronium The agent increases the effect of muscle relaxantBumetanide Increased ototoxicityEthacrynic acid Increased ototoxicityFurosemide Increased ototoxicityTorasemide Increased ototoxicityThalidomide Thalidomide increases the renal toxicity of the aminoglycosideCisplatin Increased risk of nephrotoxicityCefradine Increased risk of nephrotoxicityCephapirin Increased risk of nephrotoxicityCefamandole Increased risk of nephrotoxicityCefazolin Increased risk of nephrotoxicityCefonicid Increased risk of nephrotoxicityCefoperazone Increased risk of nephrotoxicityCeforanide Increased risk of nephrotoxicityCefotaxime Increased risk of nephrotoxicityCefotetan Increased risk of nephrotoxicityCefoxitin Increased risk of nephrotoxicityCeftazidime Increased risk of nephrotoxicityCeftizoxime Increased risk of nephrotoxicityCeftriaxone Increased risk of nephrotoxicityCefuroxime Increased risk of nephrotoxicityCephalothin Group Increased risk of nephrotoxicity
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Fluorometholone¿¡ ´ëÇÑ Description Á¤º¸ A glucocorticoid employed, usually as eye drops, in the treatment of allergic and inflammatory conditions of the eye. It has also been used topically in the treatment of various skin disorders. (From Martindale, The Extra Pharmacopoeia, 30th ed, p732)
Gentamicin¿¡ ´ëÇÑ Description Á¤º¸ A complex of three different closely related aminoglycoside sulfates, Gentamicins C1, C2, and C1(subA), obtained from Micromonospora purpurea and related species. They are broad-spectrum antibiotics, but may cause ear and kidney damage. They act to inhibit protein synthesis (genetic translation). [PubChem]
|
| Drug Category |
Fluorometholone¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Allergic AgentsAnti-inflammatory AgentsGlucocorticoids
Gentamicin¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Bacterial AgentsProtein Synthesis Inhibitors
|
| Smiles String Canonical |
Fluorometholone¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC1CC2C3CCC(O)(C(C)=O)C3(C)CC(O)C2(F)C2(C)C=CC(=O)C=C12
Gentamicin¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CNC(C)C1CCC(N)C(O1)OC1C(N)CC(N)C(OC2OCC(C)(O)C(NC)C2O)C1O
|
| Smiles String Isomeric |
Fluorometholone¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@H]1C[C@H]2[C@@H]3CC[C@](O)(C(C)=O)[C@@]3(C)C[C@H](O)[C@]2(F)[C@@]2(C)C=CC(=O)C=C12
Gentamicin¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CN[C@H](C)[C@@H]1CC[C@@H](N)[C@@H](O1)O[C@H]1[C@H](N)C[C@H](N)[C@@H](O[C@@H]2OC[C@@](C)(O)[C@H](NC)[C@H]2O)[C@@H]1O
|
| InChI Identifier |
Fluorometholone¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C22H29FO4/c1-12-9-17-15-6-8-21(27,13(2)24)20(15,4)11-18(26)22(17,23)19(3)7-5-14(25)10-16(12)19/h5,7,10,12,15,17-18,26-27H,6,8-9,11H2,1-4H3/t12-,15-,17-,18-,19-,20-,21-,22-/m0/s1
Gentamicin¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C21H43N5O7/c1-9(25-3)13-6-5-10(22)19(31-13)32-16-11(23)7-12(24)17(14(16)27)33-20-15(28)18(26-4)21(2,29)8-30-20/h9-20,25-29H,5-8,22-24H2,1-4H3
|
| Chemical IUPAC Name |
Fluorometholone¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (6S,8S,9R,10S,11S,13S,14S,17R)-17-acetyl-9-fluoro-11,17-dihydroxy-6,10,13-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one
Gentamicin¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 2-[4,6-diamino-3-[3-amino-6-(1-methylaminoethyl)oxan-2-yl]oxy-2-hydroxycyclohexyl]oxy-5-methyl-4-methylaminooxane-3,5-diol
|
| Drug-Induced Toxicity Related Proteins |
GENTAMICIN ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Phospholipase A Drug:gentamicin Toxicity:aminoglycoside toxicity. [¹Ù·Î°¡±â] Replated Protein:phospholipases C Drug:gentamicin Toxicity:aminoglycoside toxicity. [¹Ù·Î°¡±â] Replated Protein:Angiotensinase A Drug:gentamicin Toxicity:important consequences upon renal function and metabolism. [¹Ù·Î°¡±â] Replated Protein:Dipeptidylpeptidase IV Drug:gentamicin Toxicity:important consequences upon renal function and metabolism. [¹Ù·Î°¡±â] Replated Protein:Sodium/potassium-transporting ATPase Drug:Gentamicin Toxicity:necrosis. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-12-02
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|