| |
|
|
|
|
|
 |
| |
|
Æú·ÎÁ¡¾ÈÁ¦ POLO EYE.[Dipotassium glycyrrhizinate , Sulfamethoxazole sodium]
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
[A02302691]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1ml(2005.06.01)(ÇöÀç¾à°¡)
\99 ¿ø/1ml(2003.01.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁý ´Ù¿î·Îµå]
[¿ì¸®Áý°Ç°ÁÖÄ¡ÀÇ ¹Ù·Î°¡±â]
|
| ºü¸¥Á¶È¸ |
|
| Æ÷À塤À¯Åë´ÜÀ§ |
15ML |
| ¾à¸®ÀÛ¿ë |
[Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
°á¸·¿°(À¯Ç༺ °á¸·¿°), ´Ù·¡³¢, ¾È°Ë¿°(´«²¨Ç®ÀÇ Áø¹«¸§), ´«ÀÇ °¡·Á¿ò
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
[ÁÖ¼ººÐÄÚµå:332500COS ¿¡ µû¸¥ ½É»çÁöħ¿¶÷]
1ȸ 1-3Àû, 1ÀÏ 3-6ȸ Á¡¾ÈÇÑ´Ù.
[Á¦Çüº°º¹¾àÁöµµ]
|
| ÁÖ¿ä¾à¹° »óÈ£ÀÛ¿ë |
[º¸±â]
|
| ½ÅÁßÅõ¿© |
´«ÀÇ ÅëÁõÀÌ ½ÉÇÑ È¯ÀÚ, Áö±Ý±îÁö ¼³ÆÄÁ¦¿¡ ÀÇÇØ ¾Ë·¯Áö Áõ»ó(¿¹¸¦ µé¸é ¹ßÁø, ¹ßÀû, °¡·Á¿ò, ¿À½É, ¹ß¿ µî) ±â¿Õ·ÂÀÚ, Áö±Ý±îÁö ¾È¾à¿¡ ÀÇÇÑ ¾Ë·¯Áö Áõ»ó(¿¹¸¦ µé¾î ´«ÀÇ ÃæÇ÷, °¡·Á¿ò, ºÎÁ¾, ¹ßÁø, ¹ßÀû µî) ±â¿Õ·ÂÀÚ, ÀÇ»çÀÇ Ä¡·á¸¦ ¹Þ°í Àִ ȯÀÚ |
| ÀÌ»ó¹ÝÀÀ |
º»Á¦ÀÇ Åõ¿©¿¡ ÀÇÇØ ´«ÀÇ ÃæÇ÷, °¡·Á¿ò, ºÎÁ¾ µîÀÇ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇÑ´Ù.
|
| ÀϹÝÀû ÁÖÀÇ |
- Á¤ÇØÁø ¿ë¹ý¡¤¿ë·®À» Àß ÁöŲ´Ù.
- 3, 4Àϰ£ Åõ¿©ÈÄ¿¡µµ Áõ»óÀÇ °³¼±ÀÌ º¸ÀÌÁö ¾ÊÀ» ¶§¿¡´Â Åõ¿©¸¦ ÁßÁöÇÏ°í µÇµµ·Ï »¡¸® ÀÇ»çÀÇ Ä¡·á¸¦ ¹Þ´Â´Ù.
- Àå±â°£ °è¼ÓÇÏ¿© Åõ¿©ÇÏÁö ¾Ê´Â´Ù.
- ´Ù·¡³¢ÀÎ °æ¿ì¿¡´Â ´«²¨Ç®À» ºñºñµçÁö ±× ¿Ü, ´«¿¡ ÀÚ±ØÀ» °¡ÇÏÁö ¾Êµµ·Ï ÁÖÀÇÇÑ´Ù(¶ÇÇÑ ´Ù·¡³¢´Â üÁúÀûÀ¸·Î »ý±â±â ½¬¿î °æ¿ì°¡ ÀÖ±â´Â Çϳª, ÇǷγª ¼ö¸éºÎÁ· µîÀ¸·Î ÀÎÇØ ü·ÂÀÌ ÀúÇÏµÈ ¶§ »ý±â±â ½¬¿ì¹Ç·Î È޽İú ¼ö¸éÀ» ÃæºÐÈ÷ ÃëÇϵµ·Ï À¯ÀÇÇÑ´Ù).
|
| Àû¿ë»óÀÇ ÁÖÀÇ |
- Á¡¾È¿ëÀ¸·Î¸¸ »ç¿ëÇÑ´Ù.
- ¼ÒÇÁÆ®ÄÜÅÃÆ®·»ÁîÀÇ ÀåÂø¾×À¸·Î ¶ÇÇÑ ¼ÒÇÁÆ®ÄÜÅÃÆ®·»Á Âø¿ëÇÑ Ã¤ »ç¿ëÇÏÁö ¾Ê´Â´Ù.
- ¿ë±âÀÇ ³¡ÀÌ ´«²¨Ç® ¹× ¼Õ´«½ç¿¡ ´êÀ¸¸é ´«°öÀ̳ª Áø±Õ µî¿¡ ÀÇÇØ ¾à¾×ÀÌ ¿À¿° ¶Ç´Â ȥŹµÉ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù. ¶ÇÇÑ È¥Å¹µÈ °ÍÀº »ç¿ëÇÏÁö ¾Ê´Â´Ù.
- ¿À¿°À» ¹æÁöÇϱâ À§ÇØ µÉ ¼ö ÀÖ´Â ÇÑ °øµ¿À¸·Î »ç¿ëÇÏÁö ¾Ê´Â´Ù.
|
| º¸°ü ¹× Ãë±Þ»óÀÇ ÁÖÀÇ |
- ¼Ò¾ÆÀÇ ¼ÕÀÌ ´êÁö ¾Ê´Â °÷¿¡ º¸°üÇÑ´Ù.
- Á÷»çÀϱ¤À» ÇÇÇϰí (½À±â°¡ ÀûÀº) ¼´ÃÇÑ °÷¿¡(¹ÐÀüÇÏ¿©) º¸°üÇÑ´Ù.
- ¿À¿ëÀ» ¸·°í ǰÁúÀÇ º¸Á¸À» À§ÇÏ¿© ´Ù¸¥ ¿ë±â¿¡ ¹Ù²Ù¾î ³ÖÁö ¾Ê´Â´Ù.
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| Á¦Çüº° º¹¾àÁöµµ |
[Á¡¾È¾×] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Potassium¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Sulfamethoxazole¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Sulfonamides inhibit bacterial dihydrofolate synthetase, causing interference in the conversion of p-aminobenzoic acid (PABA) into folic acid. As folic acid is a coenzyme responsible for the transport of one-carbon fragments from one molecule to another, it is an essential component of bacterial development. Pyrimethamine and trimethoprim inhibit dihydrofolate reductase, the immediate next step, and therefore act synergistically with the sulfonamides.
|
| Pharmacology |
Sulfamethoxazole¿¡ ´ëÇÑ Pharmacology Á¤º¸ Sulfamethoxazole is a sulfonamide drug that inhibits bacterial synthesis of dihydrofolic acid by competing with para-aminobenzoic acid (PABA). Sulfamethoxazole is normally given in combination with Trimethoprim (a dihydrofolate reductase inhibitor). Studies have shown that bacterial resistance develops more slowly with the combination of the two drugs than with either Trimethoprim or Sulfamethoxazole alone.
|
| Protein Binding |
Sulfamethoxazole¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 70%
|
| Half-life |
Sulfamethoxazole¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 10 hours
|
| Absorption |
Sulfamethoxazole¿¡ ´ëÇÑ Absorption Á¤º¸ Rapidly absorbed following oral administration.
|
| Pharmacokinetics |
Sulfamethoxazole sodiumÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- »ýü³»ÀÌ¿ë·ü : °æ±¸ : 90%
- ºÐÆ÷ : ŹÝÅë°ú, ³úô¼ö¾×À¸·Î ¿ëÀÌÇÏ°Ô È®»ê
- ´Ü¹é°áÇÕ : 70%
- ´ë»ç : ÀÏÂ÷ÀûÀ¸·Î °£´ë»ç, 10-20%´Â Ç÷¾×¿¡¼ N-acetylationµÈ´Ù.
- ¹Ý°¨±â : 9-12 ½Ã°£, ½ÅÀå¾Ö½Ã ¿¬Àå
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : 3-4 ½Ã°£ À̳»
- ¼Ò½Ç : 20%´Â ¹Ìº¯Èü·Î, ³ª¸ÓÁö´Â ´ë»çü·Î ½Å¹è¼³
|
| Biotransformation |
Sulfamethoxazole¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic. The metabolism of sulfamethoxazole occurs predominately by N4-acetylation, although the glucuronide conjugate has been identified.
|
| Toxicity |
Sulfamethoxazole¿¡ ´ëÇÑ Toxicity Á¤º¸ Not Available
|
| Drug Interactions |
Sulfamethoxazole¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸] Sulfamethoxazole¿¡ ´ëÇÑ P450 table
SUBSTRATES
CYP 2C9
NSAIDs:
diclofenac
ibuprofen
piroxicam
Oral Hypoglycemic Agents:
tolbutamide
glipizide
Angiotensin II Blockers:
NOT candesartan
irbesartan
losartan
NOT valsartan
celecoxib
fluvastatin naproxen
phenytoin
**sulfamethoxazole**
tamoxifen
tolbutamide
torsemide
warfarin
INHIBITORS
CYP 2C9
amiodarone
fluconazole
isoniazid
INDUCERS
CYP 2C9
rifampin
secobarbital
|
| Drug Target |
[Drug Target]
|
| Description |
Sulfamethoxazole¿¡ ´ëÇÑ Description Á¤º¸ A bacteriostatic antibacterial agent that interferes with folic acid synthesis in susceptible bacteria. Its broad spectrum of activity has been limited by the development of resistance. (From Martindale, The Extra Pharmacopoeia, 30th ed, p208)
|
| Dosage Form |
Sulfamethoxazole¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Tablet Oral
|
| Drug Category |
Sulfamethoxazole¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Infective AgentsAnti-InfectivesSulfonamides
|
| Smiles String Canonical |
Sulfamethoxazole¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC1=CC(NS(=O)(=O)C2=CC=C(N)C=C2)=NO1
|
| Smiles String Isomeric |
Sulfamethoxazole¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CC1=CC(NS(=O)(=O)C2=CC=C(N)C=C2)=NO1
|
| InChI Identifier |
Sulfamethoxazole¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C10H11N3O3S/c1-7-6-10(12-16-7)13-17(14,15)9-4-2-8(11)3-5-9/h2-6H,11H2,1H3,(H,12,13)/f/h13H
|
| Chemical IUPAC Name |
Sulfamethoxazole¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 4-amino-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide
|
| Drug-Induced Toxicity Related Proteins |
SULFAMETHOXAZOLE ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Myeloperoxidase Drug:sulfamethoxazole Toxicity:agranulocytosis. [¹Ù·Î°¡±â] Replated Protein:Myeloperoxidase Drug:sulfamethoxazole Toxicity:lupus. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2015-05-22
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|